diff options
Diffstat (limited to 'xorg-server')
192 files changed, 6402 insertions, 689 deletions
diff --git a/xorg-server/XTrap/makefile b/xorg-server/XTrap/makefile new file mode 100644 index 000000000..6846a546c --- /dev/null +++ b/xorg-server/XTrap/makefile @@ -0,0 +1,5 @@ +CSRCS = xtrapddmi.c xtrapdi.c xtrapdiswp.c xtrapditbl.c + +LIBRARY=libxtrap + + diff --git a/xorg-server/Xext/Makefile b/xorg-server/Xext/Makefile new file mode 100644 index 000000000..f78eff1eb --- /dev/null +++ b/xorg-server/Xext/Makefile @@ -0,0 +1,42 @@ +CSRCS=\ +bigreq.c \ +cup.c \ +dpms.c \ +dpmsstubs.c \ +EVI.c \ +mbuf.c \ +mitmisc.c \ +sampleEVI.c \ +saver.c \ +security.c \ +shape.c \ +sleepuntil.c \ +sync.c \ +xace.c \ +xcmisc.c \ +xevie.c \ +xres.c \ +xtest.c + +#shm.c \ +#appgroup.c \ +#fontcache.c \ +#mbufbf.c \ +#mbufpx.c \ +#panoramiX.c \ +#panoramiXprocs.c \ +#panoramiXSwap.c \ +#xcalibrate.c \ +#xf86bigfont.c \ +#xprint.c \ +#xselinux.c \ +#xvdisp.c \ +#xvmain.c \ +#xvmc.c + +LIBRARY=libxext + +INCLUDES += ..\hw\xfree86\dixmods\extmod + + + diff --git a/xorg-server/Xext/dpms.c b/xorg-server/Xext/dpms.c index e3204febb..be11fd76a 100644 --- a/xorg-server/Xext/dpms.c +++ b/xorg-server/Xext/dpms.c @@ -35,6 +35,8 @@ Equipment Corporation. #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define DPMSExtension #endif #include <X11/X.h> diff --git a/xorg-server/Xext/saver.c b/xorg-server/Xext/saver.c index feab972e2..3a70afe6d 100644 --- a/xorg-server/Xext/saver.c +++ b/xorg-server/Xext/saver.c @@ -31,6 +31,8 @@ in this Software without prior written authorization from the X Consortium. #define NEED_EVENTS #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define SCREENSAVER #endif #include <X11/X.h> diff --git a/xorg-server/Xext/security.c b/xorg-server/Xext/security.c index ad30e06b8..ff6c1edfa 100644 --- a/xorg-server/Xext/security.c +++ b/xorg-server/Xext/security.c @@ -26,6 +26,8 @@ in this Software without prior written authorization from The Open Group. #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define XACE #endif #include "scrnintstr.h" diff --git a/xorg-server/Xext/shape.c b/xorg-server/Xext/shape.c index 2f1baf917..53c7de8b8 100644 --- a/xorg-server/Xext/shape.c +++ b/xorg-server/Xext/shape.c @@ -28,6 +28,8 @@ in this Software without prior written authorization from The Open Group. #define NEED_EVENTS #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define SHAPE #endif #include <stdlib.h> diff --git a/xorg-server/Xext/shm.c b/xorg-server/Xext/shm.c index 34c875274..bbcbd05af 100644 --- a/xorg-server/Xext/shm.c +++ b/xorg-server/Xext/shm.c @@ -34,7 +34,8 @@ in this Software without prior written authorization from The Open Group. #endif #include <sys/types.h> -#ifndef Lynx +#if !defined(_MSC_VER) +#if !defined(Lynx) #include <sys/ipc.h> #include <sys/shm.h> #else @@ -42,6 +43,7 @@ in this Software without prior written authorization from The Open Group. #include <shm.h> #endif #include <unistd.h> +#endif #include <sys/stat.h> #define NEED_REPLIES #define NEED_EVENTS @@ -348,8 +350,10 @@ ProcShmQueryVersion(client) rep.pixmapFormat = pixmapFormat; rep.majorVersion = SHM_MAJOR_VERSION; rep.minorVersion = SHM_MINOR_VERSION; +#ifndef _MSC_VER rep.uid = geteuid(); rep.gid = getegid(); +#endif if (client->swapped) { swaps(&rep.sequenceNumber, n); swapl(&rep.length, n); @@ -399,6 +403,9 @@ shm_access(ClientPtr client, SHMPERM_TYPE *perm, int readonly) if (uid == 0) { return 0; } + #ifdef _MSC_VER + __asm int 3; + #else /* Check the owner */ if (SHMPERM_UID(perm) == uid || SHMPERM_CUID(perm) == uid) { mask = S_IRUSR; @@ -407,10 +414,14 @@ shm_access(ClientPtr client, SHMPERM_TYPE *perm, int readonly) } return (SHMPERM_MODE(perm) & mask) == mask ? 0 : -1; } + #endif } if (gidset) { /* Check the group */ + #ifdef _MSC_VER + __asm int 3; + #else if (SHMPERM_GID(perm) == gid || SHMPERM_CGID(perm) == gid) { mask = S_IRGRP; if (!readonly) { @@ -418,14 +429,20 @@ shm_access(ClientPtr client, SHMPERM_TYPE *perm, int readonly) } return (SHMPERM_MODE(perm) & mask) == mask ? 0 : -1; } + #endif } } + #ifdef _MSC_VER + __asm int 3; + return -1; + #else /* Otherwise, check everyone else */ mask = S_IROTH; if (!readonly) { mask |= S_IWOTH; } return (SHMPERM_MODE(perm) & mask) == mask ? 0 : -1; + #endif } static int @@ -500,7 +517,9 @@ ShmDetachSegment(value, shmseg) if (--shmdesc->refcnt) return TRUE; +#ifndef _MSC_VER shmdt(shmdesc->addr); +#endif for (prev = &Shmsegs; *prev != shmdesc; prev = &(*prev)->next) ; *prev = shmdesc->next; diff --git a/xorg-server/Xext/xace.c b/xorg-server/Xext/xace.c index 8a8f8c61d..9d2d2fa51 100644 --- a/xorg-server/Xext/xace.c +++ b/xorg-server/Xext/xace.c @@ -19,6 +19,8 @@ CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define XACE #endif #include <stdarg.h> diff --git a/xorg-server/Xext/xevie.c b/xorg-server/Xext/xevie.c index 1d51fd825..ad1ea52b8 100644 --- a/xorg-server/Xext/xevie.c +++ b/xorg-server/Xext/xevie.c @@ -35,6 +35,8 @@ of the copyright holder. #define NEED_EVENTS #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define XEVIE #endif #include <X11/X.h> diff --git a/xorg-server/Xi/exevents.c b/xorg-server/Xi/exevents.c index 641bead33..17cf0e86e 100644 --- a/xorg-server/Xi/exevents.c +++ b/xorg-server/Xi/exevents.c @@ -55,6 +55,8 @@ SOFTWARE. #define NEED_EVENTS #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define XINPUT #endif #include <X11/X.h> diff --git a/xorg-server/Xi/makefile b/xorg-server/Xi/makefile new file mode 100644 index 000000000..422f79acb --- /dev/null +++ b/xorg-server/Xi/makefile @@ -0,0 +1,40 @@ +CSRCS=allowev.c \ + chgdctl.c \ + chgfctl.c \ + chgkbd.c \ + chgkmap.c \ + chgprop.c \ + chgptr.c \ + closedev.c \ + devbell.c \ + exevents.c \ + extinit.c \ + getbmap.c \ + getdctl.c \ + getfctl.c \ + getfocus.c \ + getkmap.c \ + getmmap.c \ + getprop.c \ + getselev.c \ + getvers.c \ + grabdev.c \ + grabdevb.c \ + grabdevk.c \ + gtmotion.c \ + listdev.c \ + opendev.c \ + queryst.c \ + selectev.c \ + sendexev.c \ + setbmap.c \ + setdval.c \ + setfocus.c \ + setmmap.c \ + setmode.c \ + ungrdev.c \ + ungrdevb.c \ + ungrdevk.c + +LIBRARY=libXi + diff --git a/xorg-server/afb/afbply1rct.c b/xorg-server/afb/afbply1rct.c index e9d4d5e09..65002c967 100644 --- a/xorg-server/afb/afbply1rct.c +++ b/xorg-server/afb/afbply1rct.c @@ -51,14 +51,14 @@ in this Software without prior written authorization from the X Consortium. #endif #if IMAGE_BYTE_ORDER == MSBFirst -#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int)((short) (i)))) +#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int)((short) ((i)&0xffff)))) #define coordToInt(x,y) (((x) << 16) | (y)) #define intToX(i) (GetHighWord(i)) -#define intToY(i) ((int)((short) i)) +#define intToY(i) ((int)((short) ((i)&0xffff))) #else -#define intToCoord(i,x,y) (((x) = (int)((short) (i))), ((y) = GetHighWord(i))) +#define intToCoord(i,x,y) (((x) = (int)((short) ((i)&0xffff))), ((y) = GetHighWord(i))) #define coordToInt(x,y) (((y) << 16) | (x)) -#define intToX(i) ((int)((short) (i))) +#define intToX(i) ((int)((short) ((i)&0xffff))) #define intToY(i) (GetHighWord(i)) #endif diff --git a/xorg-server/afb/makefile b/xorg-server/afb/makefile new file mode 100644 index 000000000..862f25431 --- /dev/null +++ b/xorg-server/afb/makefile @@ -0,0 +1,8 @@ +CSRCS=afbbitblt.c afbbltC.c afbbltCI.c afbbltG.c afbbltO.c afbbltX.c afbbres.c afbbresd.c afbclip.c \
+ afbcmap.c afbfillarc.c afbfillrct.c afbfillsp.c afbfont.c afbgc.c afbgetsp.c afbhrzvert.c afbimage.c afbimggblt.c \
+ afbmisc.c afbpixmap.c afbply1rct.c afbplygblt.c afbpntarea.c afbpolypnt.c afbpushpxl.c afbscrinit.c afbseg.c \
+ afbsetsp.c afbtegblt.c afbtileC.c afbtileG.c afbwindow.c afbzerarc.c
+#afbtile.c afbline.c afbblt.c
+
+LIBRARY=libafb
+
diff --git a/xorg-server/cfb/cfbmap.h b/xorg-server/cfb/cfbmap.h index 16e4afc3c..14b58c550 100644 --- a/xorg-server/cfb/cfbmap.h +++ b/xorg-server/cfb/cfbmap.h @@ -32,6 +32,10 @@ in this Software without prior written authorization from The Open Group. /* a losing vendor cpp dumps core if we define CFBNAME in terms of CATNAME */ +#ifdef _MSC_VER +#define PSZ 8 +#endif + #if PSZ != 8 #if PSZ == 32 diff --git a/xorg-server/cfb/makefile b/xorg-server/cfb/makefile new file mode 100644 index 000000000..db934f2a0 --- /dev/null +++ b/xorg-server/cfb/makefile @@ -0,0 +1,10 @@ +CSRCS=cfb8bit.c cfb8lineCO.c cfb8lineCP.c cfb8lineG.c cfb8lineX.c cfb8segC.c cfb8segCS.c cfb8segX.c cfb8setG.c \
+ cfballpriv.c cfbbitblt.c cfbbltC.c cfbbltG.c cfbbltO.c cfbbltX.c cfbbres.c cfbbresd.c cfbcmap.c cfbcppl.c \
+ cfbfillarcC.c cfbfillarcG.c cfbfillrct.c cfbfillsp.c cfbgc.c cfbgetsp.c cfbglrop8.c cfbhrzvert.c cfbigblt8.c \
+ cfbimage.c cfbmskbits.c cfbpixmap.c cfbply1rctC.c cfbply1rctG.c cfbpolypnt.c cfbpush8.c cfbrctstp8.c \
+ cfbrrop.c cfbscrinit.c cfbseg.c cfbsetsp.c cfbsolidC.c cfbsolidG.c cfbsolidX.c cfbteblt8.c cfbtegblt.c \
+ cfbtile32C.c cfbtile32G.c cfbtileoddC.c cfbtileoddG.c cfbwindow.c cfbzerarcC.c cfbzerarcG.c cfbzerarcX.c
+#cfbline.c cfbfillarc.c cfbzerarc.c cfbblt.c cfbsolid.c cfbtileodd.c cfbtile32.c cfb8line.c cfbply1rct.c cfbglblt8.c
+
+LIBRARY=libcfb
+
diff --git a/xorg-server/cfb32/makefile b/xorg-server/cfb32/makefile new file mode 100644 index 000000000..e723acaa2 --- /dev/null +++ b/xorg-server/cfb32/makefile @@ -0,0 +1,5 @@ +CSRCS=cfb8lineCO.c cfb8lineCP.c cfb8lineG.c cfb8lineX.c cfb8segC.c cfb8segCS.c cfb8segX.c cfb8setG.c cfbbltC.c cfbbltG.c cfbbltO.c \
+cfbbltX.c cfbfillarcC.c cfbfillarcG.c cfbply1rctC.c cfbply1rctG.c cfbseg.c cfbsolidC.c cfbsolidG.c cfbsolidX.c cfbtile32C.c cfbtile32G.c \
+cfbtileoddC.c cfbtileoddG.c cfbzerarcC.c cfbzerarcG.c cfbzerarcX.c
+
+LIBRARY=libcfb32
diff --git a/xorg-server/composite/makefile b/xorg-server/composite/makefile new file mode 100644 index 000000000..081608674 --- /dev/null +++ b/xorg-server/composite/makefile @@ -0,0 +1,4 @@ +CSRCS=compalloc.c compext.c compinit.c compwindow.c
+
+LIBRARY=libcomposite
+
diff --git a/xorg-server/config/makefile b/xorg-server/config/makefile new file mode 100644 index 000000000..937785271 --- /dev/null +++ b/xorg-server/config/makefile @@ -0,0 +1,4 @@ +CSRCS=config.c
+
+LIBRARY=libconfig
+
diff --git a/xorg-server/damageext/makefile b/xorg-server/damageext/makefile new file mode 100644 index 000000000..c8481cd3c --- /dev/null +++ b/xorg-server/damageext/makefile @@ -0,0 +1,4 @@ +CSRCS=damageext.c
+
+LIBRARY=libdamageext
+
diff --git a/xorg-server/dbe/makefile b/xorg-server/dbe/makefile new file mode 100644 index 000000000..70fb81430 --- /dev/null +++ b/xorg-server/dbe/makefile @@ -0,0 +1,4 @@ +CSRCS=dbe.c midbe.c
+
+LIBRARY=libdbe
+
diff --git a/xorg-server/dix/colormap.c b/xorg-server/dix/colormap.c index 8b1bad8a3..f54615111 100644 --- a/xorg-server/dix/colormap.c +++ b/xorg-server/dix/colormap.c @@ -66,6 +66,10 @@ SOFTWARE. #include "privates.h" #include "xace.h" +#ifdef _MSC_VER +#define UpdateColors thisUpdateColors +#endif + extern XID clientErrorValue; static Pixel FindBestPixel( diff --git a/xorg-server/dix/dixfonts.c b/xorg-server/dix/dixfonts.c index e9a3f3963..8ed494c09 100644 --- a/xorg-server/dix/dixfonts.c +++ b/xorg-server/dix/dixfonts.c @@ -127,6 +127,7 @@ SetDefaultFont(char *defaultfontname) int err; FontPtr pf; XID fid; + static FontPtr last_pf; fid = FakeClientID(0); err = OpenFont(serverClient, fid, FontLoadAll | FontOpenSync, @@ -134,9 +135,10 @@ SetDefaultFont(char *defaultfontname) if (err != Success) return FALSE; pf = (FontPtr) LookupIDByType(fid, RT_FONT); - if (pf == (FontPtr) NULL) + if (pf != (FontPtr) NULL) last_pf = pf; + if (last_pf == (FontPtr) NULL) return FALSE; - defaultFont = pf; + defaultFont = last_pf; return TRUE; } @@ -1902,22 +1904,15 @@ InitFonts (void) { patternCache = MakeFontPatternCache(); -#ifndef BUILTIN_FONTS if (screenInfo.numScreens > screenInfo.numVideoScreens) { PrinterFontRegisterFpeFunctions(); FontFileCheckRegisterFpeFunctions(); check_fs_register_fpe_functions(); } else -#endif { -#ifdef BUILTIN_FONTS BuiltinRegisterFpeFunctions(); -#else FontFileRegisterFpeFunctions(); -#endif -#ifndef NOFONTSERVERACCESS fs_register_fpe_functions(); -#endif } } diff --git a/xorg-server/dix/main.c b/xorg-server/dix/main.c index 6d9dd3332..fa1a934a3 100644 --- a/xorg-server/dix/main.c +++ b/xorg-server/dix/main.c @@ -248,6 +248,7 @@ main(int argc, char *argv[], char *envp[]) char *xauthfile; HWEventQueueType alwaysCheckForInput[2]; + ptw32_processInitialize(); display = "0"; InitGlobals(); diff --git a/xorg-server/dix/makefile b/xorg-server/dix/makefile new file mode 100644 index 000000000..24afd2b94 --- /dev/null +++ b/xorg-server/dix/makefile @@ -0,0 +1,8 @@ +DEFINES += FONTDEBUG
+
+CSRCS=atom.c colormap.c cursor.c deprecated.c devices.c dispatch.c dix.c dixfonts.c dixutils.c events.c extension.c ffs.c gc.c \
+getevents.c globals.c glyphcurs.c grabs.c initatoms.c main.c pixmap.c privates.c property.c registry.c resource.c selection.c \
+strcasecmp.c strcasestr.c swaprep.c swapreq.c tables.c window.c xpstubs.c
+
+LIBRARY=libdix
+
diff --git a/xorg-server/exa/exa_accel.c b/xorg-server/exa/exa_accel.c index 3ec96253d..c049745f2 100644 --- a/xorg-server/exa/exa_accel.c +++ b/xorg-server/exa/exa_accel.c @@ -255,7 +255,7 @@ exaPutImage (DrawablePtr pDrawable, GCPtr pGC, int depth, int x, int y, bits); } -static Bool inline +static Bool __inline exaCopyNtoNTwoDir (DrawablePtr pSrcDrawable, DrawablePtr pDstDrawable, GCPtr pGC, BoxPtr pbox, int nbox, int dx, int dy) { diff --git a/xorg-server/exa/exa_migration.c b/xorg-server/exa/exa_migration.c index b7cc06240..adfbacc9e 100644 --- a/xorg-server/exa/exa_migration.c +++ b/xorg-server/exa/exa_migration.c @@ -169,7 +169,7 @@ exaCopyDirty(ExaMigrationPtr migrate, RegionPtr pValidDst, RegionPtr pValidSrc, static Bool firsttime = TRUE; if (firsttime) { - ErrorF("%s: Pending damage region empty!\n", __func__); + ErrorF("%s: Pending damage region empty!\n", __FUNCTION__ ); firsttime = FALSE; } } @@ -354,8 +354,8 @@ exaDoMoveInPixmap (ExaMigrationPtr migrate) void exaMoveInPixmap (PixmapPtr pPixmap) { - static ExaMigrationRec migrate = { .as_dst = FALSE, .as_src = TRUE, - .pReg = NULL }; + static ExaMigrationRec migrate = { FALSE, TRUE, NULL, + NULL }; migrate.pPix = pPixmap; exaDoMoveInPixmap (&migrate); @@ -395,8 +395,8 @@ exaDoMoveOutPixmap (ExaMigrationPtr migrate) void exaMoveOutPixmap (PixmapPtr pPixmap) { - static ExaMigrationRec migrate = { .as_dst = FALSE, .as_src = TRUE, - .pReg = NULL }; + static ExaMigrationRec migrate = { FALSE, TRUE, NULL, + NULL }; migrate.pPix = pPixmap; exaDoMoveOutPixmap (&migrate); @@ -589,7 +589,7 @@ exaDoMigration (ExaMigrationPtr pixmaps, int npixmaps, Bool can_accel) for (i = 0; i < npixmaps; i++) { if (!exaPixmapIsDirty (pixmaps[i].pPix) && !exaAssertNotDirty (pixmaps[i].pPix)) - ErrorF("%s: Pixmap %d dirty but not marked as such!\n", __func__, i); + ErrorF("%s: Pixmap %d dirty but not marked as such!\n", __FUNCTION__ , i); } } /* If anything is pinned in system memory, we won't be able to diff --git a/xorg-server/exa/makefile b/xorg-server/exa/makefile new file mode 100644 index 000000000..0373a4be3 --- /dev/null +++ b/xorg-server/exa/makefile @@ -0,0 +1,4 @@ +CSRCS=exa.c exa_accel.c exa_migration.c exa_offscreen.c exa_render.c exa_unaccel.c
+
+LIBRARY=libexa
+
diff --git a/xorg-server/fb/fbpict.c b/xorg-server/fb/fbpict.c index 85b5171c5..b70b7043b 100644 --- a/xorg-server/fb/fbpict.c +++ b/xorg-server/fb/fbpict.c @@ -31,9 +31,10 @@ #include "fb.h" +#include "picturestr.h" + #ifdef RENDER -#include "picturestr.h" #include "mipict.h" #include "fbpict.h" diff --git a/xorg-server/fb/fbpixmap.c b/xorg-server/fb/fbpixmap.c index 311da9e62..c4c2c4aa7 100644 --- a/xorg-server/fb/fbpixmap.c +++ b/xorg-server/fb/fbpixmap.c @@ -323,11 +323,7 @@ fbPixmapToRegion(PixmapPtr pPix) #ifdef FB_DEBUG -#ifndef WIN32 #include <stdio.h> -#else -#include <dbg.h> -#endif static Bool fbValidateBits (FbStip *bits, int stride, FbStip data) @@ -336,12 +332,7 @@ fbValidateBits (FbStip *bits, int stride, FbStip data) { if (*bits != data) { -#ifdef WIN32 - NCD_DEBUG ((DEBUG_FAILURE, "fdValidateBits failed at 0x%x (is 0x%x want 0x%x)", - bits, *bits, data)); -#else - fprintf (stderr, "fbValidateBits failed\n"); -#endif + fprintf (stderr, "fbValidateBits failed at 0x%x (is 0x%x want 0x%x)\n",bits, *bits, data); return FALSE; } bits++; diff --git a/xorg-server/fb/fbpseudocolor.c b/xorg-server/fb/fbpseudocolor.c index 06cf15992..df51eed8d 100644 --- a/xorg-server/fb/fbpseudocolor.c +++ b/xorg-server/fb/fbpseudocolor.c @@ -2145,13 +2145,13 @@ xxPushPixels( #define RENDER_ADD_BOX(pScreen,box) {\ if (BOX_NOT_EMPTY(box)) { \ RegionRec region; \ - xxScrPriv(pScreen);\ - ScreenPtr pScreen = pScreen;\ - REGION_INIT (pScreen, ®ion, &box, 1); \ + ScreenPtr pthisScreen = pScreen;\ + xxScrPriv(pthisScreen);\ + REGION_INIT (pthisScreen, ®ion, &box, 1); \ PRINT_RECTS(pScrPriv->region);\ - REGION_UNION(pScreen,&pScrPriv->region,&pScrPriv->region,®ion);\ + REGION_UNION(pthisScreen,&pScrPriv->region,&pScrPriv->region,®ion);\ PRINT_RECTS(pScrPriv->region);\ - REGION_UNINIT(pScreen,®ion);\ + REGION_UNINIT(pthisScreen,®ion);\ }\ } diff --git a/xorg-server/fb/makefile b/xorg-server/fb/makefile new file mode 100644 index 000000000..fd6ae3e7c --- /dev/null +++ b/xorg-server/fb/makefile @@ -0,0 +1,9 @@ +CSRCS=fb24_32.c fballpriv.c fbarc.c fbbits.c fbblt.c fbbltone.c fbcmap_mi.c fbcopy.c fbfill.c fbfillrect.c fbfillsp.c \
+fbgc.c fbgetsp.c fbglyph.c fbimage.c fbline.c fboverlay.c fbpict.c fbpixmap.c fbpoint.c fbpseudocolor.c fbpush.c fbscreen.c \
+fbseg.c fbsetsp.c fbsolid.c fbstipple.c fbtile.c fbtrap.c fbutil.c fbwindow.c
+
+LIBRARY=libfb
+
+CCFLAGS:=$(CCFLAGS:-RTCc=)
+
+
diff --git a/xorg-server/fonts.src/100dpi/makefile b/xorg-server/fonts.src/100dpi/makefile new file mode 100644 index 000000000..5b792525c --- /dev/null +++ b/xorg-server/fonts.src/100dpi/makefile @@ -0,0 +1,343 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\100dpi +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +BDF2UCS_FONT_FILES = \ + lutBS08 \ + lutBS10 \ + lutBS12 \ + lutBS14 \ + lutBS18 \ + lutBS19 \ + lutBS24 \ + lutRS08 \ + lutRS10 \ + lutRS12 \ + lutRS14 \ + lutRS18 \ + lutRS19 \ + lutRS24 \ + lubB08 \ + lubB10 \ + lubB12 \ + lubB14 \ + lubB18 \ + lubB19 \ + lubB24 \ + lubBI08 \ + lubBI10 \ + lubBI12 \ + lubBI14 \ + lubBI18 \ + lubBI19 \ + lubBI24 \ + lubI08 \ + lubI10 \ + lubI12 \ + lubI14 \ + lubI18 \ + lubI19 \ + lubI24 \ + luBIS08 \ + luBIS10 \ + luBIS12 \ + luBIS14 \ + luBIS18 \ + luBIS19 \ + luBIS24 \ + lubR08 \ + lubR10 \ + lubR12 \ + lubR14 \ + lubR18 \ + lubR19 \ + lubR24 \ + luBS08 \ + luBS10 \ + luBS12 \ + luBS14 \ + luBS18 \ + luBS19 \ + luBS24 \ + luIS08 \ + luIS10 \ + luIS12 \ + luIS14 \ + luIS18 \ + luIS19 \ + luIS24 \ + luRS08 \ + luRS10 \ + luRS12 \ + luRS14 \ + luRS18 \ + luRS19 \ + luRS24 \ + UTB___10 \ + UTB___12 \ + UTB___14 \ + UTB___18 \ + UTB___24 \ + UTBI__10 \ + UTBI__12 \ + UTBI__14 \ + UTBI__18 \ + UTBI__24 \ + UTI___10 \ + UTI___12 \ + UTI___14 \ + UTI___18 \ + UTI___24 \ + UTRG__10 \ + UTRG__12 \ + UTRG__14 \ + UTRG__18 \ + UTRG__24 \ + courB08 \ + courB10 \ + courB12 \ + courB14 \ + courB18 \ + courB24 \ + courBO08 \ + courBO10 \ + courBO12 \ + courBO14 \ + courBO18 \ + courBO24 \ + courO08 \ + courO10 \ + courO12 \ + courO14 \ + courO18 \ + courO24 \ + courR08 \ + courR10 \ + courR12 \ + courR14 \ + courR18 \ + courR24 \ + helvB08 \ + helvB10 \ + helvB12 \ + helvB14 \ + helvB18 \ + helvB24 \ + helvBO08 \ + helvBO10 \ + helvBO12 \ + helvBO14 \ + helvBO18 \ + helvBO24 \ + helvO08 \ + helvO10 \ + helvO12 \ + helvO14 \ + helvO18 \ + helvO24 \ + helvR08 \ + helvR10 \ + helvR12 \ + helvR14 \ + helvR18 \ + helvR24 \ + ncenB08 \ + ncenB10 \ + ncenB12 \ + ncenB14 \ + ncenB18 \ + ncenB24 \ + ncenBI08 \ + ncenBI10 \ + ncenBI12 \ + ncenBI14 \ + ncenBI18 \ + ncenBI24 \ + ncenI08 \ + ncenI10 \ + ncenI12 \ + ncenI14 \ + ncenI18 \ + ncenI24 \ + ncenR08 \ + ncenR10 \ + ncenR12 \ + ncenR14 \ + ncenR18 \ + ncenR24 \ + timB08 \ + timB10 \ + timB12 \ + timB14 \ + timB18 \ + timB24 \ + timBI08 \ + timBI10 \ + timBI12 \ + timBI14 \ + timBI18 \ + timBI24 \ + timI08 \ + timI10 \ + timI12 \ + timI14 \ + timI18 \ + timI24 \ + timR08 \ + timR10 \ + timR12 \ + timR14 \ + timR18 \ + timR24 +EXTRA_FONT_FILES = \ + symb08 \ + symb10 \ + symb12 \ + symb14 \ + symb18 \ + symb24 \ + charB08 \ + charB10 \ + charB12 \ + charB14 \ + charB18 \ + charB24 \ + charBI08 \ + charBI10 \ + charBI12 \ + charBI14 \ + charBI18 \ + charBI24 \ + charI08 \ + charI10 \ + charI12 \ + charI14 \ + charI18 \ + charI24 \ + charR08 \ + charR10 \ + charR12 \ + charR14 \ + charR18 \ + charR24 \ + tech14 \ + techB14 \ + term14 \ + termB14 +FONT_FILES = $(BDF2UCS_FONT_FILES) $(EXTRA_FONT_FILES) + +BDF_FILES = $(FONT_FILES:%=%.bdf) +PCF_FILES = $(FONT_FILES:%=$(DESTDIR)\%.pcf.gz) + +ISO8859_1_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-1.bdf) +ISO8859_1_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-1.pcf.gz) + +ISO8859_2_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-2.bdf) +ISO8859_2_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-2.pcf.gz) + +ISO8859_3_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-3.bdf) +ISO8859_3_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-3.pcf.gz) + +ISO8859_4_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-4.bdf) +ISO8859_4_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-4.pcf.gz) + +ISO8859_9_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-9.bdf) +ISO8859_9_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-9.pcf.gz) + +ISO8859_10_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-10.bdf) +ISO8859_10_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-10.pcf.gz) + +ISO8859_13_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-13.bdf) +ISO8859_13_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-13.pcf.gz) + +ISO8859_14_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-14.bdf) +ISO8859_14_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-14.pcf.gz) + +ISO8859_15_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-15.bdf) +ISO8859_15_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-15.pcf.gz) + +UTIL_DIR = ..\font-util +UCS2ANY = $(UTIL_DIR)\$(OBJDIR)\ucs2any.exe + +load_makefile $(UTIL_DIR)\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +%-ISO8859-1.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-1 ISO8859-1 + +%-ISO8859-2.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-2 ISO8859-2 + +%-ISO8859-3.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-3 ISO8859-3 + +%-ISO8859-4.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-4 ISO8859-4 + +%-ISO8859-9.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-9 ISO8859-9 + +%-ISO8859-10.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-10 ISO8859-10 + +%-ISO8859-13.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-13 ISO8859-13 + +%-ISO8859-14.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-14 ISO8859-14 + +%-ISO8859-15.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-15 ISO8859-15 + +fontdir = . +font_DATA = \ + $(PCF_FILES) \ + $(ISO8859_1_PCF_FILES) \ + $(ISO8859_2_PCF_FILES) \ + $(ISO8859_3_PCF_FILES) \ + $(ISO8859_4_PCF_FILES) \ + $(ISO8859_9_PCF_FILES) \ + $(ISO8859_10_PCF_FILES) \ + $(ISO8859_13_PCF_FILES) \ + $(ISO8859_14_PCF_FILES) \ + $(ISO8859_15_PCF_FILES) +BUILT_BDF_FILES = \ + $(ISO8859_1_BDF_FILES) \ + $(ISO8859_2_BDF_FILES) \ + $(ISO8859_3_BDF_FILES) \ + $(ISO8859_4_BDF_FILES) \ + $(ISO8859_9_BDF_FILES) \ + $(ISO8859_10_BDF_FILES) \ + $(ISO8859_13_BDF_FILES) \ + $(ISO8859_14_BDF_FILES) \ + $(ISO8859_15_BDF_FILES) + +all: $(DESTDIR) $(UCS2ANY) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir $(DESTDIR)\fonts.alias + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . + +$(DESTDIR)\fonts.alias: fonts.alias + copy $< $@ + diff --git a/xorg-server/fonts.src/75dpi/makefile b/xorg-server/fonts.src/75dpi/makefile new file mode 100644 index 000000000..e7d8bf085 --- /dev/null +++ b/xorg-server/fonts.src/75dpi/makefile @@ -0,0 +1,343 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\75dpi +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +BDF2UCS_FONT_FILES = \ + lutBS08 \ + lutBS10 \ + lutBS12 \ + lutBS14 \ + lutBS18 \ + lutBS19 \ + lutBS24 \ + lutRS08 \ + lutRS10 \ + lutRS12 \ + lutRS14 \ + lutRS18 \ + lutRS19 \ + lutRS24 \ + UTB___10 \ + UTB___12 \ + UTB___14 \ + UTB___18 \ + UTB___24 \ + UTBI__10 \ + UTBI__12 \ + UTBI__14 \ + UTBI__18 \ + UTBI__24 \ + UTI___10 \ + UTI___12 \ + UTI___14 \ + UTI___18 \ + UTI___24 \ + UTRG__10 \ + UTRG__12 \ + UTRG__14 \ + UTRG__18 \ + UTRG__24 \ + courB08 \ + courB10 \ + courB12 \ + courB14 \ + courB18 \ + courB24 \ + courBO08 \ + courBO10 \ + courBO12 \ + courBO14 \ + courBO18 \ + courBO24 \ + courO08 \ + courO10 \ + courO12 \ + courO14 \ + courO18 \ + courO24 \ + courR08 \ + courR10 \ + courR12 \ + courR14 \ + courR18 \ + courR24 \ + helvB08 \ + helvB10 \ + helvB12 \ + helvB14 \ + helvB18 \ + helvB24 \ + helvBO08 \ + helvBO10 \ + helvBO12 \ + helvBO14 \ + helvBO18 \ + helvBO24 \ + helvO08 \ + helvO10 \ + helvO12 \ + helvO14 \ + helvO18 \ + helvO24 \ + helvR08 \ + helvR10 \ + helvR12 \ + helvR14 \ + helvR18 \ + helvR24 \ + ncenB08 \ + ncenB10 \ + ncenB12 \ + ncenB14 \ + ncenB18 \ + ncenB24 \ + ncenBI08 \ + ncenBI10 \ + ncenBI12 \ + ncenBI14 \ + ncenBI18 \ + ncenBI24 \ + ncenI08 \ + ncenI10 \ + ncenI12 \ + ncenI14 \ + ncenI18 \ + ncenI24 \ + ncenR08 \ + ncenR10 \ + ncenR12 \ + ncenR14 \ + ncenR18 \ + ncenR24 \ + timB08 \ + timB10 \ + timB12 \ + timB14 \ + timB18 \ + timB24 \ + timBI08 \ + timBI10 \ + timBI12 \ + timBI14 \ + timBI18 \ + timBI24 \ + timI08 \ + timI10 \ + timI12 \ + timI14 \ + timI18 \ + timI24 \ + timR08 \ + timR10 \ + timR12 \ + timR14 \ + timR18 \ + timR24 \ + lubB08 \ + lubB10 \ + lubB12 \ + lubB14 \ + lubB18 \ + lubB19 \ + lubB24 \ + lubBI08 \ + lubBI10 \ + lubBI12 \ + lubBI14 \ + lubBI18 \ + lubBI19 \ + lubBI24 \ + lubI08 \ + lubI10 \ + lubI12 \ + lubI14 \ + lubI18 \ + lubI19 \ + lubI24 \ + luBIS08 \ + luBIS10 \ + luBIS12 \ + luBIS14 \ + luBIS18 \ + luBIS19 \ + luBIS24 \ + lubR08 \ + lubR10 \ + lubR12 \ + lubR14 \ + lubR18 \ + lubR19 \ + lubR24 \ + luBS08 \ + luBS10 \ + luBS12 \ + luBS14 \ + luBS18 \ + luBS19 \ + luBS24 \ + luIS08 \ + luIS10 \ + luIS12 \ + luIS14 \ + luIS18 \ + luIS19 \ + luIS24 \ + luRS08 \ + luRS10 \ + luRS12 \ + luRS14 \ + luRS18 \ + luRS19 \ + luRS24 +EXTRA_FONT_FILES = \ + charB08 \ + charB10 \ + charB12 \ + charB14 \ + charB18 \ + charB24 \ + charBI08 \ + charBI10 \ + charBI12 \ + charBI14 \ + charBI18 \ + charBI24 \ + charI08 \ + charI10 \ + charI12 \ + charI14 \ + charI18 \ + charI24 \ + charR08 \ + charR10 \ + charR12 \ + charR14 \ + charR18 \ + charR24 \ + tech14 \ + techB14 \ + term14 \ + termB14 \ + symb08 \ + symb10 \ + symb12 \ + symb14 \ + symb18 \ + symb24 +FONT_FILES = $(BDF2UCS_FONT_FILES) $(EXTRA_FONT_FILES) + +BDF_FILES = $(FONT_FILES:%=%.bdf) +PCF_FILES = $(FONT_FILES:%=$(DESTDIR)\%.pcf.gz) + +ISO8859_1_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-1.bdf) +ISO8859_1_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-1.pcf.gz) + +ISO8859_2_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-2.bdf) +ISO8859_2_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-2.pcf.gz) + +ISO8859_3_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-3.bdf) +ISO8859_3_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-3.pcf.gz) + +ISO8859_4_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-4.bdf) +ISO8859_4_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-4.pcf.gz) + +ISO8859_9_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-9.bdf) +ISO8859_9_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-9.pcf.gz) + +ISO8859_10_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-10.bdf) +ISO8859_10_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-10.pcf.gz) + +ISO8859_13_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-13.bdf) +ISO8859_13_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-13.pcf.gz) + +ISO8859_14_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-14.bdf) +ISO8859_14_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-14.pcf.gz) + +ISO8859_15_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-15.bdf) +ISO8859_15_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-15.pcf.gz) + +UTIL_DIR = ..\font-util +UCS2ANY = $(UTIL_DIR)\$(OBJDIR)\ucs2any.exe + +load_makefile $(UTIL_DIR)\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +%-ISO8859-1.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-1 ISO8859-1 + +%-ISO8859-2.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-2 ISO8859-2 + +%-ISO8859-3.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-3 ISO8859-3 + +%-ISO8859-4.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-4 ISO8859-4 + +%-ISO8859-9.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-9 ISO8859-9 + +%-ISO8859-10.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-10 ISO8859-10 + +%-ISO8859-13.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-13 ISO8859-13 + +%-ISO8859-14.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-14 ISO8859-14 + +%-ISO8859-15.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-15 ISO8859-15 + +fontdir = . +font_DATA = \ + $(PCF_FILES) \ + $(ISO8859_1_PCF_FILES) \ + $(ISO8859_2_PCF_FILES) \ + $(ISO8859_3_PCF_FILES) \ + $(ISO8859_4_PCF_FILES) \ + $(ISO8859_9_PCF_FILES) \ + $(ISO8859_10_PCF_FILES) \ + $(ISO8859_13_PCF_FILES) \ + $(ISO8859_14_PCF_FILES) \ + $(ISO8859_15_PCF_FILES) +BUILT_BDF_FILES = \ + $(ISO8859_1_BDF_FILES) \ + $(ISO8859_2_BDF_FILES) \ + $(ISO8859_3_BDF_FILES) \ + $(ISO8859_4_BDF_FILES) \ + $(ISO8859_9_BDF_FILES) \ + $(ISO8859_10_BDF_FILES) \ + $(ISO8859_13_BDF_FILES) \ + $(ISO8859_14_BDF_FILES) \ + $(ISO8859_15_BDF_FILES) + +all: $(DESTDIR) $(UCS2ANY) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir $(DESTDIR)\fonts.alias + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . + +$(DESTDIR)\fonts.alias: fonts.alias + copy $< $@ + diff --git a/xorg-server/fonts.src/OTF/makefile b/xorg-server/fonts.src/OTF/makefile new file mode 100644 index 000000000..5e5d84814 --- /dev/null +++ b/xorg-server/fonts.src/OTF/makefile @@ -0,0 +1,52 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\OTF +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +FONT_FILES = \ + SyrCOMAdiabene.otf \ + SyrCOMAntioch.otf \ + SyrCOMBatnanBold.otf \ + SyrCOMBatnan.otf \ + SyrCOMCtesiphon.otf \ + SyrCOMEdessa.otf \ + SyrCOMJerusalemBold.otf \ + SyrCOMJerusalemItalic.otf \ + SyrCOMJerusalem.otf \ + SyrCOMJerusalemOutline.otf \ + SyrCOMKharput.otf \ + SyrCOMMalankara.otf \ + SyrCOMMardinBold.otf \ + SyrCOMMardin.otf \ + SyrCOMMidyat.otf \ + SyrCOMNisibin.otf \ + SyrCOMNisibinOutline.otf \ + SyrCOMQenNeshrin.otf \ + SyrCOMTalada.otf \ + SyrCOMTurAbdin.otf \ + SyrCOMUrhoyBold.otf \ + SyrCOMUrhoy.otf + +fontdir = . +font_DATA = $(FONT_FILES:%=$(DESTDIR)\%) + +all: $(DESTDIR) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . +# $(FCCACHE) $(DESTDIR) + +$(DESTDIR)\%.otf: %.otf + copy $< $@ diff --git a/xorg-server/fonts.src/Speedo/makefile b/xorg-server/fonts.src/Speedo/makefile new file mode 100644 index 000000000..96223c065 --- /dev/null +++ b/xorg-server/fonts.src/Speedo/makefile @@ -0,0 +1,37 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\Speedo +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +FONT_FILES = \ + font0419.spd \ + font0582.spd \ + font0583.spd \ + font0611.spd \ + font0648.spd \ + font0649.spd \ + font0709.spd \ + font0710.spd \ + fonts.scale + +fontdir = . +font_DATA = $(FONT_FILES:%=$(DESTDIR)\%) + +all: $(DESTDIR) $(DESTDIR)\fonts.dir $(DESTDIR)\fonts.scale + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . + +$(DESTDIR)\%.spd: %.spd + copy $< $@ + +$(DESTDIR)\%.scale: %.scale + copy $< $@ diff --git a/xorg-server/fonts.src/TTF/makefile b/xorg-server/fonts.src/TTF/makefile new file mode 100644 index 000000000..a488a8395 --- /dev/null +++ b/xorg-server/fonts.src/TTF/makefile @@ -0,0 +1,53 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\TTF +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + + +FONT_FILES = \ + luximbi.ttf \ + luximb.ttf \ + luximri.ttf \ + luximr.ttf \ + luxirbi.ttf \ + luxirb.ttf \ + luxirri.ttf \ + luxirr.ttf \ + luxisbi.ttf \ + luxisb.ttf \ + luxisri.ttf \ + luxisr.ttf \ + Vera.ttf \ + VeraBd.ttf \ + VeraBI.ttf \ + VeraIt.ttf \ + VeraMoBd.ttf \ + VeraMoBI.ttf \ + VeraMoIt.ttf \ + VeraMono.ttf \ + VeraSe.ttf \ + VeraSeBd.ttf + +fontdir = . +font_DATA = $(FONT_FILES:%=$(DESTDIR)\%) + +all: $(DESTDIR) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . +# $(FCCACHE) $(DESTDIR) + +$(DESTDIR)\%.ttf: %.ttf + copy $< $@ diff --git a/xorg-server/fonts.src/Type1/makefile b/xorg-server/fonts.src/Type1/makefile new file mode 100644 index 000000000..48371a6b2 --- /dev/null +++ b/xorg-server/fonts.src/Type1/makefile @@ -0,0 +1,93 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\Type1 +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +FONT_FILES = \ + cursor.pfa \ + UTB_____.afm \ + UTBI____.afm \ + UTBI____.pfa \ + UTB_____.pfa \ + UTI_____.afm \ + UTI_____.pfa \ + UTRG____.afm \ + UTRG____.pfa \ + cour.afm \ + courb.afm \ + courbi.afm \ + courbi.pfa \ + courb.pfa \ + couri.afm \ + couri.pfa \ + cour.pfa \ + l047013t.afm \ + l047013t.pfa \ + l047016t.afm \ + l047016t.pfa \ + l047033t.afm \ + l047033t.pfa \ + l047036t.afm \ + l047036t.pfa \ + l048013t.afm \ + l048013t.pfa \ + l048016t.afm \ + l048016t.pfa \ + l048033t.afm \ + l048033t.pfa \ + l048036t.afm \ + l048036t.pfa \ + l049013t.afm \ + l049013t.pfa \ + l049016t.afm \ + l049016t.pfa \ + l049033t.afm \ + l049033t.pfa \ + l049036t.afm \ + l049036t.pfa \ + c0419bt_.afm \ + c0419bt_.pfb \ + c0582bt_.afm \ + c0582bt_.pfb \ + c0583bt_.afm \ + c0583bt_.pfb \ + c0611bt_.afm \ + c0611bt_.pfb \ + c0632bt_.afm \ + c0632bt_.pfb \ + c0633bt_.afm \ + c0633bt_.pfb \ + c0648bt_.afm \ + c0648bt_.pfb \ + c0649bt_.afm \ + c0649bt_.pfb + +fontdir = . +font_DATA = $(FONT_FILES:%=$(DESTDIR)\%) + +all: $(DESTDIR) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . +# $(FCCACHE) $(DESTDIR) + +$(DESTDIR)\%.afm: %.afm + copy $< $@ + +$(DESTDIR)\%.pfb: %.pfb + copy $< $@ + +$(DESTDIR)\%.pfa: %.pfa + copy $< $@ diff --git a/xorg-server/fonts.src/cyrillic/makefile b/xorg-server/fonts.src/cyrillic/makefile new file mode 100644 index 000000000..faa115461 --- /dev/null +++ b/xorg-server/fonts.src/cyrillic/makefile @@ -0,0 +1,114 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\cyrillic +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +FONT_FILES = \ + proof9x16 \ + koi12x24b \ + koi12x24 \ + koi5x8 \ + koi6x13b \ + koi6x13 \ + koi6x9 \ + koi7x14b \ + koi7x14 \ + koi8x13 \ + koi8x16b \ + koi8x16 \ + koi9x15b \ + koi9x15 \ + koi9x18b \ + koi9x18 \ + screen8x16b \ + screen8x16 \ + crox1cb \ + crox1c \ + crox1cbo \ + crox1co \ + crox1hb \ + crox1h \ + crox1hbo \ + crox1ho \ + crox1tb \ + crox1t \ + crox1tbo \ + crox1to \ + crox2cb \ + crox2c \ + crox2cbo \ + crox2co \ + crox2hb \ + crox2h \ + crox2hbo \ + crox2ho \ + crox2tb \ + crox2t \ + crox2tbo \ + crox2to \ + crox3cb \ + crox3c \ + crox3cbo \ + crox3co \ + crox3hb \ + crox3h \ + crox3hbo \ + crox3ho \ + crox3tb \ + crox3t \ + crox3tbo \ + crox3to \ + crox4hb \ + crox4h \ + crox4hbo \ + crox4ho \ + crox4tb \ + crox4t \ + crox4tbo \ + crox4to \ + crox5hb \ + crox5h \ + crox5hbo \ + crox5ho \ + crox5tb \ + crox5t \ + crox5tbo \ + crox5to \ + crox6hb \ + crox6h \ + crox6hbo \ + crox6ho \ + crox6tb \ + crox6t \ + crox6tbo \ + crox6to \ + koi10x16b \ + koi10x20 \ + koi6x10 \ + koinil2 + +BDF_FILES = $(FONT_FILES:%=%.bdf) +PCF_FILES = $(FONT_FILES:%=$(DESTDIR)\%.pcf.gz) + +font_DATA = $(PCF_FILES) + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +all: $(DESTDIR) $(MKFONTSCALE) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir $(DESTDIR)\fonts.alias + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . + + +$(DESTDIR)\fonts.alias: fonts.alias + copy $< $@ diff --git a/xorg-server/fonts.src/encodings/large/makefile b/xorg-server/fonts.src/encodings/large/makefile new file mode 100644 index 000000000..6c60c5651 --- /dev/null +++ b/xorg-server/fonts.src/encodings/large/makefile @@ -0,0 +1,39 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\encodings\large +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +ENCODING_FILES = \ + big5.eten-0.enc \ + big5hkscs-0.enc \ + cns11643-1.enc \ + cns11643-2.enc \ + cns11643-3.enc \ + gb18030-0.enc \ + gb18030.2000-0.enc \ + gb18030.2000-1.enc \ + gb2312.1980-0.enc \ + gbk-0.enc \ + jisx0201.1976-0.enc \ + jisx0208.1990-0.enc \ + jisx0212.1990-0.enc \ + ksc5601.1987-0.enc \ + ksc5601.1992-3.enc \ + sun.unicode.india-0.enc + +COMPRESSED = $(ENCODING_FILES:%=$(DESTDIR)\%.gz) + +DATA_FILES = $(COMPRESSED) + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +all: $(DESTDIR)\encodings.dir + +$(DESTDIR)\encodings.dir: $(DATA_FILES) $(MKFONTSCALE) + cd "$(DESTDIR)" & $(MKFONTSCALE) -b -s -l -n -r -p .