From 3562e78743202e43aec8727005182a2558117eca Mon Sep 17 00:00:00 2001 From: marha Date: Sun, 28 Jun 2009 22:07:26 +0000 Subject: Checked in the following released items: xkeyboard-config-1.4.tar.gz ttf-bitstream-vera-1.10.tar.gz font-alias-1.0.1.tar.gz font-sun-misc-1.0.0.tar.gz font-sun-misc-1.0.0.tar.gz font-sony-misc-1.0.0.tar.gz font-schumacher-misc-1.0.0.tar.gz font-mutt-misc-1.0.0.tar.gz font-misc-misc-1.0.0.tar.gz font-misc-meltho-1.0.0.tar.gz font-micro-misc-1.0.0.tar.gz font-jis-misc-1.0.0.tar.gz font-isas-misc-1.0.0.tar.gz font-dec-misc-1.0.0.tar.gz font-daewoo-misc-1.0.0.tar.gz font-cursor-misc-1.0.0.tar.gz font-arabic-misc-1.0.0.tar.gz font-winitzki-cyrillic-1.0.0.tar.gz font-misc-cyrillic-1.0.0.tar.gz font-cronyx-cyrillic-1.0.0.tar.gz font-screen-cyrillic-1.0.1.tar.gz font-xfree86-type1-1.0.1.tar.gz font-adobe-utopia-type1-1.0.1.tar.gz font-ibm-type1-1.0.0.tar.gz font-bitstream-type1-1.0.0.tar.gz font-bitstream-speedo-1.0.0.tar.gz font-bh-ttf-1.0.0.tar.gz font-bh-type1-1.0.0.tar.gz font-bitstream-100dpi-1.0.0.tar.gz font-bh-lucidatypewriter-100dpi-1.0.0.tar.gz font-bh-100dpi-1.0.0.tar.gz font-adobe-utopia-100dpi-1.0.1.tar.gz font-adobe-100dpi-1.0.0.tar.gz font-util-1.0.1.tar.gz font-bitstream-75dpi-1.0.0.tar.gz font-bh-lucidatypewriter-75dpi-1.0.0.tar.gz font-adobe-utopia-75dpi-1.0.1.tar.gz font-bh-75dpi-1.0.0.tar.gz bdftopcf-1.0.1.tar.gz font-adobe-75dpi-1.0.0.tar.gz mkfontscale-1.0.6.tar.gz openssl-0.9.8k.tar.gz bigreqsproto-1.0.2.tar.gz xtrans-1.2.2.tar.gz resourceproto-1.0.2.tar.gz inputproto-1.4.4.tar.gz compositeproto-0.4.tar.gz damageproto-1.1.0.tar.gz zlib-1.2.3.tar.gz xkbcomp-1.0.5.tar.gz freetype-2.3.9.tar.gz pthreads-w32-2-8-0-release.tar.gz pixman-0.12.0.tar.gz kbproto-1.0.3.tar.gz evieext-1.0.2.tar.gz fixesproto-4.0.tar.gz recordproto-1.13.2.tar.gz randrproto-1.2.2.tar.gz scrnsaverproto-1.1.0.tar.gz renderproto-0.9.3.tar.gz xcmiscproto-1.1.2.tar.gz fontsproto-2.0.2.tar.gz xextproto-7.0.3.tar.gz xproto-7.0.14.tar.gz libXdmcp-1.0.2.tar.gz libxkbfile-1.0.5.tar.gz libfontenc-1.0.4.tar.gz libXfont-1.3.4.tar.gz libX11-1.1.5.tar.gz libXau-1.0.4.tar.gz libxcb-1.1.tar.gz xorg-server-1.5.3.tar.gz --- xorg-server/dix/BuiltInAtoms | 329 +++ xorg-server/dix/CHANGES | 17 + xorg-server/dix/Makefile.am | 82 + xorg-server/dix/Makefile.in | 1079 ++++++++ xorg-server/dix/Xserver-dtrace.h.in | 100 + xorg-server/dix/Xserver.d | 59 + xorg-server/dix/atom.c | 211 ++ xorg-server/dix/buildatoms | 43 + xorg-server/dix/colormap.c | 2693 ++++++++++++++++++ xorg-server/dix/cursor.c | 492 ++++ xorg-server/dix/deprecated.c | 162 ++ xorg-server/dix/devices.c | 2114 ++++++++++++++ xorg-server/dix/dispatch.c | 3761 +++++++++++++++++++++++++ xorg-server/dix/dispatch.h | 146 + xorg-server/dix/dix.c | 0 xorg-server/dix/dixfonts.c | 2102 ++++++++++++++ xorg-server/dix/dixutils.c | 898 ++++++ xorg-server/dix/events.c | 5145 +++++++++++++++++++++++++++++++++++ xorg-server/dix/extension.c | 356 +++ xorg-server/dix/ffs.c | 44 + xorg-server/dix/gc.c | 1259 +++++++++ xorg-server/dix/getevents.c | 940 +++++++ xorg-server/dix/globals.c | 162 ++ xorg-server/dix/glyphcurs.c | 194 ++ xorg-server/dix/grabs.c | 492 ++++ xorg-server/dix/initatoms.c | 84 + xorg-server/dix/main.c | 754 +++++ xorg-server/dix/pixmap.c | 122 + xorg-server/dix/privates.c | 314 +++ xorg-server/dix/property.c | 637 +++++ xorg-server/dix/protocol.txt | 1066 ++++++++ xorg-server/dix/registry.c | 336 +++ xorg-server/dix/resource.c | 879 ++++++ xorg-server/dix/selection.c | 311 +++ xorg-server/dix/strcasecmp.c | 70 + xorg-server/dix/strcasestr.c | 64 + xorg-server/dix/swaprep.c | 1298 +++++++++ xorg-server/dix/swapreq.c | 1100 ++++++++ xorg-server/dix/tables.c | 512 ++++ xorg-server/dix/window.c | 3867 ++++++++++++++++++++++++++ xorg-server/dix/xpstubs.c | 78 + 41 files changed, 34372 insertions(+) create mode 100644 xorg-server/dix/BuiltInAtoms create mode 100644 xorg-server/dix/CHANGES create mode 100644 xorg-server/dix/Makefile.am create mode 100644 xorg-server/dix/Makefile.in create mode 100644 xorg-server/dix/Xserver-dtrace.h.in create mode 100644 xorg-server/dix/Xserver.d create mode 100644 xorg-server/dix/atom.c create mode 100644 xorg-server/dix/buildatoms create mode 100644 xorg-server/dix/colormap.c create mode 100644 xorg-server/dix/cursor.c create mode 100644 xorg-server/dix/deprecated.c create mode 100644 xorg-server/dix/devices.c create mode 100644 xorg-server/dix/dispatch.c create mode 100644 xorg-server/dix/dispatch.h create mode 100644 xorg-server/dix/dix.c create mode 100644 xorg-server/dix/dixfonts.c create mode 100644 xorg-server/dix/dixutils.c create mode 100644 xorg-server/dix/events.c create mode 100644 xorg-server/dix/extension.c create mode 100644 xorg-server/dix/ffs.c create mode 100644 xorg-server/dix/gc.c create mode 100644 xorg-server/dix/getevents.c create mode 100644 xorg-server/dix/globals.c create mode 100644 xorg-server/dix/glyphcurs.c create mode 100644 xorg-server/dix/grabs.c create mode 100644 xorg-server/dix/initatoms.c create mode 100644 xorg-server/dix/main.c create mode 100644 xorg-server/dix/pixmap.c create mode 100644 xorg-server/dix/privates.c create mode 100644 xorg-server/dix/property.c create mode 100644 xorg-server/dix/protocol.txt create mode 100644 xorg-server/dix/registry.c create mode 100644 xorg-server/dix/resource.c create mode 100644 xorg-server/dix/selection.c create mode 100644 xorg-server/dix/strcasecmp.c create mode 100644 xorg-server/dix/strcasestr.c create mode 100644 xorg-server/dix/swaprep.c create mode 100644 xorg-server/dix/swapreq.c create mode 100644 xorg-server/dix/tables.c create mode 100644 xorg-server/dix/window.c create mode 100644 xorg-server/dix/xpstubs.c (limited to 'xorg-server/dix') diff --git a/xorg-server/dix/BuiltInAtoms b/xorg-server/dix/BuiltInAtoms new file mode 100644 index 000000000..910c62706 --- /dev/null +++ b/xorg-server/dix/BuiltInAtoms @@ -0,0 +1,329 @@ +File: .../x11/server/dix/BuiltInAtoms + +This file is of a fixed format and is used to generate both the file +include/XAtom.h and dix/initatoms.c. Neither of those files should be +edited directly. Changing the atoms in this file, or even the order in +which they occur, is equivalent to forcing a new (minor) version number +on the server. Take care. + +The format of the file is that each built in atom starts in column 1 +with no text, other than spaces and tabs, on that line other than a +mandatory trailing "@" at the end of the line. For each atom (Foo) +below the defines will be of the form + #define XA_Foo +and the string value of the atom will be "Foo". + +The comment lines in this file are not guaranteed to be accurate. To see the +current truth, look at the Xlib documentation as well as the protocol spec. + +Atoms occur in five distinct name spaces within the protocol. Any particular +atom may or may not have some client interpretation within each of the name +spaces. For each of the built in atoms, the intended semantics and the space +within which it is defined is indicated. + +Those name spaces are + Property names + Property types + Selections + Font properties + Type of a ClientMessage event (none built into server) + +For the font properties mentioned here, see the spec for more