\large -e . . + + diff --git a/xorg-server/fonts.src/encodings/makefile b/xorg-server/fonts.src/encodings/makefile new file mode 100644 index 000000000..1f92bf112 --- /dev/null +++ b/xorg-server/fonts.src/encodings/makefile @@ -0,0 +1,63 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif +load_makefile large\makefile + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\encodings +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +ENCODING_FILES = \ + adobe-dingbats.enc \ + adobe-standard.enc \ + adobe-symbol.enc \ + armscii-8.enc \ + ascii-0.enc \ + dec-special.enc \ + ibm-cp437.enc \ + ibm-cp850.enc \ + ibm-cp852.enc \ + ibm-cp866.enc \ + iso8859-11.enc \ + iso8859-13.enc \ + iso8859-16.enc \ + iso8859-6.16.enc \ + iso8859-6.8x.enc \ + microsoft-cp1250.enc \ + microsoft-cp1251.enc \ + microsoft-cp1252.enc \ + microsoft-cp1253.enc \ + microsoft-cp1254.enc \ + microsoft-cp1255.enc \ + microsoft-cp1256.enc \ + microsoft-cp1257.enc \ + microsoft-cp1258.enc \ + microsoft-win3.1.enc \ + mulearabic-0.enc \ + mulearabic-1.enc \ + mulearabic-2.enc \ + mulelao-1.enc \ + suneu-greek.enc \ + tcvn-0.enc \ + tis620-2.enc \ + viscii1.1-1.enc + +COMPRESSED = $(ENCODING_FILES:%=$(DESTDIR)\%.gz) + +DATA_FILES = $(COMPRESSED) + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\encodings.dir: $(DATA_FILES) $(DESTDIR)\large\encodings.dir $(MKFONTSCALE) + cd "$(DESTDIR)" & $(MKFONTSCALE) -b -s -l -n -r -p . -e . -e large . + +all: $(DESTDIR)\encodings.dir + +.PHONY: cleanthis +cleanthis: + del -e $(DESTDIR) + +clean: cleanthis + diff --git a/xorg-server/fonts.src/font-util/makefile b/xorg-server/fonts.src/font-util/makefile new file mode 100644 index 000000000..bc3218f18 --- /dev/null +++ b/xorg-server/fonts.src/font-util/makefile @@ -0,0 +1,5 @@ +WINAPP = ucs2any + +CSRCS = ucs2any.c + +DEFINES += NEED_BASENAME diff --git a/xorg-server/fonts.src/misc/makefile b/xorg-server/fonts.src/misc/makefile new file mode 100644 index 000000000..62ba64b7f --- /dev/null +++ b/xorg-server/fonts.src/misc/makefile @@ -0,0 +1,331 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\fonts\misc +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +BDF2UCS_FONT_FILES = \ + clR6x12 \ + 4x6 \ + 5x7 \ + 5x8 \ + 6x9 \ + 6x10 \ + 6x12 \ + 6x13 \ + 6x13B \ + 6x13O \ + 7x13 \ + 7x13B \ + 7x13O \ + 7x14 \ + 7x14B \ + 8x13 \ + 8x13B \ + 8x13O \ + 9x15 \ + 9x15B \ + 9x18 \ + 9x18B \ + 10x20 +BDF2UCS_8_FONT_FILES = \ + clR6x12 \ + 4x6 \ + 5x7 \ + 5x8 \ + 6x9 \ + 6x10 \ + 6x12 \ + 6x13 \ + 6x13B \ + 7x13 \ + 7x13B \ + 7x14 \ + 7x14B \ + 8x13 \ + 8x13B \ + 9x15 \ + 9x15B \ + 9x18 \ + 9x18B \ + 10x20 +BDF2UCS_11_FONT_FILES = \ + 6x13 \ + 7x13 \ + 7x13B \ + 7x13O \ + 7x14 \ + 7x14B \ + 9x15 \ + 9x15B \ + 9x18 \ + 10x20 +BDF2UCS_KOI8_FONT_FILES = \ + clR6x12 \ + 4x6 \ + 5x7 \ + 5x8 \ + 6x9 \ + 6x10 \ + 6x12 \ + 6x13 \ + 7x13 \ + 7x14 \ + 8x13 \ + 9x15 \ + 9x18 \ + 10x20 +BDF2UCS_JISX0201_FONT_FILES = \ + 7x14 +EXTRA_FONT_FILES = \ + 12x13ja \ + 18x18ja \ + 18x18ko \ + k14 \ + nil2 \ + micro \ + jiskan16 \ + jiskan24 \ + gb16fs \ + gb16st \ + gb24st \ + deccurs \ + decsess \ + arabic24 \ + cursor \ + hanglg16 \ + hanglm16 \ + hanglm24 \ + cu12 \ + cu-alt12 \ + cu-arabic12 \ + cuarabic12 \ + cu-devnag12 \ + cudevnag12 \ + cu-lig12 \ + cu-pua12 \ + clB6x10 \ + clB6x12 \ + clB8x10 \ + clB8x12 \ + clB8x13 \ + clB8x14 \ + clB8x16 \ + clB8x8 \ + clB9x15 \ + clI6x12 \ + clI8x8 \ + clR4x6 \ + clR5x10 \ + clR5x6 \ + clR5x8 \ + clR6x10 \ + clR6x13 \ + clR6x6 \ + clR6x8 \ + clR7x10 \ + clR7x12 \ + clR7x14 \ + clR7x8 \ + clR8x10 \ + clR8x12 \ + clR8x13 \ + clR8x14 \ + clR8x16 \ + clR8x8 \ + clR9x15 \ + 12x24 \ + 12x24rk \ + 8x16 \ + 8x16rk \ + olcursor \ + olgl10 \ + olgl12 \ + olgl14 \ + olgl19 + +FONT_FILES = $(BDF2UCS_FONT_FILES) $(EXTRA_FONT_FILES) + +BDF_FILES = $(FONT_FILES:%=%.bdf) +PCF_FILES = $(FONT_FILES:%=$(DESTDIR)\%.pcf.gz) + +ISO8859_1_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-1.bdf) +ISO8859_1_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-1.pcf.gz) + +ISO8859_2_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-2.bdf) +ISO8859_2_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-2.pcf.gz) + +ISO8859_3_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-3.bdf) +ISO8859_3_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-3.pcf.gz) + +ISO8859_4_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-4.bdf) +ISO8859_4_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-4.pcf.gz) + +ISO8859_5_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-5.bdf) +ISO8859_5_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-5.pcf.gz) + +ISO8859_7_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-7.bdf) +ISO8859_7_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-7.pcf.gz) + +ISO8859_8_BDF_FILES = $(BDF2UCS_8_FONT_FILES:%=%-ISO8859-8.bdf) +ISO8859_8_PCF_FILES = $(BDF2UCS_8_FONT_FILES:%=$(DESTDIR)\%-ISO8859-8.pcf.gz) + +ISO8859_9_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-9.bdf) +ISO8859_9_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-9.pcf.gz) + +ISO8859_10_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-10.bdf) +ISO8859_10_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-10.pcf.gz) + +ISO8859_11_BDF_FILES = $(BDF2UCS_11_FONT_FILES:%=%-ISO8859-11.bdf) +ISO8859_11_PCF_FILES = $(BDF2UCS_11_FONT_FILES:%=$(DESTDIR)\%-ISO8859-11.pcf.gz) + +ISO8859_13_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-13.bdf) +ISO8859_13_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-13.pcf.gz) + +ISO8859_14_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-14.bdf) +ISO8859_14_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-14.pcf.gz) + +ISO8859_15_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-15.bdf) +ISO8859_15_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-15.pcf.gz) + + +ISO8859_16_BDF_FILES = $(BDF2UCS_FONT_FILES:%=%-ISO8859-16.bdf) +ISO8859_16_PCF_FILES = $(BDF2UCS_FONT_FILES:%=$(DESTDIR)\%-ISO8859-16.pcf.gz) + +KOI8_R_BDF_FILES = $(BDF2UCS_KOI8_FONT_FILES:%=%-KOI8-R.bdf) +KOI8_R_PCF_FILES = $(BDF2UCS_KOI8_FONT_FILES:%=$(DESTDIR)\%-KOI8-R.pcf.gz) + +JISX0201_BDF_FILES = $(BDF2UCS_JISX0201_FONT_FILES:%=%-JISX0201.1976-0.bdf) +JISX0201_PCF_FILES = $(BDF2UCS_JISX0201_FONT_FILES:%=$(DESTDIR)\%-JISX0201.1976-0.pcf.gz) + +UTIL_DIR = ..\font-util +UCS2ANY = $(UTIL_DIR)\$(OBJDIR)\ucs2any.exe + +load_makefile $(UTIL_DIR)\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +#%t.bdf: %.bdf +# @rm -f $@ +# perl $(BDFTRUNCATE) 0x3200 < $< > $@ + +%-ISO8859-1.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-1 ISO8859-1 + +%-ISO8859-2.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-2 ISO8859-2 + +%-ISO8859-3.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-3 ISO8859-3 + +%-ISO8859-4.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-4 ISO8859-4 + +%-ISO8859-5.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-5 ISO8859-5 + +%-ISO8859-7.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-7 ISO8859-7 + +%-ISO8859-8.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-8 ISO8859-8 + +%-ISO8859-9.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-9 ISO8859-9 + +%-ISO8859-10.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-10 ISO8859-10 + +%-ISO8859-11.bdf: %.bdf + @rm -f $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-11 ISO8859-11 + +%-ISO8859-13.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-13 ISO8859-13 + +%-ISO8859-14.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-14 ISO8859-14 + +%-ISO8859-15.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-15 ISO8859-15 + +%-ISO8859-16.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-ISO8859-16 ISO8859-16 + +%-KOI8-R.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-KOI8-R KOI8-R + +%-JISX0201.1976-0.bdf: %.bdf + @del -e $@ + $(UCS2ANY) $< $(UTIL_DIR)\map-JISX0201.1976-0 JISX0201.1976-0 + +#%.pcf.gz: %t.bdf +# @del -e $@ +# $(BDFTOPCF) -t $< | gzip > $@ + +font_DATA = \ + $(PCF_FILES) \ + $(ISO8859_1_PCF_FILES) \ + $(ISO8859_2_PCF_FILES) \ + $(ISO8859_3_PCF_FILES) \ + $(ISO8859_4_PCF_FILES) \ + $(ISO8859_5_PCF_FILES) \ + $(ISO8859_7_PCF_FILES) \ + $(ISO8859_8_PCF_FILES) \ + $(ISO8859_9_PCF_FILES) \ + $(ISO8859_10_PCF_FILES) \ + $(ISO8859_11_PCF_FILES) \ + $(ISO8859_13_PCF_FILES) \ + $(ISO8859_14_PCF_FILES) \ + $(ISO8859_15_PCF_FILES) \ + $(ISO8859_16_PCF_FILES) \ + $(KOI8_R_PCF_FILES) \ + $(JISX0201_PCF_FILES) +BUILT_BDF_FILES = \ + $(ISO8859_1_BDF_FILES) \ + $(ISO8859_2_BDF_FILES) \ + $(ISO8859_3_BDF_FILES) \ + $(ISO8859_4_BDF_FILES) \ + $(ISO8859_5_BDF_FILES) \ + $(ISO8859_7_BDF_FILES) \ + $(ISO8859_8_BDF_FILES) \ + $(ISO8859_9_BDF_FILES) \ + $(ISO8859_10_BDF_FILES) \ + $(ISO8859_11_BDF_FILES) \ + $(ISO8859_13_BDF_FILES) \ + $(ISO8859_14_BDF_FILES) \ + $(ISO8859_15_BDF_FILES) \ + $(ISO8859_16_BDF_FILES) \ + $(KOI8_R_BDF_FILES) \ + $(JISX0201_BDF_FILES) + +all: $(DESTDIR) $(UCS2ANY) $(DESTDIR)\fonts.scale $(DESTDIR)\fonts.dir $(DESTDIR)\fonts.alias + +MKFONTSCALE=$(MHMAKECONF)\mkfontscale\$(OBJDIR)\mkfontscale.exe + +load_makefile $(MHMAKECONF)\mkfontscale\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +$(DESTDIR)\fonts.scale: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) . + +$(DESTDIR)\fonts.dir: $(font_DATA) + del -e $@ + cd $(DESTDIR) & $(MKFONTSCALE) -b -s -l . + +$(DESTDIR)\fonts.alias: fonts.alias + copy $< $@ diff --git a/xorg-server/glx/glapi.h b/xorg-server/glx/glapi.h index ddfb1cffb..697337ea0 100644 --- a/xorg-server/glx/glapi.h +++ b/xorg-server/glx/glapi.h @@ -46,6 +46,7 @@ #include "GL/gl.h" +#include "GL/glext.h" #include "glapitable.h" #include "glthread.h" diff --git a/xorg-server/glx/glheader.h b/xorg-server/glx/glheader.h new file mode 100644 index 000000000..1c0ee2c9e --- /dev/null +++ b/xorg-server/glx/glheader.h @@ -0,0 +1,24 @@ +#ifndef __GLHEADER_H__
+#define __GLHEADER_H__
+
+#define STDC_HEADERS 1
+
+#include <X11/Xwinsock.h>
+#include <X11/Xwindows.h>
+#include <assert.h>
+#define strcasecmp _stricmp
+
+#undef MINSHORT
+#undef MAXSHORT
+
+#define MINSHORT -32768
+#define MAXSHORT 32767
+
+#define PUBLIC
+
+#define GL_GLEXT_PROTOTYPES
+
+#define DRI_DRIVER_PATH "/usr/lib/dri"
+
+#endif
+
diff --git a/xorg-server/glx/glxcmds.c b/xorg-server/glx/glxcmds.c index 95221a729..2181170ef 100644 --- a/xorg-server/glx/glxcmds.c +++ b/xorg-server/glx/glxcmds.c @@ -37,6 +37,10 @@ #define FONT_PCF #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> diff --git a/xorg-server/glx/glxcmdsswap.c b/xorg-server/glx/glxcmdsswap.c index 7f17c263b..cb34a11c7 100644 --- a/xorg-server/glx/glxcmdsswap.c +++ b/xorg-server/glx/glxcmdsswap.c @@ -37,6 +37,10 @@ #define FONT_PCF #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> diff --git a/xorg-server/glx/glxdri.c b/xorg-server/glx/glxdri.c index 52a97d4c4..f76a0ce44 100644 --- a/xorg-server/glx/glxdri.c +++ b/xorg-server/glx/glxdri.c @@ -29,10 +29,13 @@ #include <stdio.h> #include <string.h> #include <errno.h> +#ifndef _MSC_VER #include <sys/time.h> #include <dlfcn.h> #include <drm.h> +#endif + #include <GL/gl.h> #include <GL/internal/dri_interface.h> diff --git a/xorg-server/glx/glxdricommon.c b/xorg-server/glx/glxdricommon.c index faaa3b7ae..028c77842 100644 --- a/xorg-server/glx/glxdricommon.c +++ b/xorg-server/glx/glxdricommon.c @@ -25,6 +25,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <stdint.h> @@ -47,12 +51,16 @@ getUST(int64_t *ust) if (ust == NULL) return -EFAULT; +#ifdef _MSC_VER + __asm int 3; +#else if (gettimeofday(&tv, NULL) == 0) { ust[0] = (tv.tv_sec * 1000000) + tv.tv_usec; return 0; } else { return -errno; } + #endif } const __DRIsystemTimeExtension systemTimeExtension = { diff --git a/xorg-server/glx/glxdriswrast.c b/xorg-server/glx/glxdriswrast.c index f36dae739..a1bd4032b 100644 --- a/xorg-server/glx/glxdriswrast.c +++ b/xorg-server/glx/glxdriswrast.c @@ -26,6 +26,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <stdint.h> @@ -55,6 +59,14 @@ #include "dispatch.h" #include "extension_string.h" +#ifndef RTLD_LOCAL +#define RTLD_LOCAL 0 +#endif + +#ifdef _MSC_VER +#define dlerror() "Getting loadlibrary error string not implemented" +#endif + typedef struct __GLXDRIscreen __GLXDRIscreen; typedef struct __GLXDRIcontext __GLXDRIcontext; typedef struct __GLXDRIdrawable __GLXDRIdrawable; @@ -252,7 +264,11 @@ __glXDRIscreenDestroy(__GLXscreen *baseScreen) (*screen->core->destroyScreen)(screen->driScreen); +#ifdef _MSC_VER + FreeLibrary(screen->driver); +#else dlclose(screen->driver); +#endif __glXScreenDestroy(baseScreen); @@ -473,14 +489,22 @@ __glXDRIscreenProbe(ScreenPtr pScreen) snprintf(filename, sizeof filename, "%s/%s_dri.so", dri_driver_path, driverName); +#ifdef _MSC_VER + screen->driver = LoadLibrary(filename); +#else screen->driver = dlopen(filename, RTLD_LAZY | RTLD_LOCAL); +#endif if (screen->driver == NULL) { LogMessage(X_ERROR, "AIGLX error: dlopen of %s failed (%s)\n", filename, dlerror()); goto handle_error; } +#ifdef _MSC_VER + extensions = GetProcAddress(screen->driver, __DRI_DRIVER_EXTENSIONS); +#else extensions = dlsym(screen->driver, __DRI_DRIVER_EXTENSIONS); +#endif if (extensions == NULL) { LogMessage(X_ERROR, "AIGLX error: %s exports no extensions (%s)\n", driverName, dlerror()); @@ -528,7 +552,11 @@ __glXDRIscreenProbe(ScreenPtr pScreen) handle_error: if (screen->driver) +#ifdef _MSC_VER + FreeLibrary(screen->driver); +#else dlclose(screen->driver); +#endif xfree(screen); diff --git a/xorg-server/glx/glxext.c b/xorg-server/glx/glxext.c index 6ba404fb1..c7784ad10 100644 --- a/xorg-server/glx/glxext.c +++ b/xorg-server/glx/glxext.c @@ -21,6 +21,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> diff --git a/xorg-server/glx/glxscreens.c b/xorg-server/glx/glxscreens.c index f4839b32c..bda649e46 100644 --- a/xorg-server/glx/glxscreens.c +++ b/xorg-server/glx/glxscreens.c @@ -35,6 +35,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <GL/glxtokens.h> diff --git a/xorg-server/glx/glxserver.h b/xorg-server/glx/glxserver.h index 518868981..0cc54c773 100644 --- a/xorg-server/glx/glxserver.h +++ b/xorg-server/glx/glxserver.h @@ -59,6 +59,7 @@ #define GL_GLEXT_PROTOTYPES /* we want prototypes */ #include <GL/gl.h> +#include <GL/glext.h> #include <GL/glxproto.h> #include <GL/glxint.h> diff --git a/xorg-server/glx/glxutil.c b/xorg-server/glx/glxutil.c index fc73a02c9..ab39f27f2 100644 --- a/xorg-server/glx/glxutil.c +++ b/xorg-server/glx/glxutil.c @@ -37,6 +37,10 @@ #define FONT_PCF #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> diff --git a/xorg-server/glx/indirect_dispatch.c b/xorg-server/glx/indirect_dispatch.c index 2afd3eb22..fac726805 100644 --- a/xorg-server/glx/indirect_dispatch.c +++ b/xorg-server/glx/indirect_dispatch.c @@ -24,6 +24,13 @@ * OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE * SOFTWARE. */ +#ifdef HAVE_DIX_CONFIG_H +#include <dix-config.h> +#else + +#include "glheader.h" + +#endif #include <X11/Xmd.h> #include <GL/gl.h> diff --git a/xorg-server/glx/indirect_dispatch_swap.c b/xorg-server/glx/indirect_dispatch_swap.c index f137cbe98..afced8bc1 100644 --- a/xorg-server/glx/indirect_dispatch_swap.c +++ b/xorg-server/glx/indirect_dispatch_swap.c @@ -24,6 +24,13 @@ * OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE * SOFTWARE. */ +#ifdef HAVE_DIX_CONFIG_H +#include <dix-config.h> +#else + +#include "glheader.h" + +#endif #include <X11/Xmd.h> #include <GL/gl.h> diff --git a/xorg-server/glx/indirect_program.c b/xorg-server/glx/indirect_program.c index d23a0a9e6..421d9a0cb 100644 --- a/xorg-server/glx/indirect_program.c +++ b/xorg-server/glx/indirect_program.c @@ -32,6 +32,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/indirect_reqsize.c b/xorg-server/glx/indirect_reqsize.c index 954eecd97..44a53c5f2 100644 --- a/xorg-server/glx/indirect_reqsize.c +++ b/xorg-server/glx/indirect_reqsize.c @@ -25,6 +25,13 @@ * SOFTWARE. */ +#ifdef HAVE_DIX_CONFIG_H +#include <dix-config.h> +#else + +#include "glheader.h" + +#endif #include <GL/gl.h> #include "glxserver.h" diff --git a/xorg-server/glx/indirect_size_get.c b/xorg-server/glx/indirect_size_get.c index 8f726904f..aacb76a2b 100644 --- a/xorg-server/glx/indirect_size_get.c +++ b/xorg-server/glx/indirect_size_get.c @@ -25,6 +25,13 @@ * SOFTWARE. */ +#ifdef HAVE_DIX_CONFIG_H +#include <dix-config.h> +#else + +#include "glheader.h" + +#endif #include <GL/gl.h> #include "indirect_size_get.h" @@ -877,7 +884,9 @@ __glGetTexLevelParameterfv_size(GLenum e) case GL_TEXTURE_INTENSITY_SIZE: /* case GL_TEXTURE_INTENSITY_SIZE_EXT:*/ case GL_TEXTURE_DEPTH: +#ifndef _MSC_VER case GL_TEXTURE_INDEX_SIZE_EXT: +#endif case GL_TEXTURE_COMPRESSED_IMAGE_SIZE: /* case GL_TEXTURE_COMPRESSED_IMAGE_SIZE_ARB:*/ case GL_TEXTURE_COMPRESSED: diff --git a/xorg-server/glx/indirect_table.c b/xorg-server/glx/indirect_table.c index cb3202605..b5ac86a5a 100644 --- a/xorg-server/glx/indirect_table.c +++ b/xorg-server/glx/indirect_table.c @@ -25,6 +25,10 @@ * SOFTWARE. */ +#ifndef HAVE_DIX_CONFIG_H +#include "glheader.h" +#endif + #include <inttypes.h> #include "glxserver.h" #include "glxext.h" diff --git a/xorg-server/glx/indirect_texture_compression.c b/xorg-server/glx/indirect_texture_compression.c index 3c09663fc..bae82c360 100644 --- a/xorg-server/glx/indirect_texture_compression.c +++ b/xorg-server/glx/indirect_texture_compression.c @@ -26,6 +26,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/indirect_util.c b/xorg-server/glx/indirect_util.c index 58c194c99..b2ecc2578 100644 --- a/xorg-server/glx/indirect_util.c +++ b/xorg-server/glx/indirect_util.c @@ -25,6 +25,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> diff --git a/xorg-server/glx/makefile b/xorg-server/glx/makefile new file mode 100644 index 000000000..8e595d7ab --- /dev/null +++ b/xorg-server/glx/makefile @@ -0,0 +1,7 @@ +CSRCS=glapi.c glthread.c glxcmds.c glxcmdsswap.c glxdricommon.c glxext.c glxscreens.c glxutil.c \
+indirect_dispatch.c indirect_dispatch_swap.c indirect_program.c indirect_reqsize.c indirect_size_get.c indirect_table.c indirect_texture_compression.c \
+indirect_util.c render2.c render2swap.c renderpix.c renderpixswap.c rensize.c single2.c single2swap.c singlepix.c singlepixswap.c singlesize.c \
+swap_interval.c xfont.c glxdriswrast.c
+
+LIBRARY=libglx
+
diff --git a/xorg-server/glx/render2.c b/xorg-server/glx/render2.c index 5b3d3e6d0..607b2d8ff 100644 --- a/xorg-server/glx/render2.c +++ b/xorg-server/glx/render2.c @@ -36,6 +36,10 @@ /* #define NEED_REPLIES */ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <glxserver.h> diff --git a/xorg-server/glx/render2swap.c b/xorg-server/glx/render2swap.c index 23b7ebd37..b0e87b021 100644 --- a/xorg-server/glx/render2swap.c +++ b/xorg-server/glx/render2swap.c @@ -36,6 +36,10 @@ /* #define NEED_REPLIES */ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/renderpix.c b/xorg-server/glx/renderpix.c index 2fe630193..6de93e3c3 100644 --- a/xorg-server/glx/renderpix.c +++ b/xorg-server/glx/renderpix.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/renderpixswap.c b/xorg-server/glx/renderpixswap.c index 8455807e6..7b2c605d3 100644 --- a/xorg-server/glx/renderpixswap.c +++ b/xorg-server/glx/renderpixswap.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/rensize.c b/xorg-server/glx/rensize.c index c69619a61..7d7c62719 100644 --- a/xorg-server/glx/rensize.c +++ b/xorg-server/glx/rensize.c @@ -35,6 +35,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <GL/gl.h> @@ -224,7 +228,9 @@ int __glXImageSize( GLenum format, GLenum type, GLenum target, case GL_422_AVERAGE_EXT: case GL_422_REV_AVERAGE_EXT: case GL_DEPTH_STENCIL_NV: +#ifndef _MSC_VER case GL_DEPTH_STENCIL_MESA: +#endif case GL_YCBCR_MESA: case GL_LUMINANCE_ALPHA: elementsPerGroup = 2; @@ -263,11 +269,13 @@ int __glXImageSize( GLenum format, GLenum type, GLenum target, case GL_UNSIGNED_SHORT_1_5_5_5_REV: case GL_UNSIGNED_SHORT_8_8_APPLE: case GL_UNSIGNED_SHORT_8_8_REV_APPLE: +#ifndef _MSC_VER case GL_UNSIGNED_SHORT_15_1_MESA: case GL_UNSIGNED_SHORT_1_15_REV_MESA: bytesPerElement = 2; elementsPerGroup = 1; break; +#endif case GL_INT: case GL_UNSIGNED_INT: case GL_FLOAT: @@ -278,8 +286,10 @@ int __glXImageSize( GLenum format, GLenum type, GLenum target, case GL_UNSIGNED_INT_10_10_10_2: case GL_UNSIGNED_INT_2_10_10_10_REV: case GL_UNSIGNED_INT_24_8_NV: +#ifndef _MSC_VER case GL_UNSIGNED_INT_24_8_MESA: case GL_UNSIGNED_INT_8_24_REV_MESA: +#endif bytesPerElement = 4; elementsPerGroup = 1; break; diff --git a/xorg-server/glx/single2.c b/xorg-server/glx/single2.c index 3387af2a2..d9272a156 100644 --- a/xorg-server/glx/single2.c +++ b/xorg-server/glx/single2.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <string.h> @@ -341,6 +345,9 @@ int DoGetString(__GLXclientState *cl, GLbyte *pc, GLboolean need_swap) string = (const char *) CALL_GetString( GET_DISPATCH(), (name) ); client = cl->client; + if (string == NULL) + string = ""; + /* ** Restrict extensions to those that are supported by both the ** implementation and the connection. That is, return the diff --git a/xorg-server/glx/single2swap.c b/xorg-server/glx/single2swap.c index 41a42bb0f..83408ae14 100644 --- a/xorg-server/glx/single2swap.c +++ b/xorg-server/glx/single2swap.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/singlepix.c b/xorg-server/glx/singlepix.c index d6b96defc..bac9a08be 100644 --- a/xorg-server/glx/singlepix.c +++ b/xorg-server/glx/singlepix.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/singlepixswap.c b/xorg-server/glx/singlepixswap.c index 032b42765..3a19dd51c 100644 --- a/xorg-server/glx/singlepixswap.c +++ b/xorg-server/glx/singlepixswap.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/glx/singlesize.c b/xorg-server/glx/singlesize.c index b5a74f30d..124c32a4e 100644 --- a/xorg-server/glx/singlesize.c +++ b/xorg-server/glx/singlesize.c @@ -35,6 +35,10 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include <GL/gl.h> diff --git a/xorg-server/glx/swap_interval.c b/xorg-server/glx/swap_interval.c index 24abd69fa..a136c950f 100644 --- a/xorg-server/glx/swap_interval.c +++ b/xorg-server/glx/swap_interval.c @@ -25,6 +25,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" @@ -54,7 +58,7 @@ int DoSwapInterval(__GLXclientState *cl, GLbyte *pc, int do_swap) cx = __glXLookupContextByTag(cl, tag); - LogMessage(X_ERROR, "%s: cx = %p, GLX screen = %p\n", __func__, + LogMessage(X_ERROR, "%s: cx = %p, GLX screen = %p\n", __FUNCTION__ , cx, (cx == NULL) ? NULL : cx->pGlxScreen); if ((cx == NULL) || (cx->pGlxScreen == NULL)) { client->errorValue = tag; diff --git a/xorg-server/glx/xfont.c b/xorg-server/glx/xfont.c index 9629cf147..2d1993f90 100644 --- a/xorg-server/glx/xfont.c +++ b/xorg-server/glx/xfont.c @@ -36,6 +36,10 @@ #define NEED_REPLIES #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else + +#include "glheader.h" + #endif #include "glxserver.h" diff --git a/xorg-server/hw/dmx/dmxinit.c b/xorg-server/hw/dmx/dmxinit.c index 29dc00575..334c78693 100644 --- a/xorg-server/hw/dmx/dmxinit.c +++ b/xorg-server/hw/dmx/dmxinit.c @@ -851,6 +851,13 @@ void AbortDDX(void) } } +#ifdef DDXBEFORERESET +/* This function is called in Xserver/dix/dispatch.c */ +void ddxBeforeReset(void) +{ +} +#endif + /** This function is called in Xserver/dix/main.c from \a main() when * dispatchException & DE_TERMINATE (which is the only way to exit the * main loop without an interruption. */ diff --git a/xorg-server/hw/kdrive/ephyr/ephyr.c b/xorg-server/hw/kdrive/ephyr/ephyr.c index b02f9903c..7c825a3fd 100644 --- a/xorg-server/hw/kdrive/ephyr/ephyr.c +++ b/xorg-server/hw/kdrive/ephyr/ephyr.c @@ -61,8 +61,11 @@ Bool EphyrWantGrayScale = 0; Bool ephyrInitialize (KdCardInfo *card, EphyrPriv *priv) { +#ifdef _MSC_VER + __asm int 3; +#else OsSignal(SIGUSR1, hostx_handle_signal); - +#endif priv->base = 0; priv->bytes_per_line = 0; return TRUE; @@ -420,8 +423,6 @@ ephyrRandRGetInfo (ScreenPtr pScreen, Rotation *rotations) Rotation randr; int n = 0; - EPHYR_LOG("mark"); - struct { int width, height; } sizes[] = { { 1600, 1200 }, @@ -442,6 +443,8 @@ ephyrRandRGetInfo (ScreenPtr pScreen, Rotation *rotations) { 0, 0 } }; + EPHYR_LOG("mark"); + *rotations = RR_Rotate_All|RR_Reflect_All; if (!hostx_want_preexisting_window (screen) @@ -795,21 +798,29 @@ ephyrUpdateModifierState(unsigned int state) static void ephyrBlockSigio (void) { +#ifdef _MSC_VER + __asm int 3; +#else sigset_t set; sigemptyset (&set); sigaddset (&set, SIGIO); sigprocmask (SIG_BLOCK, &set, 0); +#endif } static void ephyrUnblockSigio (void) { +#ifdef _MSC_VER + __asm int 3; +#else sigset_t set; sigemptyset (&set); sigaddset (&set, SIGIO); sigprocmask (SIG_UNBLOCK, &set, 0); +#endif } static Bool diff --git a/xorg-server/hw/kdrive/ephyr/ephyr.h b/xorg-server/hw/kdrive/ephyr/ephyr.h index 5d58a216c..dd22bd150 100644 --- a/xorg-server/hw/kdrive/ephyr/ephyr.h +++ b/xorg-server/hw/kdrive/ephyr/ephyr.h @@ -26,9 +26,11 @@ #ifndef _EPHYR_H_ #define _EPHYR_H_ #include <stdio.h> +#ifndef _MSC_VER #include <unistd.h> -#include <signal.h> #include <libgen.h> +#endif +#include <signal.h> #include "os.h" /* for OsSignal() */ #include "kdrive.h" diff --git a/xorg-server/hw/kdrive/ephyr/ephyrinit.c b/xorg-server/hw/kdrive/ephyr/ephyrinit.c index 47ddb3d82..005b0baa9 100644 --- a/xorg-server/hw/kdrive/ephyr/ephyrinit.c +++ b/xorg-server/hw/kdrive/ephyr/ephyrinit.c @@ -53,6 +53,7 @@ InitCard (char *name) KdCardInfoAdd (&ephyrFuncs, &attr, 0); } +#ifndef _MSC_VER void InitOutput (ScreenInfo *pScreenInfo, int argc, char **argv) { @@ -114,6 +115,7 @@ ddxUseMsg (void) exit(1); } +#endif void processScreenArg (char *screen_size, char *parent_id) @@ -144,6 +146,7 @@ processScreenArg (char *screen_size, char *parent_id) } } +#ifndef _MSC_VER int ddxProcessArgument (int argc, char **argv, int i) { @@ -250,6 +253,13 @@ ddxProcessArgument (int argc, char **argv, int i) return KdProcessArgument (argc, argv, i); } +#ifdef DDXBEFORERESET +void +ddxBeforeReset (void) +{ +} +#endif + void OsVendorInit (void) { @@ -264,6 +274,15 @@ OsVendorInit (void) KdOsInit (&EphyrOsFuncs); } +#ifdef DDXOSFATALERROR +void +OsVendorFatalError(void) +{ +} +#endif + +#endif + /* 'Fake' cursor stuff, could be improved */ static Bool diff --git a/xorg-server/hw/kdrive/ephyr/hostx.c b/xorg-server/hw/kdrive/ephyr/hostx.c index c870a291d..90f0ea64e 100644 --- a/xorg-server/hw/kdrive/ephyr/hostx.c +++ b/xorg-server/hw/kdrive/ephyr/hostx.c @@ -43,13 +43,15 @@ #include <stdlib.h> #include <stdio.h> -#include <unistd.h> #include <string.h> /* for memset */ #include <time.h> +#ifndef _MSC_VER +#include <unistd.h> #include <sys/ipc.h> #include <sys/shm.h> #include <sys/time.h> +#endif #include <X11/Xlib.h> #include <X11/Xutil.h> @@ -206,7 +208,11 @@ hostx_add_screen (EphyrScreenInfo screen, void hostx_set_display_name (char *name) { +#ifdef _MSC_VER + __asm int 3; +#else HostX.server_dpy_name = strdup (name); +#endif } void @@ -462,6 +468,9 @@ hostx_init (void) } /* Try to get share memory ximages for a little bit more speed */ +#ifdef _MSC_VER + __asm int 3; +#else if (!XShmQueryExtension(HostX.dpy) || getenv("XEPHYR_NO_SHM")) { fprintf(stderr, "\nXephyr unable to use SHM XImages\n"); @@ -492,6 +501,7 @@ hostx_init (void) shmdt(shminfo.shmaddr); shmctl(shminfo.shmid, IPC_RMID, 0); } +#endif XFlush(HostX.dpy); @@ -611,7 +621,7 @@ hostx_screen_init (EphyrScreenInfo screen, struct EphyrHostScreen *host_screen = host_screen_from_screen_info (screen); if (!host_screen) { - fprintf (stderr, "%s: Error in accessing hostx data\n", __func__ ); + fprintf (stderr, "%s: Error in accessing hostx data\n", __FUNCTION__ ); exit(1); } @@ -626,10 +636,14 @@ hostx_screen_init (EphyrScreenInfo screen, if (HostX.have_shm) { +#ifdef _MSC_VER + __asm int 3; +#else XShmDetach(HostX.dpy, &host_screen->shminfo); XDestroyImage (host_screen->ximg); shmdt(host_screen->shminfo.shmaddr); shmctl(host_screen->shminfo.shmid, IPC_RMID, 0); +#endif } else { @@ -645,6 +659,9 @@ hostx_screen_init (EphyrScreenInfo screen, if (HostX.have_shm) { +#ifdef _MSC_VER +__asm int 3; +#else host_screen->ximg = XShmCreateImage (HostX.dpy, HostX.visual, HostX.depth, ZPixmap, NULL, &host_screen->shminfo, width, buffer_height ); @@ -670,6 +687,7 @@ hostx_screen_init (EphyrScreenInfo screen, XShmAttach(HostX.dpy, &host_screen->shminfo); shm_success = True; } +#endif } if (!shm_success) @@ -798,9 +816,13 @@ hostx_paint_rect (EphyrScreenInfo screen, if (HostX.have_shm) { +#ifdef _MSC_VER + __asm int 3; +#else XShmPutImage (HostX.dpy, host_screen->win, HostX.gc, host_screen->ximg, sx, sy, dx, dy, width, height, False); +#endif } else { @@ -816,6 +838,9 @@ hostx_paint_debug_rect (struct EphyrHostScreen *host_screen, int x, int y, int width, int height) { +#ifdef _MSC_VER + __asm int 3; +#else struct timespec tspec; tspec.tv_sec = HostX.damage_debug_msec / (1000000); @@ -831,6 +856,7 @@ hostx_paint_debug_rect (struct EphyrHostScreen *host_screen, /* nanosleep seems to work better than usleep for me... */ nanosleep(&tspec, NULL); +#endif } void @@ -1265,8 +1291,12 @@ hostx_set_window_bounding_rectangles (int a_window, rects[i].width, rects[i].height) ; } /*this aways returns 1*/ +#ifdef _MSC_VER + __asm int 3; +#else XShapeCombineRectangles (dpy, a_window, ShapeBounding, 0, 0, rects, a_num_rects, ShapeSet, YXBanded) ; +#endif is_ok = TRUE ; if (rects) { @@ -1302,8 +1332,12 @@ hostx_set_window_clipping_rectangles (int a_window, rects[i].width, rects[i].height) ; } /*this aways returns 1*/ +#ifdef _MSC_VER + __asm int 3; +#else XShapeCombineRectangles (dpy, a_window, ShapeClip, 0, 0, rects, a_num_rects, ShapeSet, YXBanded) ; +#endif is_ok = TRUE ; if (rects) { @@ -1318,12 +1352,16 @@ int hostx_has_xshape (void) { int event_base=0, error_base=0 ; +#ifdef _MSC_VER + __asm int 3; +#else Display *dpy=hostx_get_display () ; if (!XShapeQueryExtension (dpy, &event_base, &error_base)) { return FALSE ; } +#endif return TRUE; } diff --git a/xorg-server/hw/kdrive/ephyr/hostx.h b/xorg-server/hw/kdrive/ephyr/hostx.h index 47ba61b5b..ba037d511 100644 --- a/xorg-server/hw/kdrive/ephyr/hostx.h +++ b/xorg-server/hw/kdrive/ephyr/hostx.h @@ -35,8 +35,12 @@ #define EPHYR_DBG(x, a...) \ fprintf(stderr, __FILE__ ":%d,%s() " x "\n", __LINE__, __func__, ##a) #else +#ifdef _MSC_VER +#define EPHYR_DBG() +#else #define EPHYR_DBG(x, a...) do {} while (0) #endif +#endif typedef struct EphyrHostXVars EphyrHostXVars; typedef struct EphyrHostXEvent EphyrHostXEvent; diff --git a/xorg-server/hw/kdrive/ephyr/makefile b/xorg-server/hw/kdrive/ephyr/makefile new file mode 100644 index 000000000..eba9a93e1 --- /dev/null +++ b/xorg-server/hw/kdrive/ephyr/makefile @@ -0,0 +1,6 @@ +LIBRARY = libxephyr + +CSRCS=ephyrinit.c ephyr.c hostx.c + +INCLUDES += ..\src ..\..\..\exa + diff --git a/xorg-server/hw/kdrive/fake/fakeinit.c b/xorg-server/hw/kdrive/fake/fakeinit.c index 2cfcbedd5..9e8372eee 100644 --- a/xorg-server/hw/kdrive/fake/fakeinit.c +++ b/xorg-server/hw/kdrive/fake/fakeinit.c @@ -72,12 +72,26 @@ ddxProcessArgument (int argc, char **argv, int i) return KdProcessArgument (argc, argv, i); } +#ifdef DDXBEFORERESET +void +ddxBeforeReset (void) +{ +} +#endif + void OsVendorInit (void) { KdOsInit (&FakeOsFuncs); } +#ifdef DDXOSFATALERROR +void +OsVendorFatalError(void) +{ +} +#endif + KdCardFuncs fakeFuncs = { fakeCardInit, /* cardinit */ fakeScreenInit, /* scrinit */ diff --git a/xorg-server/hw/kdrive/sdl/sdl.c b/xorg-server/hw/kdrive/sdl/sdl.c index 411b5d4e1..bd8106a27 100644 --- a/xorg-server/hw/kdrive/sdl/sdl.c +++ b/xorg-server/hw/kdrive/sdl/sdl.c @@ -369,6 +369,12 @@ int ddxProcessArgument(int argc, char **argv, int i) return KdProcessArgument(argc, argv, i); } +#ifdef DDXBEFORERESET +void ddxBeforeReset (void) +{ +} +#endif + void sdlTimer(void) { static int buttonState=0; @@ -452,4 +458,9 @@ void OsVendorInit (void) KdOsInit (&sdlOsFuncs); } +#ifdef DDXOSFATALERROR +void OsVendorFatalError(void) +{ +} +#endif diff --git a/xorg-server/hw/kdrive/src/kdrive.c b/xorg-server/hw/kdrive/src/kdrive.c index e2ee4adea..3e739b8ec 100644 --- a/xorg-server/hw/kdrive/src/kdrive.c +++ b/xorg-server/hw/kdrive/src/kdrive.c @@ -340,6 +340,7 @@ KdProcessSwitch (void) KdEnableScreens (); } +#ifndef _MSC_VER void AbortDDX(void) { @@ -362,6 +363,7 @@ ddxGiveUp () { AbortDDX (); } +#endif Bool kdDumbDriver; Bool kdSoftCursor; @@ -1394,6 +1396,7 @@ KdInitOutput (ScreenInfo *pScreenInfo, } #ifdef DPMSExtension +#ifndef _MSC_VER int DPMSSet(ClientPtr client, int level) { @@ -1411,6 +1414,8 @@ DPMSSupported (void) return FALSE; } #endif +#endif +#ifndef _MSC_VER void ddxInitGlobals(void) { /* THANK YOU XPRINT */ } - +#endif diff --git a/xorg-server/hw/kdrive/src/kinput.c b/xorg-server/hw/kdrive/src/kinput.c index 9ba11661c..b1b04fa52 100644 --- a/xorg-server/hw/kdrive/src/kinput.c +++ b/xorg-server/hw/kdrive/src/kinput.c @@ -110,21 +110,29 @@ KdSigio (int sig) static void KdBlockSigio (void) { +#ifdef _MSC_VER + __asm int 3; +#else sigset_t set; sigemptyset (&set); sigaddset (&set, SIGIO); sigprocmask (SIG_BLOCK, &set, 0); +#endif } static void KdUnblockSigio (void) { +#ifdef _MSC_VER + __asm int 3; +#else sigset_t set; sigemptyset (&set); sigaddset (&set, SIGIO); sigprocmask (SIG_UNBLOCK, &set, 0); +#endif } #ifdef DEBUG_SIGIO @@ -170,15 +178,22 @@ KdResetInputMachine (void) static void KdNonBlockFd (int fd) { +#ifdef _MSC_VER + __asm int 3; +#else int flags; flags = fcntl (fd, F_GETFL); flags |= FASYNC|NOBLOCK; fcntl (fd, F_SETFL, flags); +#endif } static void KdAddFd (int fd) { +#ifdef _MSC_VER + __asm int 3; +#else struct sigaction act; sigset_t set; @@ -195,11 +210,15 @@ KdAddFd (int fd) sigaction (SIGIO, &act, 0); sigemptyset (&set); sigprocmask (SIG_SETMASK, &set, 0); +#endif } static void KdRemoveFd (int fd) { +#ifdef _MSC_VER + __asm int 3; +#else struct sigaction act; int flags; @@ -215,6 +234,7 @@ KdRemoveFd (int fd) sigemptyset (&act.sa_mask); sigaction (SIGIO, &act, 0); } +#endif } Bool @@ -513,11 +533,13 @@ KdPointerProc(DeviceIntPtr pDevice, int onoff) return BadImplementation; } +#ifndef _MSC_VER Bool LegalModifier(unsigned int key, DeviceIntPtr pDev) { return TRUE; } +#endif static void KdBell (int volume, DeviceIntPtr pDev, pointer arg, int something) @@ -536,6 +558,7 @@ KdBell (int volume, DeviceIntPtr pDev, pointer arg, int something) KdRingBell(ki, volume, ctrl->bell_pitch, ctrl->bell_duration); } +#ifndef _MSC_VER void DDXRingBell(int volume, int pitch, int duration) { @@ -551,7 +574,7 @@ DDXRingBell(int volume, int pitch, int duration) } } } - +#endif void KdRingBell(KdKeyboardInfo *ki, int volume, int pitch, int duration) { @@ -2345,6 +2368,7 @@ miPointerScreenFuncRec kdPointerScreenFuncs = KdWarpCursor }; +#ifndef _MSC_VER void ProcessInputEvents () { @@ -2354,6 +2378,7 @@ ProcessInputEvents () KdProcessSwitch (); KdCheckLock (); } +#endif /* FIXME use XSECURITY to work out whether the client should be allowed to * open and close. */ diff --git a/xorg-server/hw/kdrive/src/kmap.c b/xorg-server/hw/kdrive/src/kmap.c index ce1e28ae4..0762e72af 100644 --- a/xorg-server/hw/kdrive/src/kmap.c +++ b/xorg-server/hw/kdrive/src/kmap.c @@ -24,6 +24,7 @@ #include "kdrive.h" #include <errno.h> +#ifndef _MSC_VER #include <unistd.h> #include <sys/mman.h> #ifdef HAVE_ASM_MTRR_H @@ -31,6 +32,9 @@ #endif #include <sys/ioctl.h> +#else +#define DRAW_DEBUG(a) +#endif void * KdMapDevice (CARD32 addr, CARD32 size) @@ -39,7 +43,8 @@ KdMapDevice (CARD32 addr, CARD32 size) void *a; void *d; - d = VirtualAlloc (NULL, size, MEM_RESERVE, PAGE_NOACCESS); + d = VirtualAlloc (NULL, size, MEM_RESERVE, PAGE_READWRITE|PAGE_NOCACHE); +/* if (!d) return NULL; DRAW_DEBUG ((DEBUG_S3INIT, "Virtual address of 0x%x is 0x%x", addr, d)); @@ -53,6 +58,8 @@ KdMapDevice (CARD32 addr, CARD32 size) return NULL; } DRAW_DEBUG ((DEBUG_S3INIT, "Device mapped successfully")); +*/ + __asm int 3; return d; #endif #ifdef linux diff --git a/xorg-server/hw/kdrive/src/makefile b/xorg-server/hw/kdrive/src/makefile new file mode 100644 index 000000000..1400d0427 --- /dev/null +++ b/xorg-server/hw/kdrive/src/makefile @@ -0,0 +1,20 @@ +LIBRARY = libkdrive + +CSRCS = kaa.c \ + kaapict.c \ + kasync.c \ + kcmap.c \ + kcurscol.c \ + kinfo.c \ + kkeymap.c \ + kmap.c \ + kmode.c \ + knoop.c \ + koffscreen.c \ + kshadow.c \ + kinput.c \ + kdrive.c \ + ktest.c + + + diff --git a/xorg-server/hw/xfree86/common/compiler.h b/xorg-server/hw/xfree86/common/compiler.h index 7b65da844..ff6ac8ad7 100644 --- a/xorg-server/hw/xfree86/common/compiler.h +++ b/xorg-server/hw/xfree86/common/compiler.h @@ -66,7 +66,7 @@ # endif # endif /* __inline__ */ # ifndef __inline -# if defined(__GNUC__) +# if defined(__GNUC__) || defined(_MSC_VER) /* gcc has __inline */ # elif defined(__HIGHC__) # define __inline _Inline @@ -1529,13 +1529,13 @@ inl(unsigned short port) # define uint_t unsigned int # define uchar_t unsigned char # endif /* __UNIXWARE__ */ -# if !defined(sgi) && !defined(__SUNPRO_C) +# if !defined(sgi) && !defined(__SUNPRO_C) && !defined(_MSC_VER) # include <sys/inline.h> # endif # else # include "scoasm.h" # endif -# if (!defined(__HIGHC__) && !defined(sgi) && !defined(__SUNPRO_C)) || \ +# if (!defined(__HIGHC__) && !defined(sgi) && !defined(__SUNPRO_C) && !defined(_MSC_VER)) || \ defined(__USLC__) # pragma asm partial_optimization outl # pragma asm partial_optimization outw diff --git a/xorg-server/hw/xwin/InitInput.c b/xorg-server/hw/xwin/InitInput.c index 6a850cd44..bce7ac54e 100644 --- a/xorg-server/hw/xwin/InitInput.c +++ b/xorg-server/hw/xwin/InitInput.c @@ -30,10 +30,8 @@ #include <xwin-config.h> #endif #include "win.h" -#ifdef XWIN_CLIPBOARD -# include "../../Xext/xf86miscproc.h" -#endif #include "dixstruct.h" +#include "inputstr.h" /* @@ -104,6 +102,11 @@ ProcessInputEvents (void) #endif } +void DDXRingBell(int volume, int pitch, int duration) +{ + /* winKeybdBell is used instead */ + return; +} int TimeSinceLastInputEvent () @@ -147,8 +150,10 @@ InitInput (int argc, char *argv[]) RegisterPointerDevice (pMouse); RegisterKeyboardDevice (pKeyboard); - miRegisterPointerDevice (screenInfo.screens[0], pMouse); - mieqInit ((DevicePtr)pKeyboard, (DevicePtr)pMouse); + pMouse->name = strdup("Windows mouse"); + pKeyboard->name = strdup("Windows keyboard"); + + mieqInit (); /* Initialize the mode key states */ winInitializeModeKeyStates (); diff --git a/xorg-server/hw/xwin/InitOutput.c b/xorg-server/hw/xwin/InitOutput.c index d2159813c..545437437 100644 --- a/xorg-server/hw/xwin/InitOutput.c +++ b/xorg-server/hw/xwin/InitOutput.c @@ -1,6 +1,7 @@ /* Copyright 1993, 1998 The Open Group +Copyright (C) Colin Harrison 2005-2008 Permission to use, copy, modify, distribute, and sell this software and its documentation for any purpose is hereby granted without fee, provided that @@ -45,14 +46,16 @@ from The Open Group. #if defined(XKB) && defined(WIN32) #include <xkbsrv.h> #endif + #ifdef RELOCATE_PROJECTROOT +#undef Status #include <shlobj.h> -typedef HRESULT (*SHGETFOLDERPATHPROC)( +typedef HRESULT (__stdcall * SHGETFOLDERPATHPROC)( HWND hwndOwner, int nFolder, HANDLE hToken, DWORD dwFlags, - LPTSTR pszPath + LPSTR pszPath ); #endif @@ -73,6 +76,7 @@ extern int g_iLogVerbose; Bool g_fLogInited; extern Bool g_fXdmcpEnabled; +extern Bool g_fAuthEnabled; #ifdef HAS_DEVWINDOWS extern int g_fdMessageQueue; #endif @@ -132,6 +136,9 @@ const char * winGetBaseDir(void); #endif +static +void glx_debugging(void); + /* * For the depth 24 pixmap we default to 32 bits per pixel, but * we change this pixmap format later if we detect that the display @@ -241,7 +248,7 @@ ddxGiveUp (void) #endif if (!g_fLogInited) { - LogInit (g_pszLogFile, NULL); + g_pszLogFile = LogInit (g_pszLogFile, NULL); g_fLogInited = TRUE; } LogClose (); @@ -424,7 +431,17 @@ winFixupPaths (void) #ifdef READ_FONTDIRS { /* Open fontpath configuration file */ +#if defined WIN32 && defined __MINGW32__ + static Bool once = False; + char buffer[MAX_PATH]; + snprintf(buffer, sizeof(buffer), "%s\\font-dirs", basedir); + buffer[sizeof(buffer)-1] = 0; + FILE *fontdirs = fopen(buffer, "rt"); + if (once) fontdirs = NULL; + else once = True; +#else FILE *fontdirs = fopen(ETCX11DIR "/font-dirs", "rt"); +#endif if (fontdirs != NULL) { char buffer[256]; @@ -624,6 +641,14 @@ winFixupPaths (void) buffer[sizeof(buffer)-1] = 0; putenv(buffer); } + if (getenv("XHOSTPREFIX") == NULL) + { + char buffer[MAX_PATH]; + snprintf(buffer, sizeof(buffer), "XHOSTPREFIX=%s\\X", + basedir); + buffer[sizeof(buffer)-1] = 0; + putenv(buffer); + } if (getenv("HOME") == NULL) { HMODULE shfolder; @@ -661,9 +686,10 @@ winFixupPaths (void) if (size && size < sizeof(buffer)) { snprintf(buffer + size, sizeof(buffer) - size, - "XWin.%s.log", display); + "VCXSrv.%s.log", display); buffer[sizeof(buffer)-1] = 0; g_pszLogFile = buffer; + GetLongPathName(buffer, buffer, MAX_PATH); winMsg (X_DEFAULT, "Logfile set to \"%s\"\n", g_pszLogFile); } } @@ -671,7 +697,7 @@ winFixupPaths (void) { static char xkbbasedir[MAX_PATH]; - snprintf(xkbbasedir, sizeof(xkbbasedir), "%s\\xkb", basedir); + snprintf(xkbbasedir, sizeof(xkbbasedir), "%s\\xkbdata", basedir); if (sizeof(xkbbasedir) > 0) xkbbasedir[sizeof(xkbbasedir)-1] = 0; XkbBaseDirectory = xkbbasedir; @@ -687,9 +713,6 @@ OsVendorInit (void) /* Re-initialize global variables on server reset */ winInitializeGlobals (); - LogInit (NULL, NULL); - LogSetParameter (XLOG_VERBOSITY, g_iLogVerbose); - winFixupPaths(); #ifdef DDXOSVERRORF @@ -704,7 +727,7 @@ OsVendorInit (void) * avoid the second call */ g_fLogInited = TRUE; - LogInit (g_pszLogFile, NULL); + g_pszLogFile = LogInit (g_pszLogFile, NULL); } LogSetParameter (XLOG_FLUSH, 1); LogSetParameter (XLOG_VERBOSITY, g_iLogVerbose); @@ -877,7 +900,7 @@ winUseMsg (void) #endif ErrorF ("-logfile filename\n" - "\tWrite logmessages to <filename> instead of /tmp/Xwin.log.\n"); + "\tWrite logmessages to <filename>.\n"); ErrorF ("-logverbose verbosity\n" "\tSet the verbosity of logmessages. [NOTE: Only a few messages\n" @@ -907,7 +930,7 @@ ddxUseMsg(void) /* Log file will not be opened for UseMsg unless we open it now */ if (!g_fLogInited) { - LogInit (g_pszLogFile, NULL); + g_pszLogFile = LogInit (g_pszLogFile, NULL); g_fLogInited = TRUE; } LogClose (); @@ -915,9 +938,9 @@ ddxUseMsg(void) /* Notify user where UseMsg text can be found.*/ if (!g_fNoHelpMessageBox) winMessageBoxF ("The " PROJECT_NAME " help text has been printed to " - "/tmp/XWin.log.\n" - "Please open /tmp/XWin.log to read the help text.\n", - MB_ICONINFORMATION); + "%s.\n" + "Please open %s to read the help text.\n", + MB_ICONINFORMATION, g_pszLogFile, g_pszLogFile); } /* ddxInitGlobals - called by |InitGlobals| from os/util.c */ @@ -965,9 +988,6 @@ InitOutput (ScreenInfo *screenInfo, int argc, char *argv[]) if (!winReadConfigfile ()) winErrorFVerb (1, "InitOutput - Error reading config file\n"); #else - winMsg(X_INFO, "XF86Config is not supported\n"); - winMsg(X_INFO, "See http://x.cygwin.com/docs/faq/cygwin-x-faq.html " - "for more information\n"); winConfigFiles (); #endif @@ -1031,7 +1051,7 @@ InitOutput (ScreenInfo *screenInfo, int argc, char *argv[]) #if defined(XCSECURITY) /* Generate a cookie used by internal clients for authorization */ - if (g_fXdmcpEnabled) + if (g_fXdmcpEnabled || g_fAuthEnabled) winGenerateAuthorization (); #endif @@ -1043,6 +1063,8 @@ InitOutput (ScreenInfo *screenInfo, int argc, char *argv[]) * Apply locale specified in LANG environment variable. */ setlocale (LC_ALL, ""); + + glx_debugging(); } #endif @@ -1071,7 +1093,7 @@ winCheckDisplayNumber () /* Check display range */ nDisp = atoi (display); - if (nDisp < 0 || nDisp > 65535) + if (nDisp < 0 || nDisp > 59535) { ErrorF ("winCheckDisplayNumber - Bad display number: %d\n", nDisp); return FALSE; @@ -1118,7 +1140,7 @@ winCheckDisplayNumber () if (GetLastError () == ERROR_ALREADY_EXISTS) { ErrorF ("winCheckDisplayNumber - " - PROJECT_NAME " is already running on display %d\n", + "VCXsrv, Xming or Cygwin/X is already running on display %d\n", nDisp); return FALSE; } @@ -1126,19 +1148,21 @@ winCheckDisplayNumber () return TRUE; } -#ifdef DPMSExtension -Bool DPMSSupported(void) -{ - return FALSE; -} +/* GLX debugging helpers */ +#include <../glx/glapi.h> -void DPMSSet(int level) -{ - return; +static +void warn_func(void * p1, const char *format, ...) { + va_list v; + va_start(v, format); + vfprintf(stderr, format, v); + va_end(v); + fprintf(stderr,"\n"); } -int DPMSGet(int *plevel) +static +void glx_debugging(void) { - return 0; + _glapi_set_warning_func(warn_func); + _glapi_noop_enable_warnings(TRUE); } -#endif diff --git a/xorg-server/hw/xwin/X.ico b/xorg-server/hw/xwin/X.ico Binary files differindex d47168fca..5d69818b5 100644 --- a/xorg-server/hw/xwin/X.ico +++ b/xorg-server/hw/xwin/X.ico diff --git a/xorg-server/hw/xwin/XWin.exe.manifest b/xorg-server/hw/xwin/XWin.exe.manifest new file mode 100644 index 000000000..221150d52 --- /dev/null +++ b/xorg-server/hw/xwin/XWin.exe.manifest @@ -0,0 +1,16 @@ +<?xml version="1.0" encoding="UTF-8" standalone="yes"?> +<assembly xmlns="urn:schemas-microsoft-com:asm.v1" manifestVersion="1.0"> + <description>The XWin X Windows server for Cygwin.</description> + <dependency> + <dependentAssembly> + <assemblyIdentity + type="win32" + name="Microsoft.Windows.Common-Controls" + version="6.0.0.0" + processorArchitecture="X86" + publicKeyToken="6595b64144ccf1df" + language="*" + /> + </dependentAssembly> + </dependency> +</assembly> diff --git a/xorg-server/hw/xwin/XWin.rc b/xorg-server/hw/xwin/XWin.rc index 749c0f5f5..cbe5244e9 100644 --- a/xorg-server/hw/xwin/XWin.rc +++ b/xorg-server/hw/xwin/XWin.rc @@ -1,5 +1,6 @@ /* *Copyright (C) 2002-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) 2008 Yaakov Selkowitz All Rights Reserved * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -20,62 +21,58 @@ *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. * - *Except as contained in this notice, the name of Harold L Hunt II + *Except as contained in this notice, the names of the authors *shall not be used in advertising or otherwise to promote the sale, use *or other dealings in this Software without prior written authorization - *from Harold L Hunt II. + *from the authors. * - * Authors: Harold L Hunt II + * Authors: Harold L Hunt II, Yaakov Selkowitz */ -#include "windows.h" +#include <windows.h> #include "winresource.h" +#include "xwin-config.h" /* * Dialogs */ /* About */ -ABOUT_BOX DIALOG DISCARDABLE 32, 32, 240, 105 +ABOUT_BOX DIALOGEX 32, 32, 260, 95 STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | WS_TABSTOP | DS_CENTERMOUSE -CAPTION "About " PROJECT_NAME -FONT 8, "MS Sans Serif" +CAPTION "About XSrv" +FONT 8, "MS Shell Dlg 2" BEGIN - CONTROL PROJECT_NAME " Website", ID_ABOUT_WEBSITE, "Button", - BS_OWNERDRAW | WS_TABSTOP, 30, 45, 75, 15 - CONTROL "Change Log", ID_ABOUT_CHANGELOG, "Button", - BS_OWNERDRAW | WS_TABSTOP, 135, 45, 75, 15 - CONTROL "User's Guide", ID_ABOUT_UG, "Button", - BS_OWNERDRAW | WS_TABSTOP, 30, 65, 75, 15 - CONTROL "FAQ", ID_ABOUT_FAQ, "Button", - BS_OWNERDRAW | WS_TABSTOP, 135, 65, 75, 15 - - DEFPUSHBUTTON "Dismiss", IDOK, 95, 85, 50, 15 - - CTEXT "Welcome to the preliminary About box for the " PROJECT_NAME " X Server. This dialog was created on 2004/03/25 and will eventually be filled with more useful information. For now, use the links below to learn more about the " PROJECT_NAME " project.", IDC_STATIC, 5, 5, 230, 35 + CONTROL IDI_XWIN, IDC_STATIC, "Static", SS_ICON, 8, 8, 32, 32 + LTEXT "XSrv X Server ", IDC_STATIC, 36, 8, 220, 8 + LTEXT "Version 0.0 (1 Jan 2009)", IDC_STATIC, 36, 18, 220, 8 + LTEXT "This product is licensed under the terms of the MIT/X11 License.", IDC_STATIC, 36, 38, 220, 20 + CONTROL __VENDORDWEBSUPPORT__, ID_ABOUT_WEBSITE, "Button", + BS_OWNERDRAW | WS_TABSTOP, 36, 58, 68, 8 + DEFPUSHBUTTON "OK", IDOK, 105, 75, 50, 15 END /* Depth change */ -DEPTH_CHANGE_BOX DIALOG DISCARDABLE 32, 32, 180, 100 +DEPTH_CHANGE_BOX DIALOGEX 32, 32, 180, 100 STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | DS_CENTERMOUSE -FONT 8, "MS Sans Serif" -CAPTION PROJECT_NAME +FONT 8, "MS Shell Dlg 2" +CAPTION "XSrv" BEGIN DEFPUSHBUTTON "Dismiss", IDOK, 66, 80, 50, 14 - CTEXT PROJECT_NAME, IDC_STATIC, 40, 12, 100, 8 + CTEXT "VCXSrv", IDC_STATIC, 40, 12, 100, 8 CTEXT "Disruptive screen configuration change.", IDC_STATIC, 7, 40, 166, 8 - CTEXT "Restore previous resolution to use " PROJECT_NAME ".", IDC_STATIC, 7, 52, 166, 8 + CTEXT "Restore previous resolution to use VCXSrv.", IDC_STATIC, 7, 52, 166, 8 END /* Exit */ -EXIT_DIALOG DIALOG DISCARDABLE 32, 32, 180, 78 +EXIT_DIALOG DIALOGEX 32, 32, 180, 78 STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | WS_TABSTOP | DS_CENTERMOUSE -FONT 8, "MS Sans Serif" -CAPTION PROJECT_NAME " - Exit?" +FONT 8, "MS Shell Dlg 2" +CAPTION "Exit VCXSrv?" BEGIN PUSHBUTTON "E&xit", IDOK, 55, 56, 30, 14 DEFPUSHBUTTON "&Cancel", IDCANCEL, 95, 56, 30, 14 @@ -89,14 +86,14 @@ END * Menus */ -IDM_TRAYICON_MENU MENU DISCARDABLE +IDM_TRAYICON_MENU MENU BEGIN POPUP "TRAYICON_MENU" BEGIN MENUITEM "&Hide Root Window", ID_APP_HIDE_ROOT MENUITEM "&About...", ID_APP_ABOUT MENUITEM SEPARATOR - MENUITEM "E&xit", ID_APP_EXIT + MENUITEM "E&xit...", ID_APP_EXIT END END @@ -105,5 +102,5 @@ END * Icons */ -IDI_XWIN ICON DISCARDABLE "X.ico" -IDI_XWIN_BOXED ICON DISCARDABLE "X-boxed.ico" +IDI_XWIN ICON "X.ico" +CREATEPROCESS_MANIFEST_RESOURCE_ID RT_MANIFEST "XWin.exe.manifest" diff --git a/xorg-server/hw/xwin/makefile b/xorg-server/hw/xwin/makefile new file mode 100644 index 000000000..5b409759d --- /dev/null +++ b/xorg-server/hw/xwin/makefile @@ -0,0 +1,101 @@ +LIBRARY = libXWin + +SRCS_CLIPBOARD = \ + winclipboardinit.c \ + winclipboardtextconv.c \ + winclipboardthread.c \ + winclipboardunicode.c \ + winclipboardwndproc.c \ + winclipboardwrappers.c \ + winclipboardxevents.c + +DEFINES += XWIN_CLIPBOARD + +SRCS_MULTIWINDOW = \ + winmultiwindowshape.c \ + winmultiwindowwindow.c \ + winmultiwindowwm.c \ + winmultiwindowwndproc.c + +DEFINES += XWIN_MULTIWINDOW + +SRCS_RANDR = \ + winrandr.c +DEFINES += XWIN_RANDR RELOCATE_PROJECTROOT + +CSRCS = InitInput.c \ + InitOutput.c \ + winallpriv.c \ + winauth.c \ + winblock.c \ + wincmap.c \ + winconfig.c \ + wincreatewnd.c \ + wincursor.c \ + windialogs.c \ + winengine.c \ + winerror.c \ + winglobals.c \ + winkeybd.c \ + winkeyhook.c \ + winmisc.c \ + winmouse.c \ + winmsg.c \ + winmultiwindowclass.c \ + winmultiwindowicons.c \ + winprefs.c \ + winprocarg.c \ + winregistry.c \ + winscrinit.c \ + winshaddd.c \ + winshadddnl.c \ + winshadgdi.c \ + wintrayicon.c \ + winvalargs.c \ + winwakeup.c \ + winwindow.c \ + winprefslex.c \ + winprefsyacc.c \ + winwndproc.c $(SRCS_RANDR) $(SRCS_MULTIWINDOW) $(SRCS_CLIPBOARD) + +DEFINES += YY_NO_UNISTD_H + +# XWin.rc \ +# $(top_srcdir)/Xext/dpmsstubs.c \ +# $(top_srcdir)/Xi/stubs.c \ +# $(top_srcdir)/mi/miinitext.c \ +# $(top_srcdir)/fb/fbcmap_mi.c \ +# $(SRCS_CLIPBOARD) \ +# $(SRCS_GLX_WINDOWS) \ +# $(SRCS_MULTIWINDOW) \ +# $(SRCS_MULTIWINDOWEXTWM) \ +# $(SRCS_NATIVEGDI) \ +# $(SRCS_PRIMARYFB) \ +# $(SRCS_RANDR) \ +# $(SRCS_XV) + +INCLUDES += ..\..\miext\rootless + +SRCS_NATIVEGDI = \ + winclip.c \ + winfillsp.c \ + winfont.c \ + wingc.c \ + wingetsp.c \ + winnativegdi.c \ + winpixmap.c \ + winpolyline.c \ + winpushpxl.c \ + winrop.c \ + winsetsp.c +CSRCS += $(SRCS_NATIVEGDI) +DEFINES += XWIN_NATIVEGDI + +#.rc.o: + +# $(WINDRES) --use-temp-file -i $< --input-format=rc -o $@ -O coff -I $(top_builddir)/include -DPROJECT_NAME=\"$(VENDOR_NAME_SHORT)\" -DPROJECT_VERSION=\"$(PACKAGE_VERSION)\" -DBUILD_DATE=\"$(BUILD_DATE)\" + +DEFINES += HAVE_XWIN_CONFIG_H BUILD_DATE=0-0-0000 PTW32_STATIC_LIB + +#CSRCS=winkeybd.c + diff --git a/xorg-server/hw/xwin/win.h b/xorg-server/hw/xwin/win.h index 3ab324931..62fcd83b8 100644 --- a/xorg-server/hw/xwin/win.h +++ b/xorg-server/hw/xwin/win.h @@ -103,6 +103,7 @@ #define WIN_E3B_TIMER_ID 1 #define WIN_POLLING_MOUSE_TIMER_ID 2 +#define MOUSE_POLLING_INTERVAL 50 #define WIN_E3B_OFF -1 #define WIN_FD_INVALID -1 @@ -142,6 +143,9 @@ #include <errno.h> #if defined(XWIN_MULTIWINDOWEXTWM) || defined(XWIN_CLIPBOARD) || defined(XWIN_MULTIWINDOW) #define HANDLE void * +#ifdef _MSC_VER +typedef int pid_t; +#endif #include <pthread.h> #undef HANDLE #endif @@ -314,6 +318,7 @@ typedef Bool (*winReleasePrimarySurfaceProcPtr)(ScreenPtr); typedef Bool (*winFinishCreateWindowsWindowProcPtr)(WindowPtr pWin); +typedef Bool (*winCreateScreenResourcesProc)(ScreenPtr); /* Typedef for DIX wrapper functions */ typedef int (*winDispatchProcPtr) (ClientPtr); @@ -564,6 +569,8 @@ typedef struct _winPrivScreenRec winCreatePrimarySurfaceProcPtr pwinCreatePrimarySurface; winReleasePrimarySurfaceProcPtr pwinReleasePrimarySurface; + winCreateScreenResourcesProc pwinCreateScreenResources; + #ifdef XWIN_MULTIWINDOW /* Window Procedures for MultiWindow mode */ winFinishCreateWindowsWindowProcPtr pwinFinishCreateWindowsWindow; @@ -590,6 +597,11 @@ typedef struct _winPrivScreenRec SetShapeProcPtr SetShape; #endif +#ifdef XWIN_NATIVEGDI + RealizeFontProcPtr RealizeFont; + UnrealizeFontProcPtr UnrealizeFont; +#endif + winCursorRec cursor; } winPrivScreenRec; @@ -1006,6 +1018,9 @@ winMouseButtonsHandle (ScreenPtr pScreen, int iEventType, int iButton, WPARAM wParam); +void +winEnqueueMotion(int x, int y); + #ifdef XWIN_NATIVEGDI /* * winnativegdi.c diff --git a/xorg-server/hw/xwin/winclipboard.h b/xorg-server/hw/xwin/winclipboard.h index 445c01b27..9603b92fe 100644 --- a/xorg-server/hw/xwin/winclipboard.h +++ b/xorg-server/hw/xwin/winclipboard.h @@ -34,15 +34,20 @@ #include <assert.h> #include <stdio.h> #include <stdlib.h> +#ifndef _MSC_VER #include <unistd.h> +#endif #ifdef __CYGWIN__ #include <sys/select.h> #else -#include "Xwinsock.h" +#include "X11/Xwinsock.h" #define HAS_WINSOCK #endif #include <fcntl.h> #include <setjmp.h> +#ifdef _MSC_VER +typedef int pid_t; +#endif #include <pthread.h> /* X headers */ @@ -60,8 +65,10 @@ #define ATOM DWORD #ifndef __CYGWIN__ +#ifndef sleep #define sleep(x) Sleep (1000 * (x)) #endif +#endif /* Windows headers */ #ifndef XFree86Server diff --git a/xorg-server/hw/xwin/winclipboardthread.c b/xorg-server/hw/xwin/winclipboardthread.c index 081abd5e7..0e654d267 100644 --- a/xorg-server/hw/xwin/winclipboardthread.c +++ b/xorg-server/hw/xwin/winclipboardthread.c @@ -1,5 +1,6 @@ /* *Copyright (C) 2003-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -20,12 +21,13 @@ *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. * - *Except as contained in this notice, the name of Harold L Hunt II - *shall not be used in advertising or otherwise to promote the sale, use - *or other dealings in this Software without prior written authorization - *from Harold L Hunt II. + *Except as contained in this notice, the name of the copyright holder(s) + *and author(s) shall not be used in advertising or otherwise to promote + *the sale, use or other dealings in this Software without prior written + *authorization from the copyright holder(s) and author(s). * * Authors: Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -38,6 +40,10 @@ #endif #include "X11/Xauth.h" +#ifdef _MSC_VER +#define snprintf _snprintf +#define max __max +#endif /* * Constants @@ -218,7 +224,7 @@ winClipboardProc (void *pvNotUsed) #ifdef HAS_DEVWINDOWS /* Open a file descriptor for the windows message queue */ - fdMessageQueue = open (WIN_MSG_QUEUE_FNAME, O_RDONLY); + fdMessageQueue = open (WIN_MSG_QUEUE_FNAME, _O_RDONLY); if (fdMessageQueue == -1) { ErrorF ("winClipboardProc - Failed opening %s\n", WIN_MSG_QUEUE_FNAME); @@ -231,15 +237,6 @@ winClipboardProc (void *pvNotUsed) iMaxDescriptor = iConnectionNumber + 1; #endif - /* Select event types to watch */ - if (XSelectInput (pDisplay, - DefaultRootWindow (pDisplay), - SubstructureNotifyMask | - StructureNotifyMask | - PropertyChangeMask) == BadWindow) - ErrorF ("winClipboardProc - XSelectInput generated BadWindow " - "on RootWindow\n\n"); - /* Create atoms */ atomClipboard = XInternAtom (pDisplay, "CLIPBOARD", False); atomClipboardManager = XInternAtom (pDisplay, "CLIPBOARD_MANAGER", False); @@ -258,6 +255,13 @@ winClipboardProc (void *pvNotUsed) pthread_exit (NULL); } + /* Select event types to watch */ + if (XSelectInput (pDisplay, + iWindow, + PropertyChangeMask) == BadWindow) + ErrorF ("winClipboardProc - XSelectInput generated BadWindow " + "on messaging window\n"); + /* Save the window in the screen privates */ g_iClipboardWindow = iWindow; @@ -273,7 +277,8 @@ winClipboardProc (void *pvNotUsed) /* PRIMARY */ iReturn = XSetSelectionOwner (pDisplay, XA_PRIMARY, iWindow, CurrentTime); - if (iReturn == BadAtom || iReturn == BadWindow) + if (iReturn == BadAtom || iReturn == BadWindow || + XGetSelectionOwner (pDisplay, XA_PRIMARY) != iWindow) { ErrorF ("winClipboardProc - Could not set PRIMARY owner\n"); pthread_exit (NULL); @@ -282,7 +287,8 @@ winClipboardProc (void *pvNotUsed) /* CLIPBOARD */ iReturn = XSetSelectionOwner (pDisplay, atomClipboard, iWindow, CurrentTime); - if (iReturn == BadAtom || iReturn == BadWindow) + if (iReturn == BadAtom || iReturn == BadWindow || + XGetSelectionOwner (pDisplay, atomClipboard) != iWindow) { ErrorF ("winClipboardProc - Could not set CLIPBOARD owner\n"); pthread_exit (NULL); diff --git a/xorg-server/hw/xwin/winclipboardunicode.c b/xorg-server/hw/xwin/winclipboardunicode.c index ba86915a4..531f5703a 100644 --- a/xorg-server/hw/xwin/winclipboardunicode.c +++ b/xorg-server/hw/xwin/winclipboardunicode.c @@ -43,25 +43,43 @@ Bool winClipboardDetectUnicodeSupport (void) { Bool fReturn = FALSE; - OSVERSIONINFO osvi = {0}; + OSVERSIONINFOEX osvi = {0}; /* Get operating system version information */ osvi.dwOSVersionInfoSize = sizeof (osvi); - GetVersionEx (&osvi); + GetVersionEx ((LPOSVERSIONINFO)&osvi); /* Branch on platform ID */ switch (osvi.dwPlatformId) { case VER_PLATFORM_WIN32_NT: - /* Unicode supported on NT only */ - ErrorF ("DetectUnicodeSupport - Windows NT/2000/XP\n"); - fReturn = TRUE; + if (osvi.dwMajorVersion >= 6) + { + if (osvi.wProductType == VER_NT_WORKSTATION) + ErrorF ("OS: Windows Vista\n"); + else + ErrorF ("OS: Windows Server 2008\n"); + fReturn = TRUE; + } + else if (osvi.dwMajorVersion == 5) + { + if (osvi.dwMinorVersion == 2) + { + ErrorF ("OS: Windows 2003\n"); + fReturn = TRUE; + } + else if (osvi.dwMinorVersion == 1) + { + ErrorF ("OS: Windows XP\n"); + fReturn = TRUE; + } + else if (osvi.dwMinorVersion == 0) ErrorF ("OS: Windows 2000\n"); + } + else if (osvi.dwMajorVersion <= 4) ErrorF ("OS: Windows NT\n"); break; case VER_PLATFORM_WIN32_WINDOWS: - /* Unicode is not supported on non-NT */ - ErrorF ("DetectUnicodeSupport - Windows 95/98/Me\n"); - fReturn = FALSE; + ErrorF ("OS: Windows 95/98/Me\n"); break; } diff --git a/xorg-server/hw/xwin/winclipboardwndproc.c b/xorg-server/hw/xwin/winclipboardwndproc.c index 802a74035..a69edaeca 100644 --- a/xorg-server/hw/xwin/winclipboardwndproc.c +++ b/xorg-server/hw/xwin/winclipboardwndproc.c @@ -1,5 +1,6 @@ /* *Copyright (C) 2003-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -20,12 +21,13 @@ *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. * - *Except as contained in this notice, the name of Harold L Hunt II - *shall not be used in advertising or otherwise to promote the sale, use - *or other dealings in this Software without prior written authorization - *from Harold L Hunt II. + *Except as contained in this notice, the name of the copyright holder(s) + *and author(s) shall not be used in advertising or otherwise to promote + *the sale, use or other dealings in this Software without prior written + *authorization from the copyright holder(s) and author(s). * * Authors: Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -63,7 +65,7 @@ extern HWND g_hwndClipboard; * Local function prototypes */ -static Bool +static int winProcessXEventsTimeout (HWND hwnd, int iWindow, Display *pDisplay, Bool fUseUnicode, int iTimeoutSec); @@ -260,12 +262,15 @@ winClipboardWindowProc (HWND hwnd, UINT message, case WM_DRAWCLIPBOARD: { static Bool s_fProcessingDrawClipboard = FALSE; + static Atom atomClipboard; Display *pDisplay = g_pClipboardDisplay; Window iWindow = g_iClipboardWindow; int iReturn; winDebug ("winClipboardWindowProc - WM_DRAWCLIPBOARD: Enter\n"); + if (atomClipboard == None) atomClipboard = XInternAtom (pDisplay, "CLIPBOARD", False); + /* * We've occasionally seen a loop in the clipboard chain. * Try and fix it on the first hint of recursion. @@ -353,17 +358,13 @@ winClipboardWindowProc (HWND hwnd, UINT message, /* Release CLIPBOARD selection if owned */ iReturn = XGetSelectionOwner (pDisplay, - XInternAtom (pDisplay, - "CLIPBOARD", - False)); + atomClipboard); if (iReturn == g_iClipboardWindow) { winDebug ("winClipboardWindowProc - WM_DRAWCLIPBOARD - " "CLIPBOARD selection is owned by us.\n"); XSetSelectionOwner (pDisplay, - XInternAtom (pDisplay, - "CLIPBOARD", - False), + atomClipboard, None, CurrentTime); } @@ -383,7 +384,8 @@ winClipboardWindowProc (HWND hwnd, UINT message, XA_PRIMARY, iWindow, CurrentTime); - if (iReturn == BadAtom || iReturn == BadWindow) + if (iReturn == BadAtom || iReturn == BadWindow || + XGetSelectionOwner (pDisplay, XA_PRIMARY) != iWindow) { winErrorFVerb (1, "winClipboardWindowProc - WM_DRAWCLIPBOARD - " "Could not reassert ownership of PRIMARY\n"); @@ -396,12 +398,12 @@ winClipboardWindowProc (HWND hwnd, UINT message, /* Reassert ownership of the CLIPBOARD */ iReturn = XSetSelectionOwner (pDisplay, - XInternAtom (pDisplay, - "CLIPBOARD", - False), + atomClipboard, iWindow, CurrentTime); - if (iReturn == BadAtom || iReturn == BadWindow) + + if (iReturn == BadAtom || iReturn == BadWindow || + XGetSelectionOwner (pDisplay, atomClipboard) != iWindow) { winErrorFVerb (1, "winClipboardWindowProc - WM_DRAWCLIPBOARD - " "Could not reassert ownership of CLIPBOARD\n"); diff --git a/xorg-server/hw/xwin/winclipboardwrappers.c b/xorg-server/hw/xwin/winclipboardwrappers.c index 2cfe0ffce..5578182c1 100644 --- a/xorg-server/hw/xwin/winclipboardwrappers.c +++ b/xorg-server/hw/xwin/winclipboardwrappers.c @@ -1,5 +1,6 @@ /* *Copyright (C) 2003-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -20,12 +21,13 @@ *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. * - *Except as contained in this notice, the name of Harold L Hunt II - *shall not be used in advertising or otherwise to promote the sale, use - *or other dealings in this Software without prior written authorization - *from Harold L Hunt II. + *Except as contained in this notice, the name of the copyright holder(s) + *and author(s) shall not be used in advertising or otherwise to promote + *the sale, use or other dealings in this Software without prior written + *authorization from the copyright holder(s) and author(s). * * Authors: Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -40,6 +42,7 @@ * Constants */ +#define CLIP_NUM_CALLS 4 #define CLIP_NUM_SELECTIONS 2 #define CLIP_OWN_PRIMARY 0 #define CLIP_OWN_CLIPBOARD 1 @@ -85,6 +88,8 @@ winProcQueryTree (ClientPtr client) { int iReturn; + ErrorF ("winProcQueryTree - Hello\n"); + /* * This procedure is only used for initialization. * We can unwrap the original procedure at this point @@ -184,7 +189,7 @@ winProcEstablishConnection (ClientPtr client) static int s_iCallCount = 0; static unsigned long s_ulServerGeneration = 0; - ErrorF ("winProcEstablishConnection - Hello\n"); + if (s_iCallCount == 0 || s_iCallCount == CLIP_NUM_CALLS) ErrorF ("winProcEstablishConnection - Hello\n"); /* Do nothing if clipboard is not enabled */ if (!g_fClipboard) @@ -212,13 +217,15 @@ winProcEstablishConnection (ClientPtr client) /* Increment call count */ ++s_iCallCount; - /* Wait for second call when Xdmcp is enabled */ + /* Wait for CLIP_NUM_CALLS when Xdmcp is enabled */ if (g_fXdmcpEnabled && !g_fClipboardLaunched - && s_iCallCount < 4) + && s_iCallCount < CLIP_NUM_CALLS) { - ErrorF ("winProcEstablishConnection - Xdmcp enabled, waiting to " - "start clipboard client until fourth call.\n"); + if (s_iCallCount == 1) ErrorF ("winProcEstablishConnection - Xdmcp, waiting to " + "start clipboard client until %dth call", CLIP_NUM_CALLS); + if (s_iCallCount == CLIP_NUM_CALLS - 1) ErrorF (".\n"); + else ErrorF ("."); return (*winProcEstablishConnectionOrig) (client); } @@ -275,7 +282,7 @@ winProcEstablishConnection (ClientPtr client) * 8) Unfortunately, there is another problem. * 9) XDM walks the list of windows with XQueryTree, * killing any client it finds with a window. - * 10)Thus, when using XDMCP we wait until the second call + * 10)Thus, when using XDMCP we wait until CLIP_NUM_CALLS * to ProcEstablishCeonnection before we startup the clipboard * client. This should prevent XDM from finding the clipboard * client, since it has not yet created a window. diff --git a/xorg-server/hw/xwin/winclipboardxevents.c b/xorg-server/hw/xwin/winclipboardxevents.c index d4c617bec..09bdb7396 100644 --- a/xorg-server/hw/xwin/winclipboardxevents.c +++ b/xorg-server/hw/xwin/winclipboardxevents.c @@ -1,5 +1,6 @@ /* *Copyright (C) 2003-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -20,12 +21,13 @@ *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. * - *Except as contained in this notice, the name of Harold L Hunt II - *shall not be used in advertising or otherwise to promote the sale, use - *or other dealings in this Software without prior written authorization - *from Harold L Hunt II. + *Except as contained in this notice, the name of the copyright holder(s) + *and author(s) shall not be used in advertising or otherwise to promote + *the sale, use or other dealings in this Software without prior written + *authorization from the copyright holder(s) and author(s). * * Authors: Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -51,18 +53,25 @@ winClipboardFlushXEvents (HWND hwnd, Display *pDisplay, Bool fUseUnicode) { - Atom atomLocalProperty = XInternAtom (pDisplay, - WIN_LOCAL_PROPERTY, - False); - Atom atomUTF8String = XInternAtom (pDisplay, - "UTF8_STRING", - False); - Atom atomCompoundText = XInternAtom (pDisplay, - "COMPOUND_TEXT", - False); - Atom atomTargets = XInternAtom (pDisplay, - "TARGETS", - False); + static Atom atomLocalProperty, atomCompoundText; + static Atom atomUTF8String, atomTargets; + + if (atomLocalProperty == None) + atomLocalProperty = XInternAtom (pDisplay, + WIN_LOCAL_PROPERTY, + False); + if (atomUTF8String == None) + atomUTF8String = XInternAtom (pDisplay, + "UTF8_STRING", + False); + if (atomCompoundText == None) + atomCompoundText = XInternAtom (pDisplay, + "COMPOUND_TEXT", + False); + if (atomTargets == None) + atomTargets = XInternAtom (pDisplay, + "TARGETS", + False); /* Process all pending events */ while (XPending (pDisplay)) @@ -183,6 +192,7 @@ winClipboardFlushXEvents (HWND hwnd, } /* Check that clipboard format is available */ + XLockDisplay (pDisplay); if (fUseUnicode && !IsClipboardFormatAvailable (CF_UNICODETEXT)) { @@ -190,6 +200,7 @@ winClipboardFlushXEvents (HWND hwnd, "available from Win32 clipboard. Aborting.\n"); /* Abort */ + XUnlockDisplay (pDisplay); fAbort = TRUE; goto winClipboardFlushXEvents_SelectionRequest_Done; } @@ -200,6 +211,7 @@ winClipboardFlushXEvents (HWND hwnd, "available from Win32 clipboard. Aborting.\n"); /* Abort */ + XUnlockDisplay (pDisplay); fAbort = TRUE; goto winClipboardFlushXEvents_SelectionRequest_Done; } @@ -218,6 +230,7 @@ winClipboardFlushXEvents (HWND hwnd, GetLastError ()); /* Abort */ + XUnlockDisplay (pDisplay); fAbort = TRUE; goto winClipboardFlushXEvents_SelectionRequest_Done; } @@ -259,6 +272,7 @@ winClipboardFlushXEvents (HWND hwnd, GetLastError ()); /* Abort */ + XUnlockDisplay (pDisplay); fAbort = TRUE; goto winClipboardFlushXEvents_SelectionRequest_Done; } @@ -294,6 +308,7 @@ winClipboardFlushXEvents (HWND hwnd, /* Convert DOS string to UNIX string */ winClipboardDOStoUNIX (pszConvertData, strlen (pszConvertData)); + XUnlockDisplay (pDisplay); /* Setup our text list */ pszTextList[0] = pszConvertData; @@ -301,6 +316,7 @@ winClipboardFlushXEvents (HWND hwnd, /* Initialize the text property */ xtpText.value = NULL; + xtpText.nitems = 0; /* Create the text property from the text list */ if (fUseUnicode) @@ -361,10 +377,13 @@ winClipboardFlushXEvents (HWND hwnd, /* Release the clipboard data */ GlobalUnlock (hGlobal); pszGlobalData = NULL; + fCloseClipboard = FALSE; + CloseClipboard (); /* Clean up */ XFree (xtpText.value); xtpText.value = NULL; + xtpText.nitems = 0; /* Setup selection notify event */ eventSelection.type = SelectionNotify; @@ -395,7 +414,11 @@ winClipboardFlushXEvents (HWND hwnd, winClipboardFlushXEvents_SelectionRequest_Done: /* Free allocated resources */ if (xtpText.value) + { XFree (xtpText.value); + xtpText.value = NULL; + xtpText.nitems = 0; + } if (pszConvertData) free (pszConvertData); if (hGlobal && pszGlobalData) @@ -436,7 +459,10 @@ winClipboardFlushXEvents (HWND hwnd, /* Close clipboard if it was opened */ if (fCloseClipboard) + { + fCloseClipboard = FALSE; CloseClipboard (); + } break; @@ -618,11 +644,12 @@ winClipboardFlushXEvents (HWND hwnd, /* Conversion succeeded or some unconvertible characters */ if (ppszTextList != NULL) { + iReturnDataLen = 0; for (i = 0; i < iCount; i++) { iReturnDataLen += strlen(ppszTextList[i]); } - pszReturnData = malloc (iReturnDataLen + 1); + pszReturnData = (char *) malloc (iReturnDataLen + 1); pszReturnData[0] = '\0'; for (i = 0; i < iCount; i++) { @@ -633,7 +660,7 @@ winClipboardFlushXEvents (HWND hwnd, { ErrorF ("winClipboardFlushXEvents - SelectionNotify - " "X*TextPropertyToTextList list_return is NULL.