information. + + -- Selections -- + +PRIMARY @ + Selection. +SECONDARY @ + Selection. + + -- Property types and names -- + +ARC @ + Property type: + x, y: INT16 + width, height: CARD16, + angle1, angle2: INT16 +ATOM @ + Property type: + atom: ATOM +BITMAP @ + Property type: + bitmap: PIXMAP + This is asserted to be of depth 1. +CARDINAL @ + Property type: + card: CARD32 or CARD16 or CARD8 + the datum size is dependent on the property format +COLORMAP @ + Property type: + colormap: COLORMAP +CURSOR @ + Property type: + cursor: CURSOR +CUT_BUFFER0 @ +CUT_BUFFER1 @ +CUT_BUFFER2 @ +CUT_BUFFER3 @ +CUT_BUFFER4 @ +CUT_BUFFER5 @ +CUT_BUFFER6 @ +CUT_BUFFER7 @ + Property name: (type: STRING) + Used to implement cut buffer ring, in particular Andrew uses + this mechanism. Anyone else using this sort of IPC mechanism + should use these properties. + + Data is normally fetched and stored out of CUT_BUFFER0; the + RotateProperties request is used to rotate these buffers. +DRAWABLE @ + Property type: + drawable: DRAWABLE +FONT @ + Property type: + font: FONT +INTEGER @ + Property type: + card: INT32 or INT16 or INT8 + the datum size is dependent on the property format +PIXMAP @ + Property type: + pixmap: PIXMAP +POINT @ + Property type: + x, y: INT16 +RECTANGLE @ + Property type: + x, y: INT16 + width, height: CARD16 +RESOURCE_MANAGER @ + Property name: (type: STRING) + Contents of the user's resource manager data base. +RGB_COLOR_MAP @ + Property type: + colormap: COLORMAP + red-max: CARD32 + red-mult: CARD32 + green-max: CARD32 + green-mult: CARD32 + blue-max: CARD32 + blue-mult: CARD32 + base-pixel: CARD32 + + The fields `red_max', `green_max', and `blue_max' give the maximum + red, green, and blue values, respectively. Each color + coefficient ranges from 0 to its max, inclusive. For example, + a common colormap allocation is 3/3/2: 3 planes for red, 3 + planes for green, and 2 planes for blue. Such a colormap would + have red_max == 7, green_max = 7, and blue_max = 3. An alternate + allocation that uses only 216 colors is red_max = 5, green_max = + 5, and blue_max = 5. + + The fields `red_mult', `green_mult', and `blue_mult' give the + scale factors used to compose a full pixel value. (See next + paragraph.) For a 3/3/2 allocation red_mult might be 32, + green_mult might be 4, and blue_mult might be 1. For a + 6-colors-each allocation, red_mult might be 36, green_mult might + be 6, and blue_mult might be 1. + + The field `base_pixel' gives the base pixel value used to + compose a full pixel value. Normally base_pixel is obtained + from a call to XAllocColorPlanes(). Given integer red, green, + and blue coefficients in their appropriate ranges, one can + compute a corresponding pixel value with the expression: + + r * red_mult + g * green_mult + b * blue_mult + base_pixel + + For gray-scale colormaps, only the colormap, red_max, red_mult, + and base_pixel fields are defined; the other fields are + ignored. To compute a gray-scale pixel value, use: + + gray * red_mult + base_pixel + + This is provided to allow applications to share color maps. + +RGB_BEST_MAP @ +RGB_BLUE_MAP @ +RGB_DEFAULT_MAP @ +RGB_GRAY_MAP @ +RGB_GREEN_MAP @ +RGB_RED_MAP @ + Property name: (type: RGB_COLOR_MAP) + The needs of most applications can be met with five colormaps. + Polite applications may need only a small RGB space, and can + use a portion of the default color map. Applications doing + high-quality RGB rendering will need an entire colormap, + filled with as large an RGB space as possible, e.g. 332. For + color separations, an application may need maximum device + resolution for each of red, green, and blue, even if this + requires three renderings with three colormaps. + + Each of the above five names would be used for sharing color + maps. +STRING @ + Property type: + sequence of Bytes +VISUALID @ + Property type: + visual: VISUALID +WINDOW @ + Property type: + window: WINDOW +WM_COMMAND @ + Property name: (type: STRING) + Command line arguments used to invoke this application. The + arguments are delimited by null characters (ASCII 0). +WM_HINTS @ + Property type: + flags: CARD32 + input: BOOL32 + initial-state: CARD32 + icon-pixmap: PIXMAP + icon-window: WINDOW + icon_mask: BITMAP + icon-x, icon-y: INT32 + flags contains the following bits + 0x00000001 input hint + 0x00000002 state hint + 0x00000004 icon pixmap hint + 0x00000008 icon window hint + 0x00000010 icon position hint + values for initial-state + 0 unspecified -> application does not + care and WM should pick one. + 1 normal + 2 zoomed + 3 iconic + 4 inactive -> application believes + itself to be seldomly used. WM may wish to + place it on an inactive menu. + This type is potentially extensible. The order is critical; + append to the end only. + Property name: (type: WM_HINTS) + Additional hints set by the client for use by the window + manager. +WM_CLIENT_MACHINE @ + Property name: (type: STRING) + used to communicate with the window manager. The host name + of the machine the client is running on may be set here. +WM_ICON_NAME @ + Property name: (type: STRING) + what the application would like the label to be for + the iconic form of the window. +WM_ICON_SIZE @ + Property type: + minWidth, min-height: CARD32 + maxWidth, max-height: CARD32 + widthInc, height-inc: CARD32 + Property name: (type: ICON_SIZE) + The window manager may set this property on the root window + to specify the icon sizes it allows. +WM_NAME @ + Property name: (type: STRING) + used to communicate with the window manager. This is + what the application would like the label for the window. +WM_NORMAL_HINTS @ + Property name: (type: SIZE_HINTS) + used to communicate with the window manager. This is size + hints for a window in its "normal" state. +WM_SIZE_HINTS @ + Property type: + flags: CARD32 + x, y: INT32 + width, height: CARD32 + min-width, min-height: CARD32 + max-width, max-height: CARD32 + width-inc, height-inc: CARD32 + min-aspect-x, min-aspect-y: CARD32 + max-aspect-x, max-aspect-y: CARD32 + flags contains the following bits + 0x00000001 user specified x and y + 0x00000002 user specified width and height + 0x00000004 program specified position + 0x00000008 program specified size + 0x00000010 program specified minimum size + 0x00000020 program specified maximum size + 0x00000040 program specified resize increment + 0x00000080 program specified aspect ratio + This type is potentially extensible. The order is critical; + append to the end only. +WM_ZOOM_HINTS @ + Property name: (type: SIZE_HINTS) + used to communicate with the window manager. This is size + hints for a window in its "zoomed" state. + + -- Font properties -- + +MIN_SPACE @ + Font property: CARD32 +NORM_SPACE @ + Font property: CARD32 +MAX_SPACE @ + Font property: CARD32 +END_SPACE @ + Font property: CARD32 +SUPERSCRIPT_X @ + Font property: INT32 +SUPERSCRIPT_Y @ + Font property: INT32 +SUBSCRIPT_X @ + Font property: INT32 +SUBSCRIPT_Y @ + Font property: INT32 +UNDERLINE_POSITION @ + Font property: INT32 +UNDERLINE_THICKNESS @ + Font property: CARD32 +STRIKEOUT_ASCENT @ + Font property: INT32 +STRIKEOUT_DESCENT @ + Font property: INT32 +ITALIC_ANGLE @ + Font property: INT32 +X_HEIGHT @ + Font property: INT32 +QUAD_WIDTH @ + Font property: INT32 +WEIGHT @ + Font property: CARD32 +POINT_SIZE @ + Font property: CARD32 +RESOLUTION @ + Font property: CARD32 + +The following optional properties on fonts have values that are atoms. The +atom print name is the useful information. + +COPYRIGHT @ + of the font distribution +NOTICE @ + trademark/copyright of the character shapes +FONT_NAME @ + name of this particular instance of a font +FAMILY_NAME @ + name of the 'font family' to which it belongs +FULL_NAME @ + full text name of the font + +The following aren't in order but putting them at the end avoids encoding +changes. + +CAP_HEIGHT @ + Font property: CARD32 + + +WM_CLASS @ + Property name: (type: STRING) + Used (possibly by some window managers; definitely by + session managers) to look up resources in the resource + data base on behalf of the client who set this property. + There are 2 elements: + {char *resource_name; char *resource_class;} + delimited by a null character (ascii 0) + +WM_TRANSIENT_FOR @ + Property name: (type: WINDOW) + Used by transient top-level windows, such as dialog + boxes, to point to their logical "parents". The window + manager can then take down the dialog boxes when the + "parent" gets iconified, for instance. diff --git a/xorg-server/dix/CHANGES b/xorg-server/dix/CHANGES new file mode 100644 index 000000000..d8fb7c31a --- /dev/null +++ b/xorg-server/dix/CHANGES @@ -0,0 +1,17 @@ +The following changes have been made to this directory since R3 (for +a full description, see doc/Server/r4.tbl.ms): + + o Windows restructured (memory reduction, devPrivates and speedups) + o GCs restructured (memory reduction, devPrivates and wrappers) + o Screens restructured (window ops merged in, devPrivates) + o Pixmaps restructured (drawable changes mostly) + o Cursors restructured (shares glyph bits now) + o Visuals restructured (screen index removed, fields rearranged) + o Devices restructured (input extension changes) + o Out of memory changes. Many interfaces now return OutOfMemory + status. + o Synchronous grab code rewritten. Should conform to our + understanding of the protocol now. Be careful when time + stamping events (don't allow time to run backwards). + o Resource types redesigned and rewritten. + o Internal fake color allocation routine for software cursors. diff --git a/xorg-server/dix/Makefile.am b/xorg-server/dix/Makefile.am new file mode 100644 index 000000000..eb5e77946 --- /dev/null +++ b/xorg-server/dix/Makefile.am @@ -0,0 +1,82 @@ +standard_dix_libs = libdix.la libxpstubs.la + +if XPRINT +noinst_LTLIBRARIES = $(standard_dix_libs) libXpdix.la +else +noinst_LTLIBRARIES = $(standard_dix_libs) +endif + +AM_CFLAGS = $(DIX_CFLAGS) \ + -DVENDOR_NAME=\""@VENDOR_NAME@"\" \ + -DVENDOR_RELEASE="@VENDOR_RELEASE@" + +libdix_la_SOURCES = \ + atom.c \ + colormap.c \ + cursor.c \ + deprecated.c \ + devices.c \ + dispatch.c \ + dispatch.h \ + dixfonts.c \ + dixutils.c \ + events.c \ + extension.c \ + ffs.c \ + gc.c \ + getevents.c \ + globals.c \ + glyphcurs.c \ + grabs.c \ + initatoms.c \ + main.c \ + pixmap.c \ + privates.c \ + property.c \ + registry.c \ + resource.c \ + selection.c \ + swaprep.c \ + swapreq.c \ + tables.c \ + window.c \ + strcasecmp.c \ + strcasestr.c + +libxpstubs_la_SOURCES = \ + xpstubs.c + +if XPRINT +libXpdix_la_SOURCES = $(libdix_la_SOURCES) +libXpdix_la_CPPFLAGS = -I$(top_srcdir)/hw/xprint +libXpdix_la_CFLAGS = $(AM_CFLAGS) $(XPRINT_CFLAGS) +endif + +EXTRA_DIST = buildatoms BuiltInAtoms CHANGES Xserver.d Xserver-dtrace.h.in + +# Install list of protocol names +miscconfigdir = $(SERVER_MISC_CONFIG_PATH) +dist_miscconfig_DATA = protocol.txt + +if XSERVER_DTRACE +# Generate dtrace header file for C sources to include +BUILT_SOURCES = Xserver-dtrace.h + +Xserver-dtrace.h: $(srcdir)/Xserver.d + $(DTRACE) -C -h -o $@ -s $(srcdir)/Xserver.d \ + || cp Xserver-dtrace.h.in $@ + +# Generate dtrace object code for probes in libdix +dtrace-dix.o: $(top_srcdir)/dix/Xserver.d $(am_libdix_la_OBJECTS) + $(DTRACE) -G -C -o $@ -s $(top_srcdir)/dix/Xserver.d .libs/*.o + +noinst_PROGRAMS = dix.O + +dix.O: dtrace-dix.o $(am_libdix_la_OBJECTS) + ld -r -o $@ .libs/*.o +endif + +dix.c: + touch $@ + +CLEANFILES = dix.c diff --git a/xorg-server/dix/Makefile.in b/xorg-server/dix/Makefile.in new file mode 100644 index 000000000..c1a07a163 --- /dev/null +++ b/xorg-server/dix/Makefile.in @@ -0,0 +1,1079 @@ +# Makefile.in generated by automake 1.10.1 from Makefile.am. +# @configure_input@ + +# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002, +# 2003, 2004, 2005, 2006, 2007, 2008 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + +@SET_MAKE@ + + + +VPATH = @srcdir@ +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ +am__cd = CDPATH="$${ZSH_VERSION+.}$(PATH_SEPARATOR)" && cd +install_sh_DATA = $(install_sh) -c -m 644 +install_sh_PROGRAM = $(install_sh) -c +install_sh_SCRIPT = $(install_sh) -c +INSTALL_HEADER = $(INSTALL_DATA) +transform = $(program_transform_name) +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +build_triplet = @build@ +host_triplet = @host@ +@XSERVER_DTRACE_TRUE@noinst_PROGRAMS = dix.O$(EXEEXT) +subdir = dix +DIST_COMMON = $(dist_miscconfig_DATA) $(srcdir)/Makefile.am \ + $(srcdir)/Makefile.in +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +am__aclocal_m4_deps = $(top_srcdir)/acinclude.m4 \ + $(top_srcdir)/configure.ac +am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \ + $(ACLOCAL_M4) +mkinstalldirs = $(install_sh) -d +CONFIG_HEADER = $(top_builddir)/include/do-not-use-config.h \ + $(top_builddir)/include/xorg-server.h \ + $(top_builddir)/include/dix-config.h \ + $(top_builddir)/include/xgl-config.h \ + $(top_builddir)/include/xorg-config.h \ + $(top_builddir)/include/xkb-config.h \ + $(top_builddir)/include/xwin-config.h \ + $(top_builddir)/include/kdrive-config.h +CONFIG_CLEAN_FILES = +LTLIBRARIES = $(noinst_LTLIBRARIES) +libXpdix_la_LIBADD = +am__libXpdix_la_SOURCES_DIST = atom.c colormap.c cursor.c deprecated.c \ + devices.c dispatch.c dispatch.h dixfonts.c dixutils.c events.c \ + extension.c ffs.c gc.c getevents.c globals.c glyphcurs.c \ + grabs.c initatoms.c main.c pixmap.c privates.c property.c \ + registry.c resource.c selection.c swaprep.c swapreq.c tables.c \ + window.c strcasecmp.c strcasestr.c +am__objects_1 = libXpdix_la-atom.lo libXpdix_la-colormap.lo \ + libXpdix_la-cursor.lo libXpdix_la-deprecated.lo \ + libXpdix_la-devices.lo libXpdix_la-dispatch.lo \ + libXpdix_la-dixfonts.lo libXpdix_la-dixutils.lo \ + libXpdix_la-events.lo libXpdix_la-extension.lo \ + libXpdix_la-ffs.lo libXpdix_la-gc.lo libXpdix_la-getevents.lo \ + libXpdix_la-globals.lo libXpdix_la-glyphcurs.lo \ + libXpdix_la-grabs.lo libXpdix_la-initatoms.lo \ + libXpdix_la-main.lo libXpdix_la-pixmap.lo \ + libXpdix_la-privates.lo libXpdix_la-property.lo \ + libXpdix_la-registry.lo libXpdix_la-resource.lo \ + libXpdix_la-selection.lo libXpdix_la-swaprep.lo \ + libXpdix_la-swapreq.lo libXpdix_la-tables.lo \ + libXpdix_la-window.lo libXpdix_la-strcasecmp.lo \ + libXpdix_la-strcasestr.lo +@XPRINT_TRUE@am_libXpdix_la_OBJECTS = $(am__objects_1) +libXpdix_la_OBJECTS = $(am_libXpdix_la_OBJECTS) +libXpdix_la_LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) \ + $(LIBTOOLFLAGS) --mode=link $(CCLD) $(libXpdix_la_CFLAGS) \ + $(CFLAGS) $(AM_LDFLAGS) $(LDFLAGS) -o $@ +@XPRINT_TRUE@am_libXpdix_la_rpath = +libdix_la_LIBADD = +am_libdix_la_OBJECTS = atom.lo colormap.lo cursor.lo deprecated.lo \ + devices.lo dispatch.lo dixfonts.lo dixutils.lo events.lo \ + extension.lo ffs.lo gc.lo getevents.lo globals.lo glyphcurs.lo \ + grabs.lo initatoms.lo main.lo pixmap.lo privates.lo \ + property.lo registry.lo resource.lo selection.lo swaprep.lo \ + swapreq.lo tables.lo window.lo strcasecmp.lo strcasestr.lo +libdix_la_OBJECTS = $(am_libdix_la_OBJECTS) +@XPRINT_FALSE@am_libdix_la_rpath = +@XPRINT_TRUE@am_libdix_la_rpath = +libxpstubs_la_LIBADD = +am_libxpstubs_la_OBJECTS = xpstubs.lo +libxpstubs_la_OBJECTS = $(am_libxpstubs_la_OBJECTS) +@XPRINT_FALSE@am_libxpstubs_la_rpath = +@XPRINT_TRUE@am_libxpstubs_la_rpath = +PROGRAMS = $(noinst_PROGRAMS) +dix_O_SOURCES = dix.c +dix_O_OBJECTS = dix.