\n"); - pszReturnData = malloc (1); + pszReturnData = (char *) malloc (1); pszReturnData[0] = '\0'; } } @@ -653,7 +680,7 @@ winClipboardFlushXEvents (HWND hwnd, ErrorF ("%d", iReturn); break; } - pszReturnData = malloc (1); + pszReturnData = (char *) malloc (1); pszReturnData[0] = '\0'; } @@ -663,9 +690,11 @@ winClipboardFlushXEvents (HWND hwnd, ppszTextList = NULL; XFree (xtpText.value); xtpText.value = NULL; + xtpText.nitems = 0; /* Convert the X clipboard string to DOS format */ - winClipboardUNIXtoDOS (&pszReturnData, strlen (pszReturnData)); + XLockDisplay (pDisplay); + winClipboardUNIXtoDOS ((unsigned char **)&pszReturnData, strlen (pszReturnData)); if (fUseUnicode) { @@ -711,6 +740,8 @@ winClipboardFlushXEvents (HWND hwnd, hGlobal = GlobalAlloc (GMEM_MOVEABLE, iConvertDataLen); } + free (pszReturnData); + /* Check that global memory was allocated */ if (!hGlobal) { @@ -770,11 +801,16 @@ winClipboardFlushXEvents (HWND hwnd, */ winClipboardFlushXEvents_SelectionNotify_Done: + XUnlockDisplay (pDisplay); /* Free allocated resources */ if (ppszTextList) XFreeStringList (ppszTextList); if (xtpText.value) + { XFree (xtpText.value); + xtpText.value = NULL; + xtpText.nitems = 0; + } if (pszConvertData) free (pszConvertData); if (pwszUnicodeStr) diff --git a/xorg-server/hw/xwin/wincreatewnd.c b/xorg-server/hw/xwin/wincreatewnd.c index 796a08593..85b6cf8a9 100644 --- a/xorg-server/hw/xwin/wincreatewnd.c +++ b/xorg-server/hw/xwin/wincreatewnd.c @@ -88,7 +88,9 @@ winCreateBoundingWindowFullScreen (ScreenPtr pScreen) snprintf (szTitle, sizeof (szTitle), WINDOW_TITLE_XDMCP, - g_pszQueryHost); + g_pszQueryHost, + display, + (int) pScreenInfo->dwScreen); else snprintf (szTitle, sizeof (szTitle), @@ -331,7 +333,9 @@ winCreateBoundingWindowWindowed (ScreenPtr pScreen) snprintf (szTitle, sizeof (szTitle), WINDOW_TITLE_XDMCP, - g_pszQueryHost); + g_pszQueryHost, + display, + (int) pScreenInfo->dwScreen); else snprintf (szTitle, sizeof (szTitle), diff --git a/xorg-server/hw/xwin/wincursor.c b/xorg-server/hw/xwin/wincursor.c index 021b8b82c..0b8f7e7b2 100644 --- a/xorg-server/hw/xwin/wincursor.c +++ b/xorg-server/hw/xwin/wincursor.c @@ -99,8 +99,16 @@ winPointerWarpCursor (ScreenPtr pScreen, int x, int y) return; } - /* Only update the Windows cursor position if we are active */ - if (pScreenPriv->hwndScreen == GetForegroundWindow ()) + /* + Only update the Windows cursor position if root window is active, + or we are in a rootless mode + */ + if ((pScreenPriv->hwndScreen == GetForegroundWindow ()) + || pScreenPriv->pScreenInfo->fRootless +#ifdef XWIN_MULTIWINDOW + || pScreenPriv->pScreenInfo->fMultiWindow +#endif + ) { /* Get the client area coordinates */ GetClientRect (pScreenPriv->hwndScreen, &rcClient); @@ -601,9 +609,11 @@ winInitCursor (ScreenPtr pScreen) pPointPriv = (miPointerScreenPtr) dixLookupPrivate(&pScreen->devPrivates, miPointerScreenKey); + if (pPointPriv) + { pScreenPriv->cursor.spriteFuncs = pPointPriv->spriteFuncs; pPointPriv->spriteFuncs = &winSpriteFuncsRec; - + } pScreenPriv->cursor.handle = NULL; pScreenPriv->cursor.visible = FALSE; diff --git a/xorg-server/hw/xwin/windialogs.c b/xorg-server/hw/xwin/windialogs.c index ab06b0d00..822941e83 100644 --- a/xorg-server/hw/xwin/windialogs.c +++ b/xorg-server/hw/xwin/windialogs.c @@ -54,6 +54,10 @@ extern Bool g_fClipboardStarted; #endif extern Bool g_fSoftwareCursor; +#if defined(XWIN_MULTIWINDOW) +extern HICON g_hIconX; +extern HICON g_hSmallIconX; +#endif /* * Local function prototypes @@ -112,8 +116,8 @@ winDrawURLWindow (LPARAM lParam) crText = RGB(0,0,128+64); SetTextColor (draw->hDC, crText); - /* Create underlined font 14 high, standard dialog font */ - font = CreateFont (-14, 0, 0, 0, FW_NORMAL, FALSE, TRUE, FALSE, + /* Create font 8 high, standard dialog font */ + font = CreateFont (-8, 0, 0, 0, FW_DONTCARE, FALSE, FALSE, FALSE, 0, 0, 0, 0, 0, "MS Sans Serif"); if (!font) { @@ -181,34 +185,73 @@ winUnoverrideURLButton (HWND hwnd, int id) /* * Center a dialog window in the desktop window + * and set small and large icons to X icons. */ static void -winCenterDialog (HWND hwndDlg) +winInitDialog (HWND hwndDlg) { HWND hwndDesk; - RECT rc, rcDlg, rcDesk; - + RECT rc, rcDlg, rcDesk; + HICON hIcon, hIconSmall; + hwndDesk = GetParent (hwndDlg); if (!hwndDesk || IsIconic (hwndDesk)) hwndDesk = GetDesktopWindow (); - GetWindowRect (hwndDesk, &rcDesk); - GetWindowRect (hwndDlg, &rcDlg); - CopyRect (&rc, &rcDesk); - - OffsetRect (&rcDlg, -rcDlg.left, -rcDlg.top); - OffsetRect (&rc, -rc.left, -rc.top); - OffsetRect (&rc, -rcDlg.right, -rcDlg.bottom); - - SetWindowPos (hwndDlg, - HWND_TOP, - rcDesk.left + (rc.right / 2), - rcDesk.top + (rc.bottom / 2), - 0, 0, - SWP_NOSIZE | SWP_NOZORDER); -} + /* Remove minimize and maximize buttons */ + SetWindowLongPtr (hwndDlg, GWL_STYLE, + GetWindowLongPtr (hwndDlg, GWL_STYLE) + & ~(WS_MAXIMIZEBOX | WS_MINIMIZEBOX)); + + /* Set Window not to show in the task bar */ + SetWindowLongPtr (hwndDlg, GWL_EXSTYLE, + GetWindowLongPtr (hwndDlg, GWL_EXSTYLE) & ~WS_EX_APPWINDOW ); + + /* Center dialog window in the screen. Not done for multi-monitor systems, where + * it is likely to end up split across the screens. In that case, it appears + * near the Tray icon. + */ + if (GetSystemMetrics(SM_CMONITORS)>1) { + /* Still need to refresh the frame change. */ + SetWindowPos (hwndDlg, HWND_TOP, 0,0,0,0, + SWP_NOMOVE | SWP_NOSIZE | SWP_NOZORDER | SWP_FRAMECHANGED); + } else { + GetWindowRect (hwndDesk, &rcDesk); + GetWindowRect (hwndDlg, &rcDlg); + CopyRect (&rc, &rcDesk); + + OffsetRect (&rcDlg, -rcDlg.left, -rcDlg.top); + OffsetRect (&rc, -rc.left, -rc.top); + OffsetRect (&rc, -rcDlg.right, -rcDlg.bottom); + + SetWindowPos (hwndDlg, + HWND_TOPMOST, + rcDesk.left + (rc.right / 2), + rcDesk.top + (rc.bottom / 2), + 0, 0, + SWP_NOSIZE | SWP_FRAMECHANGED); + } +#ifdef XWIN_MULTIWINDOW + if (g_hIconX) hIcon=g_hIconX; + else +#endif + hIcon = LoadIcon (g_hInstance, MAKEINTRESOURCE(IDI_XWIN)); + +#ifdef XWIN_MULTIWINDOW + if (g_hSmallIconX) hIconSmall=g_hSmallIconX; + else +#endif + hIconSmall = LoadImage (g_hInstance, + MAKEINTRESOURCE(IDI_XWIN), IMAGE_ICON, + GetSystemMetrics(SM_CXSMICON), + GetSystemMetrics(SM_CYSMICON), + LR_SHARED); + + PostMessage (hwndDlg, WM_SETICON, ICON_BIG, (LPARAM) hIcon); + PostMessage (hwndDlg, WM_SETICON, ICON_SMALL, (LPARAM) hIconSmall); +} /* * Display the Exit dialog box @@ -220,7 +263,7 @@ winDisplayExitDialog (winPrivScreenPtr pScreenPriv) int i; int liveClients = 0; - /* Count up running clinets (clients[0] is serverClient) */ + /* Count up running clients (clients[0] is serverClient) */ for (i = 1; i < currentMaxClients; i++) if (clients[i] != NullClient) liveClients++; @@ -271,15 +314,6 @@ winDisplayExitDialog (winPrivScreenPtr pScreenPriv) winExitDlgProc, (int) pScreenPriv); - /* Drop minimize and maximize buttons */ - SetWindowLong (g_hDlgExit, GWL_STYLE, - GetWindowLong (g_hDlgExit, GWL_STYLE) - & ~(WS_MAXIMIZEBOX | WS_MINIMIZEBOX)); - SetWindowLong (g_hDlgExit, GWL_EXSTYLE, - GetWindowLong (g_hDlgExit, GWL_EXSTYLE) & ~WS_EX_APPWINDOW ); - SetWindowPos (g_hDlgExit, HWND_TOPMOST, 0, 0, 0, 0, - SWP_FRAMECHANGED | SWP_NOMOVE | SWP_NOSIZE); - /* Show the dialog box */ ShowWindow (g_hDlgExit, SW_SHOW); @@ -314,14 +348,7 @@ winExitDlgProc (HWND hDialog, UINT message, /* Store pointers to private structures for future use */ s_pScreenPriv = (winPrivScreenPtr) lParam; - winCenterDialog (hDialog); - - /* Set icon to standard app icon */ - PostMessage (hDialog, - WM_SETICON, - ICON_SMALL, - (LPARAM) LoadIcon (g_hInstance, - MAKEINTRESOURCE(IDI_XWIN))); + winInitDialog (hDialog); /* Format the connected clients string */ pszConnectedClients = Xprintf (CONNECTED_CLIENTS_FORMAT, @@ -413,17 +440,6 @@ winDisplayDepthChangeDialog (winPrivScreenPtr pScreenPriv) pScreenPriv->hwndScreen, winChangeDepthDlgProc, (int) pScreenPriv); - - /* Drop minimize and maximize buttons */ - SetWindowLong (g_hDlgDepthChange, GWL_STYLE, - GetWindowLong (g_hDlgDepthChange, GWL_STYLE) - & ~(WS_MAXIMIZEBOX | WS_MINIMIZEBOX)); - SetWindowLong (g_hDlgDepthChange, GWL_EXSTYLE, - GetWindowLong (g_hDlgDepthChange, GWL_EXSTYLE) - & ~WS_EX_APPWINDOW ); - SetWindowPos (g_hDlgDepthChange, 0, 0, 0, 0, 0, - SWP_FRAMECHANGED | SWP_NOMOVE | SWP_NOZORDER | SWP_NOSIZE); - /* Show the dialog box */ ShowWindow (g_hDlgDepthChange, SW_SHOW); @@ -480,13 +496,7 @@ winChangeDepthDlgProc (HWND hwndDialog, UINT message, s_pScreenPriv->dwLastWindowsBitsPixel); #endif - winCenterDialog( hwndDialog ); - - /* Set icon to standard app icon */ - PostMessage (hwndDialog, - WM_SETICON, - ICON_SMALL, - (LPARAM) LoadIcon (g_hInstance, MAKEINTRESOURCE(IDI_XWIN))); + winInitDialog( hwndDialog ); return TRUE; @@ -572,15 +582,6 @@ winDisplayAboutDialog (winPrivScreenPtr pScreenPriv) winAboutDlgProc, (int) pScreenPriv); - /* Drop minimize and maximize buttons */ - SetWindowLong (g_hDlgAbout, GWL_STYLE, - GetWindowLong (g_hDlgAbout, GWL_STYLE) - & ~(WS_MAXIMIZEBOX | WS_MINIMIZEBOX)); - SetWindowLong (g_hDlgAbout, GWL_EXSTYLE, - GetWindowLong (g_hDlgAbout, GWL_EXSTYLE) & ~WS_EX_APPWINDOW); - SetWindowPos (g_hDlgAbout, 0, 0, 0, 0, 0, - SWP_FRAMECHANGED | SWP_NOMOVE | SWP_NOSIZE); - /* Show the dialog box */ ShowWindow (g_hDlgAbout, SW_SHOW); @@ -622,13 +623,7 @@ winAboutDlgProc (HWND hwndDialog, UINT message, s_pScreenInfo = s_pScreenPriv->pScreenInfo; s_pScreen = s_pScreenInfo->pScreen; - winCenterDialog (hwndDialog); - - /* Set icon to standard app icon */ - PostMessage (hwndDialog, - WM_SETICON, - ICON_SMALL, - (LPARAM) LoadIcon (g_hInstance, MAKEINTRESOURCE(IDI_XWIN))); + winInitDialog (hwndDialog); /* Override the URL buttons */ winOverrideURLButton (hwndDialog, ID_ABOUT_CHANGELOG); @@ -706,7 +701,7 @@ winAboutDlgProc (HWND hwndDialog, UINT message, case ID_ABOUT_WEBSITE: { - const char * pszPath = "http://x.cygwin.com/"; + const char * pszPath = __VENDORDWEBSUPPORT__; int iReturn; iReturn = (int) ShellExecute (NULL, diff --git a/xorg-server/hw/xwin/winerror.c b/xorg-server/hw/xwin/winerror.c index 7d292134f..9c5c92ccf 100644 --- a/xorg-server/hw/xwin/winerror.c +++ b/xorg-server/hw/xwin/winerror.c @@ -33,17 +33,17 @@ #endif #ifdef XVENDORNAME #define VENDOR_STRING XVENDORNAME -#define VERSION_STRING XORG_RELEASE #define VENDOR_CONTACT BUILDERADDR #endif - +#include <../xfree86/common/xorgVersion.h> #include "win.h" /* References to external symbols */ extern char * g_pszCommandLine; extern char * g_pszLogFile; extern Bool g_fSilentFatalError; - +extern Bool g_fSilentDupError; +extern Bool g_fLogInited; #ifdef DDXOSVERRORF /* Prototype */ @@ -62,6 +62,24 @@ OsVendorVErrorF (const char *pszFormat, va_list va_args) pthread_mutex_lock (&s_pmPrinting); #endif + /* + If we want to silence it, + detect if we are going to abort due to duplication error + */ + if (g_fSilentDupError) + { + if ((strcmp(pszFormat, + "InitOutput - Duplicate invocation on display " + "number: %s. Exiting.\n") == 0) + || (strcmp(pszFormat, + "Server is already active for display %s\n%s %s\n%s\n") == 0) + || (strcmp(pszFormat, + "MakeAllCOTSServerListeners: server already running\n") == 0)) + { + g_fSilentFatalError = TRUE; + } + } + /* Print the error message to a log file, could be stderr */ LogVWrite (0, pszFormat, va_args); @@ -80,7 +98,6 @@ OsVendorVErrorF (const char *pszFormat, va_list va_args) * * Attempt to do last-ditch, safe, important cleanup here. */ -#ifdef DDXOSFATALERROR void OsVendorFatalError (void) { @@ -88,12 +105,17 @@ OsVendorFatalError (void) if (g_fSilentFatalError) return; + if (!g_fLogInited) { + g_fLogInited = TRUE; + g_pszLogFile = LogInit (g_pszLogFile, NULL); + } + LogClose (); + winMessageBoxF ( "A fatal error has occurred and " PROJECT_NAME " will now exit.\n" \ "Please open %s for more information.\n", MB_ICONERROR, (g_pszLogFile?g_pszLogFile:"the logfile")); } -#endif /* @@ -117,13 +139,15 @@ winMessageBoxF (const char *pszError, UINT uType, ...) #define MESSAGEBOXF \ "%s\n" \ "Vendor: %s\n" \ - "Release: %s\n" \ + "Release: %d.%d.%d.%d (%d)\n" \ "Contact: %s\n" \ "XWin was started with the following command-line:\n\n" \ "%s\n" pszMsgBox = Xprintf (MESSAGEBOXF, - pszErrorF, VENDOR_STRING, VERSION_STRING, VENDOR_CONTACT, + pszErrorF, VENDOR_STRING, + XORG_VERSION_MAJOR, XORG_VERSION_MINOR, XORG_VERSION_PATCH, XORG_VERSION_SNAP, BUILD_DATE, + VENDOR_CONTACT, g_pszCommandLine); if (!pszMsgBox) goto winMessageBoxF_Cleanup; diff --git a/xorg-server/hw/xwin/winglobals.c b/xorg-server/hw/xwin/winglobals.c index fddada39e..01604a8c4 100644 --- a/xorg-server/hw/xwin/winglobals.c +++ b/xorg-server/hw/xwin/winglobals.c @@ -1,5 +1,6 @@ /* *Copyright (C) 2003-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -26,6 +27,7 @@ *from Harold L Hunt II. * * Authors: Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -58,10 +60,11 @@ HWND g_hDlgExit = NULL; HWND g_hDlgAbout = NULL; const char * g_pszQueryHost = NULL; Bool g_fXdmcpEnabled = FALSE; +Bool g_fAuthEnabled = FALSE; HICON g_hIconX = NULL; HICON g_hSmallIconX = NULL; #ifndef RELOCATE_PROJECTROOT -char * g_pszLogFile = "/tmp/XWin.log"; +char * g_pszLogFile = DEFAULT_LOGDIR "/XWin.%s.log"; #else char * g_pszLogFile = "XWin.log"; Bool g_fLogFileChanged = FALSE; diff --git a/xorg-server/hw/xwin/winkeybd.c b/xorg-server/hw/xwin/winkeybd.c index d574f2053..1cd3e4cb3 100644 --- a/xorg-server/hw/xwin/winkeybd.c +++ b/xorg-server/hw/xwin/winkeybd.c @@ -49,10 +49,6 @@ static Bool g_winKeyState[NUM_KEYCODES]; -/* Stored to get internal mode key states. Must be read-only. */ -static unsigned short const *g_winInternalModeKeyStatesPtr = NULL; - - /* * Local prototypes */ @@ -84,6 +80,20 @@ winTranslateKey (WPARAM wParam, LPARAM lParam, int *piScanCode) int iKeyFixupEx = g_iKeyMap[wParam * WIN_KEYMAP_COLS + 2]; int iParamScanCode = LOBYTE (HIWORD (lParam)); +/* WM_ key messages faked by Vista speech recognition (WSR) don't have a + * scan code. + * + * Vocola 3 (Rick Mohr's supplement to WSR) uses + * System.Windows.Forms.SendKeys.SendWait(), which appears always to give a + * scan code of 1 + */ + if (iParamScanCode <= 1) + { + iParamScanCode = MapVirtualKeyEx(wParam, + /*MAPVK_VK_TO_VSC*/0, + GetKeyboardLayout(0)); + } + /* Branch on special extended, special non-extended, or normal key */ if ((HIWORD (lParam) & KF_EXTENDED) && iKeyFixupEx) *piScanCode = iKeyFixupEx; @@ -209,7 +219,6 @@ winKeybdBell (int iPercent, DeviceIntPtr pDeviceInt, static void winKeybdCtrl (DeviceIntPtr pDevice, KeybdCtrl *pCtrl) { - g_winInternalModeKeyStatesPtr = &(pDevice->key->state); } @@ -293,21 +302,23 @@ winKeybdProc (DeviceIntPtr pDeviceInt, int iState) { winErrorFVerb (1, "winKeybdProc - Error initializing keyboard AutoRepeat (No XKB)\n"); } + + XkbSetExtension(pDeviceInt, ProcessKeyboardEvent); } #endif - - g_winInternalModeKeyStatesPtr = &(pDeviceInt->key->state); break; case DEVICE_ON: pDevice->on = TRUE; - g_winInternalModeKeyStatesPtr = &(pDeviceInt->key->state); + + // immediately copy the state of this keyboard device to the VCK + // (which otherwise happens lazily after the first keypress) + SwitchCoreKeyboard(pDeviceInt); break; case DEVICE_CLOSE: case DEVICE_OFF: pDevice->on = FALSE; - g_winInternalModeKeyStatesPtr = NULL; break; } @@ -369,7 +380,7 @@ winRestoreModeKeyStates () unsigned short internalKeyStates; /* X server is being initialized */ - if (!g_winInternalModeKeyStatesPtr) + if (!inputInfo.keyboard) return; /* Only process events if the rootwindow is mapped. The keyboard events @@ -382,7 +393,9 @@ winRestoreModeKeyStates () mieqProcessInputEvents (); /* Read the mode key states of our X server */ - internalKeyStates = *g_winInternalModeKeyStatesPtr; + /* (stored in the virtual core keyboard) */ + internalKeyStates = inputInfo.keyboard->key->state; + winDebug("winRestoreModeKeyStates: state %d\n", internalKeyStates); /* * NOTE: The C XOR operator, ^, will not work here because it is @@ -580,6 +593,7 @@ winKeybdReleaseKeys () void winSendKeyEvent (DWORD dwKey, Bool fDown) { + DeviceIntPtr pDev; xEvent xCurrentEvent; /* @@ -597,7 +611,16 @@ winSendKeyEvent (DWORD dwKey, Bool fDown) xCurrentEvent.u.keyButtonPointer.time = g_c32LastInputEventTime = GetTickCount (); xCurrentEvent.u.u.detail = dwKey + MIN_KEYCODE; - mieqEnqueue (&xCurrentEvent); + +#if CYGDEBUG + ErrorF("winSendKeyEvent: xCurrentEvent.u.u.type: %d, xCurrentEvent.u.u.detail: %d\n", + xCurrentEvent.u.u.type, xCurrentEvent.u.u.detail); +#endif + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) + if ((pDev->coreEvents && pDev != inputInfo.keyboard) && pDev->key) + { + mieqEnqueue (pDev, &xCurrentEvent); + } } BOOL winCheckKeyPressed(WPARAM wParam, LPARAM lParam) diff --git a/xorg-server/hw/xwin/winkeybd.h b/xorg-server/hw/xwin/winkeybd.h index 09eed1491..d5b115736 100644 --- a/xorg-server/hw/xwin/winkeybd.h +++ b/xorg-server/hw/xwin/winkeybd.h @@ -45,6 +45,11 @@ #define WIN_KEYMAP_COLS 3 +/* ASCII column, rows 33 through 40 are for Speech Recognition with + * num-lock asserted. + * Rows 160 through 165 correspond to software-generated codes, which + * may not be associated with the appropriate scan code/extended bit + */ const int g_iKeyMap [] = { /* count Windows VK, ASCII, ASCII when extended VK */ @@ -81,14 +86,14 @@ g_iKeyMap [] = { /* 30 */ 0, 0, 0, /* 31 */ 0, 0, 0, /* 32 */ 0, 0, 0, - /* 33 */ VK_PRIOR, 0, KEY_PgUp, - /* 34 */ VK_NEXT, 0, KEY_PgDown, - /* 35 */ VK_END, 0, KEY_End, - /* 36 */ VK_HOME, 0, KEY_Home, - /* 37 */ VK_LEFT, 0, KEY_Left, - /* 38 */ VK_UP, 0, KEY_Up, - /* 39 */ VK_RIGHT, 0, KEY_Right, - /* 40 */ VK_DOWN, 0, KEY_Down, + /* 33 */ VK_PRIOR, KEY_PgUp, KEY_PgUp, + /* 34 */ VK_NEXT, KEY_PgDown, KEY_PgDown, + /* 35 */ VK_END, KEY_End, KEY_End, + /* 36 */ VK_HOME, KEY_Home, KEY_Home, + /* 37 */ VK_LEFT, KEY_Left, KEY_Left, + /* 38 */ VK_UP, KEY_Up, KEY_Up, + /* 39 */ VK_RIGHT, KEY_Right, KEY_Right, + /* 40 */ VK_DOWN, KEY_Down, KEY_Down, /* 41 */ 0, 0, 0, /* 42 */ 0, 0, 0, /* 43 */ 0, 0, 0, @@ -208,12 +213,12 @@ g_iKeyMap [] = { /* 157 */ 0, 0, 0, /* 158 */ 0, 0, 0, /* 159 */ 0, 0, 0, - /* 160 */ 0, 0, 0, - /* 161 */ 0, 0, 0, - /* 162 */ 0, 0, 0, - /* 163 */ 0, 0, 0, - /* 164 */ 0, 0, 0, - /* 165 */ 0, 0, 0, + /* 160 */ VK_LSHIFT, KEY_ShiftL, KEY_ShiftL, + /* 161 */ VK_RSHIFT, KEY_ShiftR, KEY_ShiftR, + /* 162 */ VK_LCONTROL, KEY_LCtrl, KEY_LCtrl, + /* 163 */ VK_RCONTROL, KEY_RCtrl, KEY_RCtrl, + /* 164 */ VK_LMENU, KEY_Alt, KEY_Alt, + /* 165 */ VK_RMENU, KEY_AltLang, KEY_AltLang, /* 166 */ 0, 0, 0, /* 167 */ 0, 0, 0, /* 168 */ 0, 0, 0, diff --git a/xorg-server/hw/xwin/winlayouts.h b/xorg-server/hw/xwin/winlayouts.h index cc0752430..336839453 100644 --- a/xorg-server/hw/xwin/winlayouts.h +++ b/xorg-server/hw/xwin/winlayouts.h @@ -38,34 +38,50 @@ typedef struct char *layoutname; } WinKBLayoutRec, *WinKBLayoutPtr; +/* + This table is sorted by low byte of winlayout, then by next byte, etc. +*/ + WinKBLayoutRec winKBLayouts[] = { + { 0x404, -1, "pc105", "zh_TW", NULL, NULL, "Chinese (Taiwan)"}, { 0x405, -1, "pc105", "cz", NULL, NULL, "Czech"}, {0x10405, -1, "pc105", "cz_qwerty", NULL, NULL, "Czech (QWERTY)"}, { 0x406, -1, "pc105", "dk", NULL, NULL, "Danish"}, { 0x407, -1, "pc105", "de", NULL, NULL, "German (Germany)"}, {0x10407, -1, "pc105", "de", NULL, NULL, "German (Germany, IBM)"}, - { 0x807, -1, "pc105", "de_CH", NULL, NULL, "German (Switzerland)"}, + { 0x807, -1, "pc105", "ch", "de", NULL, "German (Switzerland)"}, { 0x409, -1, "pc105", "us", NULL, NULL, "English (USA)"}, {0x10409, -1, "pc105", "dvorak", NULL, NULL, "English (USA, Dvorak)"}, {0x20409, -1, "pc105", "us_intl", NULL, NULL, "English (USA, International)"}, { 0x809, -1, "pc105", "gb", NULL, NULL, "English (United Kingdom)"}, { 0x1809, -1, "pc105", "ie", NULL, NULL, "Irish"}, { 0x40a, -1, "pc105", "es", NULL, NULL, "Spanish (Spain, Traditional Sort)"}, + { 0x80a, -1, "pc105", "la", NULL, NULL, "Latin American"}, { 0x40b, -1, "pc105", "fi", NULL, NULL, "Finnish"}, { 0x40c, -1, "pc105", "fr", NULL, NULL, "French (Standard)"}, { 0x80c, -1, "pc105", "be", NULL, NULL, "French (Belgian)"}, - { 0xc0c, -1, "pc105", "ca_enhanced", NULL, NULL, "French (Canada)"}, - { 0x100c, -1, "pc105", "fr_CH", NULL, NULL, "French (Switzerland)"}, + {0x1080c, -1, "pc105", "be", NULL, NULL, "Belgian (Comma)"}, + { 0xc0c, -1, "pc105", "ca", "fr", NULL, "French (Canada)"}, + { 0x100c, -1, "pc105", "ch", "fr", NULL, "French (Switzerland)"}, { 0x40e, -1, "pc105", "hu", NULL, NULL, "Hungarian"}, + { 0x40f, -1, "pc105", "is", NULL, NULL, "Icelandic"}, { 0x410, -1, "pc105", "it", NULL, NULL, "Italian"}, + {0x10410, -1, "pc105", "it", NULL, NULL, "Italian (142)"}, + {0xa0000410,-1, "macbook79","it", "mac",NULL, "Italiano (Apple)"}, { 0x411, 7, "jp106", "jp", NULL, NULL, "Japanese"}, + { 0x413, -1, "pc105", "nl", NULL, NULL, "Dutch"}, { 0x813, -1, "pc105", "be", NULL, NULL, "Dutch (Belgian)"}, { 0x414, -1, "pc105", "no", NULL, NULL, "Norwegian"}, + { 0x415, -1, "pc105", "pl", NULL, NULL, "Polish (Programmers)"}, { 0x416, -1, "pc105", "br", NULL, NULL, "Portuguese (Brazil, ABNT)"}, {0x10416, -1, "abnt2", "br", NULL, NULL, "Portuguese (Brazil, ABNT2)"}, { 0x816, -1, "pc105", "pt", NULL, NULL, "Portuguese (Portugal)"}, + { 0x41a, -1, "pc105", "hr", NULL, NULL, "Croatian"}, { 0x41d, -1, "pc105", "se", NULL, NULL, "Swedish (Sweden)"}, + { 0x424, -1, "pc105", "si", NULL, NULL, "Slovenian"}, + { 0x425, -1, "pc105", "ee", NULL, NULL, "Estonian"}, + { 0x452, -1, "pc105", "gb", "intl", NULL, "United Kingdom (Extended)"}, { -1, -1, NULL, NULL, NULL, NULL, NULL} }; @@ -147,6 +163,7 @@ Support ID XKB Language Finnish (with Sami) X 0x040c fr French (Standard) X 0x080c be French (Belgian) + X 0x1080c be Belgian (Comma) . 0x0c0c French (Canadian) French (Canadian, Legacy) Canadian (Multilingual) diff --git a/xorg-server/hw/xwin/winmouse.c b/xorg-server/hw/xwin/winmouse.c index 1507dd34f..d25a66524 100644 --- a/xorg-server/hw/xwin/winmouse.c +++ b/xorg-server/hw/xwin/winmouse.c @@ -36,7 +36,7 @@ #endif #include "win.h" -#if defined(XFree86Server) && defined(XINPUT) +#ifdef XINPUT #include "inputstr.h" /* Peek the internal button mapping */ @@ -106,7 +106,7 @@ winMouseProc (DeviceIntPtr pDeviceInt, int iState) 2); free(map); -#if defined(XFree86Server) && defined(XINPUT) +#ifdef XINPUT g_winMouseButtonMap = pDeviceInt->button->map; #endif break; @@ -116,7 +116,7 @@ winMouseProc (DeviceIntPtr pDeviceInt, int iState) break; case DEVICE_CLOSE: -#if defined(XFree86Server) && defined(XINPUT) +#ifdef XINPUT g_winMouseButtonMap = NULL; #endif case DEVICE_OFF: @@ -221,11 +221,12 @@ winMouseWheel (ScreenPtr pScreen, int iDeltaZ) void winMouseButtonsSendEvent (int iEventType, int iButton) { + DeviceIntPtr pDev; xEvent xCurrentEvent; /* Load an xEvent and enqueue the event */ xCurrentEvent.u.u.type = iEventType; -#if defined(XFree86Server) && defined(XINPUT) +#ifdef XINPUT if (g_winMouseButtonMap) xCurrentEvent.u.u.detail = g_winMouseButtonMap[iButton]; else @@ -233,7 +234,16 @@ winMouseButtonsSendEvent (int iEventType, int iButton) xCurrentEvent.u.u.detail = iButton; xCurrentEvent.u.keyButtonPointer.time = g_c32LastInputEventTime = GetTickCount (); - mieqEnqueue (&xCurrentEvent); + +#if CYGDEBUG + ErrorF("winMouseButtonsSendEvent: xCurrentEvent.u.u.type: %d, xCurrentEvent.u.u.detail: %d\n", + xCurrentEvent.u.u.type, xCurrentEvent.u.u.detail); +#endif + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) + if ((pDev->coreEvents && pDev != inputInfo.pointer) && pDev->button) + { + mieqEnqueue (pDev, &xCurrentEvent); + } } @@ -339,3 +349,25 @@ winMouseButtonsHandle (ScreenPtr pScreen, return 0; } + +/** + * Enqueue a motion event. + */ +void winEnqueueMotion(int x, int y) +{ + int i, nevents; + int valuators[2]; + + xEvent *events = (xEvent *)malloc(sizeof(xEvent) * GetMaximumEventsNum()); + + valuators[0] = x; + valuators[1] = y; + nevents = GetPointerEvents(events, inputInfo.pointer, MotionNotify, 0, + POINTER_ABSOLUTE, 0, 2, valuators); + + for (i = 0; i < nevents; i++) + mieqEnqueue(inputInfo.pointer, events + i); + + xfree(events); +} +// XXX: miPointerMove does exactly this, but is static :-( (and uses a static buffer) diff --git a/xorg-server/hw/xwin/winmultiwindowclass.c b/xorg-server/hw/xwin/winmultiwindowclass.c index 5b47c3976..fe81f2bd0 100644 --- a/xorg-server/hw/xwin/winmultiwindowclass.c +++ b/xorg-server/hw/xwin/winmultiwindowclass.c @@ -1,5 +1,6 @@ /* *Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -26,6 +27,7 @@ *from the XFree86 Project. * * Authors: Earle F. Philhower, III + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -263,7 +265,7 @@ winMultiWindowGetTransientFor (WindowPtr pWin, WindowPtr *ppDaddy) if (prop->propertyName == XA_WM_TRANSIENT_FOR) { if (ppDaddy) - memcpy (*ppDaddy, prop->data, sizeof (WindowPtr)); + memcpy (ppDaddy, prop->data, sizeof (WindowPtr)); return 1; } else diff --git a/xorg-server/hw/xwin/winmultiwindowicons.c b/xorg-server/hw/xwin/winmultiwindowicons.c index 45ed093ec..0d9d87ed2 100644 --- a/xorg-server/hw/xwin/winmultiwindowicons.c +++ b/xorg-server/hw/xwin/winmultiwindowicons.c @@ -36,6 +36,9 @@ #include "winmultiwindowclass.h" #include "winprefs.h" +#include "propertyst.h" +#include "windowstr.h" + /* * External global variables @@ -50,9 +53,15 @@ extern HICON g_hSmallIconX; */ static void -winScaleXBitmapToWindows (int iconSize, int effBPP, - PixmapPtr pixmap, unsigned char *image); - +winScaleIconToWindows (int iconSize, + int effBPP, + unsigned char *iconData, + unsigned short width, + unsigned short height, + int xStride, + int effXBPP, + int effXDepth, + unsigned char *image); /* * Scale an X icon bitmap into a Windoze icon bitmap @@ -64,15 +73,9 @@ winScaleXBitmapToWindows (int iconSize, PixmapPtr pixmap, unsigned char *image) { - int row, column, effXBPP, effXDepth; - unsigned char *outPtr; - unsigned char *iconData = 0; - int stride, xStride; - float factX, factY; - int posX, posY; - unsigned char *ptr; - unsigned int zero; - unsigned int color; + int effXBPP, effXDepth; + int xStride; + unsigned char *iconData = 0; effXBPP = BitsPerPixel(pixmap->drawable.depth); effXDepth = pixmap->drawable.depth; @@ -83,12 +86,10 @@ winScaleXBitmapToWindows (int iconSize, if (pixmap->drawable.depth == 15) effXDepth = 16; - /* Need 32-bit aligned rows */ - stride = ((iconSize * effBPP + 31) & (~31)) / 8; xStride = PixmapBytePad (pixmap->drawable.width, pixmap->drawable.depth); - if (stride == 0 || xStride == 0) + if (xStride == 0) { - ErrorF ("winScaleXBitmapToWindows - stride or xStride is zero. " + ErrorF ("winScaleXBitmapToWindows - xStride is zero. " "Bailing.\n"); return; } @@ -107,9 +108,54 @@ winScaleXBitmapToWindows (int iconSize, pixmap->drawable.width, pixmap->drawable.height, ZPixmap, 0xffffffff, iconData); + winScaleIconToWindows(iconSize, effBPP, + iconData, + pixmap->drawable.width, pixmap->drawable.height, + xStride, effXBPP, effXDepth, + image); + + free (iconData); +} + +/* + * Scale a drawable into a Windoze icon bitmap + */ + +static void +winScaleIconToWindows (int iconSize, + int effBPP, + unsigned char *iconData, + unsigned short width, + unsigned short height, + int xStride, + int effXBPP, + int effXDepth, + unsigned char *image) +{ + int row, column; + unsigned char *outPtr; + int stride; + float factX, factY; + int posX, posY; + unsigned char *ptr; + unsigned int zero; + unsigned int color; + + winDebug("winScaleIconToWindows: scaling from %d x %d @ %d bpp (depth %d) to %d x %d @ %d bpp\n", + width, height, effXBPP, effXDepth, iconSize, iconSize, effBPP); + + /* Need 16-bit aligned rows for DDBitmaps */ + stride = ((iconSize * effBPP + 15) & (~15)) / 8; + if (stride == 0) + { + ErrorF ("winScaleXBitmapToWindows - stride is zero. " + "Bailing.\n"); + return; + } + /* Keep aspect ratio */ - factX = ((float)pixmap->drawable.width) / ((float)iconSize); - factY = ((float)pixmap->drawable.height) / ((float)iconSize); + factX = ((float)width) / ((float)iconSize); + factY = ((float)height) / ((float)iconSize); if (factX > factY) factY = factX; else @@ -132,8 +178,8 @@ winScaleXBitmapToWindows (int iconSize, ptr += posX / 8; /* Out of X icon bounds, leave space blank */ - if (posX >= pixmap->drawable.width - || posY >= pixmap->drawable.height) + if (posX >= width + || posY >= height) ptr = (unsigned char *) &zero; if ((*ptr) & (1 << (posX & 7))) @@ -178,8 +224,8 @@ winScaleXBitmapToWindows (int iconSize, ptr += posX * (effXBPP / 8); /* Out of X icon bounds, leave space blank */ - if (posX >= pixmap->drawable.width - || posY >= pixmap->drawable.height) + if (posX >= width + || posY >= height) ptr = (unsigned char *) &zero; color = (((*ptr) << 16) + ((*(ptr + 1)) << 8) @@ -190,7 +236,7 @@ winScaleXBitmapToWindows (int iconSize, *(outPtr++) = *(ptr++); // b *(outPtr++) = *(ptr++); // g *(outPtr++) = *(ptr++); // r - *(outPtr++) = 0; // resvd + *(outPtr++) = (effXDepth == 32) ? *(ptr++) : 0x0; // alpha break; case 24: *(outPtr++) = *(ptr++); @@ -221,8 +267,8 @@ winScaleXBitmapToWindows (int iconSize, ptr += posX * (effXBPP / 8); /* Out of X icon bounds, leave space blank */ - if (posX >= pixmap->drawable.width - || posY >= pixmap->drawable.height) + if (posX >= width + || posY >= height) ptr = (unsigned char *) &zero; color = ((*ptr) << 8) + (*(ptr + 1)); switch (effBPP) @@ -257,9 +303,50 @@ winScaleXBitmapToWindows (int iconSize, } /* end if effxbpp==16) */ } /* end for column */ } /* end for row */ - free (iconData); } +static pointer +GetWindowProp(WindowPtr pWin, Atom name, long int *size_return) +{ + struct _Window *pwin; + struct _Property *prop; + + if (!pWin || !name) { + winDebug("GetWindowProp - pWin or name was NULL\n"); + return 0; + } + pwin = (struct _Window*) pWin; + if (!pwin->optional) return NULL; + for (prop = (struct _Property *) pwin->optional->userProps; + prop; + prop=prop->next){ + if (prop->propertyName == name) { + *size_return=prop->size; + return prop->data; + } + } + return NULL; +} + +static void +winScaleNetWMIconToWindows (int iconSize, + int effBPP, + uint32_t *icondata, + unsigned char *image) +{ + int height, width; + uint32_t *pixels; + + width = icondata[0]; + height = icondata[1]; + pixels = &icondata[2]; + + winScaleIconToWindows(iconSize, effBPP, + (unsigned char *)pixels, + width, height, + width*4, 32, 32, + image); +} /* * Attempt to create a custom icon from the WM_HINTS bitmaps @@ -268,7 +355,7 @@ winScaleXBitmapToWindows (int iconSize, HICON winXIconToHICON (WindowPtr pWin, int iconSize) { - unsigned char *mask, *image, *imageMask; + unsigned char *mask, *image; unsigned char *dst, *src; PixmapPtr iconPtr; PixmapPtr maskPtr; @@ -276,14 +363,12 @@ winXIconToHICON (WindowPtr pWin, int iconSize) HDC hDC; ICONINFO ii; WinXWMHints hints; - HICON hIcon; + HICON hIcon = NULL; + Bool net_wm_icon_found = FALSE; - winMultiWindowGetWMHints (pWin, &hints); - if (!hints.icon_pixmap) return NULL; - - iconPtr = (PixmapPtr) LookupIDByType (hints.icon_pixmap, RT_PIXMAP); - - if (!iconPtr) return NULL; + static Atom _XA_NET_WM_ICON = 0; + uint32_t *icon, *icon_data; + long int size=0; hDC = GetDC (GetDesktopWindow ()); planes = GetDeviceCaps (hDC, PLANES); @@ -296,38 +381,99 @@ winXIconToHICON (WindowPtr pWin, int iconSize) else effBPP = bpp; - /* Need 32-bit aligned rows */ - stride = ((iconSize * effBPP + 31) & (~31)) / 8; + /* Need 16-bit aligned rows for DDBitmaps */ + stride = ((iconSize * effBPP + 15) & (~15)) / 8; /* Mask is 1-bit deep */ - maskStride = ((iconSize * 1 + 31) & (~31)) / 8; + maskStride = ((iconSize * 1 + 15) & (~15)) / 8; - image = (unsigned char * ) malloc (stride * iconSize); - imageMask = (unsigned char *) malloc (stride * iconSize); - mask = (unsigned char *) malloc (maskStride * iconSize); - - /* Default to a completely black mask */ - memset (mask, 0, maskStride * iconSize); + if (!_XA_NET_WM_ICON) _XA_NET_WM_ICON = MakeAtom("_NET_WM_ICON", 12, FALSE); - winScaleXBitmapToWindows (iconSize, effBPP, iconPtr, image); - maskPtr = (PixmapPtr) LookupIDByType (hints.icon_mask, RT_PIXMAP); + /* Always prefer _NET_WM_ICON icons */ + icon_data = GetWindowProp(pWin, _XA_NET_WM_ICON, &size); + if (icon_data) + { + uint32_t *best_icon = 0; + unsigned int best_size = 0; + + /* + For scaling to the required size, choose the smallest icon which is + bigger than or equal to the required size, failing that, the biggest + icon which is smaller than the required size + */ + for(icon = icon_data; + icon < &icon_data[size] && *icon; + icon = &icon[icon[0]*icon[1]+2]) + { + unsigned int candidateSize = (icon[0] + icon[1])/2; + winDebug("winXIconToHICON: pWin%x found %lu x %lu NetIcon\n",(int)pWin,icon[0],icon[1]); + + if (((best_size < iconSize) && ((candidateSize > best_size) || (candidateSize >= iconSize))) + || ((best_size > iconSize) && (candidateSize >= iconSize) && (candidateSize < best_size))) + { + best_icon = icon; + best_size = candidateSize; + } + } + + if (best_icon) + { + winDebug("winXIconToHICON: pWin%x selected %lu x %lu NetIcon for scaling to %u x %u\n", + (int)pWin, best_icon[0], best_icon[1], iconSize, iconSize ); + + image = malloc (stride * iconSize); + + /* Use a completely black mask, image has alpha */ + mask = calloc (maskStride, iconSize); + + winScaleNetWMIconToWindows(iconSize, effBPP, best_icon, image); + net_wm_icon_found = TRUE; + } + else + { + winDebug("winXIconToHICON: pWin %x no %d x %d NetIcon\n",(int)pWin,iconSize,iconSize); + } + } - if (maskPtr) + if (!net_wm_icon_found) { - winScaleXBitmapToWindows (iconSize, 1, maskPtr, mask); - - winScaleXBitmapToWindows (iconSize, effBPP, maskPtr, imageMask); - - /* Now we need to set all bits of the icon which are not masked */ - /* on to 0 because Color is really an XOR, not an OR function */ - dst = image; - src = imageMask; - - for (i = 0; i < (stride * iconSize); i++) - if ((*(src++))) - *(dst++) = 0; - else - dst++; + unsigned char *imageMask; + + winMultiWindowGetWMHints (pWin, &hints); + winDebug("winXIconToHICON: pWin 0x%x icon_pixmap hint %x\n", pWin, hints.icon_pixmap); + if (!hints.icon_pixmap) return NULL; + + iconPtr = (PixmapPtr) LookupIDByType (hints.icon_pixmap, RT_PIXMAP); + winDebug("winXIconToHICON: pWin 0x%x iconPtr 0x%x\n", pWin, iconPtr); + + if (!iconPtr) return NULL; + + image = malloc (stride * iconSize); + imageMask = malloc (stride * iconSize); + /* Default to a completely black mask */ + mask = calloc (maskStride, iconSize); + + winScaleXBitmapToWindows (iconSize, effBPP, iconPtr, image); + maskPtr = (PixmapPtr) LookupIDByType (hints.icon_mask, RT_PIXMAP); + + if (maskPtr) + { + winScaleXBitmapToWindows (iconSize, 1, maskPtr, mask); + + winScaleXBitmapToWindows (iconSize, effBPP, maskPtr, imageMask); + + /* Now we need to set all bits of the icon which are not masked */ + /* on to 0 because Color is really an XOR, not an OR function */ + dst = image; + src = imageMask; + + for (i = 0; i < (stride * iconSize); i++) + if ((*(src++))) + *(dst++) = 0; + else + dst++; + } + free (imageMask); } ii.fIcon = TRUE; @@ -350,15 +496,13 @@ winXIconToHICON (WindowPtr pWin, int iconSize) /* Free X mask and bitmap */ free (mask); free (image); - free (imageMask); return hIcon; } - /* - * Change the Windows window icon + * Change the Windows window icon */ #ifdef XWIN_MULTIWINDOW @@ -366,10 +510,14 @@ void winUpdateIcon (Window id) { WindowPtr pWin; - HICON hIcon, hiconOld; + HICON hIcon, hIconSmall, hiconOld; pWin = (WindowPtr) LookupIDByType (id, RT_WINDOW); if (!pWin) return; +{ + winWindowPriv(pWin); + if (!pWinPriv->hWnd) return; + hIcon = (HICON)winOverrideIcon ((unsigned long)pWin); if (!hIcon) @@ -377,32 +525,30 @@ winUpdateIcon (Window id) if (hIcon) { - winWindowPriv(pWin); + hiconOld = (HICON) SetClassLong (pWinPriv->hWnd, + GCL_HICON, + (int) hIcon); - if (pWinPriv->hWnd) - { - hiconOld = (HICON) SetClassLong (pWinPriv->hWnd, - GCL_HICON, - (int) hIcon); - - /* Delete the icon if its not the default */ - winDestroyIcon(hiconOld); - } + /* Delete the icon if its not the default */ + if (hiconOld != g_hIconX) + winDestroyIcon(hiconOld); } - hIcon = winXIconToHICON (pWin, GetSystemMetrics(SM_CXSMICON)); - if (hIcon) - { - winWindowPriv(pWin); + hIconSmall = (HICON)winOverrideIcon ((unsigned long)pWin); + + if (!hIconSmall) + hIconSmall = winXIconToHICON (pWin, GetSystemMetrics(SM_CXSMICON)); + + if (hIconSmall) + { + hiconOld = (HICON) SetClassLong (pWinPriv->hWnd, + GCL_HICONSM, + (int) hIconSmall); + if (hiconOld != g_hSmallIconX) + winDestroyIcon (hiconOld); - if (pWinPriv->hWnd) - { - hiconOld = (HICON) SetClassLong (pWinPriv->hWnd, - GCL_HICONSM, - (int) hIcon); - winDestroyIcon (hiconOld); - } } + } } void winInitGlobalIcons (void) diff --git a/xorg-server/hw/xwin/winmultiwindowshape.c b/xorg-server/hw/xwin/winmultiwindowshape.c index 33deae337..46e392ec3 100644 --- a/xorg-server/hw/xwin/winmultiwindowshape.c +++ b/xorg-server/hw/xwin/winmultiwindowshape.c @@ -45,7 +45,6 @@ void winSetShapeMultiWindow (WindowPtr pWin) { ScreenPtr pScreen = pWin->drawable.pScreen; - winWindowPriv(pWin); winScreenPriv(pScreen); #if CYGMULTIWINDOW_DEBUG @@ -73,6 +72,9 @@ winUpdateRgnMultiWindow (WindowPtr pWin) { SetWindowRgn (winGetWindowPriv(pWin)->hWnd, winGetWindowPriv(pWin)->hRgn, TRUE); + + /* The system now owns the region specified by the region handle and delete it when it is no longer needed. */ + winGetWindowPriv(pWin)->hRgn = NULL; } @@ -209,3 +211,14 @@ winReshapeMultiWindow (WindowPtr pWin) return; } #endif + +void +winShapeRgnUpdateMultiwindow(HWND hwnd) +{ + WindowPtr pWin = GetProp (hwnd, WIN_WINDOW_PROP); + if (pWin) + { + winReshapeMultiWindow(pWin); + winUpdateRgnMultiWindow(pWin); + } +} diff --git a/xorg-server/hw/xwin/winmultiwindowwindow.c b/xorg-server/hw/xwin/winmultiwindowwindow.c index 037c881b4..c3972013c 100644 --- a/xorg-server/hw/xwin/winmultiwindowwindow.c +++ b/xorg-server/hw/xwin/winmultiwindowwindow.c @@ -1,5 +1,6 @@ /* *Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -28,6 +29,7 @@ * Authors: Kensuke Matsuzaki * Earle F. Philhower, III * Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -63,13 +65,6 @@ static void winFindWindow (pointer value, XID id, pointer cdata); /* - * Constant defines - */ - -#define MOUSE_POLLING_INTERVAL 500 - - -/* * Macros */ @@ -486,6 +481,7 @@ winCreateWindowsWindow (WindowPtr pWin) int iWidth; int iHeight; HWND hWnd; + HWND hFore = NULL; WNDCLASSEX wc; winWindowPriv(pWin); HICON hIcon; @@ -496,6 +492,7 @@ winCreateWindowsWindow (WindowPtr pWin) static int s_iWindowID = 0; winPrivScreenPtr pScreenPriv = pWinPriv->pScreenPriv; WinXSizeHints hints; + WindowPtr pDaddy; #if CYGMULTIWINDOW_DEBUG ErrorF ("winCreateWindowsWindow - pWin: %08x\n", pWin); @@ -504,20 +501,16 @@ winCreateWindowsWindow (WindowPtr pWin) iX = pWin->drawable.x + GetSystemMetrics (SM_XVIRTUALSCREEN); iY = pWin->drawable.y + GetSystemMetrics (SM_YVIRTUALSCREEN); - /* Default positions if none specified */ - if (!winMultiWindowGetWMNormalHints(pWin, &hints)) - hints.flags = 0; - if ( !(hints.flags & (USPosition|PPosition)) && - !winMultiWindowGetTransientFor (pWin, NULL) && - !pWin->overrideRedirect ) - { - iX = CW_USEDEFAULT; - iY = CW_USEDEFAULT; - } - iWidth = pWin->drawable.width; iHeight = pWin->drawable.height; + /* ensure window actually ends up somewhere visible */ + if (iX > GetSystemMetrics (SM_CXVIRTUALSCREEN)) + iX = CW_USEDEFAULT; + + if (iY > GetSystemMetrics (SM_CYVIRTUALSCREEN)) + iY = CW_USEDEFAULT; + winSelectIcons(pWin, &hIcon, &hIconSmall); /* Set standard class name prefix so we can identify window easily */ @@ -570,6 +563,28 @@ winCreateWindowsWindow (WindowPtr pWin) wc.lpszClassName = pszClass; RegisterClassEx (&wc); + if (!pWin->overrideRedirect) + { + if (winMultiWindowGetTransientFor (pWin, &pDaddy)) + { + if (pDaddy) + { + hFore = GetForegroundWindow(); + if (hFore && (pDaddy != (WindowPtr)GetProp(hFore, WIN_WID_PROP))) hFore = NULL; + } + } + else + { + /* Default positions if none specified */ + if (!winMultiWindowGetWMNormalHints(pWin, &hints)) hints.flags = 0; + if (!(hints.flags & (USPosition|PPosition))) + { + iX = CW_USEDEFAULT; + iY = CW_USEDEFAULT; + } + } + } + /* Create the window */ /* Make it OVERLAPPED in create call since WS_POPUP doesn't support */ /* CW_USEDEFAULT, change back to popup after creation */ @@ -581,7 +596,7 @@ winCreateWindowsWindow (WindowPtr pWin) iY, /* Vertical position */ iWidth, /* Right edge */ iHeight, /* Bottom edge */ - (HWND) NULL, /* No parent or owner window */ + hFore, /* Null or Parent window if transient*/ (HMENU) NULL, /* No menu */ GetModuleHandle (NULL), /* Instance handle */ pWin); /* ScreenPrivates */ diff --git a/xorg-server/hw/xwin/winmultiwindowwm.c b/xorg-server/hw/xwin/winmultiwindowwm.c index 5401ecdee..e766c42dc 100644 --- a/xorg-server/hw/xwin/winmultiwindowwm.c +++ b/xorg-server/hw/xwin/winmultiwindowwm.c @@ -1,5 +1,6 @@ /* *Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -26,6 +27,7 @@ *from the XFree86 Project. * * Authors: Kensuke Matsuzaki + * Colin Harrison */ /* X headers */ @@ -34,13 +36,18 @@ #endif #include <stdio.h> #include <stdlib.h> +#ifndef _MSC_VER #include <unistd.h> +#endif #ifdef __CYGWIN__ #include <sys/select.h> #endif #include <fcntl.h> #include <setjmp.h> #define HANDLE void * +#ifdef _MSC_VER +typedef int pid_t; +#endif #include <pthread.h> #undef HANDLE #include <X11/X.h> @@ -52,24 +59,22 @@ #include <X11/cursorfont.h> /* Windows headers */ -#ifdef __CYGWIN__ -/* Fixups to prevent collisions between Windows and X headers */ -#define ATOM DWORD - -#include <windows.h> -#else -#include <Xwindows.h> -#endif +#include <X11/Xwindows.h> /* Local headers */ #include "objbase.h" #include "ddraw.h" #include "winwindow.h" +#include "winprefs.h" +#include "window.h" +#include "windowstr.h" #ifdef XWIN_MULTIWINDOWEXTWM -#include "windowswmstr.h" +#include <X11/extensions/windowswmstr.h> #endif extern void winDebug(const char *format, ...); +extern void winReshapeMultiWindow(WindowPtr pWin); +extern void winUpdateRgnMultiWindow(WindowPtr pWin); #ifndef CYGDEBUG #define CYGDEBUG NO @@ -86,6 +91,7 @@ extern void winDebug(const char *format, ...); #endif #define WIN_JMP_OKAY 0 #define WIN_JMP_ERROR_IO 2 +#define AUTH_NAME "MIT-MAGIC-COOKIE-1" /* @@ -135,6 +141,10 @@ typedef struct _XMsgProcArgRec { extern char *display; extern void ErrorF (const char* /*f*/, ...); +#if defined(XCSECURITY) +extern unsigned int g_uiAuthDataLen; +extern char *g_pAuthData; +#endif /* @@ -151,7 +161,7 @@ static Bool InitQueue (WMMsgQueuePtr pQueue); static void -GetWindowName (Display * pDpy, Window iWin, char **ppName); +GetWindowName (Display * pDpy, Window iWin, wchar_t **ppName); static int SendXMessage (Display *pDisplay, Window iWin, Atom atmType, long nData); @@ -191,6 +201,11 @@ PreserveWin32Stack(WMInfoPtr pWMInfo, Window iWindow, UINT direction); static Bool CheckAnotherWindowManager (Display *pDisplay, DWORD dwScreen); +static void +winApplyHints (Display *pDisplay, Window iWindow, HWND hWnd, HWND *zstyle); + +void +winUpdateWindowPosition (HWND hWnd, Bool reshape, HWND *zstyle); /* * Local globals @@ -403,10 +418,12 @@ InitQueue (WMMsgQueuePtr pQueue) */ static void -GetWindowName (Display *pDisplay, Window iWin, char **ppName) +GetWindowName (Display *pDisplay, Window iWin, wchar_t **ppName) { int nResult, nNum; char **ppList; + char *pszReturnData; + int iLen, i; XTextProperty xtpName; #if CYGMULTIWINDOW_DEBUG @@ -425,38 +442,26 @@ GetWindowName (Display *pDisplay, Window iWin, char **ppName) #endif return; } - - /* */ - if (xtpName.encoding == XA_STRING) - { - /* */ - if (xtpName.value) - { - int size = xtpName.nitems * (xtpName.format >> 3); - *ppName = malloc(size + 1); - strncpy(*ppName, xtpName.value, size); - (*ppName)[size] = 0; - XFree (xtpName.value); - } -#if CYGMULTIWINDOW_DEBUG - ErrorF ("GetWindowName - XA_STRING %s\n", *ppName); -#endif - } - else - { - if (XmbTextPropertyToTextList (pDisplay, &xtpName, &ppList, &nNum) >= Success && nNum > 0 && *ppList) - { - *ppName = strdup (*ppList); - XFreeStringList (ppList); - } - XFree (xtpName.value); - -#if CYGMULTIWINDOW_DEBUG - ErrorF ("GetWindowName - %s %s\n", - XGetAtomName (pDisplay, xtpName.encoding), *ppName); -#endif - } + if (Xutf8TextPropertyToTextList (pDisplay, &xtpName, &ppList, &nNum) >= Success && nNum > 0 && *ppList) + { + iLen = 0; + for (i = 0; i < nNum; i++) iLen += strlen(ppList[i]); + pszReturnData = (char *) malloc (iLen + 1); + pszReturnData[0] = '\0'; + for (i = 0; i < nNum; i++) strcat (pszReturnData, ppList[i]); + } + else + { + pszReturnData = (char *) malloc (1); + pszReturnData[0] = '\0'; + } + iLen = MultiByteToWideChar (CP_UTF8, 0, pszReturnData, -1, NULL, 0); + *ppName = (wchar_t*)malloc(sizeof(wchar_t)*(iLen + 1)); + MultiByteToWideChar (CP_UTF8, 0, pszReturnData, -1, *ppName, iLen); + XFree (xtpName.value); + if (ppList) XFreeStringList (ppList); + free (pszReturnData); #if CYGMULTIWINDOW_DEBUG ErrorF ("GetWindowName - Returning\n"); @@ -493,7 +498,7 @@ SendXMessage (Display *pDisplay, Window iWin, Atom atmType, long nData) static void UpdateName (WMInfoPtr pWMInfo, Window iWindow) { - char *pszName; + wchar_t *pszName; Atom atmType; int fmtRet; unsigned long items, remain; @@ -537,7 +542,7 @@ UpdateName (WMInfoPtr pWMInfo, Window iWindow) &attr); if (!attr.override_redirect) { - SetWindowText (hWnd, pszName); + SetWindowTextW (hWnd, pszName); winUpdateIcon (iWindow); } @@ -705,10 +710,25 @@ winMultiWindowWMProc (void *pArg) 1); UpdateName (pWMInfo, pNode->msg.iWindow); winUpdateIcon (pNode->msg.iWindow); -#if 0 - /* Handles the case where there are AOT windows above it in W32 */ - PreserveWin32Stack (pWMInfo, pNode->msg.iWindow, GW_HWNDPREV); + { + HWND zstyle = HWND_NOTOPMOST; + winApplyHints (pWMInfo->pDisplay, pNode->msg.iWindow, pNode->msg.hwndWindow, &zstyle); + winUpdateWindowPosition (pNode->msg.hwndWindow, TRUE, &zstyle); + } + break; + + case WM_WM_MAP2: +#if CYGMULTIWINDOW_DEBUG + ErrorF ("\tWM_WM_MAP2\n"); #endif + XChangeProperty (pWMInfo->pDisplay, + pNode->msg.iWindow, + pWMInfo->atmPrivMap, + XA_INTEGER,//pWMInfo->atmPrivMap, + 32, + PropModeReplace, + (unsigned char *) &(pNode->msg.hwndWindow), + 1); break; case WM_WM_UNMAP: @@ -803,6 +823,7 @@ winMultiWindowWMProc (void *pArg) #if CYGMULTIWINDOW_DEBUG ErrorF("-winMultiWindowWMProc ()\n"); #endif + return NULL; } @@ -1063,6 +1084,7 @@ winMultiWindowXMsgProc (void *pArg) XCloseDisplay (pProcArg->pDisplay); pthread_exit (NULL); + return NULL; } @@ -1226,6 +1248,14 @@ winInitMultiWindowWM (WMInfoPtr pWMInfo, WMProcArgPtr pProcArg) /* Print the display connection string */ ErrorF ("winInitMultiWindowWM - DISPLAY=%s\n", pszDisplay); + +#if defined(XCSECURITY) + /* Use our generated cookie for authentication */ + XSetAuthorization (AUTH_NAME, + strlen (AUTH_NAME), + g_pAuthData, + g_uiAuthDataLen); +#endif /* Open the X display */ do @@ -1265,11 +1295,10 @@ winInitMultiWindowWM (WMInfoPtr pWMInfo, WMProcArgPtr pProcArg) pWMInfo->atmWmDelete = XInternAtom (pWMInfo->pDisplay, "WM_DELETE_WINDOW", False); -#ifdef XWIN_MULTIWINDOWEXTWM + pWMInfo->atmPrivMap = XInternAtom (pWMInfo->pDisplay, - WINDOWSWM_NATIVE_HWND, + "_WINDOWSWM_NATIVE_HWND", False); -#endif if (1) { @@ -1364,7 +1393,9 @@ winMultiWindowXMsgProcErrorHandler (Display *pDisplay, XErrorEvent *pErr) pErr->error_code, pszErrorMsg, sizeof (pszErrorMsg)); +#if CYGMULTIWINDOW_DEBUG ErrorF ("winMultiWindowXMsgProcErrorHandler - ERROR: %s\n", pszErrorMsg); +#endif return 0; } @@ -1438,3 +1469,205 @@ winDeinitMultiWindowWM () ErrorF ("winDeinitMultiWindowWM - Noting shutdown in progress\n"); g_shutdown = TRUE; } + +/* Windows window styles */ +#define HINT_NOFRAME (1L<<0) +#define HINT_BORDER (1L<<1) +#define HINT_SIZEBOX (1L<<2) +#define HINT_CAPTION (1L<<3) +#define HINT_NOMAXIMIZE (1L<<4) +/* These two are used on their own */ +#define HINT_MAX (1L<<0) +#define HINT_MIN (1L<<1) + +static void +winApplyHints (Display *pDisplay, Window iWindow, HWND hWnd, HWND *zstyle) +{ + static Atom windowState, motif_wm_hints, windowType; + Atom type, *pAtom = NULL; + int format; + unsigned long hint = 0, maxmin = 0, rcStyle, nitems = 0 , left = 0; + WindowPtr pWin = GetProp (hWnd, WIN_WINDOW_PROP); + MwmHints *mwm_hint = NULL; + XSizeHints *normal_hint; + long supplied; + + if (!hWnd) return; + if (!IsWindow (hWnd)) return; + + if (windowState == None) windowState = XInternAtom(pDisplay, "_NET_WM_STATE", False); + if (motif_wm_hints == None) motif_wm_hints = XInternAtom(pDisplay, "_MOTIF_WM_HINTS", False); + if (windowType == None) windowType = XInternAtom(pDisplay, "_NET_WM_WINDOW_TYPE", False); + + if (XGetWindowProperty(pDisplay, iWindow, windowState, 0L, + 1L, False, XA_ATOM, &type, &format, + &nitems, &left, (unsigned char **)&pAtom) == Success) + { + if (pAtom && nitems == 1) + { + static Atom hiddenState, fullscreenState, belowState, aboveState; + if (hiddenState == None) hiddenState = XInternAtom(pDisplay, "_NET_WM_STATE_HIDDEN", False); + if (fullscreenState == None) fullscreenState = XInternAtom(pDisplay, "_NET_WM_STATE_FULLSCREEN", False); + if (belowState == None) belowState = XInternAtom(pDisplay, "_NET_WM_STATE_BELOW", False); + if (aboveState == None) aboveState = XInternAtom(pDisplay, "_NET_WM_STATE_ABOVE", False); + if (*pAtom == hiddenState) maxmin |= HINT_MIN; + else if (*pAtom == fullscreenState) maxmin |= HINT_MAX; + if (*pAtom == belowState) *zstyle = HWND_BOTTOM; + else if (*pAtom == aboveState) *zstyle = HWND_TOPMOST; + } + if (pAtom) XFree(pAtom); + } + + nitems = left = 0; + if (XGetWindowProperty(pDisplay, iWindow, motif_wm_hints, 0L, + PropMwmHintsElements, False, motif_wm_hints, &type, &format, + &nitems, &left, (unsigned char **)&mwm_hint) == Success) + { + if (mwm_hint && nitems == PropMwmHintsElements && (mwm_hint->flags & MwmHintsDecorations)) + { + if (!mwm_hint->decorations) hint |= HINT_NOFRAME; + else if (!(mwm_hint->decorations & MwmDecorAll)) + { + if (mwm_hint->decorations & MwmDecorBorder) hint |= HINT_BORDER; + if (mwm_hint->decorations & MwmDecorHandle) hint |= HINT_SIZEBOX; + if (mwm_hint->decorations & MwmDecorTitle) hint |= HINT_CAPTION; + } + } + if (mwm_hint) XFree(mwm_hint); + } + + nitems = left = 0; + pAtom = NULL; + if (XGetWindowProperty(pDisplay, iWindow, windowType, 0L, + 1L, False, XA_ATOM, &type, &format, + &nitems, &left, (unsigned char **)&pAtom) == Success) + { + if (pAtom && nitems == 1) + { + static Atom dockWindow; + if (dockWindow == None) dockWindow = XInternAtom(pDisplay, "_NET_WM_WINDOW_TYPE_DOCK", False); + if (*pAtom == dockWindow) + { + hint = (hint & ~HINT_NOFRAME) | HINT_SIZEBOX; /* Xming puts a sizebox on dock windows */ + *zstyle = HWND_TOPMOST; + } + } + if (pAtom) XFree(pAtom); + } + + normal_hint = XAllocSizeHints(); + if (normal_hint && (XGetWMNormalHints(pDisplay, iWindow, normal_hint, &supplied) == Success)) + { + if (normal_hint->flags & PMaxSize) + { + /* Not maximizable if a maximum size is specified */ + hint |= HINT_NOMAXIMIZE; + + if (normal_hint->flags & PMinSize) + { + /* + If both minimum size and maximum size are specified and are the same, + don't bother with a resizing frame + */ + if ((normal_hint->min_width == normal_hint->max_width) + && (normal_hint->min_height == normal_hint->max_height)) + hint = (hint & ~HINT_SIZEBOX); + } + } + } + XFree(normal_hint); + + /* Apply Styles, overriding hint settings from above */ + rcStyle = winOverrideStyle((unsigned long)pWin); + if (rcStyle & STYLE_TOPMOST) *zstyle = HWND_TOPMOST; + else if (rcStyle & STYLE_MAXIMIZE) maxmin = (hint & ~HINT_MIN) | HINT_MAX; + else if (rcStyle & STYLE_MINIMIZE) maxmin = (hint & ~HINT_MAX) | HINT_MIN; + else if (rcStyle & STYLE_BOTTOM) *zstyle = HWND_BOTTOM; + + if (maxmin & HINT_MAX) SendMessage(hWnd, WM_SYSCOMMAND, SC_MAXIMIZE, 0); + else if (maxmin & HINT_MIN) SendMessage(hWnd, WM_SYSCOMMAND, SC_MINIMIZE, 0); + + if (rcStyle & STYLE_NOTITLE) + hint = (hint & ~HINT_NOFRAME & ~HINT_BORDER & ~HINT_CAPTION) | HINT_SIZEBOX; + else if (rcStyle & STYLE_OUTLINE) + hint = (hint & ~HINT_NOFRAME & ~HINT_SIZEBOX & ~HINT_CAPTION) | HINT_BORDER; + else if (rcStyle & STYLE_NOFRAME) + hint = (hint & ~HINT_BORDER & ~HINT_CAPTION & ~HINT_SIZEBOX) | HINT_NOFRAME; + + SetWindowLongPtr (hWnd, GWL_STYLE, GetWindowLongPtr(hWnd, GWL_STYLE) & ~WS_CAPTION & ~WS_SIZEBOX); /* Just in case */ + if (!hint) /* All on */ + SetWindowLongPtr (hWnd, GWL_STYLE, GetWindowLongPtr(hWnd, GWL_STYLE) | WS_CAPTION | WS_SIZEBOX); + else if (hint & HINT_NOFRAME); /* All off, so do nothing */ + else SetWindowLongPtr (hWnd, GWL_STYLE, GetWindowLongPtr(hWnd, GWL_STYLE) | + ((hint & HINT_BORDER) ? WS_BORDER : 0) | + ((hint & HINT_SIZEBOX) ? WS_SIZEBOX : 0) | + ((hint & HINT_CAPTION) ? WS_CAPTION : 0)); + + if (hint & HINT_NOMAXIMIZE) + SetWindowLongPtr(hWnd, GWL_STYLE, GetWindowLongPtr(hWnd, GWL_STYLE) & ~WS_MAXIMIZEBOX); +} + +void +winUpdateWindowPosition (HWND hWnd, Bool reshape, HWND *zstyle) +{ + int iX, iY, iWidth, iHeight; + int iDx, iDy; + RECT rcNew; + WindowPtr pWin = GetProp (hWnd, WIN_WINDOW_PROP); + DrawablePtr pDraw = NULL; + + if (!pWin) return; + pDraw = &pWin->drawable; + if (!pDraw) return; + + /* Get the X and Y location of the X window */ + iX = pWin->drawable.x + GetSystemMetrics (SM_XVIRTUALSCREEN); + iY = pWin->drawable.y + GetSystemMetrics (SM_YVIRTUALSCREEN); + + /* Get the height and width of the X window */ + iWidth = pWin->drawable.width; + iHeight = pWin->drawable.height; + + /* Setup a rectangle with the X window position and size */ + SetRect (&rcNew, iX, iY, iX + iWidth, iY + iHeight); + +#if 0 + ErrorF ("winUpdateWindowPosition - (%d, %d)-(%d, %d)\n", + rcNew.left, rcNew.top, + rcNew.right, rcNew.bottom); +#endif + + AdjustWindowRectEx (&rcNew, GetWindowLongPtr (hWnd, GWL_STYLE), FALSE, WS_EX_APPWINDOW); + + /* Don't allow window decoration to disappear off to top-left as a result of this adjustment */ + if (rcNew.left < GetSystemMetrics(SM_XVIRTUALSCREEN)) + { + iDx = GetSystemMetrics(SM_XVIRTUALSCREEN) - rcNew.left; + rcNew.left += iDx; + rcNew.right += iDx; + } + + if (rcNew.top < GetSystemMetrics(SM_YVIRTUALSCREEN)) + { + iDy = GetSystemMetrics(SM_YVIRTUALSCREEN) - rcNew.top; + rcNew.top += iDy; + rcNew.bottom += iDy; + } + +#if 0 + ErrorF ("winUpdateWindowPosition - (%d, %d)-(%d, %d)\n", + rcNew.left, rcNew.top, + rcNew.right, rcNew.bottom); +#endif + + /* Position the Windows window */ + SetWindowPos (hWnd, *zstyle, rcNew.left, rcNew.top, + rcNew.right - rcNew.left, rcNew.bottom - rcNew.top, + 0); + + if (reshape) + { + winReshapeMultiWindow(pWin); + winUpdateRgnMultiWindow(pWin); + } +} diff --git a/xorg-server/hw/xwin/winmultiwindowwndproc.c b/xorg-server/hw/xwin/winmultiwindowwndproc.c index 20ff9f7db..bfb74a092 100644 --- a/xorg-server/hw/xwin/winmultiwindowwndproc.c +++ b/xorg-server/hw/xwin/winmultiwindowwndproc.c @@ -1,5 +1,6 @@ /* *Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -28,6 +29,7 @@ * Authors: Kensuke Matsuzaki * Earle F. Philhower, III * Harold L Hunt II + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -49,6 +51,8 @@ extern Bool g_fKeyboardHookLL; extern Bool g_fSoftwareCursor; extern Bool g_fButton[3]; +extern void winUpdateWindowPosition (HWND hWnd, Bool reshape, HWND *zstyle); + /* * Local globals @@ -61,7 +65,6 @@ static UINT_PTR g_uipMousePollingTimerID = 0; * Constant defines */ -#define MOUSE_POLLING_INTERVAL 500 #define WIN_MULTIWINDOW_SHAPE YES @@ -206,6 +209,7 @@ ValidateSizing (HWND hwnd, WindowPtr pWin, WinXSizeHints sizeHints; RECT *rect; int iWidth, iHeight; + unsigned long rcStyle; /* Invalid input checking */ if (pWin==NULL || lParam==0) @@ -227,19 +231,31 @@ ValidateSizing (HWND hwnd, WindowPtr pWin, iWidth = rect->right - rect->left; iHeight = rect->bottom - rect->top; - /* Now remove size of any borders */ - iWidth -= 2 * GetSystemMetrics(SM_CXSIZEFRAME); - iHeight -= (GetSystemMetrics(SM_CYCAPTION) - + 2 * GetSystemMetrics(SM_CYSIZEFRAME)); - + /* Now remove size of any borders and title bar */ + rcStyle = GetWindowLongPtr(hwnd, GWL_STYLE); + if (rcStyle & WS_CAPTION) + { + iHeight -= GetSystemMetrics(SM_CYCAPTION); + } + if (rcStyle & WS_SIZEBOX) + { + iWidth -= 2 * GetSystemMetrics(SM_CXSIZEFRAME); + iHeight -= 2 * GetSystemMetrics(SM_CYSIZEFRAME); + } /* Constrain the size to legal values */ ConstrainSize (sizeHints, &iWidth, &iHeight); - /* Add back the borders */ - iWidth += 2 * GetSystemMetrics(SM_CXSIZEFRAME); - iHeight += (GetSystemMetrics(SM_CYCAPTION) - + 2 * GetSystemMetrics(SM_CYSIZEFRAME)); + /* Add back the size of borders and title bar */ + if (rcStyle & WS_CAPTION) + { + iHeight += GetSystemMetrics(SM_CYCAPTION); + } + if (rcStyle & WS_SIZEBOX) + { + iWidth += 2 * GetSystemMetrics(SM_CXSIZEFRAME); + iHeight += 2 * GetSystemMetrics(SM_CYSIZEFRAME); + } /* Adjust size according to where we're dragging from */ switch(wParam) { @@ -276,16 +292,30 @@ static void winRaiseWindow(WindowPtr pWin) if (!winInDestroyWindowsWindow && !winInRaiseWindow) { BOOL oldstate = winInRaiseWindow; + XID vlist[1] = { 0 }; winInRaiseWindow = TRUE; /* Call configure window directly to make sure it gets processed * in time */ - XID vlist[1] = { 0 }; ConfigureWindow(pWin, CWStackMode, vlist, serverClient); winInRaiseWindow = oldstate; } } +static +void winStartMousePolling(winPrivScreenPtr s_pScreenPriv) +{ + /* + * Timer to poll mouse position. This is needed to make + * programs like xeyes follow the mouse properly when the + * mouse pointer is outside of any X window. + */ + if (g_uipMousePollingTimerID == 0) + g_uipMousePollingTimerID = SetTimer (s_pScreenPriv->hwndScreen, + WIN_POLLING_MOUSE_TIMER_ID, + MOUSE_POLLING_INTERVAL, + NULL); +} /* * winTopLevelWindowProc - Window procedure for all top-level Windows windows. @@ -377,7 +407,9 @@ winTopLevelWindowProc (HWND hwnd, UINT message, switch (message) { case WM_CREATE: - +{ + RECT rWindow; + HRGN hRgnWindow; /* */ SetProp (hwnd, WIN_WINDOW_PROP, @@ -396,13 +428,13 @@ winTopLevelWindowProc (HWND hwnd, UINT message, winReorderWindowsMultiWindow (); /* Fix a 'round title bar corner background should be transparent not black' problem when first painted */ - RECT rWindow; - HRGN hRgnWindow; GetWindowRect(hwnd, &rWindow); hRgnWindow = CreateRectRgnIndirect(&rWindow); SetWindowRgn (hwnd, hRgnWindow, TRUE); DeleteObject(hRgnWindow); + SetWindowLongPtr(hwnd, GWLP_USERDATA, (LONG_PTR)XMING_SIGNATURE); +} return 0; case WM_INIT_SYS_MENU: @@ -535,9 +567,9 @@ winTopLevelWindowProc (HWND hwnd, UINT message, } /* Deliver absolute cursor position to X Server */ - miPointerAbsoluteCursor (ptMouse.x - s_pScreenInfo->dwXOffset, - ptMouse.y - s_pScreenInfo->dwYOffset, - g_c32LastInputEventTime = GetTickCount ()); + winEnqueueMotion(ptMouse.x - s_pScreenInfo->dwXOffset, + ptMouse.y - s_pScreenInfo->dwYOffset); + return 0; case WM_NCMOUSEMOVE: @@ -561,15 +593,8 @@ winTopLevelWindowProc (HWND hwnd, UINT message, ShowCursor (TRUE); } - /* - * Timer to poll mouse events. This is needed to make - * programs like xeyes follow the mouse properly. - */ - if (g_uipMousePollingTimerID == 0) - g_uipMousePollingTimerID = SetTimer (s_pScreenPriv->hwndScreen, - WIN_POLLING_MOUSE_TIMER_ID, - MOUSE_POLLING_INTERVAL, - NULL); + winStartMousePolling(s_pScreenPriv); + break; case WM_MOUSELEAVE: @@ -585,15 +610,8 @@ winTopLevelWindowProc (HWND hwnd, UINT message, ShowCursor (TRUE); } - /* - * Timer to poll mouse events. This is needed to make - * programs like xeyes follow the mouse properly. - */ - if (g_uipMousePollingTimerID == 0) - g_uipMousePollingTimerID = SetTimer (s_pScreenPriv->hwndScreen, - WIN_POLLING_MOUSE_TIMER_ID, - MOUSE_POLLING_INTERVAL, - NULL); + winStartMousePolling(s_pScreenPriv); + return 0; case WM_LBUTTONDBLCLK: @@ -601,12 +619,15 @@ winTopLevelWindowProc (HWND hwnd, UINT message, if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[0] = TRUE; + SetCapture(hwnd); return winMouseButtonsHandle (s_pScreen, ButtonPress, Button1, wParam); - + case WM_LBUTTONUP: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[0] = FALSE; + ReleaseCapture(); + winStartMousePolling(s_pScreenPriv); return winMouseButtonsHandle (s_pScreen, ButtonRelease, Button1, wParam); case WM_MBUTTONDBLCLK: @@ -614,47 +635,66 @@ winTopLevelWindowProc (HWND hwnd, UINT message, if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[1] = TRUE; + SetCapture(hwnd); return winMouseButtonsHandle (s_pScreen, ButtonPress, Button2, wParam); - + case WM_MBUTTONUP: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[1] = FALSE; + ReleaseCapture(); + winStartMousePolling(s_pScreenPriv); return winMouseButtonsHandle (s_pScreen, ButtonRelease, Button2, wParam); - + case WM_RBUTTONDBLCLK: case WM_RBUTTONDOWN: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[2] = TRUE; + SetCapture(hwnd); return winMouseButtonsHandle (s_pScreen, ButtonPress, Button3, wParam); - + case WM_RBUTTONUP: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; g_fButton[2] = FALSE; + ReleaseCapture(); + winStartMousePolling(s_pScreenPriv); return winMouseButtonsHandle (s_pScreen, ButtonRelease, Button3, wParam); case WM_XBUTTONDBLCLK: case WM_XBUTTONDOWN: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; + SetCapture(hwnd); return winMouseButtonsHandle (s_pScreen, ButtonPress, HIWORD(wParam) + 5, wParam); + case WM_XBUTTONUP: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; + ReleaseCapture(); + winStartMousePolling(s_pScreenPriv); return winMouseButtonsHandle (s_pScreen, ButtonRelease, HIWORD(wParam) + 5, wParam); case WM_MOUSEWHEEL: - - /* Pass the message to the root window */ - SendMessage (hwndScreen, message, wParam, lParam); - return 0; + if (SendMessage(hwnd, WM_NCHITTEST, 0, MAKELONG(GET_X_LPARAM(lParam), GET_Y_LPARAM(lParam))) == HTCLIENT) + { + /* Pass the message to the root window */ + SendMessage (hwndScreen, message, wParam, lParam); + return 0; + } + else break; case WM_SETFOCUS: if (s_pScreenPriv == NULL || s_pScreenInfo->fIgnoreInput) break; + { + /* Get the parent window for transient handling */ + HWND hParent = GetParent(hwnd); + if (hParent && IsIconic(hParent)) ShowWindow (hParent, SW_RESTORE); + } + winRestoreModeKeyStates (); /* Add the keyboard hook if possible */ @@ -668,6 +708,9 @@ winTopLevelWindowProc (HWND hwnd, UINT message, /* Remove our keyboard hook if it is installed */ winRemoveKeyboardHookLL (); + if (!wParam) + /* Revert the X focus as well, but only if the Windows focus is going to another thread */ + DeleteWindowFromAnyEvents(pWin, FALSE); return 0; case WM_SYSDEADCHAR: @@ -770,6 +813,10 @@ winTopLevelWindowProc (HWND hwnd, UINT message, if (!pWin || !pWin->overrideRedirect) /* for OOo menus */ winSendMessageToWM (s_pScreenPriv->pWMInfo, &wmMsg); } + /* Prevent the mouse wheel from stalling when another window is minimized */ + if (HIWORD(wParam) == 0 && LOWORD(wParam) == WA_ACTIVE && + (HWND)lParam != NULL && (HWND)lParam != (HWND)GetParent(hwnd)) + SetFocus(hwnd); return 0; case WM_ACTIVATEAPP: @@ -824,98 +871,57 @@ winTopLevelWindowProc (HWND hwnd, UINT message, if (!wParam) return 0; - /* Tell X to map the window */ - MapWindow (pWin, wClient(pWin)); - /* */ if (!pWin->overrideRedirect) { - DWORD dwExStyle; - DWORD dwStyle; - RECT rcNew; - int iDx, iDy; - /* Flag that this window needs to be made active when clicked */ SetProp (hwnd, WIN_NEEDMANAGE_PROP, (HANDLE) 1); - /* Get the standard and extended window style information */ - dwExStyle = GetWindowLongPtr (hwnd, GWL_EXSTYLE); - dwStyle = GetWindowLongPtr (hwnd, GWL_STYLE); - - /* */ - if (dwExStyle != WS_EX_APPWINDOW) + if (!(GetWindowLongPtr (hwnd, GWL_EXSTYLE) & WS_EX_APPWINDOW)) { - /* Setup a rectangle with the X window position and size */ - SetRect (&rcNew, - pDraw->x, - pDraw->y, - pDraw->x + pDraw->width, - pDraw->y + pDraw->height); - -#if 0 - ErrorF ("winTopLevelWindowProc - (%d, %d)-(%d, %d)\n", - rcNew.left, rcNew.top, - rcNew.right, rcNew.bottom); -#endif - - /* */ - AdjustWindowRectEx (&rcNew, - WS_POPUP | WS_SIZEBOX | WS_OVERLAPPEDWINDOW, - FALSE, - WS_EX_APPWINDOW); - - /* Calculate position deltas */ - iDx = pDraw->x - rcNew.left; - iDy = pDraw->y - rcNew.top; - - /* Calculate new rectangle */ - rcNew.left += iDx; - rcNew.right += iDx; - rcNew.top += iDy; - rcNew.bottom += iDy; - -#if 0 - ErrorF ("winTopLevelWindowProc - (%d, %d)-(%d, %d)\n", - rcNew.left, rcNew.top, - rcNew.right, rcNew.bottom); -#endif + HWND zstyle = HWND_NOTOPMOST; /* Set the window extended style flags */ SetWindowLongPtr (hwnd, GWL_EXSTYLE, WS_EX_APPWINDOW); + /* Set the transient style flags */ + if (GetParent(hwnd)) SetWindowLongPtr (hwnd, GWL_STYLE, + WS_POPUP | WS_OVERLAPPED | WS_SYSMENU | WS_CLIPCHILDREN | WS_CLIPSIBLINGS); /* Set the window standard style flags */ - SetWindowLongPtr (hwnd, GWL_STYLE, - WS_POPUP | WS_SIZEBOX | WS_OVERLAPPEDWINDOW); - - /* Position the Windows window */ - SetWindowPos (hwnd, HWND_TOP, - rcNew.left, rcNew.top, - rcNew.right - rcNew.left, rcNew.bottom - rcNew.top, - SWP_NOMOVE | SWP_FRAMECHANGED - | SWP_SHOWWINDOW | SWP_NOACTIVATE); + else SetWindowLongPtr (hwnd, GWL_STYLE, + (WS_POPUP | WS_OVERLAPPEDWINDOW | WS_CLIPCHILDREN | WS_CLIPSIBLINGS) + & ~WS_CAPTION & ~WS_SIZEBOX); - /* Bring the Windows window to the foreground */ + winUpdateWindowPosition (hwnd, FALSE, &zstyle); SetForegroundWindow (hwnd); } + wmMsg.msg = WM_WM_MAP; } else /* It is an overridden window so make it top of Z stack */ { + HWND forHwnd = GetForegroundWindow(); #if CYGWINDOWING_DEBUG ErrorF ("overridden window is shown\n"); #endif - SetWindowPos (hwnd, HWND_TOPMOST, 0, 0, 0, 0, - SWP_NOMOVE | SWP_NOSIZE | SWP_NOACTIVATE); + if (forHwnd != NULL) + { + if (GetWindowLongPtr(forHwnd, GWLP_USERDATA) & (LONG_PTR)XMING_SIGNATURE) + { + if (GetWindowLongPtr(forHwnd, GWL_EXSTYLE) & WS_EX_TOPMOST) + SetWindowPos (hwnd, HWND_TOPMOST, 0, 0, 0, 0, SWP_NOMOVE | SWP_NOSIZE | SWP_NOACTIVATE); + else + SetWindowPos (hwnd, HWND_NOTOPMOST, 0, 0, 0, 0, SWP_NOMOVE | SWP_NOSIZE | SWP_NOACTIVATE); + } + } + wmMsg.msg = WM_WM_MAP2; } - /* Setup the Window Manager message */ - wmMsg.msg = WM_WM_MAP; - wmMsg.iWidth = pDraw->width; - wmMsg.iHeight = pDraw->height; - /* Tell our Window Manager thread to map the window */ if (fWMMsgInitialized) winSendMessageToWM (s_pScreenPriv->pWMInfo, &wmMsg); + winStartMousePolling(s_pScreenPriv); + return 0; case WM_SIZING: @@ -1009,8 +1015,20 @@ winTopLevelWindowProc (HWND hwnd, UINT message, #endif /* Adjust the X Window to the moved Windows window */ winAdjustXWindow (pWin, hwnd); + if (wParam == SIZE_MINIMIZED) winReorderWindowsMultiWindow(); return 0; /* end of WM_SIZE handler */ + case WM_STYLECHANGED: + /* when the style changes, adjust the window size so the client area remains the same */ + { + LONG x,y; + DrawablePtr pDraw = &pWin->drawable; + x = pDraw->x - wBorderWidth(pWin); + y = pDraw->y - wBorderWidth(pWin); + winPositionWindowMultiWindow(pWin, x, y); + } + return 0; + case WM_MOUSEACTIVATE: /* Check if this window needs to be made active when clicked */ diff --git a/xorg-server/hw/xwin/winpolyline.c b/xorg-server/hw/xwin/winpolyline.c index db9dd345b..bf98d73ec 100644 --- a/xorg-server/hw/xwin/winpolyline.c +++ b/xorg-server/hw/xwin/winpolyline.c @@ -45,7 +45,7 @@ winPolyLineNativeGDI (DrawablePtr pDrawable, { case LineSolid: if (pGC->lineWidth == 0) - return miZeroLine (pDrawable, pGC, mode, npt, ppt); + miZeroLine (pDrawable, pGC, mode, npt, ppt); else miWideLine (pDrawable, pGC, mode, npt, ppt); break; diff --git a/xorg-server/hw/xwin/winprefs.c b/xorg-server/hw/xwin/winprefs.c index 30e587d4a..c5fd7eb08 100644 --- a/xorg-server/hw/xwin/winprefs.c +++ b/xorg-server/hw/xwin/winprefs.c @@ -1,5 +1,6 @@ /* * Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + * Copyright (C) Colin Harrison 2005-2008 * * Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -26,6 +27,7 @@ * from the XFree86 Project. * * Authors: Earle F. Philhower, III + * Colin Harrison */ #ifdef HAVE_XWIN_CONFIG_H @@ -724,7 +726,7 @@ winIconIsOverride(unsigned hiconIn) /* - * Try and open ~/.XWinrc and /usr/X11R6/lib/X11/system.XWinrc + * Try and open ~/.XWinrc and system.XWinrc * Load it into prefs structure for use by other functions */ void @@ -764,7 +766,7 @@ LoadPreferences () #ifdef RELOCATE_PROJECTROOT snprintf(buffer, sizeof(buffer), "%s\\system.XWinrc", winGetBaseDir()); #else - strncpy(buffer, PROJECTROOT"/lib/X11/system.XWinrc", sizeof(buffer)); + strncpy(buffer, SYSCONFDIR"/X11/system.XWinrc", sizeof(buffer)); #endif buffer[sizeof(buffer)-1] = 0; prefFile = fopen (buffer, "r"); @@ -820,3 +822,49 @@ LoadPreferences () } /* for all menus */ } + + +/* + * Check for a match of the window class to one specified in the + * STYLES{} section in the prefs file, and return the style type + */ +unsigned long +winOverrideStyle (unsigned long longpWin) +{ + WindowPtr pWin = (WindowPtr) longpWin; + char *res_name, *res_class; + int i; + char *wmName; + + if (pWin==NULL) + return STYLE_NONE; + + /* If we can't find the class, we can't override from default! */ + if (!winMultiWindowGetClassHint (pWin, &res_name, &res_class)) + return STYLE_NONE; + + winMultiWindowGetWMName (pWin, &wmName); + + for (i=0; i<pref.styleItems; i++) { + if (!strcmp(pref.style[i].match, res_name) || + !strcmp(pref.style[i].match, res_class) || + (wmName && strstr(wmName, pref.style[i].match))) + { + free (res_name); + free (res_class); + if (wmName) + free (wmName); + + if (pref.style[i].type) + return pref.style[i].type; + } + } + + /* Didn't find the style, fail gracefully */ + free (res_name); + free (res_class); + if (wmName) + free (wmName); + + return STYLE_NONE; +} diff --git a/xorg-server/hw/xwin/winprefs.h b/xorg-server/hw/xwin/winprefs.h index d9e09deea..996b02ade 100644 --- a/xorg-server/hw/xwin/winprefs.h +++ b/xorg-server/hw/xwin/winprefs.h @@ -2,6 +2,7 @@ #define WINPREFS_H /* * Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + * Copyright (C) Colin Harrison 2005-2008 * * Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -28,6 +29,7 @@ * from the XFree86 Project. * * Authors: Earle F. Philhower, III + * Colin Harrison */ /* Need Bool */ @@ -57,6 +59,15 @@ typedef enum MENUCOMMANDTYPE CMD_RELOAD /* Reparse the .XWINRC file */ } MENUCOMMANDTYPE; +#define STYLE_NONE (0L) /* Dummy the first entry */ +#define STYLE_NOTITLE (1L) /* Force window style no titlebar */ +#define STYLE_OUTLINE (1L<<1) /* Force window style just thin-line border */ +#define STYLE_NOFRAME (1L<<2) /* Force window style no frame */ +#define STYLE_TOPMOST (1L<<3) /* Open a window always-on-top */ +#define STYLE_MAXIMIZE (1L<<4) /* Open a window maximized */ +#define STYLE_MINIMIZE (1L<<5) /* Open a window minimized */ +#define STYLE_BOTTOM (1L<<6) /* Open a window at the bottom of the Z order */ + /* Where to place a system menu */ typedef enum MENUPOSITION { @@ -97,6 +108,13 @@ typedef struct ICONITEM unsigned long hicon; /* LoadImage() result */ } ICONITEM; +/* To redefine styles for certain window types */ +typedef struct STYLEITEM +{ + char match[MENU_MAX+1]; /* What string to search for? */ + unsigned long type; /* What should it do? */ +} STYLEITEM; + typedef struct WINPREFS { /* Menu information */ @@ -122,6 +140,9 @@ typedef struct WINPREFS ICONITEM *icon; int iconItems; + STYLEITEM *style; + int styleItems; + /* Silent exit flag */ Bool fSilentExit; @@ -155,6 +176,9 @@ unsigned long winOverrideIcon (unsigned long longpWin); unsigned long +winOverrideStyle (unsigned long longpWin); + +unsigned long winTaskbarIcon(void); unsigned long diff --git a/xorg-server/hw/xwin/winprefslex.l b/xorg-server/hw/xwin/winprefslex.l index a4c1abc3d..ee2478bcc 100644 --- a/xorg-server/hw/xwin/winprefslex.l +++ b/xorg-server/hw/xwin/winprefslex.l @@ -1,6 +1,7 @@ %{ # -*- C -*- /* * Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + * Copyright (C) Colin Harrison 2005-2008 * * Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -27,6 +28,7 @@ * from the XFree86 Project. * * Authors: Earle F. Philhower, III + * Colin Harrison */ /* $XFree86: $ */ @@ -70,6 +72,14 @@ MENU { return MENU; } ICONDIRECTORY { return ICONDIRECTORY; } DEFAULTICON { return DEFAULTICON; } ICONS { return ICONS; } +STYLES { return STYLES; } +TOPMOST { return TOPMOST; } +MAXIMIZE { return MAXIMIZE; } +MINIMIZE { return MINIMIZE; } +BOTTOM { return BOTTOM; } +NOTITLE { return NOTITLE; } +OUTLINE { return OUTLINE; } +NOFRAME { return NOFRAME; } ROOTMENU { return ROOTMENU; } DEFAULTSYSMENU { return DEFAULTSYSMENU; } SYSMENU { return SYSMENU; } diff --git a/xorg-server/hw/xwin/winprefsyacc.c b/xorg-server/hw/xwin/winprefsyacc.c index abdc681b6..131379f48 100644 --- a/xorg-server/hw/xwin/winprefsyacc.c +++ b/xorg-server/hw/xwin/winprefsyacc.c @@ -62,6 +62,9 @@ /* Tokens. */ #ifndef YYTOKENTYPE +#ifdef DEBUG +#undef DEBUG +#endif # define YYTOKENTYPE /* Put the tokens into the symbol table, so that GDB and other debuggers know about them. */ @@ -373,14 +376,14 @@ YYID (i) # ifndef YYMALLOC # define YYMALLOC malloc # if ! defined malloc && ! defined _STDLIB_H && (defined __STDC__ || defined __C99__FUNC__ \ - || defined __cplusplus || defined _MSC_VER) + || defined __cplusplus) void *malloc (YYSIZE_T); /* INFRINGES ON USER NAME SPACE */ # endif # endif # ifndef YYFREE # define YYFREE free # if ! defined free && ! defined _STDLIB_H && (defined __STDC__ || defined __C99__FUNC__ \ - || defined __cplusplus || defined _MSC_VER) + || defined __cplusplus) void free (void *); /* INFRINGES ON USER NAME SPACE */ # endif # endif diff --git a/xorg-server/hw/xwin/winprefsyacc.h b/xorg-server/hw/xwin/winprefsyacc.h index 60a879a4d..de075f50a 100644 --- a/xorg-server/hw/xwin/winprefsyacc.h +++ b/xorg-server/hw/xwin/winprefsyacc.h @@ -35,6 +35,10 @@ /* Tokens. */ #ifndef YYTOKENTYPE +#ifdef DEBUG +#undef DEBUG +#endif + # define YYTOKENTYPE /* Put the tokens into the symbol table, so that GDB and other debuggers know about them. */ diff --git a/xorg-server/hw/xwin/winprefsyacc.y b/xorg-server/hw/xwin/winprefsyacc.y index 2a54ff28f..c917d04ff 100644 --- a/xorg-server/hw/xwin/winprefsyacc.y +++ b/xorg-server/hw/xwin/winprefsyacc.y @@ -1,6 +1,7 @@ %{ /* * Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + * Copyright (C) Colin Harrison 2005-2008 * * Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -27,6 +28,7 @@ * from the XFree86 Project. * * Authors: Earle F. Philhower, III + * Colin Harrison */ /* $XFree86: $ */ @@ -41,6 +43,10 @@ /* The following give better error messages in bison at the cost of a few KB */ #define YYERROR_VERBOSE 1 +/* YYLTYPE_IS_TRIVIAL and YYENABLE_NLS defined to suppress warnings */ +#define YYLTYPE_IS_TRIVIAL 1 +#define YYENABLE_NLS 0 + /* The global pref settings */ WINPREFS pref; @@ -64,6 +70,10 @@ static void OpenIcons(void); static void AddIconLine(char *matchstr, char *iconfile); static void CloseIcons(void); +static void OpenStyles(void); +static void AddStyleLine(char *matchstr, unsigned long style); +static void CloseStyles(void); + static void OpenSysMenu(void); static void AddSysMenuLine(char *matchstr, char *menuname, int pos); static void CloseSysMenu(void); @@ -78,14 +88,19 @@ extern int yylex(void); %union { char *sVal; + unsigned long uVal; int iVal; } -%token NEWLINE MENU LB RB ICONDIRECTORY DEFAULTICON ICONS DEFAULTSYSMENU +%token NEWLINE MENU LB RB ICONDIRECTORY DEFAULTICON ICONS STYLES +%token TOPMOST MAXIMIZE MINIMIZE BOTTOM NOTITLE OUTLINE NOFRAME DEFAULTSYSMENU %token SYSMENU ROOTMENU SEPARATOR ATSTART ATEND EXEC ALWAYSONTOP DEBUG %token RELOAD TRAYICON SILENTEXIT %token <sVal> STRING +%type <uVal> group1 +%type <uVal> group2 +%type <uVal> stylecombo %type <iVal> atspot %% @@ -107,6 +122,7 @@ command: defaulticon | icondirectory | menu | icons + | styles | sysmenu | rootmenu | defaultsysmenu @@ -154,6 +170,33 @@ iconlist: iconline icons: ICONS LB {OpenIcons();} newline_or_nada iconlist RB {CloseIcons();} ; +group1: TOPMOST { $$=STYLE_TOPMOST; } + | MAXIMIZE { $$=STYLE_MAXIMIZE; } + | MINIMIZE { $$=STYLE_MINIMIZE; } + | BOTTOM { $$=STYLE_BOTTOM; } + ; + +group2: NOTITLE { $$=STYLE_NOTITLE; } + | OUTLINE { $$=STYLE_OUTLINE; } + | NOFRAME { $$=STYLE_NOFRAME; } + ; + +stylecombo: group1 { $$=$1; } + | group2 { $$=$1; } + | group1 group2 { $$=$1+$2; } + | group2 group1 { $$=$1+$2; } + ; + +styleline: STRING stylecombo NEWLINE newline_or_nada { AddStyleLine($1, $2); free($1); } + ; + +stylelist: styleline + | styleline stylelist + ; + +styles: STYLES LB {OpenStyles();} newline_or_nada stylelist RB {CloseStyles();} + ; + atspot: { $$=AT_END; } | ATSTART { $$=AT_START; } | ATEND { $$=AT_END; } @@ -316,6 +359,39 @@ CloseIcons (void) } static void +OpenStyles (void) +{ + if (pref.style != NULL) { + ErrorF("LoadPreferences: Redefining window style\n"); + free(pref.style); + pref.style = NULL; + } + pref.styleItems = 0; +} + +static void +AddStyleLine (char *matchstr, unsigned long style) +{ + if (pref.style==NULL) + pref.style = (STYLEITEM*)malloc(sizeof(STYLEITEM)); + else + pref.style = (STYLEITEM*) + realloc(pref.style, sizeof(STYLEITEM)*(pref.styleItems+1)); + + strncpy(pref.style[pref.styleItems].match, matchstr, MENU_MAX); + pref.style[pref.styleItems].match[MENU_MAX] = 0; + + pref.style[pref.styleItems].type = style; + + pref.styleItems++; +} + +static void +CloseStyles (void) +{ +} + +static void OpenSysMenu (void) { if (pref.sysMenu != NULL) { diff --git a/xorg-server/hw/xwin/winprocarg.c b/xorg-server/hw/xwin/winprocarg.c index 7139cbaab..9271da02b 100644 --- a/xorg-server/hw/xwin/winprocarg.c +++ b/xorg-server/hw/xwin/winprocarg.c @@ -1,6 +1,7 @@ /* Copyright 1993, 1998 The Open Group +Copyright (C) Colin Harrison 2005-2008 Permission to use, copy, modify, distribute, and sell this software and its documentation for any purpose is hereby granted without fee, provided that @@ -31,9 +32,9 @@ from The Open Group. #endif #ifdef XVENDORNAME #define VENDOR_STRING XVENDORNAME -#define VERSION_STRING XORG_RELEASE #define VENDOR_CONTACT BUILDERADDR #endif +#include <../xfree86/common/xorgVersion.h> #include "win.h" #include "winconfig.h" #include "winprefs.h" @@ -57,6 +58,7 @@ extern char * g_pszLogFile; extern Bool g_fLogFileChanged; #endif extern Bool g_fXdmcpEnabled; +extern Bool g_fAuthEnabled; extern char * g_pszCommandLine; extern Bool g_fKeyboardHookLL; extern Bool g_fNoHelpMessageBox; @@ -1289,6 +1291,29 @@ ddxProcessArgument (int argc, char *argv[], int i) } /* + * Look for the '-auth' argument + */ + if (IS_OPTION ("-auth")) + { +#ifdef __MINGW32__ + HANDLE hFile; + char * pszFile; + CHECK_ARGS (1); + pszFile = argv[++i]; + hFile = CreateFile(pszFile,GENERIC_READ,FILE_SHARE_READ,NULL,OPEN_EXISTING,FILE_ATTRIBUTE_NORMAL,NULL); + if (hFile == INVALID_HANDLE_VALUE) + winMessageBoxF ("This authorization file for the -auth option could not be opened...