$(OBJEXT) +dix_O_LDADD = $(LDADD) +DEFAULT_INCLUDES = -I.@am__isrc@ -I$(top_builddir)/include +depcomp = $(SHELL) $(top_srcdir)/depcomp +am__depfiles_maybe = depfiles +COMPILE = $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(AM_CPPFLAGS) \ + $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \ + --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) \ + $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +CCLD = $(CC) +LINK = $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) \ + --mode=link $(CCLD) $(AM_CFLAGS) $(CFLAGS) $(AM_LDFLAGS) \ + $(LDFLAGS) -o $@ +SOURCES = $(libXpdix_la_SOURCES) $(libdix_la_SOURCES) \ + $(libxpstubs_la_SOURCES) dix.c +DIST_SOURCES = $(am__libXpdix_la_SOURCES_DIST) $(libdix_la_SOURCES) \ + $(libxpstubs_la_SOURCES) dix.c +am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; +am__vpath_adj = case $$p in \ + $(srcdir)/*) f=`echo "$$p" | sed "s|^$$srcdirstrip/||"`;; \ + *) f=$$p;; \ + esac; +am__strip_dir = `echo $$p | sed -e 's|^.*/||'`; +am__installdirs = "$(DESTDIR)$(miscconfigdir)" +dist_miscconfigDATA_INSTALL = $(INSTALL_DATA) +DATA = $(dist_miscconfig_DATA) +ETAGS = etags +CTAGS = ctags +DISTFILES = $(DIST_COMMON) $(DIST_SOURCES) $(TEXINFOS) $(EXTRA_DIST) +ACLOCAL = @ACLOCAL@ +ADMIN_MAN_DIR = @ADMIN_MAN_DIR@ +ADMIN_MAN_SUFFIX = @ADMIN_MAN_SUFFIX@ +ALLOCA = @ALLOCA@ +AMTAR = @AMTAR@ +APPDEFAULTDIR = @APPDEFAULTDIR@ +APPLE_APPLICATIONS_DIR = @APPLE_APPLICATIONS_DIR@ +APP_MAN_DIR = @APP_MAN_DIR@ +APP_MAN_SUFFIX = @APP_MAN_SUFFIX@ +AR = @AR@ +AS = @AS@ +AUTOCONF = @AUTOCONF@ +AUTOHEADER = @AUTOHEADER@ +AUTOMAKE = @AUTOMAKE@ +AWK = @AWK@ +BASE_FONT_PATH = @BASE_FONT_PATH@ +BUILD_DATE = @BUILD_DATE@ +BUILD_TIME = @BUILD_TIME@ +CC = @CC@ +CCAS = @CCAS@ +CCASDEPMODE = @CCASDEPMODE@ +CCASFLAGS = @CCASFLAGS@ +CCDEPMODE = @CCDEPMODE@ +CFLAGS = @CFLAGS@ +COMPILEDDEFAULTFONTPATH = @COMPILEDDEFAULTFONTPATH@ +CPP = @CPP@ +CPPFLAGS = @CPPFLAGS@ +CXX = @CXX@ +CXXCPP = @CXXCPP@ +CXXDEPMODE = @CXXDEPMODE@ +CXXFLAGS = @CXXFLAGS@ +CYGPATH_W = @CYGPATH_W@ +DARWIN_LIBS = @DARWIN_LIBS@ +DBUS_CFLAGS = @DBUS_CFLAGS@ +DBUS_LIBS = @DBUS_LIBS@ +DEFAULT_LIBRARY_PATH = @DEFAULT_LIBRARY_PATH@ +DEFAULT_LOGPREFIX = @DEFAULT_LOGPREFIX@ +DEFAULT_MODULE_PATH = @DEFAULT_MODULE_PATH@ +DEFS = @DEFS@ +DEPDIR = @DEPDIR@ +DGA_CFLAGS = @DGA_CFLAGS@ +DGA_LIBS = @DGA_LIBS@ +DIX_CFLAGS = @DIX_CFLAGS@ +DLLTOOL = @DLLTOOL@ +DMXEXAMPLES_DEP_CFLAGS = @DMXEXAMPLES_DEP_CFLAGS@ +DMXEXAMPLES_DEP_LIBS = @DMXEXAMPLES_DEP_LIBS@ +DMXMODULES_CFLAGS = @DMXMODULES_CFLAGS@ +DMXMODULES_LIBS = @DMXMODULES_LIBS@ +DMXXIEXAMPLES_DEP_CFLAGS = @DMXXIEXAMPLES_DEP_CFLAGS@ +DMXXIEXAMPLES_DEP_LIBS = @DMXXIEXAMPLES_DEP_LIBS@ +DMXXMUEXAMPLES_DEP_CFLAGS = @DMXXMUEXAMPLES_DEP_CFLAGS@ +DMXXMUEXAMPLES_DEP_LIBS = @DMXXMUEXAMPLES_DEP_LIBS@ +DRI2PROTO_CFLAGS = @DRI2PROTO_CFLAGS@ +DRI2PROTO_LIBS = @DRI2PROTO_LIBS@ +DRIPROTO_CFLAGS = @DRIPROTO_CFLAGS@ +DRIPROTO_LIBS = @DRIPROTO_LIBS@ +DRIVER_MAN_DIR = @DRIVER_MAN_DIR@ +DRIVER_MAN_SUFFIX = @DRIVER_MAN_SUFFIX@ +DRI_DRIVER_PATH = @DRI_DRIVER_PATH@ +DSYMUTIL = @DSYMUTIL@ +DTRACE = @DTRACE@ +ECHO = @ECHO@ +ECHO_C = @ECHO_C@ +ECHO_N = @ECHO_N@ +ECHO_T = @ECHO_T@ +EGREP = @EGREP@ +EXEEXT = @EXEEXT@ +F77 = @F77@ +FFLAGS = @FFLAGS@ +FILE_MAN_DIR = @FILE_MAN_DIR@ +FILE_MAN_SUFFIX = @FILE_MAN_SUFFIX@ +FREETYPE_CFLAGS = @FREETYPE_CFLAGS@ +FREETYPE_LIBS = @FREETYPE_LIBS@ +GLX_ARCH_DEFINES = @GLX_ARCH_DEFINES@ +GLX_DEFINES = @GLX_DEFINES@ +GL_CFLAGS = @GL_CFLAGS@ +GL_LIBS = @GL_LIBS@ +GREP = @GREP@ +HAL_CFLAGS = @HAL_CFLAGS@ +HAL_LIBS = @HAL_LIBS@ +INSTALL = @INSTALL@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +INSTALL_STRIP_PROGRAM = @INSTALL_STRIP_PROGRAM@ +KDRIVE_CFLAGS = @KDRIVE_CFLAGS@ +KDRIVE_INCS = @KDRIVE_INCS@ +KDRIVE_LIBS = @KDRIVE_LIBS@ +KDRIVE_LOCAL_LIBS = @KDRIVE_LOCAL_LIBS@ +KDRIVE_PURE_INCS = @KDRIVE_PURE_INCS@ +KDRIVE_PURE_LIBS = @KDRIVE_PURE_LIBS@ +LAUNCHD = @LAUNCHD@ +LDFLAGS = @LDFLAGS@ +LD_EXPORT_SYMBOLS_FLAG = @LD_EXPORT_SYMBOLS_FLAG@ +LEX = @LEX@ +LEXLIB = @LEXLIB@ +LEX_OUTPUT_ROOT = @LEX_OUTPUT_ROOT@ +LIBDRM_CFLAGS = @LIBDRM_CFLAGS@ +LIBDRM_LIBS = @LIBDRM_LIBS@ +LIBOBJS = @LIBOBJS@ +LIBS = @LIBS@ +LIBTOOL = @LIBTOOL@ +LIB_MAN_DIR = @LIB_MAN_DIR@ +LIB_MAN_SUFFIX = @LIB_MAN_SUFFIX@ +LINUXDOC = @LINUXDOC@ +LN_S = @LN_S@ +LTLIBOBJS = @LTLIBOBJS@ +MAINT = @MAINT@ +MAKEINFO = @MAKEINFO@ +MAKE_HTML = @MAKE_HTML@ +MAKE_PDF = @MAKE_PDF@ +MAKE_PS = @MAKE_PS@ +MAKE_TEXT = @MAKE_TEXT@ +MESA_SOURCE = @MESA_SOURCE@ +MISC_MAN_DIR = @MISC_MAN_DIR@ +MISC_MAN_SUFFIX = @MISC_MAN_SUFFIX@ +MKDIR_P = @MKDIR_P@ +MKFONTDIR = @MKFONTDIR@ +MKFONTSCALE = @MKFONTSCALE@ +NMEDIT = @NMEDIT@ +OBJC = @OBJC@ +OBJCCLD = @OBJCCLD@ +OBJCDEPMODE = @OBJCDEPMODE@ +OBJCFLAGS = @OBJCFLAGS@ +OBJCLINK = @OBJCLINK@ +OBJDUMP = @OBJDUMP@ +OBJEXT = @OBJEXT@ +OPENSSL_CFLAGS = @OPENSSL_CFLAGS@ +OPENSSL_LIBS = @OPENSSL_LIBS@ +PACKAGE = @PACKAGE@ +PACKAGE_BUGREPORT = @PACKAGE_BUGREPORT@ +PACKAGE_NAME = @PACKAGE_NAME@ +PACKAGE_STRING = @PACKAGE_STRING@ +PACKAGE_TARNAME = @PACKAGE_TARNAME@ +PACKAGE_VERSION = @PACKAGE_VERSION@ +PATH_SEPARATOR = @PATH_SEPARATOR@ +PCIACCESS_CFLAGS = @PCIACCESS_CFLAGS@ +PCIACCESS_LIBS = @PCIACCESS_LIBS@ +PCI_TXT_IDS_PATH = @PCI_TXT_IDS_PATH@ +PERL = @PERL@ +PKG_CONFIG = @PKG_CONFIG@ +PROJECTROOT = @PROJECTROOT@ +PS2PDF = @PS2PDF@ +RANLIB = @RANLIB@ +RAWCPP = @RAWCPP@ +RAWCPPFLAGS = @RAWCPPFLAGS@ +SED = @SED@ +SERVER_MISC_CONFIG_PATH = @SERVER_MISC_CONFIG_PATH@ +SET_MAKE = @SET_MAKE@ +SHELL = @SHELL@ +SOLARIS_ASM_CFLAGS = @SOLARIS_ASM_CFLAGS@ +SOLARIS_INOUT_ARCH = @SOLARIS_INOUT_ARCH@ +STRIP = @STRIP@ +TSLIB_CFLAGS = @TSLIB_CFLAGS@ +TSLIB_LIBS = @TSLIB_LIBS@ +UTILS_SYS_LIBS = @UTILS_SYS_LIBS@ +VENDOR_MAN_VERSION = @VENDOR_MAN_VERSION@ +VENDOR_NAME = @VENDOR_NAME@ +VENDOR_NAME_SHORT = @VENDOR_NAME_SHORT@ +VENDOR_RELEASE = @VENDOR_RELEASE@ +VERSION = @VERSION@ +X11APP_ARCHS = @X11APP_ARCHS@ +X11EXAMPLES_DEP_CFLAGS = @X11EXAMPLES_DEP_CFLAGS@ +X11EXAMPLES_DEP_LIBS = @X11EXAMPLES_DEP_LIBS@ +XDMCP_CFLAGS = @XDMCP_CFLAGS@ +XDMCP_LIBS = @XDMCP_LIBS@ +XDMXCONFIG_DEP_CFLAGS = @XDMXCONFIG_DEP_CFLAGS@ +XDMXCONFIG_DEP_LIBS = @XDMXCONFIG_DEP_LIBS@ +XDMX_CFLAGS = @XDMX_CFLAGS@ +XDMX_LIBS = @XDMX_LIBS@ +XDMX_SYS_LIBS = @XDMX_SYS_LIBS@ +XEGLMODULES_CFLAGS = @XEGLMODULES_CFLAGS@ +XEGL_LIBS = @XEGL_LIBS@ +XEGL_SYS_LIBS = @XEGL_SYS_LIBS@ +XEPHYR_CFLAGS = @XEPHYR_CFLAGS@ +XEPHYR_DRI_LIBS = @XEPHYR_DRI_LIBS@ +XEPHYR_INCS = @XEPHYR_INCS@ +XEPHYR_LIBS = @XEPHYR_LIBS@ +XF86CONFIGFILE = @XF86CONFIGFILE@ +XF86MISC_CFLAGS = @XF86MISC_CFLAGS@ +XF86MISC_LIBS = @XF86MISC_LIBS@ +XF86VIDMODE_CFLAGS = @XF86VIDMODE_CFLAGS@ +XF86VIDMODE_LIBS = @XF86VIDMODE_LIBS@ +XGLMODULES_CFLAGS = @XGLMODULES_CFLAGS@ +XGLMODULES_LIBS = @XGLMODULES_LIBS@ +XGLXMODULES_CFLAGS = @XGLXMODULES_CFLAGS@ +XGLXMODULES_LIBS = @XGLXMODULES_LIBS@ +XGLX_LIBS = @XGLX_LIBS@ +XGLX_SYS_LIBS = @XGLX_SYS_LIBS@ +XGL_LIBS = @XGL_LIBS@ +XGL_MODULE_PATH = @XGL_MODULE_PATH@ +XGL_SYS_LIBS = @XGL_SYS_LIBS@ +XKB_BASE_DIRECTORY = @XKB_BASE_DIRECTORY@ +XKB_BIN_DIRECTORY = @XKB_BIN_DIRECTORY@ +XKB_COMPILED_DIR = @XKB_COMPILED_DIR@ +XKM_OUTPUT_DIR = @XKM_OUTPUT_DIR@ +XLIB_CFLAGS = @XLIB_CFLAGS@ +XLIB_LIBS = @XLIB_LIBS@ +XNESTMODULES_CFLAGS = @XNESTMODULES_CFLAGS@ +XNESTMODULES_LIBS = @XNESTMODULES_LIBS@ +XNEST_LIBS = @XNEST_LIBS@ +XNEST_SYS_LIBS = @XNEST_SYS_LIBS@ +XORGCFG_DEP_CFLAGS = @XORGCFG_DEP_CFLAGS@ +XORGCFG_DEP_LIBS = @XORGCFG_DEP_LIBS@ +XORGCONFIG_DEP_CFLAGS = @XORGCONFIG_DEP_CFLAGS@ +XORGCONFIG_DEP_LIBS = @XORGCONFIG_DEP_LIBS@ +XORG_CFLAGS = @XORG_CFLAGS@ +XORG_INCS = @XORG_INCS@ +XORG_LIBS = @XORG_LIBS@ +XORG_MODULES_CFLAGS = @XORG_MODULES_CFLAGS@ +XORG_MODULES_LIBS = @XORG_MODULES_LIBS@ +XORG_OS = @XORG_OS@ +XORG_OS_SUBDIR = @XORG_OS_SUBDIR@ +XORG_SYS_LIBS = @XORG_SYS_LIBS@ +XPRINTMODULES_CFLAGS = @XPRINTMODULES_CFLAGS@ +XPRINTMODULES_LIBS = @XPRINTMODULES_LIBS@ +XPRINTPROTO_CFLAGS = @XPRINTPROTO_CFLAGS@ +XPRINTPROTO_LIBS = @XPRINTPROTO_LIBS@ +XPRINT_CFLAGS = @XPRINT_CFLAGS@ +XPRINT_LIBS = @XPRINT_LIBS@ +XPRINT_SYS_LIBS = @XPRINT_SYS_LIBS@ +XRESEXAMPLES_DEP_CFLAGS = @XRESEXAMPLES_DEP_CFLAGS@ +XRESEXAMPLES_DEP_LIBS = @XRESEXAMPLES_DEP_LIBS@ +XSDL_INCS = @XSDL_INCS@ +XSDL_LIBS = @XSDL_LIBS@ +XSERVERCFLAGS_CFLAGS = @XSERVERCFLAGS_CFLAGS@ +XSERVERCFLAGS_LIBS = @XSERVERCFLAGS_LIBS@ +XSERVERLIBS_CFLAGS = @XSERVERLIBS_CFLAGS@ +XSERVERLIBS_LIBS = @XSERVERLIBS_LIBS@ +XSERVER_LIBS = @XSERVER_LIBS@ +XSERVER_SYS_LIBS = @XSERVER_SYS_LIBS@ +XTSTEXAMPLES_DEP_CFLAGS = @XTSTEXAMPLES_DEP_CFLAGS@ +XTSTEXAMPLES_DEP_LIBS = @XTSTEXAMPLES_DEP_LIBS@ +XVFB_LIBS = @XVFB_LIBS@ +XVFB_SYS_LIBS = @XVFB_SYS_LIBS@ +XWINMODULES_CFLAGS = @XWINMODULES_CFLAGS@ +XWINMODULES_LIBS = @XWINMODULES_LIBS@ +XWIN_LIBS = @XWIN_LIBS@ +XWIN_SERVER_NAME = @XWIN_SERVER_NAME@ +XWIN_SYS_LIBS = @XWIN_SYS_LIBS@ +YACC = @YACC@ +YFLAGS = @YFLAGS@ +__XCONFIGFILE__ = @__XCONFIGFILE__@ +abi_ansic = @abi_ansic@ +abi_extension = @abi_extension@ +abi_font = @abi_font@ +abi_videodrv = @abi_videodrv@ +abi_xinput = @abi_xinput@ +abs_builddir = @abs_builddir@ +abs_srcdir = @abs_srcdir@ +abs_top_builddir = @abs_top_builddir@ +abs_top_srcdir = @abs_top_srcdir@ +ac_ct_CC = @ac_ct_CC@ +ac_ct_CXX = @ac_ct_CXX@ +ac_ct_F77 = @ac_ct_F77@ +am__include = @am__include@ +am__leading_dot = @am__leading_dot@ +am__quote = @am__quote@ +am__tar = @am__tar@ +am__untar = @am__untar@ +bindir = @bindir@ +build = @build@ +build_alias = @build_alias@ +build_cpu = @build_cpu@ +build_os = @build_os@ +build_vendor = @build_vendor@ +builddir = @builddir@ +datadir = @datadir@ +datarootdir = @datarootdir@ +docdir = @docdir@ +driverdir = @driverdir@ +dvidir = @dvidir@ +exec_prefix = @exec_prefix@ +extdir = @extdir@ +ft_config = @ft_config@ +host = @host@ +host_alias = @host_alias@ +host_cpu = @host_cpu@ +host_os = @host_os@ +host_vendor = @host_vendor@ +htmldir = @htmldir@ +includedir = @includedir@ +infodir = @infodir@ +install_sh = @install_sh@ +launchagentsdir = @launchagentsdir@ +libdir = @libdir@ +libexecdir = @libexecdir@ +localedir = @localedir@ +localstatedir = @localstatedir@ +logdir = @logdir@ +mandir = @mandir@ +mkdir_p = @mkdir_p@ +moduledir = @moduledir@ +oldincludedir = @oldincludedir@ +pdfdir = @pdfdir@ +prefix = @prefix@ +program_transform_name = @program_transform_name@ +psdir = @psdir@ +sbindir = @sbindir@ +sdkdir = @sdkdir@ +sharedstatedir = @sharedstatedir@ +srcdir = @srcdir@ +sysconfdir = @sysconfdir@ +target_alias = @target_alias@ +top_build_prefix = @top_build_prefix@ +top_builddir = @top_builddir@ +top_srcdir = @top_srcdir@ +xglmoduledir = @xglmoduledir@ +xpconfigdir = @xpconfigdir@ +standard_dix_libs = libdix.la libxpstubs.la +@XPRINT_FALSE@noinst_LTLIBRARIES = $(standard_dix_libs) +@XPRINT_TRUE@noinst_LTLIBRARIES = $(standard_dix_libs) libXpdix.la +AM_CFLAGS = $(DIX_CFLAGS) \ + -DVENDOR_NAME=\""@VENDOR_NAME@"\" \ + -DVENDOR_RELEASE="@VENDOR_RELEASE@" + +libdix_la_SOURCES = \ + atom.c \ + colormap.c \ + cursor.c \ + deprecated.c \ + devices.c \ + dispatch.c \ + dispatch.h \ + dixfonts.c \ + dixutils.c \ + events.c \ + extension.c \ + ffs.c \ + gc.c \ + getevents.c \ + globals.c \ + glyphcurs.c \ + grabs.c \ + initatoms.c \ + main.c \ + pixmap.c \ + privates.c \ + property.c \ + registry.c \ + resource.c \ + selection.c \ + swaprep.c \ + swapreq.c \ + tables.c \ + window.c \ + strcasecmp.c \ + strcasestr.c + +libxpstubs_la_SOURCES = \ + xpstubs.c + +@XPRINT_TRUE@libXpdix_la_SOURCES = $(libdix_la_SOURCES) +@XPRINT_TRUE@libXpdix_la_CPPFLAGS = -I$(top_srcdir)/hw/xprint +@XPRINT_TRUE@libXpdix_la_CFLAGS = $(AM_CFLAGS) $(XPRINT_CFLAGS) +EXTRA_DIST = buildatoms BuiltInAtoms CHANGES Xserver.d Xserver-dtrace.h.in + +# Install list of protocol names +miscconfigdir = $(SERVER_MISC_CONFIG_PATH) +dist_miscconfig_DATA = protocol.txt + +# Generate dtrace header file for C sources to include +@XSERVER_DTRACE_TRUE@BUILT_SOURCES = Xserver-dtrace.h +CLEANFILES = dix.c +all: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) all-am + +.SUFFIXES: +.SUFFIXES: .c .lo .o .obj +$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(am__configure_deps) + @for dep in $?; do \ + case '$(am__configure_deps)' in \ + *$$dep*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh \ + && exit 0; \ + exit 1;; \ + esac; \ + done; \ + echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign dix/Makefile'; \ + cd $(top_srcdir) && \ + $(AUTOMAKE) --foreign dix/Makefile +.PRECIOUS: Makefile +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + @case '$?' in \ + *config.status*) \ + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh;; \ + *) \ + echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \ + cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \ + esac; + +$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +$(top_srcdir)/configure: @MAINTAINER_MODE_TRUE@ $(am__configure_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh +$(ACLOCAL_M4): @MAINTAINER_MODE_TRUE@ $(am__aclocal_m4_deps) + cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh + +clean-noinstLTLIBRARIES: + -test -z "$(noinst_LTLIBRARIES)" || rm -f $(noinst_LTLIBRARIES) + @list='$(noinst_LTLIBRARIES)'; for p in $$list; do \ + dir="`echo $$p | sed -e 's|/[^/]*$$||'`"; \ + test "$$dir" != "$$p" || dir=.; \ + echo "rm -f \"$${dir}/so_locations\""; \ + rm -f "$${dir}/so_locations"; \ + done +libXpdix.la: $(libXpdix_la_OBJECTS) $(libXpdix_la_DEPENDENCIES) + $(libXpdix_la_LINK) $(am_libXpdix_la_rpath) $(libXpdix_la_OBJECTS) $(libXpdix_la_LIBADD) $(LIBS) +libdix.la: $(libdix_la_OBJECTS) $(libdix_la_DEPENDENCIES) + $(LINK) $(am_libdix_la_rpath) $(libdix_la_OBJECTS) $(libdix_la_LIBADD) $(LIBS) +libxpstubs.la: $(libxpstubs_la_OBJECTS) $(libxpstubs_la_DEPENDENCIES) + $(LINK) $(am_libxpstubs_la_rpath) $(libxpstubs_la_OBJECTS) $(libxpstubs_la_LIBADD) $(LIBS) + +clean-noinstPROGRAMS: + @list='$(noinst_PROGRAMS)'; for p in $$list; do \ + f=`echo $$p|sed 's/$(EXEEXT)$$//'`; \ + echo " rm -f $$p $$f"; \ + rm -f $$p $$f ; \ + done +@XSERVER_DTRACE_FALSE@dix.O$(EXEEXT): $(dix_O_OBJECTS) $(dix_O_DEPENDENCIES) +@XSERVER_DTRACE_FALSE@ @rm -f dix.O$(EXEEXT) +@XSERVER_DTRACE_FALSE@ $(LINK) $(dix_O_OBJECTS) $(dix_O_LDADD) $(LIBS) + +mostlyclean-compile: + -rm -f *.