\n" + "\"%s\"\n" + "You should use an \"Xauthority\" file in your HOME directory.\n" + "\nIgnoring and continuing.\n", + MB_ICONINFORMATION, + pszFile); +#endif + g_fAuthEnabled = TRUE; + return 0; /* Let DIX parse this again */ + } + + /* * Look for the '-indirect' or '-broadcast' arguments */ if (IS_OPTION ("-indirect") @@ -1459,13 +1484,13 @@ winLogCommandLine (int argc, char *argv[]) for (i = 0, iCurrLen = 0; i < argc; ++i) if (argv[i]) { - /* Add a character for lines that overflow */ + /* Adds two characters for lines that overflow */ if ((strlen (argv[i]) < CHARS_PER_LINE && iCurrLen + strlen (argv[i]) > CHARS_PER_LINE) || strlen (argv[i]) > CHARS_PER_LINE) { iCurrLen = 0; - ++iSize; + iSize += 2; } /* Add space for item and trailing space */ @@ -1525,8 +1550,8 @@ winLogVersionInfo (void) ErrorF ("Welcome to the XWin X Server\n"); ErrorF ("Vendor: %s\n", VENDOR_STRING); - ErrorF ("Release: %s\n\n", VERSION_STRING); - ErrorF ("Contact: %s\n\n", VENDOR_CONTACT); + ErrorF ("Release: %d.%d.%d.%d (%d)\n", XORG_VERSION_MAJOR, XORG_VERSION_MINOR, XORG_VERSION_PATCH, XORG_VERSION_SNAP, BUILD_DATE); + ErrorF ("Contact: %s\n", VENDOR_CONTACT); } /* diff --git a/xorg-server/hw/xwin/winresource.h b/xorg-server/hw/xwin/winresource.h index 5aa884030..7085117e6 100644 --- a/xorg-server/hw/xwin/winresource.h +++ b/xorg-server/hw/xwin/winresource.h @@ -37,7 +37,6 @@ #define IDC_STATIC -1 #define IDI_XWIN 101 -#define IDI_XWIN_BOXED 102 #define IDM_TRAYICON_MENU 103 #define IDC_CLIENTS_CONNECTED 104 diff --git a/xorg-server/hw/xwin/winscrinit.c b/xorg-server/hw/xwin/winscrinit.c index 9dc4c3da5..5cc3925c7 100644 --- a/xorg-server/hw/xwin/winscrinit.c +++ b/xorg-server/hw/xwin/winscrinit.c @@ -37,7 +37,6 @@ #endif #include "win.h" #include "winmsg.h" -#include "safeAlpha.h" #ifdef XWIN_MULTIWINDOWEXTWM @@ -142,7 +141,7 @@ winScreenInit (int index, } /* Adjust the video mode for our engine type */ - if (!(*pScreenPriv->pwinAdjustVideoMode) (pScreen)) + if (pScreenPriv->pwinAdjustVideoMode && !(*pScreenPriv->pwinAdjustVideoMode) (pScreen)) { ErrorF ("winScreenInit - winAdjustVideoMode () failed\n"); return FALSE; @@ -176,7 +175,7 @@ winScreenInit (int index, } /* Create display window */ - if (!(*pScreenPriv->pwinCreateBoundingWindow) (pScreen)) + if (pScreenPriv->pwinCreateBoundingWindow && !(*pScreenPriv->pwinCreateBoundingWindow) (pScreen)) { ErrorF ("winScreenInit - pwinCreateBoundingWindow () " "failed\n"); @@ -227,7 +226,7 @@ winScreenInit (int index, pScreenInfo->dwBPP); /* Call the engine dependent screen initialization procedure */ - if (!((*pScreenPriv->pwinFinishScreenInit) (index, pScreen, argc, argv))) + if (pScreenPriv->pwinFinishScreenInit && !((*pScreenPriv->pwinFinishScreenInit) (index, pScreen, argc, argv))) { ErrorF ("winScreenInit - winFinishScreenInit () failed\n"); return FALSE; @@ -245,6 +244,25 @@ winScreenInit (int index, return TRUE; } +static Bool +winCreateScreenResources(ScreenPtr pScreen) +{ + winScreenPriv(pScreen); + Bool result; + + result = pScreenPriv->pwinCreateScreenResources(pScreen); + + /* Now the screen bitmap has been wrapped in a pixmap, + add that to the Shadow framebuffer */ + if (!shadowAdd(pScreen, pScreen->devPrivate, + pScreenPriv->pwinShadowUpdate, NULL, 0, 0)) + { + ErrorF ("winCreateScreenResources - shadowAdd () failed\n"); + return FALSE; + } + + return result; +} /* See Porting Layer Definition - p. 20 */ Bool @@ -360,22 +378,6 @@ winFinishScreenInitFB (int index, pScreen->blockData = pScreen; pScreen->wakeupData = pScreen; -#ifdef XWIN_MULTIWINDOWEXTWM - /* - * Setup acceleration for multi-window external window manager mode. - * To be compatible with the Damage extension, this must be done - * before calling miDCInitialize, which calls DamageSetup. - */ - if (pScreenInfo->fMWExtWM) - { - if (!RootlessAccelInit (pScreen)) - { - ErrorF ("winFinishScreenInitFB - RootlessAccelInit () failed\n"); - return FALSE; - } - } -#endif - #ifdef RENDER /* Render extension initialization, calls miPictureInit */ if (!fbPictureInit (pScreen, NULL, 0)) @@ -428,15 +430,18 @@ winFinishScreenInitFB (int index, ) { #if CYGDEBUG - winDebug ("winFinishScreenInitFB - Calling shadowInit ()\n"); + winDebug ("winFinishScreenInitFB - Calling shadowSetup ()\n"); #endif - if (!shadowInit (pScreen, - pScreenPriv->pwinShadowUpdate, - NULL)) + if (!shadowSetup(pScreen)) { - ErrorF ("winFinishScreenInitFB - shadowInit () failed\n"); + ErrorF ("winFinishScreenInitFB - shadowSetup () failed\n"); return FALSE; } + + /* Wrap CreateScreenResources so we can add the screen pixmap + to the Shadow framebuffer after it's been created */ + pScreenPriv->pwinCreateScreenResources = pScreen->CreateScreenResources; + pScreen->CreateScreenResources = winCreateScreenResources; } #ifdef XWIN_MULTIWINDOWEXTWM diff --git a/xorg-server/hw/xwin/winshaddd.c b/xorg-server/hw/xwin/winshaddd.c index a2c1dc9b0..96acfcbc7 100644 --- a/xorg-server/hw/xwin/winshaddd.c +++ b/xorg-server/hw/xwin/winshaddd.c @@ -48,10 +48,12 @@ extern HWND g_hDlgExit; * FIXME: Headers are broken, DEFINE_GUID doesn't work correctly, * so we have to redefine it here. */ +#ifndef _MSC_VER #ifdef DEFINE_GUID #undef DEFINE_GUID #define DEFINE_GUID(n,l,w1,w2,b1,b2,b3,b4,b5,b6,b7,b8) const GUID n GUID_SECT = {l,w1,w2,{b1,b2,b3,b4,b5,b6,b7,b8}} #endif /* DEFINE_GUID */ +#endif /* @@ -361,7 +363,7 @@ winAllocateFBShadowDD (ScreenPtr pScreen) { ErrorF ("winAllocateFBShadowDD - Changing video mode\n"); - /* Change the video mode to the mode requested */ + /* Change the video mode to the mode requested, and use the driver default refresh rate on failure */ ddrval = IDirectDraw2_SetDisplayMode (pScreenPriv->pdd2, pScreenInfo->dwWidth, pScreenInfo->dwHeight, @@ -373,7 +375,20 @@ winAllocateFBShadowDD (ScreenPtr pScreen) ErrorF ("winAllocateFBShadowDD - Could not set "\ "full screen display mode: %08x\n", (unsigned int) ddrval); - return FALSE; + ErrorF ("winAllocateFBShadowDD - Using default driver refresh rate\n"); + ddrval = IDirectDraw2_SetDisplayMode (pScreenPriv->pdd2, + pScreenInfo->dwWidth, + pScreenInfo->dwHeight, + pScreenInfo->dwBPP, + 0, + 0); + if (FAILED(ddrval)) + { + ErrorF ("winAllocateFBShadowDD - Could not set default refresh rate " + "full screen display mode: %08x\n", + (unsigned int) ddrval); + return FALSE; + } } } else @@ -508,7 +523,7 @@ winShadowUpdateDD (ScreenPtr pScreen, { winScreenPriv(pScreen); winScreenInfo *pScreenInfo = pScreenPriv->pScreenInfo; - RegionPtr damage = &pBuf->damage; + RegionPtr damage = shadowDamage(pBuf); HRESULT ddrval = DD_OK; RECT rcDest, rcSrc; POINT ptOrigin; @@ -534,7 +549,7 @@ winShadowUpdateDD (ScreenPtr pScreen, ddrval = IDirectDrawSurface2_Unlock (pScreenPriv->pddsShadow, NULL); if (FAILED (ddrval)) { - ErrorF ("winShadowUpdateProcDD - Unlock failed\n"); + ErrorF ("winShadowUpdateDD - Unlock failed\n"); return; } @@ -626,19 +641,20 @@ winShadowUpdateDD (ScreenPtr pScreen, NULL); if (FAILED (ddrval)) { - ErrorF ("winShadowUpdateProcDD - Lock failed\n"); + ErrorF ("winShadowUpdateDD - Lock failed\n"); return; } /* Has our memory pointer changed? */ if (pScreenInfo->pfb != pScreenPriv->pddsdShadow->lpSurface) { - ErrorF ("winShadowUpdateProcDD - Memory location of the shadow " + extern char *g_pszLogFile; + ErrorF ("winShadowUpdateDD - Memory location of the shadow " "surface has changed, trying to update the root window " "pixmap header to point to the new address. If you get " "this message and "PROJECT_NAME" freezes or crashes " "after this message then send a problem report and your " - "/tmp/XWin.log file to cygwin-xfree@cygwin.com\n"); + "%s file to " BUILDERADDR, g_pszLogFile); /* Location of shadow framebuffer has changed */ pScreenInfo->pfb = pScreenPriv->pddsdShadow->lpSurface; @@ -653,7 +669,7 @@ winShadowUpdateDD (ScreenPtr pScreen, pScreenInfo->dwBPP), pScreenInfo->pfb)) { - ErrorF ("winShadowUpdateProcDD - Bits changed, could not " + ErrorF ("winShadowUpdateDD - Bits changed, could not " "notify fb.\n"); return; } diff --git a/xorg-server/hw/xwin/winshadddnl.c b/xorg-server/hw/xwin/winshadddnl.c index 47cc382e9..e029154ed 100644 --- a/xorg-server/hw/xwin/winshadddnl.c +++ b/xorg-server/hw/xwin/winshadddnl.c @@ -48,10 +48,12 @@ extern HWND g_hDlgExit; * FIXME: Headers are broken, DEFINE_GUID doesn't work correctly, * so we have to redefine it here. */ +#ifndef _MSC_VER #ifdef DEFINE_GUID #undef DEFINE_GUID #define DEFINE_GUID(n,l,w1,w2,b1,b2,b3,b4,b5,b6,b7,b8) const GUID n GUID_SECT = {l,w1,w2,{b1,b2,b3,b4,b5,b6,b7,b8}} #endif /* DEFINE_GUID */ +#endif /* * FIXME: Headers are broken, IID_IDirectDraw4 has to be defined @@ -391,7 +393,7 @@ winAllocateFBShadowDDNL (ScreenPtr pScreen) { winDebug ("winAllocateFBShadowDDNL - Changing video mode\n"); - /* Change the video mode to the mode requested */ + /* Change the video mode to the mode requested, and use the driver default refresh rate on failure */ ddrval = IDirectDraw4_SetDisplayMode (pScreenPriv->pdd4, pScreenInfo->dwWidth, pScreenInfo->dwHeight, @@ -403,7 +405,20 @@ winAllocateFBShadowDDNL (ScreenPtr pScreen) ErrorF ("winAllocateFBShadowDDNL - Could not set " "full screen display mode: %08x\n", (unsigned int) ddrval); - return FALSE; + ErrorF ("winAllocateFBShadowDDNL - Using default driver refresh rate\n"); + ddrval = IDirectDraw4_SetDisplayMode (pScreenPriv->pdd4, + pScreenInfo->dwWidth, + pScreenInfo->dwHeight, + pScreenInfo->dwBPP, + 0, + 0); + if (FAILED(ddrval)) + { + ErrorF ("winAllocateFBShadowDDNL - Could not set default refresh rate " + "full screen display mode: %08x\n", + (unsigned int) ddrval); + return FALSE; + } } } else @@ -584,7 +599,7 @@ winShadowUpdateDDNL (ScreenPtr pScreen, { winScreenPriv(pScreen); winScreenInfo *pScreenInfo = pScreenPriv->pScreenInfo; - RegionPtr damage = &pBuf->damage; + RegionPtr damage = shadowDamage(pBuf); HRESULT ddrval = DD_OK; RECT rcDest, rcSrc; POINT ptOrigin; @@ -1310,7 +1325,7 @@ winStoreColorsShadowDDNL (ColormapPtr pColormap, + pdefs[0].pixel); if (FAILED (ddrval)) { - ErrorF ("winStoreColorsShadowDDNL - SetEntries () failed: %08x\n", ddrval); + ErrorF ("winStoreColorsShadowDDNL - SetEntries () failed: %08x\n", (int) ddrval); return FALSE; } diff --git a/xorg-server/hw/xwin/winshadgdi.c b/xorg-server/hw/xwin/winshadgdi.c index 04cc2f716..d38e4f76b 100644 --- a/xorg-server/hw/xwin/winshadgdi.c +++ b/xorg-server/hw/xwin/winshadgdi.c @@ -498,7 +498,7 @@ winShadowUpdateGDI (ScreenPtr pScreen, { winScreenPriv(pScreen); winScreenInfo *pScreenInfo = pScreenPriv->pScreenInfo; - RegionPtr damage = &pBuf->damage; + RegionPtr damage = shadowDamage(pBuf); DWORD dwBox = REGION_NUM_RECTS (damage); BoxPtr pBox = REGION_RECTS (damage); int x, y, w, h; diff --git a/xorg-server/hw/xwin/winwin32rootless.c b/xorg-server/hw/xwin/winwin32rootless.c index 6f4e2c97e..2c80c0885 100644 --- a/xorg-server/hw/xwin/winwin32rootless.c +++ b/xorg-server/hw/xwin/winwin32rootless.c @@ -38,7 +38,7 @@ #include "win.h" #include <winuser.h> #define _WINDOWSWM_SERVER_ -#include "windowswmstr.h" +#include <X11/extensions/windowswmstr.h> #include "dixevents.h" #include "winmultiwindowclass.h" #include "winprefs.h" @@ -48,9 +48,6 @@ /* * Constant defines */ - -#define MOUSE_POLLING_INTERVAL 500 - #define ULW_COLORKEY 0x00000001 #define ULW_ALPHA 0x00000002 #define ULW_OPAQUE 0x00000004 diff --git a/xorg-server/hw/xwin/winwin32rootlesswndproc.c b/xorg-server/hw/xwin/winwin32rootlesswndproc.c index 859aafd29..3d16ae5c9 100644 --- a/xorg-server/hw/xwin/winwin32rootlesswndproc.c +++ b/xorg-server/hw/xwin/winwin32rootlesswndproc.c @@ -35,7 +35,7 @@ #include "win.h" #include <winuser.h> #define _WINDOWSWM_SERVER_ -#include "windowswmstr.h" +#include <X11/extensions/windowswmstr.h> #include "dixevents.h" #include "propertyst.h" #include <X11/Xatom.h> @@ -48,7 +48,6 @@ * Constant defines */ -#define MOUSE_POLLING_INTERVAL 500 #define MOUSE_ACTIVATE_DEFAULT TRUE #define RAISE_ON_CLICK_DEFAULT FALSE @@ -567,9 +566,9 @@ winMWExtWMWindowProc (HWND hwnd, UINT message, } /* Deliver absolute cursor position to X Server */ - miPointerAbsoluteCursor (ptMouse.x - pScreenInfo->dwXOffset, - ptMouse.y - pScreenInfo->dwYOffset, - g_c32LastInputEventTime = GetTickCount ()); + winEnqueueMotion(ptMouse.x - pScreenInfo->dwXOffset, + ptMouse.y - pScreenInfo->dwYOffset); + return 0; case WM_NCMOUSEMOVE: diff --git a/xorg-server/hw/xwin/winwindow.c b/xorg-server/hw/xwin/winwindow.c index 1600996df..54afe9f7e 100644 --- a/xorg-server/hw/xwin/winwindow.c +++ b/xorg-server/hw/xwin/winwindow.c @@ -60,6 +60,7 @@ winReshapeRootless (WindowPtr pWin); Bool winCreateWindowNativeGDI (WindowPtr pWin) { + Bool fResult; ScreenPtr pScreen = pWin->drawable.pScreen; winWindowPriv(pWin); winScreenPriv(pScreen); @@ -352,7 +353,6 @@ winPositionWindowRootless (WindowPtr pWin, int x, int y) { Bool fResult = FALSE; ScreenPtr pScreen = pWin->drawable.pScreen; - winWindowPriv(pWin); winScreenPriv(pScreen); @@ -378,7 +378,6 @@ winChangeWindowAttributesRootless (WindowPtr pWin, unsigned long mask) { Bool fResult = FALSE; ScreenPtr pScreen = pWin->drawable.pScreen; - winWindowPriv(pWin); winScreenPriv(pScreen); #if CYGDEBUG @@ -436,7 +435,6 @@ winMapWindowRootless (WindowPtr pWin) { Bool fResult = FALSE; ScreenPtr pScreen = pWin->drawable.pScreen; - winWindowPriv(pWin); winScreenPriv(pScreen); #if CYGDEBUG @@ -462,7 +460,6 @@ void winSetShapeRootless (WindowPtr pWin) { ScreenPtr pScreen = pWin->drawable.pScreen; - winWindowPriv(pWin); winScreenPriv(pScreen); #if CYGDEBUG diff --git a/xorg-server/hw/xwin/winwindow.h b/xorg-server/hw/xwin/winwindow.h index 9c49d6482..71c5b015e 100644 --- a/xorg-server/hw/xwin/winwindow.h +++ b/xorg-server/hw/xwin/winwindow.h @@ -2,6 +2,7 @@ #define _WINWINDOW_H_ /* *Copyright (C) 1994-2000 The XFree86 Project, Inc. All Rights Reserved. + *Copyright (C) Colin Harrison 2005-2008 * *Permission is hereby granted, free of charge, to any person obtaining * a copy of this software and associated documentation files (the @@ -28,6 +29,7 @@ *from the XFree86 Project. * * Authors: Kensuke Matsuzaki + * Colin Harrison */ #ifndef NO @@ -42,8 +44,8 @@ # define PROJECT_NAME "Cygwin/X" #endif #define WINDOW_CLASS "cygwin/x" -#define WINDOW_TITLE PROJECT_NAME " - %s:%d" -#define WINDOW_TITLE_XDMCP PROJECT_NAME " - %s" +#define WINDOW_TITLE PROJECT_NAME ":%s.%d" +#define WINDOW_TITLE_XDMCP "%s:%s.%d" #define WIN_SCR_PROP "cyg_screen_prop rl" #define WINDOW_CLASS_X "cygwin/x X rl" #define WINDOW_TITLE_X PROJECT_NAME " X" @@ -60,6 +62,8 @@ #define CYGWINDOWING_DEBUG NO #endif +#define XMING_SIGNATURE 0x12345678L + typedef struct _winPrivScreenRec *winPrivScreenPtr; @@ -111,9 +115,24 @@ typedef struct _winWMMessageRec{ #define WM_WM_NAME_EVENT (WM_USER + 9) #define WM_WM_HINTS_EVENT (WM_USER + 10) #define WM_WM_CHANGE_STATE (WM_USER + 11) +#define WM_WM_MAP2 (WM_USER + 12) #define WM_MANAGE (WM_USER + 100) #define WM_UNMANAGE (WM_USER + 102) +#define MwmHintsDecorations (1L << 1) + +#define MwmDecorAll (1l << 0) +#define MwmDecorBorder (1l << 1) +#define MwmDecorHandle (1l << 2) +#define MwmDecorTitle (1l << 3) + +/* This structure only contains 3 elements... the Motif 2.0 structure +contains 5... we only need the first 3... so that is all we will define */ +typedef struct MwmHints { + unsigned long flags, functions, decorations; +} MwmHints; +#define PropMwmHintsElements 3 + void winSendMessageToWM (void *pWMInfo, winWMMessagePtr msg); diff --git a/xorg-server/hw/xwin/winwindowswm.c b/xorg-server/hw/xwin/winwindowswm.c index e1994de84..6a0b81232 100644 --- a/xorg-server/hw/xwin/winwindowswm.c +++ b/xorg-server/hw/xwin/winwindowswm.c @@ -42,7 +42,7 @@ SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. #include "servermd.h" #include "swaprep.h" #define _WINDOWSWM_SERVER_ -#include "windowswmstr.h" +#include <X11/extensions/windowswmstr.h> static int WMErrorBase; diff --git a/xorg-server/hw/xwin/winwndproc.c b/xorg-server/hw/xwin/winwndproc.c index 29ea81fc1..c553634f9 100644 --- a/xorg-server/hw/xwin/winwndproc.c +++ b/xorg-server/hw/xwin/winwndproc.c @@ -762,11 +762,11 @@ winWindowProc (HWND hwnd, UINT message, g_fCursor = TRUE; ShowCursor (TRUE); } - + /* Deliver absolute cursor position to X Server */ - miPointerAbsoluteCursor (GET_X_LPARAM(lParam)-s_pScreenInfo->dwXOffset, - GET_Y_LPARAM(lParam)-s_pScreenInfo->dwYOffset, - g_c32LastInputEventTime = GetTickCount ()); + winEnqueueMotion(GET_X_LPARAM(lParam)-s_pScreenInfo->dwXOffset, + GET_Y_LPARAM(lParam)-s_pScreenInfo->dwYOffset); + return 0; case WM_NCMOUSEMOVE: @@ -927,10 +927,9 @@ winWindowProc (HWND hwnd, UINT message, /* Map from screen (-X, -Y) to root (0, 0) */ point.x -= GetSystemMetrics (SM_XVIRTUALSCREEN); point.y -= GetSystemMetrics (SM_YVIRTUALSCREEN); - + /* Deliver absolute cursor position to X Server */ - miPointerAbsoluteCursor (point.x, point.y, - g_c32LastInputEventTime = GetTickCount()); + winEnqueueMotion(point.x , point.y); /* Check if a button was released but we didn't see it */ GetCursorPos (&point); diff --git a/xorg-server/hw/xwin/xlaunch/config.h b/xorg-server/hw/xwin/xlaunch/config.h new file mode 100644 index 000000000..e2774e894 --- /dev/null +++ b/xorg-server/hw/xwin/xlaunch/config.h @@ -0,0 +1,76 @@ +/* + * Copyright (c) 2005 Alexander Gottwald + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in + * all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE ABOVE LISTED COPYRIGHT HOLDER(S) BE LIABLE FOR ANY CLAIM, DAMAGES OR + * OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, + * ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + * Except as contained in this notice, the name(s) of the above copyright + * holders shall not be used in advertising or otherwise to promote the sale, + * use or other dealings in this Software without prior written authorization. + * + * Authors: Alexander Gottwald, Colin Harrison + */ +#ifndef __CONFIG_H__ +#define __CONFIG_H__ +#define UNICODE +#define _UNICODE + +#define PROG_NUMBER 10 +#define HOST_NUMBER 10 +#define MAX_MESSAGE 256 +#define MAX_CAPTION 128 + +#include <windows.h> +#include <string> +#include <vector> +struct CConfig +{ + enum {MultiWindow, Fullscreen, Windowed, Nodecoration} window; + enum {NoClient, StartProgram, XDMCP} client; + enum {NoXClient, Local, PuTTY, OpenSSH} clientstart; + std::string display; + std::string protocol_path; + std::string program; + std::vector<std::string> progs; + bool compress; + bool local; + std::string protocol; + std::string host; + std::string user; + std::string password; + bool password_save; + bool password_start; + bool broadcast; + bool indirect; + std::string xdmcp_host; + std::vector<std::string> xhosts; + bool clipboard; + bool no_access_control; + std::string font_server; + std::string extra_params; + std::string extra_ssh; + CConfig() : window(MultiWindow), client(NoClient), clientstart(NoXClient), display(""), + protocol_path(""), program("xeyes"), progs(PROG_NUMBER), compress(false), host(""), user(""), + password(""), password_save(false), password_start(false), broadcast(false), + indirect(false), xdmcp_host(""), xhosts(HOST_NUMBER), clipboard(true), no_access_control(false), + font_server(), extra_params(), extra_ssh() {}; + void Load(const char * filename); + void Save(const char * filename); +}; + +#endif diff --git a/xorg-server/hw/xwin/xlaunch/main.cc b/xorg-server/hw/xwin/xlaunch/main.cc index 2247d3aaf..e4be475ee 100644 --- a/xorg-server/hw/xwin/xlaunch/main.cc +++ b/xorg-server/hw/xwin/xlaunch/main.cc @@ -34,6 +34,10 @@ #include <X11/Xlib.h> +#ifdef _MSC_VER +#define snprintf _snprintf +#endif + /// @brief Send WM_ENDSESSION to all program windows. /// This will shutdown the started xserver BOOL CALLBACK KillWindowsProc(HWND hwnd, LPARAM lParam) @@ -489,7 +493,7 @@ class CMyWizard : public CWizard return NULL; } - /// @brief Do the actual start of Xming and clients + /// @brief Do the actual start of VCXsrv and clients void StartUp() { std::string buffer; @@ -500,12 +504,12 @@ class CMyWizard : public CWizard std::string display = "localhost" + display_id + ":0"; #ifdef _DEBUG - // Debug only: Switch to Xming installation directory - SetCurrentDirectory("C:\\Programme\\Xming"); + // Debug only: Switch to VCXsrv installation directory + SetCurrentDirectory("C:\\Programme\\vcxsrv"); #endif - // Build Xming commandline - buffer = "Xming " + display_id + " "; + // Build Xsrv commandline + buffer = "vcxsrv " + display_id + " "; switch (config.window) { case CConfig::MultiWindow: @@ -577,7 +581,7 @@ class CMyWizard : public CWizard sic.cb = sizeof(sic); ZeroMemory( &pic, sizeof(pic) ); - // Start Xming process. + // Start VCXsrv process. #ifdef _DEBUG printf("%s\n", buffer.c_str()); #endif @@ -627,7 +631,7 @@ class CMyWizard : public CWizard #ifdef _DEBUG printf("killing process!\n"); #endif - // Check if Xming is still running + // Check if Xsrv is still running DWORD exitcode; GetExitCodeProcess(pi.hProcess, &exitcode); unsigned counter = 0; @@ -636,7 +640,7 @@ class CMyWizard : public CWizard if (++counter > 10) TerminateProcess(pi.hProcess, (DWORD)-1); else - // Shutdown Xming (the soft way!) + // Shutdown Xsrv (the soft way!) EnumThreadWindows(pi.dwThreadId, KillWindowsProc, 0); Sleep(500); GetExitCodeProcess(pi.hProcess, &exitcode); diff --git a/xorg-server/hw/xwin/xlaunch/makefile b/xorg-server/hw/xwin/xlaunch/makefile new file mode 100644 index 000000000..345357d92 --- /dev/null +++ b/xorg-server/hw/xwin/xlaunch/makefile @@ -0,0 +1,32 @@ +INCLUDELIBFILES = window\$(OBJDIR)\window.lib \
+ $(MHMAKECONF)\libx11\src\$(OBJDIR)\libx11.lib \
+ $(MHMAKECONF)\libxcb\src\$(OBJDIR)\libxcb.lib \
+ $(MHMAKECONF)\libxau\$(OBJDIR)\libxau.lib \
+ $(MHMAKECONF)\libx11\src\xlibi18n\$(OBJDIR)\libi18n.lib \
+ $(MHMAKECONF)\libx11\modules\lc\xlocale\$(OBJDIR)\libxlocale.lib \
+ $(MHMAKECONF)\libx11\modules\lc\utf8\$(OBJDIR)\libxlcUTF8Load.lib \
+ $(MHMAKECONF)\libx11\modules\lc\gen\$(OBJDIR)\liblcGenConvLoad.lib \
+ $(MHMAKECONF)\libx11\modules\lc\def\$(OBJDIR)\libxlcDef.lib \
+ $(MHMAKECONF)\libx11\src\xkb\$(OBJDIR)\libxkb.lib \
+ $(MHMAKECONF)\libx11\modules\im\ximcp\$(OBJDIR)\libximcp.lib \
+ $(MHMAKECONF)\libx11\modules\om\generic\$(OBJDIR)\libxomGeneric.lib
+
+CSRCS=config.cc main.cc
+
+WINAPP = xlaunch
+
+RESOURCES = resources.rc
+
+$(OBJDIR)\%.res : resources\%.rc
+ $(RC) $(RCFLAGS) $(RCDEFINES:%=-d "%") $(RCINCLUDES:%=-i "%") -Fo"$(relpath $@)" "$<"
+
+LIBDIRS=$(dir $(INCLUDELIBFILES))
+
+load_makefile $(LIBDIRS:%$(OBJDIR)\=%makefile MAKESERVER=$(MAKESERVER) DEBUG=$(DEBUG);)
+
+ifeq ($(DEBUG),1)
+LINKLIBS += $(MHMAKECONF)\pthreads\pthreadVC2d.lib
+else
+LINKLIBS += $(MHMAKECONF)\pthreads\pthreadVC2.lib
+endif
+
diff --git a/xorg-server/hw/xwin/xlaunch/window/makefile b/xorg-server/hw/xwin/xlaunch/window/makefile new file mode 100644 index 000000000..18a33e728 --- /dev/null +++ b/xorg-server/hw/xwin/xlaunch/window/makefile @@ -0,0 +1,4 @@ +CSRCS=dialog.cc util.cc window.cc wizard.cc
+
+LIBRARY = window
+
diff --git a/xorg-server/hw/xwin/xlaunch/window/util.h b/xorg-server/hw/xwin/xlaunch/window/util.h index cd21da657..2e8dab263 100644 --- a/xorg-server/hw/xwin/xlaunch/window/util.h +++ b/xorg-server/hw/xwin/xlaunch/window/util.h @@ -28,7 +28,7 @@ #include <windows.h> #include <stdexcept> - +#include <string> class win32_error : public std::runtime_error { diff --git a/xorg-server/hw/xwin/xlaunch/window/wizard.h b/xorg-server/hw/xwin/xlaunch/window/wizard.h index a2361c51c..c576cc093 100644 --- a/xorg-server/hw/xwin/xlaunch/window/wizard.h +++ b/xorg-server/hw/xwin/xlaunch/window/wizard.h @@ -29,7 +29,6 @@ #include "dialog.h"
#include <vector>
-#define _WIN32_IE 0x0500
#include <prsht.h>
class CWizard : public CBaseDialog
diff --git a/xorg-server/include/dixstruct.h b/xorg-server/include/dixstruct.h index d44b9cfa7..88d1df342 100644 --- a/xorg-server/include/dixstruct.h +++ b/xorg-server/include/dixstruct.h @@ -97,7 +97,7 @@ typedef struct _Client { Bool swapped; ReplySwapPtr pSwapReplyFunc; XID errorValue; - int sequence; + unsigned short sequence; //MH int closeDownMode; int clientGone; int noClientException; /* this client died or needs to be diff --git a/xorg-server/include/do-not-use-config.h b/xorg-server/include/do-not-use-config.h index b2c9161ee..ddec02eee 100644 --- a/xorg-server/include/do-not-use-config.h +++ b/xorg-server/include/do-not-use-config.h @@ -643,10 +643,10 @@ #define XKB 1 /* Path to XKB data */ -#define XKB_BASE_DIRECTORY "/usr/local/share/X11/xkb" +#define XKB_BASE_DIRECTORY "xkbdata" /* Path to XKB bin dir */ -#define XKB_BIN_DIRECTORY "/usr/local/bin" +#define XKB_BIN_DIRECTORY "." /* Disable XKB per default */ #define XKB_DFLT_DISABLED 0 @@ -655,7 +655,7 @@ #define XKB_IN_SERVER 1 /* Path to XKB output dir */ -#define XKM_OUTPUT_DIR "/usr/local/share/X11/xkb/compiled/" +#define XKM_OUTPUT_DIR "xkbdata/compiled/" /* Building Xorg server */ #define XORGSERVER 1 diff --git a/xorg-server/include/globals.h b/xorg-server/include/globals.h index 2ca9531d9..1ff701380 100644 --- a/xorg-server/include/globals.h +++ b/xorg-server/include/globals.h @@ -50,9 +50,7 @@ extern Bool PanoramiXExtensionDisabledHack; extern Bool noBigReqExtension; #endif -#ifdef COMPOSITE extern Bool noCompositeExtension; -#endif #ifdef DAMAGE extern Bool noDamageExtension; diff --git a/xorg-server/include/misc.h b/xorg-server/include/misc.h index a1cbe8670..ca740c08b 100644 --- a/xorg-server/include/misc.h +++ b/xorg-server/include/misc.h @@ -164,9 +164,9 @@ typedef struct _xReq *xReqPtr; #include <math.h> #undef MAXSHORT -#define MAXSHORT SHRT_MAX +#define MAXSHORT 32767 #undef MINSHORT -#define MINSHORT SHRT_MIN +#define MINSHORT -32768 #undef MAXINT #define MAXINT INT_MAX #undef MININT diff --git a/xorg-server/include/pixmapstr.h b/xorg-server/include/pixmapstr.h index cc5a8d8de..4150b69b7 100644 --- a/xorg-server/include/pixmapstr.h +++ b/xorg-server/include/pixmapstr.h @@ -76,10 +76,8 @@ typedef struct _Pixmap { int refcnt; int devKind; DevUnion devPrivate; -#ifdef COMPOSITE short screen_x; short screen_y; -#endif unsigned usage_hint; /* see CREATE_PIXMAP_USAGE_* */ } PixmapRec; diff --git a/xorg-server/include/scrnintstr.h b/xorg-server/include/scrnintstr.h index 3b2cf9f81..c49487585 100644 --- a/xorg-server/include/scrnintstr.h +++ b/xorg-server/include/scrnintstr.h @@ -68,7 +68,7 @@ typedef struct _Visual { VisualID vid; short class; short bitsPerRGBValue; - short ColormapEntries; + long ColormapEntries; short nplanes;/* = log2 (ColormapEntries). This does not * imply that the screen has this many planes. * it may have more or fewer */ @@ -432,6 +432,10 @@ typedef void (* MarkUnrealizedWindowProcPtr)( WindowPtr /*pWin*/, Bool /*fromConfigure*/); +#ifdef CreateWindow +#undef CreateWindow +#endif + typedef struct _Screen { int myNum; /* index of this instance in Screens[] */ ATOM id; diff --git a/xorg-server/include/windowstr.h b/xorg-server/include/windowstr.h index e06a2f1bd..f370a25d2 100644 --- a/xorg-server/include/windowstr.h +++ b/xorg-server/include/windowstr.h @@ -137,7 +137,7 @@ typedef struct _Window { RegionRec borderSize; DDXPointRec origin; /* position relative to parent */ unsigned short borderWidth; - unsigned short deliverableEvents; + unsigned long deliverableEvents; Mask eventMask; PixUnion background; PixUnion border; diff --git a/xorg-server/include/xkb-config.h b/xorg-server/include/xkb-config.h index 8dc80b6c5..91c7957bf 100644 --- a/xorg-server/include/xkb-config.h +++ b/xorg-server/include/xkb-config.h @@ -10,13 +10,13 @@ #define __XKBDEFRULES__ "xorg" /* Path to XKB definitions. */ -#define XKB_BASE_DIRECTORY "/usr/local/share/X11/xkb" +#define XKB_BASE_DIRECTORY "xkbdata" /* Path to xkbcomp. */ -#define XKB_BIN_DIRECTORY "/usr/local/bin" +#define XKB_BIN_DIRECTORY "." /* XKB output dir for compiled keymaps. */ -#define XKM_OUTPUT_DIR "/usr/local/share/X11/xkb/compiled/" +#define XKM_OUTPUT_DIR "xkbdata/compiled/" /* Do not have `strcasecmp'. */ /* #undef NEED_STRCASECMP */ diff --git a/xorg-server/makefile b/xorg-server/makefile new file mode 100644 index 000000000..7ccc0d784 --- /dev/null +++ b/xorg-server/makefile @@ -0,0 +1,102 @@ +ifneq ($(MAKESERVER),1) +$(error Please specify MAKESERVER=1 on the command line or as environment variable) +endif + +INCLUDELIBFILES = afb\$(OBJDIR)\libafb.lib \ + cfb\$(OBJDIR)\libcfb.lib \ + cfb32\$(OBJDIR)\libcfb32.lib \ + composite\$(OBJDIR)\libcomposite.lib \ + config\$(OBJDIR)\libconfig.lib \ + damageext\$(OBJDIR)\libdamageext.lib \ + dbe\$(OBJDIR)\libdbe.lib \ + dix\$(OBJDIR)\libdix.lib \ + exa\$(OBJDIR)\libexa.lib \ + fb\$(OBJDIR)\libfb.lib \ + glx\$(OBJDIR)\libglx.lib \ + hw\kdrive\ephyr\$(OBJDIR)\libxephyr.lib \ + hw\kdrive\src\$(OBJDIR)\libkdrive.lib \ + hw\xwin\$(OBJDIR)\libxwin.lib \ + mfb\$(OBJDIR)\libmfb.lib \ + mi\$(OBJDIR)\libmi.lib \ + miext\damage\$(OBJDIR)\libdamage.lib \ + miext\shadow\$(OBJDIR)\libshadow.lib \ + os\$(OBJDIR)\libos.lib \ + randr\$(OBJDIR)\librandr.lib \ + record\$(OBJDIR)\librecord.lib \ + Xext\$(OBJDIR)\libxext.lib \ + xfixes\$(OBJDIR)\libxfixes.lib \ + Xi\$(OBJDIR)\libxi.lib \ + xkb\$(OBJDIR)\libxkb.lib \ + render\$(OBJDIR)\librender.lib \ + $(MHMAKECONF)\libxau\$(OBJDIR)\libxau.lib \ + $(MHMAKECONF)\libxdmcp\$(OBJDIR)\libxdmcp.lib \ + $(MHMAKECONF)\libXfont\src\util\$(OBJDIR)\libutil.lib \ + $(MHMAKECONF)\libXfont\src\fc\$(OBJDIR)\libfc.lib \ + $(MHMAKECONF)\libXfont\src\fontfile\$(OBJDIR)\libfontfile.lib \ + $(MHMAKECONF)\libXfont\src\builtins\$(OBJDIR)\libbuiltins.lib \ + $(MHMAKECONF)\libXfont\src\bitmap\$(OBJDIR)\libbitmap.lib \ + $(MHMAKECONF)\pixman\pixman\$(OBJDIR)\libpixman-1.lib \ + $(MHMAKECONF)\libx11\modules\im\ximcp\$(OBJDIR)\libximcp.lib \ + $(MHMAKECONF)\libx11\src\xlibi18n\$(OBJDIR)\libi18n.lib \ + $(MHMAKECONF)\libx11\src\$(OBJDIR)\libx11.lib \ + $(MHMAKECONF)\libx11\src\xcms\$(OBJDIR)\libxcms.lib \ + $(MHMAKECONF)\libxcb\src\$(OBJDIR)\libxcb.lib \ + $(MHMAKECONF)\libx11\src\xkb\$(OBJDIR)\libxkb.lib \ + $(MHMAKECONF)\libx11\modules\om\generic\$(OBJDIR)\libxomGeneric.lib \ + $(MHMAKECONF)\libx11\modules\lc\utf8\$(OBJDIR)\libxlcUTF8Load.lib \ + $(MHMAKECONF)\libx11\modules\lc\def\$(OBJDIR)\libxlcDef.lib \ + $(MHMAKECONF)\libx11\modules\lc\gen\$(OBJDIR)\liblcGenConvLoad.lib \ + $(MHMAKECONF)\zlib\$(OBJDIR)\libz.lib \ + $(MHMAKECONF)\libx11\modules\lc\xlocale\$(OBJDIR)\libxlocale.lib \ + $(MHMAKECONF)\libXfont\src\Type1\$(OBJDIR)\libtype1.lib \ + $(MHMAKECONF)\libfontenc\src\$(OBJDIR)\libfontenc.lib \ + $(MHMAKECONF)\libXfont\src\Speedo\$(OBJDIR)\libspeedo.lib \ + $(MHMAKECONF)\libxfont\src\freetype\$(OBJDIR)\libft.lib \ + $(MHMAKECONF)\libxfont\src\stubs\$(OBJDIR)\libstubs.lib + +LIBDIRS=$(dir $(INCLUDELIBFILES)) + +load_makefile $(LIBDIRS:%$(OBJDIR)\=%makefile MAKESERVER=$(MAKESERVER) DEBUG=$(DEBUG);) + +OBJS = dix\$(OBJDIR)\main.obj + +WINAPP=vcxsrv + +LINKLIBS += $(MHMAKECONF)\openssl\out32\libeay32.lib + +ifeq ($(DEBUG),1) +LINKLIBS += $(MHMAKECONF)\freetype\lib\freetype200b8MT_D.lib \ + $(MHMAKECONF)\pthreads\pthreadVC2d.lib +else +LINKLIBS += $(MHMAKECONF)\freetype\lib\freetype200b8MT.lib \ + $(MHMAKECONF)\pthreads\pthreadVC2.lib +endif + +RCINCLUDES += hw\xwin $(MHMAKECONF)\include $(MHMAKECONF) + +XWin.rc: hw\xwin\XWin.rc + copy $< $@ + +RESOURCES = XWin.rc + +$(OBJDIR)\$(WINAPP).exe: $(LINKLIBS) + +$(WINAPP).exe: $(OBJDIR)\$(WINAPP).exe + copy $< $@ + +load_makefile hw\xwin\xlaunch\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +xlaunch.exe: hw\xwin\xlaunch\$(OBJDIR:obj\$(OBJDIRPREFIX)%=obj\%)\xlaunch.exe + copy $< $@ + +load_makefile ..\xkbcomp\makefile MAKESERVER=0 DEBUG=$(DEBUG) + +xkbcomp.exe: ..