$(OBJEXT) + +distclean-compile: + -rm -f *.tab.c + +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/atom.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/colormap.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/cursor.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/deprecated.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/devices.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dispatch.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dix.Po@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dixfonts.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/dixutils.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/events.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/extension.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/ffs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/gc.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/getevents.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/globals.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/glyphcurs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/grabs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/initatoms.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-atom.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-colormap.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-cursor.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-deprecated.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-devices.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-dispatch.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-dixfonts.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-dixutils.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-events.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-extension.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-ffs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-gc.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-getevents.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-globals.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-glyphcurs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-grabs.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-initatoms.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-main.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-pixmap.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-privates.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-property.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-registry.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-resource.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-selection.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-strcasecmp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-strcasestr.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-swaprep.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-swapreq.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-tables.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/libXpdix_la-window.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/main.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/pixmap.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/privates.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/property.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/registry.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/resource.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/selection.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/strcasecmp.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/strcasestr.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/swaprep.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/swapreq.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/tables.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/window.Plo@am__quote@ +@AMDEP_TRUE@@am__include@ @am__quote@./$(DEPDIR)/xpstubs.Plo@am__quote@ + +.c.o: +@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c $< + +.c.obj: +@am__fastdepCC_TRUE@ $(COMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ `$(CYGPATH_W) '$<'` +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Po +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=no @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(COMPILE) -c `$(CYGPATH_W) '$<'` + +.c.lo: +@am__fastdepCC_TRUE@ $(LTCOMPILE) -MT $@ -MD -MP -MF $(DEPDIR)/$*.Tpo -c -o $@ $< +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/$*.Tpo $(DEPDIR)/$*.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='$<' object='$@' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LTCOMPILE) -c -o $@ $< + +libXpdix_la-atom.lo: atom.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-atom.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-atom.Tpo -c -o libXpdix_la-atom.lo `test -f 'atom.c' || echo '$(srcdir)/'`atom.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-atom.Tpo $(DEPDIR)/libXpdix_la-atom.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='atom.c' object='libXpdix_la-atom.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-atom.lo `test -f 'atom.c' || echo '$(srcdir)/'`atom.c + +libXpdix_la-colormap.lo: colormap.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-colormap.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-colormap.Tpo -c -o libXpdix_la-colormap.lo `test -f 'colormap.c' || echo '$(srcdir)/'`colormap.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-colormap.Tpo $(DEPDIR)/libXpdix_la-colormap.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='colormap.c' object='libXpdix_la-colormap.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-colormap.lo `test -f 'colormap.c' || echo '$(srcdir)/'`colormap.c + +libXpdix_la-cursor.lo: cursor.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-cursor.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-cursor.Tpo -c -o libXpdix_la-cursor.lo `test -f 'cursor.c' || echo '$(srcdir)/'`cursor.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-cursor.Tpo $(DEPDIR)/libXpdix_la-cursor.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='cursor.c' object='libXpdix_la-cursor.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-cursor.lo `test -f 'cursor.c' || echo '$(srcdir)/'`cursor.c + +libXpdix_la-deprecated.lo: deprecated.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-deprecated.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-deprecated.Tpo -c -o libXpdix_la-deprecated.lo `test -f 'deprecated.c' || echo '$(srcdir)/'`deprecated.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-deprecated.Tpo $(DEPDIR)/libXpdix_la-deprecated.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='deprecated.c' object='libXpdix_la-deprecated.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-deprecated.lo `test -f 'deprecated.c' || echo '$(srcdir)/'`deprecated.c + +libXpdix_la-devices.lo: devices.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-devices.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-devices.Tpo -c -o libXpdix_la-devices.lo `test -f 'devices.c' || echo '$(srcdir)/'`devices.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-devices.Tpo $(DEPDIR)/libXpdix_la-devices.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='devices.c' object='libXpdix_la-devices.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-devices.lo `test -f 'devices.c' || echo '$(srcdir)/'`devices.c + +libXpdix_la-dispatch.lo: dispatch.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-dispatch.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-dispatch.Tpo -c -o libXpdix_la-dispatch.lo `test -f 'dispatch.c' || echo '$(srcdir)/'`dispatch.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-dispatch.Tpo $(DEPDIR)/libXpdix_la-dispatch.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='dispatch.c' object='libXpdix_la-dispatch.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-dispatch.lo `test -f 'dispatch.c' || echo '$(srcdir)/'`dispatch.c + +libXpdix_la-dixfonts.lo: dixfonts.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-dixfonts.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-dixfonts.Tpo -c -o libXpdix_la-dixfonts.lo `test -f 'dixfonts.c' || echo '$(srcdir)/'`dixfonts.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-dixfonts.Tpo $(DEPDIR)/libXpdix_la-dixfonts.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='dixfonts.c' object='libXpdix_la-dixfonts.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-dixfonts.lo `test -f 'dixfonts.c' || echo '$(srcdir)/'`dixfonts.c + +libXpdix_la-dixutils.lo: dixutils.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-dixutils.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-dixutils.Tpo -c -o libXpdix_la-dixutils.lo `test -f 'dixutils.c' || echo '$(srcdir)/'`dixutils.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-dixutils.Tpo $(DEPDIR)/libXpdix_la-dixutils.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='dixutils.c' object='libXpdix_la-dixutils.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-dixutils.lo `test -f 'dixutils.c' || echo '$(srcdir)/'`dixutils.c + +libXpdix_la-events.lo: events.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-events.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-events.Tpo -c -o libXpdix_la-events.lo `test -f 'events.c' || echo '$(srcdir)/'`events.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-events.Tpo $(DEPDIR)/libXpdix_la-events.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='events.c' object='libXpdix_la-events.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-events.lo `test -f 'events.c' || echo '$(srcdir)/'`events.c + +libXpdix_la-extension.lo: extension.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-extension.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-extension.Tpo -c -o libXpdix_la-extension.lo `test -f 'extension.c' || echo '$(srcdir)/'`extension.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-extension.Tpo $(DEPDIR)/libXpdix_la-extension.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='extension.c' object='libXpdix_la-extension.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-extension.lo `test -f 'extension.c' || echo '$(srcdir)/'`extension.c + +libXpdix_la-ffs.lo: ffs.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-ffs.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-ffs.Tpo -c -o libXpdix_la-ffs.lo `test -f 'ffs.c' || echo '$(srcdir)/'`ffs.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-ffs.Tpo $(DEPDIR)/libXpdix_la-ffs.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='ffs.c' object='libXpdix_la-ffs.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-ffs.lo `test -f 'ffs.c' || echo '$(srcdir)/'`ffs.c + +libXpdix_la-gc.lo: gc.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-gc.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-gc.Tpo -c -o libXpdix_la-gc.lo `test -f 'gc.c' || echo '$(srcdir)/'`gc.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-gc.Tpo $(DEPDIR)/libXpdix_la-gc.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='gc.c' object='libXpdix_la-gc.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-gc.lo `test -f 'gc.c' || echo '$(srcdir)/'`gc.c + +libXpdix_la-getevents.lo: getevents.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-getevents.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-getevents.Tpo -c -o libXpdix_la-getevents.lo `test -f 'getevents.c' || echo '$(srcdir)/'`getevents.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-getevents.Tpo $(DEPDIR)/libXpdix_la-getevents.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='getevents.c' object='libXpdix_la-getevents.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-getevents.lo `test -f 'getevents.c' || echo '$(srcdir)/'`getevents.c + +libXpdix_la-globals.lo: globals.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-globals.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-globals.Tpo -c -o libXpdix_la-globals.lo `test -f 'globals.c' || echo '$(srcdir)/'`globals.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-globals.Tpo $(DEPDIR)/libXpdix_la-globals.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='globals.c' object='libXpdix_la-globals.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-globals.lo `test -f 'globals.c' || echo '$(srcdir)/'`globals.c + +libXpdix_la-glyphcurs.lo: glyphcurs.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-glyphcurs.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-glyphcurs.Tpo -c -o libXpdix_la-glyphcurs.lo `test -f 'glyphcurs.c' || echo '$(srcdir)/'`glyphcurs.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-glyphcurs.Tpo $(DEPDIR)/libXpdix_la-glyphcurs.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='glyphcurs.c' object='libXpdix_la-glyphcurs.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-glyphcurs.lo `test -f 'glyphcurs.c' || echo '$(srcdir)/'`glyphcurs.c + +libXpdix_la-grabs.lo: grabs.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-grabs.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-grabs.Tpo -c -o libXpdix_la-grabs.lo `test -f 'grabs.c' || echo '$(srcdir)/'`grabs.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-grabs.Tpo $(DEPDIR)/libXpdix_la-grabs.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='grabs.c' object='libXpdix_la-grabs.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-grabs.lo `test -f 'grabs.c' || echo '$(srcdir)/'`grabs.c + +libXpdix_la-initatoms.lo: initatoms.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-initatoms.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-initatoms.Tpo -c -o libXpdix_la-initatoms.lo `test -f 'initatoms.c' || echo '$(srcdir)/'`initatoms.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-initatoms.Tpo $(DEPDIR)/libXpdix_la-initatoms.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='initatoms.c' object='libXpdix_la-initatoms.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-initatoms.lo `test -f 'initatoms.c' || echo '$(srcdir)/'`initatoms.c + +libXpdix_la-main.lo: main.