\xkbcomp\$(OBJDIR:obj\$(OBJDIRPREFIX)%=obj\%)\xkbcomp.exe + copy $< $@ + +all: $(WINAPP).exe xlaunch.exe xkbcomp.exe protocol.txt + +protocol.txt: dix\protocol.txt + copy $< $@ + + diff --git a/xorg-server/mfb/makefile b/xorg-server/mfb/makefile new file mode 100644 index 000000000..f3ca6e647 --- /dev/null +++ b/xorg-server/mfb/makefile @@ -0,0 +1,14 @@ +CSRCS=mfbseg.c mfbpgbwht.c mfbpgbblak.c mfbpgbinv.c mfbigbwht.c \ + mfbigbblak.c mfbpawhite.c mfbpablack.c mfbpainv.c mfbtewhite.c \ + mfbteblack.c mfbbltC.c mfbbltX.c mfbbltCI.c mfbbltO.c mfbbltG.c \ + mfbtileC.c mfbtileG.c mfbplywhite.c mfbplyblack.c mfbplyinv.c \ + mfbgc.c mfbwindow.c mfbfont.c \ + mfbfillrct.c maskbits.c mfbpixmap.c \ + mfbimage.c mfbline.c mfbbres.c mfbhrzvert.c mfbbresd.c \ + mfbpushpxl.c mfbzerarc.c mfbfillarc.c \ + mfbfillsp.c mfbsetsp.c mfbscrinit.c mfbscrclse.c mfbclip.c \ + mfbbitblt.c mfbgetsp.c mfbpolypnt.c \ + mfbcmap.c mfbmisc.c + +LIBRARY=libmfb + diff --git a/xorg-server/mfb/mfbply1rct.c b/xorg-server/mfb/mfbply1rct.c index 4227e894f..9ff4fb5be 100644 --- a/xorg-server/mfb/mfbply1rct.c +++ b/xorg-server/mfb/mfbply1rct.c @@ -51,14 +51,14 @@ in this Software without prior written authorization from The Open Group. #endif #if IMAGE_BYTE_ORDER == MSBFirst -#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int) ((short) (i)))) +#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int) ((short) ((i)&0xffff)))) #define coordToInt(x,y) (((x) << 16) | ((y) & 0xffff)) #define intToX(i) (GetHighWord(i)) -#define intToY(i) ((int) ((short) i)) +#define intToY(i) ((int) ((short) ((i)&0xffff))) #else -#define intToCoord(i,x,y) (((x) = (int) ((short) (i))), ((y) = GetHighWord(i))) +#define intToCoord(i,x,y) (((x) = (int) ((short) ((i)&0xffff))), ((y) = GetHighWord(i))) #define coordToInt(x,y) (((y) << 16) | ((x) & 0xffff)) -#define intToX(i) ((int) ((short) (i))) +#define intToX(i) ((int) ((short) ((i)&0xffff))) #define intToY(i) (GetHighWord(i)) #endif diff --git a/xorg-server/mi/makefile b/xorg-server/mi/makefile new file mode 100644 index 000000000..759278c09 --- /dev/null +++ b/xorg-server/mi/makefile @@ -0,0 +1,41 @@ +CSRCS=miarc.c \ + mibank.c \ + mibitblt.c \ + mibstore.c \ + micmap.c \ + micursor.c \ + midash.c \ + midispcur.c \ + mieq.c \ + miexpose.c \ + mifillarc.c \ + mifillrct.c \ + mifpolycon.c \ + migc.c \ + miglblt.c \ + mioverlay.c \ + mipointer.c \ + mipoly.c \ + mipolycon.c \ + mipolygen.c \ + mipolypnt.c \ + mipolyrect.c \ + mipolyseg.c \ + mipolytext.c \ + mipolyutil.c \ + mipushpxl.c \ + miregion.c \ + miscrinit.c \ + mispans.c \ + misprite.c \ + mivaltree.c \ + miwideline.c \ + miwindow.c \ + mizerarc.c \ + mizerclip.c \ + mizerline.c \ + miinitext.c + +LIBRARY=libmi + + diff --git a/xorg-server/mi/micoord.h b/xorg-server/mi/micoord.h index 876e88c95..08f315b99 100644 --- a/xorg-server/mi/micoord.h +++ b/xorg-server/mi/micoord.h @@ -55,14 +55,14 @@ #endif #if IMAGE_BYTE_ORDER == MSBFirst -#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int) ((short) (i)))) +#define intToCoord(i,x,y) (((x) = GetHighWord(i)), ((y) = (int) ((short) ((i)&0xffff)))) #define coordToInt(x,y) (((x) << 16) | ((y) & 0xffff)) #define intToX(i) (GetHighWord(i)) -#define intToY(i) ((int) ((short) i)) +#define intToY(i) ((int) ((short) ((i)&0xffff))) #else -#define intToCoord(i,x,y) (((x) = (int) ((short) (i))), ((y) = GetHighWord(i))) +#define intToCoord(i,x,y) (((x) = (int) ((short) ((i)&0xffff))), ((y) = GetHighWord(i))) #define coordToInt(x,y) (((y) << 16) | ((x) & 0xffff)) -#define intToX(i) ((int) ((short) (i))) +#define intToX(i) ((int) ((short) ((i)&0xffff))) #define intToY(i) (GetHighWord(i)) #endif diff --git a/xorg-server/miext/damage/makefile b/xorg-server/miext/damage/makefile new file mode 100644 index 000000000..e58f4a883 --- /dev/null +++ b/xorg-server/miext/damage/makefile @@ -0,0 +1,7 @@ +LIBRARY = libdamage + +#INCLUDES = -I$(srcdir)/../cw -I$(top_srcdir)/hw/xfree86/os-support + +CSRCS =damage.c + + diff --git a/xorg-server/miext/rootless/Xplugin.h b/xorg-server/miext/rootless/Xplugin.h new file mode 100644 index 000000000..0262904ac --- /dev/null +++ b/xorg-server/miext/rootless/Xplugin.h @@ -0,0 +1,713 @@ +/* Xplugin.h -- windowing API for rootless X11 server + $Id: Xplugin.h,v 1.4 2003/03/03 23:30:53 jharper Exp $ + + + Copyright (c) 2002 Apple Computer, Inc. All rights reserved. + + + Permission is hereby granted, free of charge, to any person + obtaining a copy of this software and associated documentation files + (the "Software"), to deal in the Software without restriction, + including without limitation the rights to use, copy, modify, merge, + publish, distribute, sublicense, and/or sell copies of the Software, + and to permit persons to whom the Software is furnished to do so, + subject to the following conditions: + + + The above copyright notice and this permission notice shall be + included in all copies or substantial portions of the Software. + + + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + NONINFRINGEMENT. IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT + HOLDER(S) BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + DEALINGS IN THE SOFTWARE. + + + Except as contained in this notice, the name(s) of the above + copyright holders shall not be used in advertising or otherwise to + promote the sale, use or other dealings in this Software without + prior written authorization. + + +Note that these interfaces are provided solely for the use of the +X11 server. Any other uses are unsupported and strongly discouraged. */ + +#ifndef XPLUGIN_H +#define XPLUGIN_H 1 + + +#include <stdint.h> + + +/* By default we use the X server definition of BoxRec to define xp_box, + so that the compiler can silently convert between the two. But if + XP_NO_X_HEADERS is defined, we'll define it ourselves. */ + + +#ifndef XP_NO_X_HEADERS +# include "miscstruct.h" + typedef BoxRec xp_box; +#else + struct xp_box_struct { + short x1, y1, x2, y2; + }; + typedef struct xp_box_struct xp_box; +#endif + + +typedef unsigned int xp_resource_id; +typedef xp_resource_id xp_window_id; +typedef xp_resource_id xp_surface_id; +typedef unsigned int xp_client_id; +typedef unsigned int xp_request_type; +typedef int xp_error; +typedef int xp_bool; + + + +/* Error codes that the functions declared here may return. They all + numerically match their X equivalents, i.e. the XP_ can be dropped + if <X11/X.h> has been included. */ + + +enum xp_error_enum { + XP_Success = 0, + XP_BadRequest = 1, + XP_BadValue = 2, + XP_BadWindow = 3, + XP_BadMatch = 8, + XP_BadAccess = 10, + XP_BadImplementation = 17, +}; + + + +/* Event types generated by the plugin. */ + + +enum xp_event_type_enum { + /* The global display configuration changed somehow. */ + XP_EVENT_DISPLAY_CHANGED = 1 << 0, + + + /* A window changed state. Argument is xp_window_state_event */ + XP_EVENT_WINDOW_STATE_CHANGED = 1 << 1, + + + /* An async request encountered an error. Argument is of type + xp_async_error_event */ + XP_EVENT_ASYNC_ERROR = 1 << 2, + + + /* Sent when a surface is destroyed as a side effect of destroying + a window. Arg is of type xp_surface_id. */ + XP_EVENT_SURFACE_DESTROYED = 1 << 3, + + + /* Sent when any GL contexts pointing at the given surface need to + call xp_update_gl_context () to refresh their state (because the + window moved or was resized. Arg is of type xp_surface_id. */ + XP_EVENT_SURFACE_CHANGED = 1 << 4, + + +/* Sent when a window has been moved. Arg is of type xp_window_id. */ +XP_EVENT_WINDOW_MOVED = 1 << 5, +}; + +/* Function type used to receive events. */ + + +typedef void (xp_event_fun) (unsigned int type, const void *arg, + unsigned int arg_size, void *user_data); + + + +/* Operation types. Used when reporting errors asynchronously. */ + + +enum xp_request_type_enum { + XP_REQUEST_NIL = 0, + XP_REQUEST_DESTROY_WINDOW = 1, + XP_REQUEST_CONFIGURE_WINDOW = 2, + XP_REQUEST_FLUSH_WINDOW = 3, + XP_REQUEST_COPY_WINDOW = 4, + XP_REQUEST_UNLOCK_WINDOW = 5, + XP_REQUEST_DISABLE_UPDATE = 6, + XP_REQUEST_REENABLE_UPDATE = 7, + XP_REQUEST_HIDE_CURSOR = 8, + XP_REQUEST_SHOW_CURSOR = 9, + XP_REQUEST_FRAME_DRAW = 10, +}; + + +/* Structure used to report an error asynchronously. Passed as the "arg" + of an XP_EVENT_ASYNC_ERROR event. */ + + +struct xp_async_error_event_struct { + xp_request_type request_type; + xp_resource_id id; + xp_error error; +}; + + +typedef struct xp_async_error_event_struct xp_async_error_event; + + + +/* Possible window states. */ + + +enum xp_window_state_enum { +/* The window is not in the global list of possibly-visible windows. */ +XP_WINDOW_STATE_OFFSCREEN = 1 << 0, + + /* Parts of the window may be obscured by other windows. */ + XP_WINDOW_STATE_OBSCURED = 1 << 1, +}; + + +/* Structure passed as argument of an XP_EVENT_WINDOW_STATE_CHANGED event. */ + +struct xp_window_state_event_struct { + xp_window_id id; + unsigned int state; +}; + + +typedef struct xp_window_state_event_struct xp_window_state_event; + + + +/* Function type used to supply a colormap for indexed drawables. */ + + +typedef xp_error (xp_colormap_fun) (void *data, int first_color, + int n_colors, uint32_t *colors); + + + +/* Window attributes structure. Used when creating and configuring windows. +Also used when configuring surfaces attached to windows. Functions that +take one of these structures also take a bit mask defining which +fields are set to meaningful values. */ + +enum xp_window_changes_enum { + XP_ORIGIN = 1 << 0, + XP_SIZE = 1 << 1, + XP_BOUNDS = XP_ORIGIN | XP_SIZE, + XP_SHAPE = 1 << 2, + XP_STACKING = 1 << 3, + XP_DEPTH = 1 << 4, + XP_COLORMAP = 1 << 5, + XP_WINDOW_LEVEL = 1 << 6, +}; + + +struct xp_window_changes_struct { + /* XP_ORIGIN */ + int x, y; + + + /* XP_SIZE */ + unsigned int width, height; + int bit_gravity; /* how to resize the backing store */ + + + /* XP_SHAPE */ + int shape_nrects; /* -1 = remove shape */ + xp_box *shape_rects; + int shape_tx, shape_ty; /* translation for shape */ + + + /* XP_STACKING */ + int stack_mode; + xp_window_id sibling; /* may be zero; in ABOVE/BELOW modes + it may specify a relative window */ + /* XP_DEPTH, window-only */ + unsigned int depth; + + + /* XP_COLORMAP, window-only */ + xp_colormap_fun *colormap; + void *colormap_data; + + + /* XP_WINDOW_LEVEL, window-only */ + int window_level; +}; + + +typedef struct xp_window_changes_struct xp_window_changes; + + +/* Values for bit_gravity field */ + + +enum xp_bit_gravity_enum { + XP_GRAVITY_NONE = 0, /* no gravity, fill everything */ + XP_GRAVITY_NORTH_WEST = 1, /* anchor to top-left corner */ + XP_GRAVITY_NORTH_EAST = 2, /* anchor to top-right corner */ + XP_GRAVITY_SOUTH_EAST = 3, /* anchor to bottom-right corner */ + XP_GRAVITY_SOUTH_WEST = 4, /* anchor to bottom-left corner */ +}; + + +/* Values for stack_mode field */ + + +enum xp_window_stack_mode_enum { + XP_UNMAPPED = 0, /* remove the window */ + XP_MAPPED_ABOVE = 1, /* display the window on top */ + XP_MAPPED_BELOW = 2, /* display the window at bottom */ +}; + + +/* Data formats for depth field and composite functions */ + + +enum xp_depth_enum { + XP_DEPTH_NIL = 0, /* null source when compositing */ + XP_DEPTH_ARGB8888, + XP_DEPTH_RGB555, + XP_DEPTH_A8, /* for masks when compositing */ + XP_DEPTH_INDEX8, +}; + + +/* Options that may be passed to the xp_init () function. */ + + +enum xp_init_options_enum { + /* Don't mark that this process can be in the foreground. */ + XP_IN_BACKGROUND = 1 << 0, + + + /* Deliver background pointer events to this process. */ + XP_BACKGROUND_EVENTS = 1 << 1, +}; + + + + +/* Miscellaneous functions */ + + +/* Initialize the plugin library. Only the copy/fill/composite functions + may be called without having previously called xp_init () */ + + +extern xp_error xp_init (unsigned int options); + + +/* Sets the current set of requested notifications to MASK. When any of + these arrive, CALLBACK will be invoked with CALLBACK-DATA. Note that + calling this function cancels any previously requested notifications + that aren't set in MASK. */ + + +extern xp_error xp_select_events (unsigned int mask, + xp_event_fun *callback, + void *callback_data); + + +/* Waits for all initiated operations to complete. */ + + +extern xp_error xp_synchronize (void); + + +/* Causes any display update initiated through the plugin libary to be + queued until update is reenabled. Note that calls to these functions + nest. */ + + +extern xp_error xp_disable_update (void); +extern xp_error xp_reenable_update (void); + + + + +/* Cursor functions. */ + + +/* Installs the specified cursor. ARGB-DATA should point to 32-bit + premultiplied big-endian ARGB data. The HOT-X,HOT-Y parameters + specify the offset to the cursor's hot spot from its top-left + corner. */ + + +extern xp_error xp_set_cursor (unsigned int width, unsigned int height, + unsigned int hot_x, unsigned int hot_y, + const uint32_t *argb_data, + unsigned int rowbytes); + + +/* Hide and show the cursor if it's owned by the current process. Calls + to these functions nest. */ + + +extern xp_error xp_hide_cursor (void); +extern xp_error xp_show_cursor (void); + + + + +/* Window functions. */ + + +/* Create a new window as defined by MASK and VALUES. MASK must contain + XP_BOUNDS or an error is raised. The id of the newly created window + is stored in *RET-ID if this function returns XP_Success. */ + + +extern xp_error xp_create_window (unsigned int mask, + const xp_window_changes *values, + xp_window_id *ret_id); + + +/* Destroys the window identified by ID. */ + + +extern xp_error xp_destroy_window (xp_window_id id); + + +/* Reconfigures the given window according to MASK and VALUES. */ + + +extern xp_error xp_configure_window (xp_window_id id, unsigned int mask, + const xp_window_changes *values); + + + +/* Returns true if NATIVE-ID is a window created by the plugin library. +If so and RET-ID is non-null, stores the id of the window in *RET-ID. */ + +extern xp_bool xp_lookup_native_window (unsigned int native_id, + xp_window_id *ret_id); + + +/* If ID names a window created by the plugin library, stores it's native +window id in *RET-NATIVE-ID. */ + +extern xp_error xp_get_native_window (xp_window_id id, + unsigned int *ret_native_id); + + + +/* Locks the rectangle IN-RECT (or, if null, the entire window) of the +given window's backing store. Any other non-null parameters are filled +in as follows: + + DEPTH = format of returned data. Currently either XP_DEPTH_ARGB8888 + or XP_DEPTH_RGB565 (possibly with 8 bit planar alpha). Data is + always stored in native byte order. + + + BITS[0] = pointer to top-left pixel of locked color data + BITS[1] = pointer to top-left of locked alpha data, or null if window + has no alpha. If the alpha data is meshed, then BITS[1] = BITS[0]. + + + ROWBYTES[0,1] = size in bytes of each row of color,alpha data + + + OUT-RECT = rectangle specifying the current position and size of the + locked region relative to the window origin. + + +Note that an error is raised when trying to lock an already locked +window. While the window is locked, the only operations that may +be performed on it are to modify, access or flush its marked region. */ + +extern xp_error xp_lock_window (xp_window_id id, + const xp_box *in_rect, + unsigned int *depth, + void *bits[2], + unsigned int rowbytes[2], + xp_box *out_rect); + + +/* Mark that the region specified by SHAPE-NRECTS, SHAPE-RECTS, + SHAPE-TX, and SHAPE-TY in the specified window has been updated, and + will need to subsequently be redisplayed. */ + + +extern xp_error xp_mark_window (xp_window_id id, int shape_nrects, + const xp_box *shape_rects, + int shape_tx, int shape_ty); + + +/* Unlocks the specified window. If FLUSH is true, then any marked + regions are immediately redisplayed. Note that it's an error to + unlock an already unlocked window. */ + + +extern xp_error xp_unlock_window (xp_window_id id, xp_bool flush); + + +/* If anything is marked in the given window for redisplay, do it now. */ + +extern xp_error xp_flush_window (xp_window_id id); + + +/* Moves the contents of the region DX,DY pixels away from that specified +by DST_RECTS and DST_NRECTS in the window with SRC-ID to the +destination region in the window DST-ID. Note that currently source +and destination windows must be the same. */ + +extern xp_error xp_copy_window (xp_window_id src_id, xp_window_id dst_id, +int dst_nrects, const xp_box *dst_rects, +int dx, int dy); + +/* Returns true if the given window has any regions marked for + redisplay. */ + + +extern xp_bool xp_is_window_marked (xp_window_id id); + + +/* If successful returns a superset of the region marked for update in +the given window. Use xp_free_region () to release the returned data. */ + +extern xp_error xp_get_marked_shape (xp_window_id id, + int *ret_nrects, xp_box **ret_rects); + + +extern void xp_free_shape (int nrects, xp_box *rects); + + +/* Searches for the first window below ABOVE-ID containing the point X,Y, +and returns it's window id in *RET-ID. If no window is found, *RET-ID +is set to zero. If ABOVE-ID is zero, finds the topmost window +containing the given point. */ + +extern xp_error xp_find_window (int x, int y, xp_window_id above_id, + xp_window_id *ret_id); + + +/* Returns the current origin and size of the window ID in *BOUNDS-RET if +successful. */ +extern xp_error xp_get_window_bounds (xp_window_id id, xp_box *bounds_ret); + + + +/* Window surface functions. */ + + +/* Create a new VRAM surface on the specified window. If successful, + returns the identifier of the new surface in *RET-SID. */ + + +extern xp_error xp_create_surface (xp_window_id id, xp_surface_id *ret_sid); + +/* Destroys the specified surface. */ + + +extern xp_error xp_destroy_surface (xp_surface_id sid); + + +/* Reconfigures the specified surface as defined by MASK and VALUES. + Note that specifying XP_DEPTH is an error. */ + + +extern xp_error xp_configure_surface (xp_surface_id sid, unsigned int mask, +const xp_window_changes *values); + +/* If successful, places the client identifier of the current process + in *RET-CLIENT. */ + + +extern xp_error xp_get_client_id (xp_client_id *ret_client); + + +/* Given a valid window,surface combination created by the current + process, attempts to allow the specified external client access + to that surface. If successful, returns two integers in RET-KEY + which the client can use to import the surface into their process. */ + + +extern xp_error xp_export_surface (xp_window_id wid, xp_surface_id sid, + xp_client_id client, + unsigned int ret_key[2]); + + +/* Given a two integer key returned from xp_export_surface (), tries + to import the surface into the current process. If successful the + local surface identifier is stored in *SID-RET. */ + + +extern xp_error xp_import_surface (const unsigned int key[2], + xp_surface_id *sid_ret); + + +/* If successful, stores the number of surfaces attached to the + specified window in *RET. */ + + +extern xp_error xp_get_window_surface_count (xp_window_id id, + unsigned int *ret); + + +/* Attaches the CGLContextObj CGL-CTX to the specified surface. */ + + +extern xp_error xp_attach_gl_context (void *cgl_ctx, xp_surface_id sid); + + +/* Updates the CGLContextObj CGL-CTX to reflect any recent changes to + the surface it's attached to. */ + + +extern xp_error xp_update_gl_context (void *cgl_ctx); + + + + +/* Window frame functions. */ + + +/* Possible arguments to xp_frame_get_rect (). */ + + +enum xp_frame_rect_enum { + XP_FRAME_RECT_TITLEBAR = 1, + XP_FRAME_RECT_TRACKING = 2, + XP_FRAME_RECT_GROWBOX = 3, +}; + + +/* Classes of window frame. */ + + +enum xp_frame_class_enum { + XP_FRAME_CLASS_DOCUMENT = 1 << 0, + XP_FRAME_CLASS_DIALOG = 1 << 1, + XP_FRAME_CLASS_MODAL_DIALOG = 1 << 2, + XP_FRAME_CLASS_SYSTEM_MODAL_DIALOG = 1 << 3, + XP_FRAME_CLASS_UTILITY = 1 << 4, + XP_FRAME_CLASS_TOOLBAR = 1 << 5, + XP_FRAME_CLASS_MENU = 1 << 6, + XP_FRAME_CLASS_SPLASH = 1 << 7, + XP_FRAME_CLASS_BORDERLESS = 1 << 8, +}; + + +/* Attributes of window frames. */ + + +enum xp_frame_attr_enum { + XP_FRAME_ACTIVE = 0x0001, + XP_FRAME_URGENT = 0x0002, + XP_FRAME_TITLE = 0x0004, + XP_FRAME_PRELIGHT = 0x0008, + XP_FRAME_SHADED = 0x0010, + XP_FRAME_CLOSE_BOX = 0x0100, + XP_FRAME_COLLAPSE = 0x0200, + XP_FRAME_ZOOM = 0x0400, + XP_FRAME_ANY_BUTTON = 0x0700, + XP_FRAME_CLOSE_BOX_CLICKED = 0x0800, + XP_FRAME_COLLAPSE_BOX_CLICKED = 0x1000, + XP_FRAME_ZOOM_BOX_CLICKED = 0x2000, + XP_FRAME_ANY_CLICKED = 0x3800, + XP_FRAME_GROW_BOX = 0x4000, +}; + + +#define XP_FRAME_ATTR_IS_SET(a,b) (((a) & (b)) == (b)) +#define XP_FRAME_ATTR_IS_CLICKED(a,m) ((a) & ((m) << 3)) +#define XP_FRAME_ATTR_SET_CLICKED(a,m) ((a) |= ((m) << 3)) +#define XP_FRAME_ATTR_UNSET_CLICKED(a,m) ((a) &= ~((m) << 3)) + + +#define XP_FRAME_POINTER_ATTRS (XP_FRAME_PRELIGHT \ + | XP_FRAME_ANY_BUTTON \ + | XP_FRAME_ANY_CLICKED) + + +extern xp_error xp_frame_get_rect (int type, int class, const xp_box *outer, +const xp_box *inner, xp_box *ret); +extern xp_error xp_frame_hit_test (int class, int x, int y, +const xp_box *outer, +const xp_box *inner, int *ret); +extern xp_error xp_frame_draw (xp_window_id wid, int class, unsigned int attr, +const xp_box *outer, const xp_box *inner, +unsigned int title_len, +const unsigned char *title_bytes); + + +/* Memory manipulation functions. */ + + +enum xp_composite_op_enum { + XP_COMPOSITE_SRC = 0, + XP_COMPOSITE_OVER, +}; + + +#define XP_COMPOSITE_FUNCTION(op, src_depth, mask_depth, dest_depth) \ + (((op) << 24) | ((src_depth) << 16) \ + | ((mask_depth) << 8) | ((dest_depth) << 0)) + + +#define XP_COMPOSITE_FUNCTION_OP(f) (((f) >> 24) & 255) +#define XP_COMPOSITE_FUNCTION_SRC_DEPTH(f) (((f) >> 16) & 255) +#define XP_COMPOSITE_FUNCTION_MASK_DEPTH(f) (((f) >> 8) & 255) +#define XP_COMPOSITE_FUNCTION_DEST_DEPTH(f) (((f) >> 0) & 255) + + +/* Composite WIDTH by HEIGHT pixels from source and mask to destination + using a specified function (if source and destination overlap, + undefined behavior results). + + +For SRC and DEST, the first element of the array is the color data. If +the second element is non-null it implies that there is alpha data +(which may be meshed or planar). Data without alpha is assumed to be +opaque. + + Passing a null SRC-ROWBYTES pointer implies that the data SRC points + to is a single element. + + +Operations that are not supported will return XP_BadImplementation. */ + +extern xp_error xp_composite_pixels (unsigned int width, unsigned int height, +unsigned int function, +void *src[2], unsigned int src_rowbytes[2], +void *mask, unsigned int mask_rowbytes, +void *dest[2], unsigned int dest_rowbytes[2]); + +/* Fill HEIGHT rows of data starting at DST. Each row will have WIDTH + bytes filled with the 32-bit pattern VALUE. Each row is DST-ROWBYTES + wide in total. */ + + +extern void xp_fill_bytes (unsigned int width, + unsigned int height, uint32_t value, + void *dst, unsigned int dst_rowbytes); + + +/* Copy HEIGHT rows of bytes from SRC to DST. Each row will have WIDTH +bytes copied. SRC and DST may overlap, and the right thing will happen. */ + +extern void xp_copy_bytes (unsigned int width, unsigned int height, + const void *src, unsigned int src_rowbytes, + void *dst, unsigned int dst_rowbytes); + + +/* Suggestions for the minimum number of bytes or pixels for which it + makes sense to use some of the xp_ functions */ + + +extern unsigned int xp_fill_bytes_threshold, xp_copy_bytes_threshold, + xp_composite_area_threshold, xp_scroll_area_threshold; + + + +#endif /* XPLUGIN_H */ diff --git a/xorg-server/miext/rootless/rootlessWindow.c b/xorg-server/miext/rootless/rootlessWindow.c index 0dad44a99..681fefef3 100644 --- a/xorg-server/miext/rootless/rootlessWindow.c +++ b/xorg-server/miext/rootless/rootlessWindow.c @@ -36,13 +36,13 @@ #include <stddef.h> /* For NULL */ #include <limits.h> /* For CHAR_BIT */ #include <assert.h> +#include <X11/Xatom.h> +#include <Xplugin.h> #ifdef __APPLE__ //#include <X11/Xlib.h> -#include <X11/Xatom.h> #include "mi.h" #include "pixmapstr.h" #include "windowstr.h" -#include <Xplugin.h> //#include <X11/extensions/applewm.h> extern int darwinMainScreenX, darwinMainScreenY; #endif @@ -93,9 +93,11 @@ static inline int configure_window (xp_window_id id, unsigned int mask, const xp_window_changes *values) { +#ifdef __APPLE__ if (!no_configure_window) return xp_configure_window (id, mask, values); else +#endif return XP_Success; } @@ -116,6 +118,7 @@ rootlessHasRoot (ScreenPtr pScreen) return WINREC (WindowTable[pScreen->myNum]) != NULL; } +#ifdef __APPLE__ void RootlessNativeWindowStateChanged (xp_window_id id, unsigned int state) { @@ -155,7 +158,11 @@ RootlessNativeWindowMoved (WindowPtr pWin) mask = CWX | CWY; /* pretend we're the owner of the window! */ - client = LookupClient (pWin->drawable.id, NullClient); + err = dixLookupClient(&pClient, pWin->drawable.id, NullClient, DixUnknownAccess); + if(err != Success) { + ErrorF("RootlessNativeWindowMoved(): Failed to lookup window: 0x%x\n", (unsigned int)pWin->drawable.id); + return; + } /* Don't want to do anything to the physical window (avoids notification-response feedback loops) */ @@ -184,6 +191,7 @@ set_screen_origin (WindowPtr pWin) dixChangeWindowProperty(serverClient, pWin, xa_native_screen_origin(), XA_INTEGER, 32, PropModeReplace, 2, data, TRUE); } +#endif /* __APPLE__ */ /* * RootlessCreateWindow diff --git a/xorg-server/miext/rootless/rootlessWindow.h b/xorg-server/miext/rootless/rootlessWindow.h index 055589e79..cc5396224 100644 --- a/xorg-server/miext/rootless/rootlessWindow.h +++ b/xorg-server/miext/rootless/rootlessWindow.h @@ -56,7 +56,9 @@ void RootlessResizeWindow(WindowPtr pWin, int x, int y, unsigned int w, unsigned int h, WindowPtr pSib); void RootlessReparentWindow(WindowPtr pWin, WindowPtr pPriorParent); void RootlessChangeBorderWidth(WindowPtr pWin, unsigned int width); +#ifdef __APPLE__ void RootlessNativeWindowMoved (WindowPtr pWin); void RootlessNativeWindowStateChanged (xp_window_id id, unsigned int state); +#endif #endif diff --git a/xorg-server/miext/shadow/makefile b/xorg-server/miext/shadow/makefile new file mode 100644 index 000000000..0a84b506c --- /dev/null +++ b/xorg-server/miext/shadow/makefile @@ -0,0 +1,25 @@ +LIBRARY = libshadow + +#INCLUDES = -I$(top_srcdir)/hw/xfree86/os-support + +CSRCS = shadow.c \ + shalloc.c \ + shpacked.c \ + shplanar8.c \ + shplanar.c \ + shrot16pack_180.c \ + shrot16pack_270.c \ + shrot16pack_270YX.c \ + shrot16pack_90.c \ + shrot16pack_90YX.c \ + shrot16pack.c \ + shrot32pack_180.c \ + shrot32pack_270.c \ + shrot32pack_90.c \ + shrot32pack.c \ + shrot8pack_180.c \ + shrot8pack_270.c \ + shrot8pack_90.c \ + shrot8pack.c \ + shrotate.c + diff --git a/xorg-server/os/WaitFor.c b/xorg-server/os/WaitFor.c index da12976ca..0ce1db698 100644 --- a/xorg-server/os/WaitFor.c +++ b/xorg-server/os/WaitFor.c @@ -214,6 +214,12 @@ WaitForSomething(int *pClientsReady) wt = &waittime; } } + if (!wt) + { + wt = &waittime; + waittime.tv_sec = 0; + waittime.tv_usec = 100; + } XFD_COPYSET(&AllSockets, &LastSelectMask); #ifdef SMART_SCHEDULE } diff --git a/xorg-server/os/io.c b/xorg-server/os/io.c index e7ec60952..d32096704 100644 --- a/xorg-server/os/io.c +++ b/xorg-server/os/io.c @@ -945,6 +945,7 @@ FlushClient(ClientPtr who, OsCommPtr oc, char *extraBuf, int extraCount) /* If we've arrived here, then the client is stuffed to the gills and not ready to accept more. Make a note of it and buffer the rest. */ + errno=0; FD_SET(connection, &ClientsWriteBlocked); AnyClientsWriteBlocked = TRUE; diff --git a/xorg-server/os/log.c b/xorg-server/os/log.c index ee14624dc..282d2b97c 100644 --- a/xorg-server/os/log.c +++ b/xorg-server/os/log.c @@ -95,8 +95,14 @@ OR PERFORMANCE OF THIS SOFTWARE. #ifdef WIN32 #include <process.h> +#ifndef _MSC_VER #define getpid(x) _getpid(x) #endif +#endif + +#ifdef _MSC_VER +#define S_ISREG(m) (((m)&_S_IFMT) == _S_IFREG) +#endif #ifdef DDXOSVERRORF diff --git a/xorg-server/os/makefile b/xorg-server/os/makefile new file mode 100644 index 000000000..cf9eaf53f --- /dev/null +++ b/xorg-server/os/makefile @@ -0,0 +1,4 @@ +CSRCS=access.c auth.c backtrace.c connection.c io.c log.c mitauth.c os.c oscolor.c osinit.c rpcauth.c strlcat.c strlcpy.c utils.c WaitFor.c xdmauth.c xdmcp.c xprintf.c xstrans.c
+
+LIBRARY=libos
+
diff --git a/xorg-server/os/utils.c b/xorg-server/os/utils.c index f58c76366..f2b54d8dc 100644 --- a/xorg-server/os/utils.c +++ b/xorg-server/os/utils.c @@ -56,6 +56,7 @@ OR PERFORMANCE OF THIS SOFTWARE. #ifdef __CYGWIN__ #include <stdlib.h> #include <signal.h> +__stdcall unsigned long GetTickCount(void); #endif #if defined(WIN32) && !defined(__CYGWIN__) @@ -517,7 +518,7 @@ GiveUp(int sig) errno = olderrno; } -#if defined WIN32 && defined __MINGW32__ +#if (defined WIN32 && defined __MINGW32__) || defined(__CYGWIN__) _X_EXPORT CARD32 GetTimeInMillis (void) { @@ -1504,7 +1505,7 @@ XNFstrdup(const char *s) #ifdef SMART_SCHEDULE -#ifdef SIGVTALRM +#if defined(SIGVTALRM) && !defined(__CYGWIN__) #define SMART_SCHEDULE_POSSIBLE #endif @@ -1943,6 +1944,7 @@ Fclose(pointer iop) */ /* Consider LD* variables insecure? */ +#ifndef _MSC_VER #ifndef REMOVE_ENV_LD #define REMOVE_ENV_LD 1 #endif @@ -1951,6 +1953,7 @@ Fclose(pointer iop) #ifndef REMOVE_LONG_ENV #define REMOVE_LONG_ENV 1 #endif +#endif /* * Disallow stdout or stderr as pipes? It's possible to block the X server diff --git a/xorg-server/os/xprintf.c b/xorg-server/os/xprintf.c index 07eaa1f58..bf70661ac 100644 --- a/xorg-server/os/xprintf.c +++ b/xorg-server/os/xprintf.c @@ -39,7 +39,9 @@ # ifdef __va_copy # define va_copy __va_copy # else +# ifndef _MSC_VER # error "no working va_copy was found" +# endif # endif #endif @@ -48,11 +50,16 @@ Xvprintf(const char *format, va_list va) { char *ret; int size; + +#ifdef _MSC_VER + size = vsnprintf(NULL, 0, format, va); +#else va_list va2; va_copy(va2, va); size = vsnprintf(NULL, 0, format, va2); va_end(va2); +#endif ret = (char *)Xalloc(size + 1); if (ret == NULL) @@ -78,11 +85,16 @@ XNFvprintf(const char *format, va_list va) { char *ret; int size; + +#ifdef _MSC_VER + size = vsnprintf(NULL, 0, format, va); +#else va_list va2; va_copy(va2, va); size = vsnprintf(NULL, 0, format, va2); va_end(va2); +#endif ret = (char *)XNFalloc(size + 1); if (ret == NULL) diff --git a/xorg-server/os/xstrans.c b/xorg-server/os/xstrans.c index c086e225b..86c8688da 100644 --- a/xorg-server/os/xstrans.c +++ b/xorg-server/os/xstrans.c @@ -5,4 +5,6 @@ #define TRANS_REOPEN #define TRANS_SERVER #define XSERV_t +#define TCPCONN + #include <X11/Xtrans/transport.c> diff --git a/xorg-server/protocol.txt b/xorg-server/protocol.txt new file mode 100644 index 000000000..0a85ca872 --- /dev/null +++ b/xorg-server/protocol.txt @@ -0,0 +1,1066 @@ +# Registry of protocol names used by X Server +# This will eventually be replaced by server-side XCB +# +# Format is Xnnn <extension-name>:<object-name> +# R=Request, V=Event, E=Error +# +# This is a security-sensitive file, please set permissions as appropriate. +# +R001 Adobe-DPS-Extension:Init +R002 Adobe-DPS-Extension:CreateContext +R003 Adobe-DPS-Extension:CreateSpace +R004 Adobe-DPS-Extension:GiveInput +R005 Adobe-DPS-Extension:GetStatus +R006 Adobe-DPS-Extension:DestroySpace +R007 Adobe-DPS-Extension:Reset +R008 Adobe-DPS-Extension:NotifyContext +R009 Adobe-DPS-Extension:CreateContextFromID +R010 Adobe-DPS-Extension:XIDFromContext +R011 Adobe-DPS-Extension:ContextFromXID +R012 Adobe-DPS-Extension:SetStatusMask +R013 Adobe-DPS-Extension:CreateSecureContext +R014 Adobe-DPS-Extension:NotifyWhenReady +R000 Apple-DRI:QueryVersion +R001 Apple-DRI:QueryDirectRenderingCapable +R002 Apple-DRI:CreateSurface +R003 Apple-DRI:DestroySurface +R004 Apple-DRI:AuthConnection +V000 Apple-DRI:ObsoleteEvent1 +V001 Apple-DRI:ObsoleteEvent2 +V002 Apple-DRI:ObsoleteEvent3 +V003 Apple-DRI:SurfaceNotify +E000 Apple-DRI:ClientNotLocal +E001 Apple-DRI:OperationNotSupported +R000 Apple-WM:QueryVersion +R001 Apple-WM:FrameGetRect +R002 Apple-WM:FrameHitTest +R003 Apple-WM:FrameDraw +R004 Apple-WM:DisableUpdate +R005 Apple-WM:ReenableUpdate +R006 Apple-WM:SelectInput +R007 Apple-WM:SetWindowMenuCheck +R008 Apple-WM:SetFrontProcess +R009 Apple-WM:SetWindowLevel +R010 Apple-WM:SetCanQuit +R011 Apple-WM:SetWindowMenu +V000 Apple-WM:ControllerNotify +V001 Apple-WM:ActivationNotify +V002 Apple-WM:PasteboardNotify +E000 Apple-WM:ClientNotLocal +E001 Apple-WM:OperationNotSupported +R000 BIG-REQUESTS:Enable +R000 Composite:CompositeQueryVersion +R001 Composite:CompositeRedirectWindow +R002 Composite:CompositeRedirectSubwindows +R003 Composite:CompositeUnredirectWindow +R004 Composite:CompositeUnredirectSubwindows +R005 Composite:CompositeCreateRegionFromBorderClip +R006 Composite:CompositeNameWindowPixmap +R007 Composite:CompositeGetOverlayWindow +R008 Composite:CompositeReleaseOverlayWindow +R000 DAMAGE:QueryVersion +R001 DAMAGE:Create +R002 DAMAGE:Destroy +R003 DAMAGE:Subtract +R004 DAMAGE:Add +V000 DAMAGE:Notify +E000 DAMAGE:BadDamage +R000 DEC-XTRAP:Reset +R001 DEC-XTRAP:GetAvailable +R002 DEC-XTRAP:Config +R003 DEC-XTRAP:StartTrap +R004 DEC-XTRAP:StopTrap +R005 DEC-XTRAP:GetCurrent +R006 DEC-XTRAP:GetStatistics +R007 DEC-XTRAP:SimulateXEvent +R008 DEC-XTRAP:GetVersion +R009 DEC-XTRAP:GetLastInpTime +V000 DEC-XTRAP:Event +E002 DEC-XTRAP:BadIO +E004 DEC-XTRAP:BadStatistics +E005 DEC-XTRAP:BadDevices +E007 DEC-XTRAP:BadScreen +E008 DEC-XTRAP:BadSwapReq +R000 DMX:DMXQueryVersion +R001 DMX:DMXGetScreenCount +R002 DMX:DMXGetScreenInfoDEPRECATED +R003 DMX:DMXGetWindowAttributes +R004 DMX:DMXGetInputCount +R005 DMX:DMXGetInputAttributes +R006 DMX:DMXForceWindowCreationDEPRECATED +R007 DMX:DMXReconfigureScreenDEPRECATED +R008 DMX:DMXSync +R009 DMX:DMXForceWindowCreation +R010 DMX:DMXGetScreenAttributes +R011 DMX:DMXChangeScreensAttributes +R012 DMX:DMXAddScreen +R013 DMX:DMXRemoveScreen +R014 DMX:DMXGetDesktopAttributes +R015 DMX:DMXChangeDesktopAttributes +R016 DMX:DMXAddInput +R017 DMX:DMXRemoveInput +R000 DOUBLE-BUFFER:GetVersion +R001 DOUBLE-BUFFER:AllocateBackBufferName +R002 DOUBLE-BUFFER:DeallocateBackBufferName +R003 DOUBLE-BUFFER:SwapBuffers +R004 DOUBLE-BUFFER:BeginIdiom +R005 DOUBLE-BUFFER:EndIdiom +R006 DOUBLE-BUFFER:GetVisualInfo +R007 DOUBLE-BUFFER:GetBackBufferAttributes +E000 DOUBLE-BUFFER:BadBuffer +R000 DPMS:GetVersion +R001 DPMS:Capable +R002 DPMS:GetTimeouts +R003 DPMS:SetTimeouts +R004 DPMS:Enable +R005 DPMS:Disable +R006 DPMS:ForceLevel +R007 DPMS:Info +R000 Extended-Visual-Information:QueryVersion +R001 Extended-Visual-Information:GetVisualInfo +R000 FontCache:QueryVersion +R001 FontCache:GetCacheSettings +R002 FontCache:ChangeCacheSettings +R003 FontCache:GetCacheStatistics +E000 FontCache:BadProtocol +E001 FontCache:CannotAllocMemory +R001 GLX: +R002 GLX:Large +R003 GLX:CreateContext +R004 GLX:DestroyContext +R005 GLX:MakeCurrent +R006 GLX:IsDirect +R007 GLX:QueryVersion +R008 GLX:WaitGL +R009 GLX:WaitX +R010 GLX:CopyContext +R011 GLX:SwapBuffers +R012 GLX:UseXFont +R013 GLX:CreateGLXPixmap +R014 GLX:GetVisualConfigs +R015 GLX:DestroyGLXPixmap +R016 GLX:VendorPrivate +R017 GLX:VendorPrivateWithReply +R018 GLX:QueryExtensionsString +R019 GLX:QueryServerString +R020 GLX:ClientInfo +R101 GLX:NewList +R102 GLX:EndList +R103 GLX:DeleteLists +R104 GLX:GenLists +R105 GLX:FeedbackBuffer +R106 GLX:SelectBuffer +R107 GLX:Mode +R108 GLX:Finish +R109 GLX:PixelStoref +R110 GLX:PixelStorei +R111 GLX:ReadPixels +R112 GLX:GetBooleanv +R113 GLX:GetClipPlane +R114 GLX:GetDoublev +R115 GLX:GetError +R116 GLX:GetFloatv +R117 GLX:GetIntegerv +R118 GLX:GetLightfv +R119 GLX:GetLightiv +R120 GLX:GetMapdv +R121 GLX:GetMapfv +R122 GLX:GetMapiv +R123 GLX:GetMaterialfv +R124 GLX:GetMaterialiv +R125 GLX:GetPixelfv +R126 GLX:GetPixelMapuiv +R127 GLX:GetPixelMapusv +R128 GLX:GetPolygonStipple +R129 GLX:GetString +R130 GLX:GetTexEnvfv +R131 GLX:GetTexEnviv +R132 GLX:GetTexGendv +R133 GLX:GetTexGenfv +R134 GLX:GetTexGeniv +R135 GLX:GetTexImage +R136 GLX:GetTexParameterfv +R137 GLX:GetTexParameteriv +R138 GLX:GetTexLevelParameterfv +R139 GLX:GetTexLevelParameteriv +R140 GLX:IsEnabled +R141 GLX:IsList +R142 GLX:Flush +E000 GLX:BadContext +E001 GLX:BadContextState +E002 GLX:BadDrawable +E003 GLX:BadPixmap +E004 GLX:BadContextTag +E005 GLX:BadCurrentWindow +E006 GLX:BadRenderRequest +E007 GLX:BadLargeRequest +E008 GLX:UnsupportedPrivateRequest +R000 LBX:QueryVersion +R001 LBX:StartProxy +R002 LBX:StopProxy +R003 LBX:Switch +R004 LBX:NewClient +R005 LBX:CloseClient +R006 LBX:ModifySequence +R007 LBX:AllowMotion +R008 LBX:IncrementPixel +R009 LBX:Delta +R010 LBX:GetModifierMapping +R011 LBX:QueryTag +R012 LBX:InvalidateTag +R013 LBX:PolyPoint +R014 LBX:PolyLine +R015 LBX:PolySegment +R016 LBX:PolyRectangle +R017 LBX:PolyArc +R018 LBX:FillPoly +R019 LBX:PolyFillRectangle +R020 LBX:PolyFillArc +R021 LBX:GetKeyboardMapping +R022 LBX:QueryFont +R023 LBX:ChangeProperty +R024 LBX:GetProperty +R025 LBX:TagData +R026 LBX:CopyArea +R027 LBX:CopyPlane +R028 LBX:PolyText8 +R029 LBX:PolyText16 +R030 LBX:ImageText8 +R031 LBX:ImageText16 +R032 LBX:QueryExtension +R033 LBX:PutImage +R034 LBX:GetImage +R035 LBX:BeginLargeRequest +R036 LBX:LargeRequestData +R037 LBX:EndLargeRequest +R038 LBX:InternAtoms +R039 LBX:GetWinAttrAndGeom +R040 LBX:GrabCmap +R041 LBX:ReleaseCmap +R042 LBX:AllocColor +R043 LBX:Sync +E000 LBX:BadLbxClient +R000 MIT-SCREEN-SAVER:QueryVersion +R001 MIT-SCREEN-SAVER:QueryInfo +R002 MIT-SCREEN-SAVER:SelectInput +R003 MIT-SCREEN-SAVER:SetAttributes +R004 MIT-SCREEN-SAVER:UnsetAttributes +R005 MIT-SCREEN-SAVER:Suspend +V000 MIT-SCREEN-SAVER:Notify +R000 MIT-SHM:QueryVersion +R001 MIT-SHM:Attach +R002 MIT-SHM:Detach +R003 MIT-SHM:PutImage +R004 MIT-SHM:GetImage +R005 MIT-SHM:CreatePixmap +V000 MIT-SHM:Completion +E000 MIT-SHM:BadShmSeg +R000 MIT-SUNDRY-NONSTANDARD:SetBugMode +R001 MIT-SUNDRY-NONSTANDARD:GetBugMode +R000 Multi-Buffering:GetBufferVersion +R001 Multi-Buffering:CreateImageBuffers +R002 Multi-Buffering:DestroyImageBuffers +R003 Multi-Buffering:DisplayImageBuffers +R004 Multi-Buffering:SetMBufferAttributes +R005 Multi-Buffering:GetMBufferAttributes +R006 Multi-Buffering:SetBufferAttributes +R007 Multi-Buffering:GetBufferAttributes +R008 Multi-Buffering:GetBufferInfo +R009 Multi-Buffering:CreateStereoWindow +R010 Multi-Buffering:ClearImageBufferArea +V000 Multi-Buffering:ClobberNotify +V001 Multi-Buffering:UpdateNotify +E000 Multi-Buffering:BadBuffer +R000 RANDR:QueryVersion +R001 RANDR:OldGetScreenInfo +R002 RANDR:SetScreenConfig +R003 RANDR:OldScreenChangeSelectInput +R004 RANDR:SelectInput +R005 RANDR:GetScreenInfo +R006 RANDR:GetScreenSizeRange +R007 RANDR:SetScreenSize +R008 RANDR:GetScreenResources +R009 RANDR:GetOutputInfo +R010 RANDR:ListOutputProperties +R011 RANDR:QueryOutputProperty +R012 RANDR:ConfigureOutputProperty +R013 RANDR:ChangeOutputProperty +R014 RANDR:DeleteOutputProperty +R015 RANDR:GetOutputProperty +R016 RANDR:CreateMode +R017 RANDR:DestroyMode +R018 RANDR:AddOutputMode +R019 RANDR:DeleteOutputMode +R020 RANDR:GetCrtcInfo +R021 RANDR:SetCrtcConfig +R022 RANDR:GetCrtcGammaSize +R023 RANDR:GetCrtcGamma +R024 RANDR:SetCrtcGamma +V000 RANDR:ScreenChangeNotify +V001 RANDR:Notify +E000 RANDR:BadRROutput +E001 RANDR:BadRRCrtc +E002 RANDR:BadRRMode +R000 RECORD:QueryVersion +R001 RECORD:CreateContext +R002 RECORD:RegisterClients +R003 RECORD:UnregisterClients +R004 RECORD:GetContext +R005 RECORD:EnableContext +R006 RECORD:DisableContext +R007 RECORD:FreeContext +E000 RECORD:BadContext +R000 RENDER:QueryVersion +R001 RENDER:QueryPictFormats +R002 RENDER:QueryPictIndexValues +R003 RENDER:QueryDithers +R004 RENDER:CreatePicture +R005 RENDER:ChangePicture +R006 RENDER:SetPictureClipRectangles +R007 RENDER:FreePicture +R008 RENDER:Composite +R009 RENDER:Scale +R010 RENDER:Trapezoids +R011 RENDER:Triangles +R012 RENDER:TriStrip +R013 RENDER:TriFan +R014 RENDER:ColorTrapezoids +R015 RENDER:ColorTriangles +R016 RENDER:Transform +R017 RENDER:CreateGlyphSet +R018 RENDER:ReferenceGlyphSet +R019 RENDER:FreeGlyphSet +R020 RENDER:AddGlyphs +R021 RENDER:AddGlyphsFromPicture +R022 RENDER:FreeGlyphs +R023 RENDER:CompositeGlyphs8 +R024 RENDER:CompositeGlyphs16 +R025 RENDER:CompositeGlyphs32 +R026 RENDER:FillRectangles +R027 RENDER:CreateCursor +R028 RENDER:SetPictureTransform +R029 RENDER:QueryFilters +R030 RENDER:SetPictureFilter +R031 RENDER:CreateAnimCursor +R032 RENDER:AddTraps +R033 RENDER:CreateSolidFill +R034 RENDER:CreateLinearGradient +R035 RENDER:CreateRadialGradient +R036 RENDER:CreateConicalGradient +E000 RENDER:BadPictFormat +E001 RENDER:BadPicture +E002 RENDER:BadPictOp +E003 RENDER:BadGlyphSet +E004 RENDER:BadGlyph +R000 SECURITY:QueryVersion +R001 SECURITY:GenerateAuthorization +R002 SECURITY:RevokeAuthorization +V000 SECURITY:AuthorizationRevoked +E000 SECURITY:BadAuthorization +E001 SECURITY:BadAuthorizationProtocol +R000 SELinux:SELinuxQueryVersion +R001 SELinux:SELinuxSetDeviceCreateContext +R002 SELinux:SELinuxGetDeviceCreateContext +R003 SELinux:SELinuxSetDeviceContext +R004 SELinux:SELinuxGetDeviceContext +R005 SELinux:SELinuxSetWindowCreateContext +R006 SELinux:SELinuxGetWindowCreateContext +R007 SELinux:SELinuxGetWindowContext +R008 SELinux:SELinuxSetPropertyCreateContext +R009 SELinux:SELinuxGetPropertyCreateContext +R010 SELinux:SELinuxSetPropertyUseContext +R011 SELinux:SELinuxGetPropertyUseContext +R012 SELinux:SELinuxGetPropertyContext +R013 SELinux:SELinuxGetPropertyDataContext +R014 SELinux:SELinuxListProperties +R015 SELinux:SELinuxSetSelectionCreateContext +R016 SELinux:SELinuxGetSelectionCreateContext +R017 SELinux:SELinuxSetSelectionUseContext +R018 SELinux:SELinuxGetSelectionUseContext +R019 SELinux:SELinuxGetSelectionContext +R020 SELinux:SELinuxGetSelectionDataContext +R021 SELinux:SELinuxListSelections +R022 SELinux:SELinuxGetClientContext +R000 SHAPE:QueryVersion +R001 SHAPE:Rectangles +R002 SHAPE:Mask +R003 SHAPE:Combine +R004 SHAPE:Offset +R005 SHAPE:QueryExtents +R006 SHAPE:SelectInput +R007 SHAPE:InputSelected +R008 SHAPE:GetRectangles +V000 SHAPE:Notify +R000 SYNC:Initialize +R001 SYNC:ListSystemCounters +R002 SYNC:CreateCounter +R003 SYNC:SetCounter +R004 SYNC:ChangeCounter +R005 SYNC:QueryCounter +R006 SYNC:DestroyCounter +R007 SYNC:Await +R008 SYNC:CreateAlarm +R009 SYNC:ChangeAlarm +R010 SYNC:QueryAlarm +R011 SYNC:DestroyAlarm +R012 SYNC:SetPriority +R013 SYNC:GetPriority +V000 SYNC:CounterNotify +V001 SYNC:AlarmNotify +E000 SYNC:BadCounter +E001 SYNC:BadAlarm +R000 TOG-CUP:QueryVersion +R001 TOG-CUP:GetReservedColormapEntries +R002 TOG-CUP:StoreColors +R000 Windows-WM:QueryVersion +R001 Windows-WM:FrameGetRect +R002 Windows-WM:FrameDraw +R003 Windows-WM:FrameSetTitle +R004 Windows-WM:DisableUpdate +R005 Windows-WM:ReenableUpdate +R006 Windows-WM:SelectInput +R007 Windows-WM:SetFrontProcess +V000 Windows-WM:ControllerNotify +V001 Windows-WM:ActivationNotify +E000 Windows-WM:ClientNotLocal +E001 Windows-WM:OperationNotSupported +R000 X-Resource:QueryVersion +R001 X-Resource:QueryClients +R002 X-Resource:QueryClientResources +R003 X-Resource:QueryClientPixmapBytes +R001 X11:CreateWindow +R002 X11:ChangeWindowAttributes +R003 X11:GetWindowAttributes +R004 X11:DestroyWindow +R005 X11:DestroySubwindows +R006 X11:ChangeSaveSet +R007 X11:ReparentWindow +R008 X11:MapWindow +R009 X11:MapSubwindows +R010 X11:UnmapWindow +R011 X11:UnmapSubwindows +R012 X11:ConfigureWindow +R013 X11:CirculateWindow +R014 X11:GetGeometry +R015 X11:QueryTree +R016 X11:InternAtom +R017 X11:GetAtomName +R018 X11:ChangeProperty +R019 X11:DeleteProperty +R020 X11:GetProperty +R021 X11:ListProperties +R022 X11:SetSelectionOwner +R023 X11:GetSelectionOwner +R024 X11:ConvertSelection +R025 X11:SendEvent +R026 X11:GrabPointer +R027 X11:UngrabPointer +R028 X11:GrabButton +R029 X11:UngrabButton +R030 X11:ChangeActivePointerGrab +R031 X11:GrabKeyboard +R032 X11:UngrabKeyboard +R033 X11:GrabKey +R034 X11:UngrabKey +R035 X11:AllowEvents +R036 X11:GrabServer +R037 X11:UngrabServer +R038 X11:QueryPointer +R039 X11:GetMotionEvents +R040 X11:TranslateCoords +R041 X11:WarpPointer +R042 X11:SetInputFocus +R043 X11:GetInputFocus +R044 X11:QueryKeymap +R045 X11:OpenFont +R046 X11:CloseFont +R047 X11:QueryFont +R048 X11:QueryTextExtents +R049 X11:ListFonts +R050 X11:ListFontsWithInfo +R051 X11:SetFontPath +R052 X11:GetFontPath +R053 X11:CreatePixmap +R054 X11:FreePixmap +R055 X11:CreateGC +R056 X11:ChangeGC +R057 X11:CopyGC +R058 X11:SetDashes +R059 X11:SetClipRectangles +R060 X11:FreeGC +R061 X11:ClearArea +R062 X11:CopyArea +R063 X11:CopyPlane +R064 X11:PolyPoint +R065 X11:PolyLine +R066 X11:PolySegment +R067 X11:PolyRectangle +R068 X11:PolyArc +R069 X11:FillPoly +R070 X11:PolyFillRectangle +R071 X11:PolyFillArc +R072 X11:PutImage +R073 X11:GetImage +R074 X11:PolyText8 +R075 X11:PolyText16 +R076 X11:ImageText8 +R077 X11:ImageText16 +R078 X11:CreateColormap +R079 X11:FreeColormap +R080 X11:CopyColormapAndFree +R081 X11:InstallColormap +R082 X11:UninstallColormap +R083 X11:ListInstalledColormaps +R084 X11:AllocColor +R085 X11:AllocNamedColor +R086 X11:AllocColorCells +R087 X11:AllocColorPlanes +R088 X11:FreeColors +R089 X11:StoreColors +R090 X11:StoreNamedColor +R091 X11:QueryColors +R092 X11:LookupColor +R093 X11:CreateCursor +R094 X11:CreateGlyphCursor +R095 X11:FreeCursor +R096 X11:RecolorCursor +R097 X11:QueryBestSize +R098 X11:QueryExtension +R099 X11:ListExtensions +R100 X11:ChangeKeyboardMapping +R101 X11:GetKeyboardMapping +R102 X11:ChangeKeyboardControl +R103 X11:GetKeyboardControl +R104 X11:Bell +R105 X11:ChangePointerControl +R106 X11:GetPointerControl +R107 X11:SetScreenSaver +R108 X11:GetScreenSaver +R109 X11:ChangeHosts +R110 X11:ListHosts +R111 X11:SetAccessControl +R112 X11:SetCloseDownMode +R113 X11:KillClient +R114 X11:RotateProperties +R115 X11:ForceScreenSaver +R116 X11:SetPointerMapping +R117 X11:GetPointerMapping +R118 X11:SetModifierMapping +R119 X11:GetModifierMapping +R127 X11:NoOperation +V000 X11:X_Error +V001 X11:X_Reply +V002 X11:KeyPress +V003 X11:KeyRelease +V004 X11:ButtonPress +V005 X11:ButtonRelease +V006 X11:MotionNotify +V007 X11:EnterNotify +V008 X11:LeaveNotify +V009 X11:FocusIn +V010 X11:FocusOut +V011 X11:KeymapNotify +V012 X11:Expose +V013 X11:GraphicsExpose +V014 X11:NoExpose +V015 X11:VisibilityNotify +V016 X11:CreateNotify +V017 X11:DestroyNotify +V018 X11:UnmapNotify +V019 X11:MapNotify +V020 X11:MapRequest +V021 X11:ReparentNotify +V022 X11:ConfigureNotify +V023 X11:ConfigureRequest +V024 X11:GravityNotify +V025 X11:ResizeRequest +V026 X11:CirculateNotify +V027 X11:CirculateRequest +V028 X11:PropertyNotify +V029 X11:SelectionClear +V030 X11:SelectionRequest +V031 X11:SelectionNotify +V032 X11:ColormapNotify +V033 X11:ClientMessage +V034 X11:MappingNotify +E000 X11:Success +E001 X11:BadRequest +E002 X11:BadValue +E003 X11:BadWindow +E004 X11:BadPixmap +E005 X11:BadAtom +E006 X11:BadCursor +E007 X11:BadFont +E008 X11:BadMatch +E009 X11:BadDrawable +E010 X11:BadAccess +E011 X11:BadAlloc +E012 X11:BadColor +E013 X11:BadGC +E014 X11:BadIDChoice +E015 X11:BadName +E016 X11:BadLength +E017 X11:BadImplementation +R001 X3D-PEX:GetExtensionInfo +R002 X3D-PEX:GetEnumeratedTypeInfo +R003 X3D-PEX:GetImpDepConstants +R004 X3D-PEX:CreateLookupTable +R005 X3D-PEX:CopyLookupTable +R006 X3D-PEX:FreeLookupTable +R007 X3D-PEX:GetTableInfo +R008 X3D-PEX:GetPredefinedEntries +R009 X3D-PEX:GetDefinedIndices +R010 X3D-PEX:GetTableEntry +R011 X3D-PEX:GetTableEntries +R012 X3D-PEX:SetTableEntries +R013 X3D-PEX:DeleteTableEntries +R014 X3D-PEX:CreatePipelineContext +R015 X3D-PEX:CopyPipelineContext +R016 X3D-PEX:FreePipelineContext +R017 X3D-PEX:GetPipelineContext +R018 X3D-PEX:ChangePipelineContext +R019 X3D-PEX:CreateRenderer +R020 X3D-PEX:FreeRenderer +R021 X3D-PEX:ChangeRenderer +R022 X3D-PEX:GetRendererAttributes +R023 X3D-PEX:GetRendererDynamics +R024 X3D-PEX:BeginRendering +R025 X3D-PEX:EndRendering +R026 X3D-PEX:BeginStructure +R027 X3D-PEX:EndStructure +R028 X3D-PEX:OutputCommands +R029 X3D-PEX:Network +R030 X3D-PEX:CreateStructure +R031 X3D-PEX:CopyStructure +R032 X3D-PEX:DestroyStructures +R033 X3D-PEX:GetStructureInfo +R034 X3D-PEX:GetElementInfo +R035 X3D-PEX:GetStructuresInNetwork +R036 X3D-PEX:GetAncestors +R037 X3D-PEX:GetDescendants +R038 X3D-PEX:FetchElements +R039 X3D-PEX:SetEditingMode +R040 X3D-PEX:SetElementPointer +R041 X3D-PEX:SetElementPointerAtLabel +R042 X3D-PEX:ElementSearch +R043 X3D-PEX:StoreElements +R044 X3D-PEX:DeleteElements +R045 X3D-PEX:DeleteElementsToLabel +R046 X3D-PEX:DeleteBetweenLabels +R047 X3D-PEX:CopyElements +R048 X3D-PEX:ChangeStructureRefs +R049 X3D-PEX:CreateNameSet +R050 X3D-PEX:CopyNameSet +R051 X3D-PEX:FreeNameSet +R052 X3D-PEX:GetNameSet +R053 X3D-PEX:ChangeNameSet +R054 X3D-PEX:CreateSearchContext +R055 X3D-PEX:CopySearchContext +R056 X3D-PEX:FreeSearchContext +R057 X3D-PEX:GetSearchContext +R058 X3D-PEX:ChangeSearchContext +R059 X3D-PEX:SearchNetwork +R060 X3D-PEX:CreatePhigsWks +R061 X3D-PEX:FreePhigsWks +R062 X3D-PEX:GetWksInfo +R063 X3D-PEX:GetDynamics +R064 X3D-PEX:GetViewRep +R065 X3D-PEX:RedrawAllStructures +R066 X3D-PEX:UpdateWorkstation +R067 X3D-PEX:RedrawClipRegion +R068 X3D-PEX:ExecuteDeferredActions +R069 X3D-PEX:SetViewPriority +R070 X3D-PEX:SetDisplayUpdateMode +R071 X3D-PEX:MapDCtoWC +R072 X3D-PEX:MapWCtoDC +R073 X3D-PEX:SetViewRep +R074 X3D-PEX:SetWksWindow +R075 X3D-PEX:SetWksViewport +R076 X3D-PEX:SetHlhsrMode +R077 X3D-PEX:SetWksBufferMode +R078 X3D-PEX:PostStructure +R079 X3D-PEX:UnpostStructure +R080 X3D-PEX:UnpostAllStructures +R081 X3D-PEX:GetWksPostings +R082 X3D-PEX:GetPickDevice +R083 X3D-PEX:ChangePickDevice +R084 X3D-PEX:CreatePickMeasure +R085 X3D-PEX:FreePickMeasure +R086 X3D-PEX:GetPickMeasure +R087 X3D-PEX:UpdatePickMeasure +R088 X3D-PEX:OpenFont +R089 X3D-PEX:CloseFont +R090 X3D-PEX:QueryFont +R091 X3D-PEX:ListFonts +R092 X3D-PEX:ListFontsWithInfo +R093 X3D-PEX:QueryTextExtents +R094 X3D-PEX:MatchRenderingTargets +R095 X3D-PEX:Escape +R096 X3D-PEX:EscapeWithReply +R097 X3D-PEX:Elements +R098 X3D-PEX:AccumulateState +R099 X3D-PEX:BeginPickOne +R100 X3D-PEX:EndPickOne +R101 X3D-PEX:PickOne +R102 X3D-PEX:BeginPickAll +R103 X3D-PEX:EndPickAll +R104 X3D-PEX:PickAll +E000 X3D-PEX:ColorTypeError +E001 X3D-PEX:erStateError +E002 X3D-PEX:FloatingPointFormatError +E003 X3D-PEX:LabelError +E004 X3D-PEX:LookupTableError +E005 X3D-PEX:NameSetError +E006 X3D-PEX:PathError +E007 X3D-PEX:FontError +E008 X3D-PEX:PhigsWksError +E009 X3D-PEX:PickMeasureError +E010 X3D-PEX:PipelineContextError +E011 X3D-PEX:erError +E012 X3D-PEX:SearchContextError +E013 X3D-PEX:StructureError +E014 X3D-PEX:OutputCommandError +R000 XC-APPGROUP:QueryVersion +R001 XC-APPGROUP:Create +R002 XC-APPGROUP:Destroy +R003 XC-APPGROUP:GetAttr +R004 XC-APPGROUP:Query +R005 XC-APPGROUP:CreateAssoc +R006 XC-APPGROUP:DestroyAssoc +E000 XC-APPGROUP:BadAppGroup +R000 XC-MISC:GetVersion +R001 XC-MISC:GetXIDRange +R002 XC-MISC:GetXIDList +R000 XEVIE:QueryVersion +R001 XEVIE:Start +R002 XEVIE:End +R003 XEVIE:Send +R004 XEVIE:SelectInput +R000 XFIXES:QueryVersion +R001 XFIXES:ChangeSaveSet +R002 XFIXES:SelectSelectionInput +R003 XFIXES:SelectCursorInput +R004 XFIXES:GetCursorImage +R005 XFIXES:CreateRegion +R006 XFIXES:CreateRegionFromBitmap +R007 XFIXES:CreateRegionFromWindow +R008 XFIXES:CreateRegionFromGC +R009 XFIXES:CreateRegionFromPicture +R010 XFIXES:DestroyRegion +R011 XFIXES:SetRegion +R012 XFIXES:CopyRegion +R013 XFIXES:UnionRegion +R014 XFIXES:IntersectRegion +R015 XFIXES:SubtractRegion +R016 XFIXES:InvertRegion +R017 XFIXES:TranslateRegion +R018 XFIXES:RegionExtents +R019 XFIXES:FetchRegion +R020 XFIXES:SetGCClipRegion +R021 XFIXES:SetWindowShapeRegion +R022 XFIXES:SetPictureClipRegion +R023 XFIXES:SetCursorName +R024 XFIXES:GetCursorName +R025 XFIXES:GetCursorImageAndName +R026 XFIXES:ChangeCursor +R027 XFIXES:ChangeCursorByName +R028 XFIXES:ExpandRegion +R029 XFIXES:HideCursor +R030 XFIXES:ShowCursor +V000 XFIXES:SelectionNotify +V001 XFIXES:CursorNotify +E000 XFIXES:BadRegion +R000 XFree86-Bigfont:QueryVersion +R001 XFree86-Bigfont:QueryFont +R000 XFree86-DGA:QueryVersion +R001 XFree86-DGA:GetVideoLL +R002 XFree86-DGA:DirectVideo +R003 XFree86-DGA:GetViewPortSize +R004 XFree86-DGA:SetViewPort +R005 XFree86-DGA:GetVidPage +R006 XFree86-DGA:SetVidPage +R007 XFree86-DGA:InstallColormap +R008 XFree86-DGA:QueryDirectVideo +R009 XFree86-DGA:ViewPortChanged +R010 XFree86-DGA:Obsolete1 +R011 XFree86-DGA:Obsolete2 +R012 XFree86-DGA:QueryModes +R013 XFree86-DGA:SetMode +R014 XFree86-DGA:SetViewport +R015 XFree86-DGA:InstallColormap +R016 XFree86-DGA:SelectInput +R017 XFree86-DGA:FillRectangle +R018 XFree86-DGA:CopyArea +R019 XFree86-DGA:CopyTransparentArea +R020 XFree86-DGA:GetViewportStatus +R021 XFree86-DGA:Sync +R022 XFree86-DGA:OpenFramebuffer +R023 XFree86-DGA:CloseFramebuffer +R024 XFree86-DGA:SetClientVersion +R025 XFree86-DGA:ChangePixmapMode +R026 XFree86-DGA:CreateColormap +E000 XFree86-DGA:ClientNotLocal +E001 XFree86-DGA:NoDirectVideoMode +E002 XFree86-DGA:ScreenNotActive +E003 XFree86-DGA:DirectNotActivated +E004 XFree86-DGA:OperationNotSupported +R000 XFree86-DRI:QueryVersion +R001 XFree86-DRI:QueryDirectRenderingCapable +R002 XFree86-DRI:OpenConnection +R003 XFree86-DRI:CloseConnection +R004 XFree86-DRI:GetClientDriverName +R005 XFree86-DRI:CreateContext +R006 XFree86-DRI:DestroyContext +R007 XFree86-DRI:CreateDrawable +R008 XFree86-DRI:DestroyDrawable +R009 XFree86-DRI:GetDrawableInfo +R010 XFree86-DRI:GetDeviceInfo +R011 XFree86-DRI:AuthConnection +R012 XFree86-DRI:OpenFullScreen +R013 XFree86-DRI:CloseFullScreen +E000 XFree86-DRI:ClientNotLocal +E001 XFree86-DRI:OperationNotSupported +R000 XFree86-Misc:QueryVersion +R001 XFree86-Misc:GetSaver +R002 XFree86-Misc:SetSaver +R003 XFree86-Misc:GetMouseSettings +R004 XFree86-Misc:GetKbdSettings +R005 XFree86-Misc:SetMouseSettings +R006 XFree86-Misc:SetKbdSettings +R007 XFree86-Misc:SetGrabKeysState +R008 XFree86-Misc:SetClientVersion +R009 XFree86-Misc:GetFilePaths +R010 XFree86-Misc:PassMessage +E000 XFree86-Misc:BadMouseProtocol +E001 XFree86-Misc:BadMouseBaudRate +E002 XFree86-Misc:BadMouseFlags +E003 XFree86-Misc:BadMouseCombo +E004 XFree86-Misc:BadKbdType +E005 XFree86-Misc:ModInDevDisabled +E006 XFree86-Misc:ModInDevClientNotLocal +E007 XFree86-Misc:NoModule +R000 XFree86-VidModeExtension:QueryVersion +R001 XFree86-VidModeExtension:GetModeLine +R002 XFree86-VidModeExtension:ModModeLine +R003 XFree86-VidModeExtension:SwitchMode +R004 XFree86-VidModeExtension:GetMonitor +R005 XFree86-VidModeExtension:LockModeSwitch +R006 XFree86-VidModeExtension:GetAllModeLines +R007 XFree86-VidModeExtension:AddModeLine +R008 XFree86-VidModeExtension:DeleteModeLine +R009 XFree86-VidModeExtension:ValidateModeLine +R010 XFree86-VidModeExtension:SwitchToMode +R011 XFree86-VidModeExtension:GetViewPort +R012 XFree86-VidModeExtension:SetViewPort +R013 XFree86-VidModeExtension:GetDotClocks +R014 XFree86-VidModeExtension:SetClientVersion +R015 XFree86-VidModeExtension:SetGamma +R016 XFree86-VidModeExtension:GetGamma +R017 XFree86-VidModeExtension:GetGammaRamp +R018 XFree86-VidModeExtension:SetGammaRamp +R019 XFree86-VidModeExtension:GetGammaRampSize +R020 XFree86-VidModeExtension:GetPermissions +V000 XFree86-VidModeExtension:Notify +E000 XFree86-VidModeExtension:BadClock +E001 XFree86-VidModeExtension:BadHTimings +E002 XFree86-VidModeExtension:BadVTimings +E003 XFree86-VidModeExtension:ModeUnsuitable +E004 XFree86-VidModeExtension:ExtensionDisabled +E005 XFree86-VidModeExtension:ClientNotLocal +E006 XFree86-VidModeExtension:ZoomLocked +R001 XIE:QueryImageExtension +R002 XIE:QueryTechniques +R003 XIE:CreateColorList +R004 XIE:DestroyColorList +R005 XIE:PurgeColorList +R006 XIE:QueryColorList +R007 XIE:CreateLUT +R008 XIE:DestroyLUT +R009 XIE:CreatePhotomap +R010 XIE:DestroyPhotomap +R011 XIE:QueryPhotomap +R012 XIE:CreateROI +R013 XIE:DestroyROI +R014 XIE:CreatePhotospace +R015 XIE:DestroyPhotospace +R016 XIE:ExecuteImmediate +R017 XIE:CreatePhotoflo +R018 XIE:DestroyPhotoflo +R019 XIE:ExecutePhotoflo +R020 XIE:ModifyPhotoflo +R021 XIE:RedefinePhotoflo +R022 XIE:PutClientData +R023 XIE:GetClientData +R024 XIE:QueryPhotoflo +R025 XIE:Await +R026 XIE:Abort +E000 XIE:ColorListError +E001 XIE:LUTError +E002 XIE:PhotofloError +E003 XIE:PhotomapError +E004 XIE:PhotospaceError +E005 XIE:ROIError +E006 XIE:FloError +R000 XINERAMA:QueryVersion +R001 XINERAMA:GetState +R002 XINERAMA:GetScreenCount +R003 XINERAMA:GetScreenSize +R004 XINERAMA:IsActive +R005 XINERAMA:QueryScreens +R001 XInputExtension:GetExtensionVersion +R002 XInputExtension:ListInputDevices +R003 XInputExtension:OpenDevice +R004 XInputExtension:CloseDevice +R005 XInputExtension:SetDeviceMode +R006 XInputExtension:SelectExtensionEvent +R007 XInputExtension:GetSelectedExtensionEvents +R008 XInputExtension:ChangeDeviceDontPropagateList +R009 XInputExtension:GetDeviceDontPropagageList +R010 XInputExtension:GetDeviceMotionEvents +R011 XInputExtension:ChangeKeyboardDevice +R012 XInputExtension:ChangePointerDevice +R013 XInputExtension:GrabDevice +R014 XInputExtension:UngrabDevice +R015 XInputExtension:GrabDeviceKey +R016 XInputExtension:UngrabDeviceKey +R017 XInputExtension:GrabDeviceButton +R018 XInputExtension:UngrabDeviceButton +R019 XInputExtension:AllowDeviceEvents +R020 XInputExtension:GetDeviceFocus +R021 XInputExtension:SetDeviceFocus +R022 XInputExtension:GetFeedbackControl +R023 XInputExtension:ChangeFeedbackControl +R024 XInputExtension:GetDeviceKeyMapping +R025 XInputExtension:ChangeDeviceKeyMapping +R026 XInputExtension:GetDeviceModifierMapping +R027 XInputExtension:SetDeviceModifierMapping +R028 XInputExtension:GetDeviceButtonMapping +R029 XInputExtension:SetDeviceButtonMapping +R030 XInputExtension:QueryDeviceState +R031 XInputExtension:SendExtensionEvent +R032 XInputExtension:DeviceBell +R033 XInputExtension:SetDeviceValuators +R034 XInputExtension:GetDeviceControl +R035 XInputExtension:ChangeDeviceControl +V000 XInputExtension:DeviceValuator +V001 XInputExtension:DeviceKeyPress +V002 XInputExtension:DeviceKeyRelease +V003 XInputExtension:DeviceButtonPress +V004 XInputExtension:DeviceButtonRelease +V005 XInputExtension:DeviceMotionNotify +V006 XInputExtension:DeviceFocusIn +V007 XInputExtension:DeviceFocusOut +V008 XInputExtension:ProximityIn +V009 XInputExtension:ProximityOut +V010 XInputExtension:DeviceStateNotify +V011 XInputExtension:DeviceMappingNotify +V012 XInputExtension:ChangeDeviceNotify +V013 XInputExtension:DeviceKeystateNotify +V014 XInputExtension:DeviceButtonstateNotify +V015 XInputExtension:DevicePresenceNotify +E000 XInputExtension:BadDevice +E001 XInputExtension:BadEvent +E002 XInputExtension:BadMode +E003 XInputExtension:DeviceBusy +E004 XInputExtension:BadClass +R000 XKEYBOARD:UseExtension +R001 XKEYBOARD:SelectEvents +R002 XKEYBOARD:Obsolete +R003 XKEYBOARD:Bell +R004 XKEYBOARD:GetState +R005 XKEYBOARD:LatchLockState +R006 XKEYBOARD:GetControls +R007 XKEYBOARD:SetControls +R008 XKEYBOARD:GetMap +R009 XKEYBOARD:SetMap +R010 XKEYBOARD:GetCompatMap +R011 XKEYBOARD:SetCompatMap +R012 XKEYBOARD:GetIndicatorState +R013 XKEYBOARD:GetIndicatorMap +R014 XKEYBOARD:SetIndicatorMap +R015 XKEYBOARD:GetNamedIndicator +R016 XKEYBOARD:SetNamedIndicator +R017 XKEYBOARD:GetNames +R018 XKEYBOARD:SetNames +R019 XKEYBOARD:GetGeometry +R020 XKEYBOARD:SetGeometry +R021 XKEYBOARD:PerClientFlags +R022 XKEYBOARD:ListComponents +R023 XKEYBOARD:GetKbdByName +R024 XKEYBOARD:GetDeviceInfo +R025 XKEYBOARD:SetDeviceInfo +R101 XKEYBOARD:SetDebuggingFlags +V000 XKEYBOARD:EventCode +E000 XKEYBOARD:BadKeyboard +R000 XTEST:GetVersion +R001 XTEST:CompareCursor +R002 XTEST:FakeInput +R003 XTEST:GrabControl +R000 XVideo:QueryExtension +R001 XVideo:QueryAdaptors +R002 XVideo:QueryEncodings +R003 XVideo:GrabPort +R004 XVideo:UngrabPort +R005 XVideo:PutVideo +R006 XVideo:PutStill +R007 XVideo:GetVideo +R008 XVideo:GetStill +R009 XVideo:StopVideo +R010 XVideo:SelectVideoNotify +R011 XVideo:SelectPortNotify +R012 XVideo:QueryBestSize +R013 XVideo:SetPortAttribute +R014 XVideo:GetPortAttribute +R015 XVideo:QueryPortAttributes +R016 XVideo:ListImageFormats +R017 XVideo:QueryImageAttributes +R018 XVideo:PutImage +R019 XVideo:ShmPutImage +V000 XVideo:VideoNotify +V001 XVideo:PortNotify +E000 XVideo:BadPort +E001 XVideo:BadEncoding +E002 XVideo:BadControl +R000 XVideo-MotionCompensation:QueryVersion +R001 XVideo-MotionCompensation:ListSurfaceTypes +R002 XVideo-MotionCompensation:CreateContext +R003 XVideo-MotionCompensation:DestroyContext +R004 XVideo-MotionCompensation:CreateSurface +R005 XVideo-MotionCompensation:DestroySurface +R006 XVideo-MotionCompensation:CreateSubpicture +R007 XVideo-MotionCompensation:DestroySubpicture +R008 XVideo-MotionCompensation:ListSubpictureTypes +R009 XVideo-MotionCompensation:GetDRInfo +E000 XVideo-MotionCompensation:BadContext +E001 XVideo-MotionCompensation:BadSurface +E002 XVideo-MotionCompensation:BadSubpicture +R000 XpExtension:QueryVersion +R001 XpExtension:GetPrinterList +R002 XpExtension:CreateContext +R003 XpExtension:SetContext +R004 XpExtension:GetContext +R005 XpExtension:DestroyContext +R006 XpExtension:GetContextScreen +R007 XpExtension:StartJob +R008 XpExtension:EndJob +R009 XpExtension:StartDoc +R010 XpExtension:EndDoc +R011 XpExtension:PutDocumentData +R012 XpExtension:GetDocumentData +R013 XpExtension:StartPage +R014 XpExtension:EndPage +R015 XpExtension:SelectInput +R016 XpExtension:InputSelected +R017 XpExtension:GetAttributes +R018 XpExtension:SetAttributes +R019 XpExtension:GetOneAttribute +R020 XpExtension:RehashPrinterList +R021 XpExtension:GetPageDimensions +R022 XpExtension:QueryScreens +R023 XpExtension:SetImageResolution +R024 XpExtension:GetImageResolution +V000 XpExtension:PrintNotify +V001 XpExtension:AttributeNotify +E000 XpExtension:BadContext +E001 XpExtension:BadSequence +E002 XpExtension:BadResourceID diff --git a/xorg-server/randr/makefile b/xorg-server/randr/makefile new file mode 100644 index 000000000..ea6fa3fde --- /dev/null +++ b/xorg-server/randr/makefile @@ -0,0 +1,4 @@ +CSRCS=mirandr.c randr.c rrcrtc.c rrdispatch.c rrinfo.c rrmode.c rroutput.c rrpointer.c rrproperty.c rrscreen.c rrsdispatch.c
+
+LIBRARY=librandr
+
diff --git a/xorg-server/randr/rroutput.c b/xorg-server/randr/rroutput.c index 1ecde31a2..af456e93a 100644 --- a/xorg-server/randr/rroutput.c +++ b/xorg-server/randr/rroutput.c @@ -23,6 +23,11 @@ #include "randrstr.h" #include "registry.h" +/* From render.h */ +#ifndef SubPixelUnknown +#define SubPixelUnknown 0 +#endif + RESTYPE RROutputType; /* diff --git a/xorg-server/randr/rrscreen.c b/xorg-server/randr/rrscreen.c index f39197337..e357189ca 100644 --- a/xorg-server/randr/rrscreen.c +++ b/xorg-server/randr/rrscreen.c @@ -22,6 +22,11 @@ #include "randrstr.h" +/* From render.h */ +#ifndef SubPixelUnknown +#define SubPixelUnknown 0 +#endif + extern char *ConnectionInfo; static int padlength[4] = {0, 3, 2, 1}; diff --git a/xorg-server/record/makefile b/xorg-server/record/makefile new file mode 100644 index 000000000..1cef2de18 --- /dev/null +++ b/xorg-server/record/makefile @@ -0,0 +1,4 @@ +CSRCS = record.c set.c + +LIBRARY=librecord + diff --git a/xorg-server/render/makefile b/xorg-server/render/makefile new file mode 100644 index 000000000..1490c7c59 --- /dev/null +++ b/xorg-server/render/makefile @@ -0,0 +1,4 @@ +CSRCS=animcur.c filter.c glyph.c miindex.c mipict.c mirect.c mitrap.c mitri.c picture.c render.c renderedge.c
+
+LIBRARY=librender
+
diff --git a/xorg-server/render/mipict.c b/xorg-server/render/mipict.c index 87dccbbda..dde4134fb 100644 --- a/xorg-server/render/mipict.c +++ b/xorg-server/render/mipict.c @@ -266,7 +266,7 @@ miChangePictureFilter (PicturePtr pPicture, #define BOUND(v) (INT16) ((v) < MINSHORT ? MINSHORT : (v) > MAXSHORT ? MAXSHORT : (v)) -static inline pixman_bool_t +static __inline pixman_bool_t miClipPictureReg (pixman_region16_t * pRegion, pixman_region16_t * pClip, int dx, diff --git a/xorg-server/startmulti.bat b/xorg-server/startmulti.bat new file mode 100644 index 000000000..1f9d4980a --- /dev/null +++ b/xorg-server/startmulti.bat @@ -0,0 +1 @@ +vcxsrv :1 -ac -terminate -lesspointer -multiwindow -clipboard +kb
diff --git a/xorg-server/startxdmcp.bat b/xorg-server/startxdmcp.bat new file mode 100644 index 000000000..0f4c2485f --- /dev/null +++ b/xorg-server/startxdmcp.bat @@ -0,0 +1,2 @@ +vcxsrv :1 -query 192.168.37.20 -clipboard -ac -xkblayout be -logverbose 3
+
diff --git a/xorg-server/xfixes/cursor.c b/xorg-server/xfixes/cursor.c index d51251f19..ba2e36775 100644 --- a/xorg-server/xfixes/cursor.c +++ b/xorg-server/xfixes/cursor.c @@ -42,6 +42,8 @@ #ifdef HAVE_DIX_CONFIG_H #include <dix-config.h> +#else +#define XFIXES #endif #include "xfixesint.h" diff --git a/xorg-server/xfixes/makefile b/xorg-server/xfixes/makefile new file mode 100644 index 000000000..73df36c4e --- /dev/null +++ b/xorg-server/xfixes/makefile @@ -0,0 +1,9 @@ +CSRCS = cursor.c \ + region.c \ + saveset.c \ + select.c \ + xfixes.c + +LIBRARY=libxfixes + + diff --git a/xorg-server/xkb/makefile b/xorg-server/xkb/makefile new file mode 100644 index 000000000..dc1b559e0 --- /dev/null +++ b/xorg-server/xkb/makefile @@ -0,0 +1,47 @@ +DEFINES += HAVE_XKB_CONFIG_H + +DDX_SRCS = \ + ddxBeep.c \ + ddxCtrls.c \ + ddxFakeBtn.c \ + ddxFakeMtn.c \ + ddxInit.c \ + ddxKeyClick.c \ + ddxLEDs.c \ + ddxLoad.c \ + ddxList.c \ + ddxDevBtn.c + +DIX_SRCS = \ + xkb.c \ + xkbUtils.c \ + xkbEvents.c \ + xkbAccessX.c \ + xkbSwap.c \ + xkbLEDs.c \ + xkbInit.c \ + xkbActions.c \ + xkbPrKeyEv.c + +# this should be replaced by a common library or something, ideally -d +XKBFILE_SRCS = \ + maprules.c \ + xkmread.c \ + xkbtext.c \ + xkbfmisc.c \ + xkbout.c + +X11_SRCS = \ + XKBMisc.c \ + XKBAlloc.c \ + XKBGAlloc.c \ + XKBMAlloc.c + +# ends up unused... +# XI_SRCS = xkbPrOtherEv.c + +CSRCS = $(DDX_SRCS) $(DIX_SRCS) $(XI_SRCS) $(XKBFILE_SRCS) \ + $(X11_SRCS) ddxVT.c ddxPrivate.c ddxKillSrv.c + +LIBRARY=libxkb + diff --git a/xorg-server/xkb/xkb.c b/xorg-server/xkb/xkb.c index 7c569d483..4850a50de 100644 --- a/xorg-server/xkb/xkb.c +++ b/xorg-server/xkb/xkb.c @@ -5579,6 +5579,8 @@ ProcXkbGetKbdByName(ClientPtr client) if (!(client->xkbClientFlags&_XkbClientInitialized)) return BadAccess; + memset(&mrep,0,sizeof(mrep)); //MH + CHK_KBD_DEVICE(dev, stuff->deviceSpec, client, access_mode); xkb = dev->key->xkbInfo->desc; diff --git a/xorg-server/xkb/xkbActions.c b/xorg-server/xkb/xkbActions.c index 8c72874df..0b7e03032 100644 --- a/xorg-server/xkb/xkbActions.c +++ b/xorg-server/xkb/xkbActions.c @@ -1031,15 +1031,15 @@ _XkbFilterDeviceBtn( XkbSrvInfoPtr xkbi, DeviceIntPtr dev; int button; - if (dev == inputInfo.keyboard) - return 0; - if (filter->keycode==0) { /* initial press */ _XkbLookupButtonDevice(&dev, pAction->devbtn.device, serverClient, DixUnknownAccess, &button); if (!dev || !dev->public.on || dev == inputInfo.pointer) return 1; + if (dev == inputInfo.keyboard) + return 0; + button= pAction->devbtn.button; if ((button<1)||(button>dev->button->numButtons)) return 1; diff --git a/xorg-server/xkb/xkbInit.c b/xorg-server/xkb/xkbInit.c index 3b47396e5..c1be14c8e 100644 --- a/xorg-server/xkb/xkbInit.c +++ b/xorg-server/xkb/xkbInit.c @@ -35,7 +35,9 @@ THE USE OR PERFORMANCE OF THIS SOFTWARE. #include <stdio.h> #include <stdlib.h> #include <ctype.h> +#ifndef _MSC_VER #include <unistd.h> +#endif #include <math.h> #define NEED_EVENTS 1 #include <X11/X.h> @@ -95,10 +97,10 @@ typedef struct _SrvXkmInfo { /***====================================================================***/ #ifndef XKB_BASE_DIRECTORY -#define XKB_BASE_DIRECTORY "/usr/lib/X11/xkb" +#define XKB_BASE_DIRECTORY "xkbdata" #endif #ifndef XKB_BIN_DIRECTORY -#define XKB_BIN_DIRECTORY XKB_BASE_DIRECTORY +#define XKB_BIN_DIRECTORY "." #endif #ifndef XKB_DFLT_RULES_FILE #define XKB_DFLT_RULES_FILE "rules" diff --git a/xorg-server/xkbdata.src/compat/makefile b/xorg-server/xkbdata.src/compat/makefile new file mode 100644 index 000000000..0598a1fd9 --- /dev/null +++ b/xorg-server/xkbdata.src/compat/makefile @@ -0,0 +1,33 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=compat + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +dist_xkbdata_compat_DATA = \ + accessx \ + basic \ + complete \ + default \ + iso9995 \ + japan \ + keypad \ + ledcaps \ + lednum \ + ledscroll \ + misc \ + mousekeys \ + norepeat \ + pc \ + pc98 \ + README \ + xfree86 \ + xtest + +DATA_FILES=$(dist_xkbdata_compat_DATA:%=$(DESTDIR)\%) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/geometry/makefile b/xorg-server/xkbdata.src/geometry/makefile new file mode 100644 index 000000000..0c8e83bfb --- /dev/null +++ b/xorg-server/xkbdata.src/geometry/makefile @@ -0,0 +1,41 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=geometry + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +dist_xkbdata_geometry_DATA = \ + amiga \ + ataritt \ + chicony \ + dell \ + everex \ + fujitsu \ + hp \ + keytronic \ + kinesis \ + macintosh \ + microsoft \ + nec \ + northgate \ + pc \ + README \ + sony \ + sun \ + winbook + +DATA_FILES=$(dist_xkbdata_geometry_DATA:%=$(DESTDIR)\%) + +SUBDIRS = digital ibm sgi + +load_makefile $(SUBDIRS:%=%\makefile MAKESERVER=0 DEBUG=$(DEBUG);) + +.PHONY: extrastuff + +extrastuff: $(SUBDIRS:%=%\all) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/keycodes/makefile b/xorg-server/xkbdata.src/keycodes/makefile new file mode 100644 index 000000000..880881042 --- /dev/null +++ b/xorg-server/xkbdata.src/keycodes/makefile @@ -0,0 +1,36 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=keycodes + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +SUBDIRS = digital sgi + +dist_xkbdata_keycodes_DATA = \ + aliases \ + amiga \ + ataritt \ + fujitsu \ + hp \ + ibm \ + macintosh \ + powerpcps2 \ + README \ + sony \ + sun \ + xfree86 \ + xfree98 + +DATA_FILES=$(dist_xkbdata_keycodes_DATA:%=$(DESTDIR)\%) + +load_makefile $(SUBDIRS:%=%\makefile MAKESERVER=0 DEBUG=$(DEBUG);) + +.PHONY: extrastuff + +extrastuff: $(SUBDIRS:%=%\all) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/keymap/makefile b/xorg-server/xkbdata.src/keymap/makefile new file mode 100644 index 000000000..0cb723e11 --- /dev/null +++ b/xorg-server/xkbdata.src/keymap/makefile @@ -0,0 +1,30 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=keymap + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +SUBDIRS = sun digital sgi + +dist_xkbdata_keymap_DATA = \ + amiga \ + ataritt \ + macintosh \ + README \ + sony \ + xfree86 \ + xfree98 + +DATA_FILES=$(dist_xkbdata_keymap_DATA:%=$(DESTDIR)\%) + +load_makefile $(SUBDIRS:%=%\makefile MAKESERVER=0 DEBUG=$(DEBUG);) + +.PHONY: extrastuff + +extrastuff: $(SUBDIRS:%=%\all) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/makefile b/xorg-server/xkbdata.src/makefile new file mode 100644 index 000000000..1e3855fa4 --- /dev/null +++ b/xorg-server/xkbdata.src/makefile @@ -0,0 +1,9 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +SUBDIRS = semantics keycodes keymap compat geometry torture symbols rules types + +load_makefile $(SUBDIRS:%=%\makefile MAKESERVER=0 DEBUG=$(DEBUG);) + +all: $(SUBDIRS:%=%\all) diff --git a/xorg-server/xkbdata.src/rules/makefile b/xorg-server/xkbdata.src/rules/makefile new file mode 100644 index 000000000..e130c3a7b --- /dev/null +++ b/xorg-server/xkbdata.src/rules/makefile @@ -0,0 +1,26 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\rules +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +dist_xkbdata_rules_DATA = \ + README \ + sgi \ + sgi.lst \ + sun \ + sun.lst \ + xfree98 \ + xfree98.lst \ + xkb.dtd \ + xml2lst.pl \ + xorg \ + xorg-it.lst \ + xorg.lst \ + xorg.xml + +DATA_FILES=$(dist_xkbdata_rules_DATA:%=$(DESTDIR)\%) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/semantics/makefile b/xorg-server/xkbdata.src/semantics/makefile new file mode 100644 index 000000000..806ca60f4 --- /dev/null +++ b/xorg-server/xkbdata.src/semantics/makefile @@ -0,0 +1,19 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=semantics + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +dist_xkbdata_semantics_DATA = \ + basic \ + complete \ + default \ + xtest + +DATA_FILES=$(dist_xkbdata_semantics_DATA:%=$(DESTDIR)\%) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/symbols/makefile b/xorg-server/xkbdata.src/symbols/makefile new file mode 100644 index 000000000..82bdbea58 --- /dev/null +++ b/xorg-server/xkbdata.src/symbols/makefile @@ -0,0 +1,136 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=symbols + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +SUBDIRS = pc macintosh sun fujitsu nec digital hp sgi sony xfree68 + +dist_xkbdata_symbols_DATA = \ + al \ + altwin \ + am \ + apple \ + ar \ + az \ + be \ + ben \ + bg \ + br \ + bs \ + by \ + ca \ + ca_enhanced \ + capslock \ + compose \ + ctrl \ + cz \ + cz_qwerty \ + czsk \ + de \ + de_CH \ + dev \ + dk \ + dvorak \ + ee \ + el \ + en_US \ + es \ + eurosign \ + fi \ + fo \ + fr \ + fr_CH \ + gb \ + ge_la \ + ge_ru \ + group \ + guj \ + gur \ + hr \ + hr_US \ + hu \ + hu_qwerty \ + hu_US \ + ie \ + il \ + il_phonetic \ + inet \ + ir \ + is \ + iso9995-3 \ + it \ + iu \ + jp \ + kan \ + keypad \ + la \ + level3 \ + lo \ + lock \ + lt \ + lt_a \ + lt_p \ + lt_std \ + lv \ + mk \ + ml \ + mm \ + mn \ + mt \ + mt_us \ + nl \ + no \ + ogham \ + ori \ + pc104 \ + pl \ + pl2 \ + pt \ + ralt \ + README \ + ro \ + ro2 \ + ru \ + sapmi \ + se \ + se_FI \ + se_NO \ + se_SE \ + si \ + sk \ + sk_qwerty \ + sr \ + srvr_ctrl \ + syr \ + syr_phonetic \ + tel \ + th \ + th_pat \ + th_tis \ + tj \ + tml \ + tr \ + tr_f \ + ua \ + us \ + us_group2 \ + us_group3 \ + us_intl \ + uz \ + vn \ + yu + +DATA_FILES=$(dist_xkbdata_symbols_DATA:%=$(DESTDIR)\%) + +load_makefile $(SUBDIRS:%=%\makefile MAKESERVER=0 DEBUG=$(DEBUG);) + +.PHONY: extrastuff + +extrastuff: $(SUBDIRS:%=%\all) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/types/makefile b/xorg-server/xkbdata.src/types/makefile new file mode 100644 index 000000000..98271716a --- /dev/null +++ b/xorg-server/xkbdata.src/types/makefile @@ -0,0 +1,26 @@ +ifeq ($(MAKESERVER),1) +$(error Please do not specify MAKESERVER=1) +endif + +THISDIR=types + +DESTDIR=$(MHMAKECONF)\xorg-server\xkbdata\$(THISDIR) +$(DESTDIR): + if not isdir "$(DESTDIR)" mkdir /s "$(DESTDIR)" + +dist_xkbdata_types_DATA = \ + basic \ + cancel \ + caps \ + complete \ + default \ + extra \ + iso9995 \ + mousekeys \ + numpad \ + pc \ + README + +DATA_FILES=$(dist_xkbdata_types_DATA:%=$(DESTDIR)\%) + +include ..\xkbrules.mak diff --git a/xorg-server/xkbdata.src/xkbrules.mak b/xorg-server/xkbdata.src/xkbrules.mak new file mode 100644 index 000000000..e13c0a28b --- /dev/null +++ b/xorg-server/xkbdata.src/xkbrules.mak @@ -0,0 +1,14 @@ +DIRFILE=$(THISDIR:%=$(DESTDIR)\..\%.dir) +all: $(DESTDIR) $(DATA_FILES) $(DIRFILE) + +$(DESTDIR)\default: default + copy $< $@ + +$(DESTDIR)\%: % + copy $< $@ + +ifneq ($(DIRFILE),) +$(DIRFILE): extrastuff $(DATA_FILES) + -del -e $@ + cd $(DESTDIR) & ..\..\xkbcomp.exe -lfhlpR -o $(relpath $@) * +endif diff --git a/xorg-server/xwin.rc b/xorg-server/xwin.rc new file mode 100644 index 000000000..cbe5244e9 --- /dev/null +++ b/xorg-server/xwin.rc @@ -0,0 +1,106 @@ +/* + *Copyright (C) 2002-2004 Harold L Hunt II All Rights Reserved. + *Copyright (C) 2008 Yaakov Selkowitz All Rights Reserved + * + *Permission is hereby granted, free of charge, to any person obtaining + * a copy of this software and associated documentation files (the + *"Software"), to deal in the Software without restriction, including + *without limitation the rights to use, copy, modify, merge, publish, + *distribute, sublicense, and/or sell copies of the Software, and to + *permit persons to whom the Software is furnished to do so, subject to + *the following conditions: + * + *The above copyright notice and this permission notice shall be + *included in all copies or substantial portions of the Software. + * + *THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, + *EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + *MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND + *NONINFRINGEMENT. IN NO EVENT SHALL HAROLD L HUNT II BE LIABLE FOR + *ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF + *CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION + *WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + * + *Except as contained in this notice, the names of the authors + *shall not be used in advertising or otherwise to promote the sale, use + *or other dealings in this Software without prior written authorization + *from the authors. + * + * Authors: Harold L Hunt II, Yaakov Selkowitz + */ + +#include <windows.h> +#include "winresource.h" +#include "xwin-config.h" + +/* + * Dialogs + */ + +/* About */ +ABOUT_BOX DIALOGEX 32, 32, 260, 95 +STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | WS_TABSTOP | DS_CENTERMOUSE +CAPTION "About XSrv" +FONT 8, "MS Shell Dlg 2" +BEGIN + CONTROL IDI_XWIN, IDC_STATIC, "Static", SS_ICON, 8, 8, 32, 32 + LTEXT "XSrv X Server ", IDC_STATIC, 36, 8, 220, 8 + LTEXT "Version 0.0 (1 Jan 2009)", IDC_STATIC, 36, 18, 220, 8 + LTEXT "This product is licensed under the terms of the MIT/X11 License.", IDC_STATIC, 36, 38, 220, 20 + CONTROL __VENDORDWEBSUPPORT__, ID_ABOUT_WEBSITE, "Button", + BS_OWNERDRAW | WS_TABSTOP, 36, 58, 68, 8 + DEFPUSHBUTTON "OK", IDOK, 105, 75, 50, 15 +END + + +/* Depth change */ + +DEPTH_CHANGE_BOX DIALOGEX 32, 32, 180, 100 +STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | DS_CENTERMOUSE +FONT 8, "MS Shell Dlg 2" +CAPTION "XSrv" +BEGIN + DEFPUSHBUTTON "Dismiss", IDOK, 66, 80, 50, 14 + CTEXT "VCXSrv", IDC_STATIC, 40, 12, 100, 8 + CTEXT "Disruptive screen configuration change.", IDC_STATIC, 7, 40, 166, 8 + CTEXT "Restore previous resolution to use VCXSrv.", IDC_STATIC, 7, 52, 166, 8 +END + + +/* Exit */ + +EXIT_DIALOG DIALOGEX 32, 32, 180, 78 +STYLE WS_POPUP | WS_CAPTION | WS_SYSMENU | WS_VISIBLE | WS_TABSTOP | DS_CENTERMOUSE +FONT 8, "MS Shell Dlg 2" +CAPTION "Exit VCXSrv?" +BEGIN + PUSHBUTTON "E&xit", IDOK, 55, 56, 30, 14 + DEFPUSHBUTTON "&Cancel", IDCANCEL, 95, 56, 30, 14 + CTEXT "Exiting will close all screens running on this display.", IDC_STATIC, 7, 12, 166, 8 + CTEXT "No information about connected clients available.", IDC_CLIENTS_CONNECTED, 7, 24, 166, 8 + CTEXT "Proceed with shutdown of this display/server?", IDC_STATIC, 7, 36, 166, 8 +END + + +/* + * Menus + */ + +IDM_TRAYICON_MENU MENU +BEGIN + POPUP "TRAYICON_MENU" + BEGIN + MENUITEM "&Hide Root Window", ID_APP_HIDE_ROOT + MENUITEM "&About...", ID_APP_ABOUT + MENUITEM SEPARATOR + MENUITEM "E&xit...", ID_APP_EXIT + END +END + + +/* + * Icons + */ + +IDI_XWIN ICON "X.ico" +CREATEPROCESS_MANIFEST_RESOURCE_ID RT_MANIFEST "XWin.exe.manifest" |