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-main.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-main.Tpo -c -o libXpdix_la-main.lo `test -f 'main.c' || echo '$(srcdir)/'`main.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-main.Tpo $(DEPDIR)/libXpdix_la-main.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='main.c' object='libXpdix_la-main.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-main.lo `test -f 'main.c' || echo '$(srcdir)/'`main.c + +libXpdix_la-pixmap.lo: pixmap.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-pixmap.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-pixmap.Tpo -c -o libXpdix_la-pixmap.lo `test -f 'pixmap.c' || echo '$(srcdir)/'`pixmap.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-pixmap.Tpo $(DEPDIR)/libXpdix_la-pixmap.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='pixmap.c' object='libXpdix_la-pixmap.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-pixmap.lo `test -f 'pixmap.c' || echo '$(srcdir)/'`pixmap.c + +libXpdix_la-privates.lo: privates.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-privates.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-privates.Tpo -c -o libXpdix_la-privates.lo `test -f 'privates.c' || echo '$(srcdir)/'`privates.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-privates.Tpo $(DEPDIR)/libXpdix_la-privates.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='privates.c' object='libXpdix_la-privates.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-privates.lo `test -f 'privates.c' || echo '$(srcdir)/'`privates.c + +libXpdix_la-property.lo: property.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-property.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-property.Tpo -c -o libXpdix_la-property.lo `test -f 'property.c' || echo '$(srcdir)/'`property.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-property.Tpo $(DEPDIR)/libXpdix_la-property.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='property.c' object='libXpdix_la-property.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-property.lo `test -f 'property.c' || echo '$(srcdir)/'`property.c + +libXpdix_la-registry.lo: registry.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-registry.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-registry.Tpo -c -o libXpdix_la-registry.lo `test -f 'registry.c' || echo '$(srcdir)/'`registry.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-registry.Tpo $(DEPDIR)/libXpdix_la-registry.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='registry.c' object='libXpdix_la-registry.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-registry.lo `test -f 'registry.c' || echo '$(srcdir)/'`registry.c + +libXpdix_la-resource.lo: resource.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-resource.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-resource.Tpo -c -o libXpdix_la-resource.lo `test -f 'resource.c' || echo '$(srcdir)/'`resource.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-resource.Tpo $(DEPDIR)/libXpdix_la-resource.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='resource.c' object='libXpdix_la-resource.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-resource.lo `test -f 'resource.c' || echo '$(srcdir)/'`resource.c + +libXpdix_la-selection.lo: selection.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-selection.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-selection.Tpo -c -o libXpdix_la-selection.lo `test -f 'selection.c' || echo '$(srcdir)/'`selection.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-selection.Tpo $(DEPDIR)/libXpdix_la-selection.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='selection.c' object='libXpdix_la-selection.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-selection.lo `test -f 'selection.c' || echo '$(srcdir)/'`selection.c + +libXpdix_la-swaprep.lo: swaprep.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-swaprep.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-swaprep.Tpo -c -o libXpdix_la-swaprep.lo `test -f 'swaprep.c' || echo '$(srcdir)/'`swaprep.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-swaprep.Tpo $(DEPDIR)/libXpdix_la-swaprep.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='swaprep.c' object='libXpdix_la-swaprep.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-swaprep.lo `test -f 'swaprep.c' || echo '$(srcdir)/'`swaprep.c + +libXpdix_la-swapreq.lo: swapreq.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-swapreq.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-swapreq.Tpo -c -o libXpdix_la-swapreq.lo `test -f 'swapreq.c' || echo '$(srcdir)/'`swapreq.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-swapreq.Tpo $(DEPDIR)/libXpdix_la-swapreq.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='swapreq.c' object='libXpdix_la-swapreq.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-swapreq.lo `test -f 'swapreq.c' || echo '$(srcdir)/'`swapreq.c + +libXpdix_la-tables.lo: tables.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-tables.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-tables.Tpo -c -o libXpdix_la-tables.lo `test -f 'tables.c' || echo '$(srcdir)/'`tables.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-tables.Tpo $(DEPDIR)/libXpdix_la-tables.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='tables.c' object='libXpdix_la-tables.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-tables.lo `test -f 'tables.c' || echo '$(srcdir)/'`tables.c + +libXpdix_la-window.lo: window.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-window.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-window.Tpo -c -o libXpdix_la-window.lo `test -f 'window.c' || echo '$(srcdir)/'`window.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-window.Tpo $(DEPDIR)/libXpdix_la-window.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='window.c' object='libXpdix_la-window.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-window.lo `test -f 'window.c' || echo '$(srcdir)/'`window.c + +libXpdix_la-strcasecmp.lo: strcasecmp.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-strcasecmp.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-strcasecmp.Tpo -c -o libXpdix_la-strcasecmp.lo `test -f 'strcasecmp.c' || echo '$(srcdir)/'`strcasecmp.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-strcasecmp.Tpo $(DEPDIR)/libXpdix_la-strcasecmp.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='strcasecmp.c' object='libXpdix_la-strcasecmp.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-strcasecmp.lo `test -f 'strcasecmp.c' || echo '$(srcdir)/'`strcasecmp.c + +libXpdix_la-strcasestr.lo: strcasestr.c +@am__fastdepCC_TRUE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -MT libXpdix_la-strcasestr.lo -MD -MP -MF $(DEPDIR)/libXpdix_la-strcasestr.Tpo -c -o libXpdix_la-strcasestr.lo `test -f 'strcasestr.c' || echo '$(srcdir)/'`strcasestr.c +@am__fastdepCC_TRUE@ mv -f $(DEPDIR)/libXpdix_la-strcasestr.Tpo $(DEPDIR)/libXpdix_la-strcasestr.Plo +@AMDEP_TRUE@@am__fastdepCC_FALSE@ source='strcasestr.c' object='libXpdix_la-strcasestr.lo' libtool=yes @AMDEPBACKSLASH@ +@AMDEP_TRUE@@am__fastdepCC_FALSE@ DEPDIR=$(DEPDIR) $(CCDEPMODE) $(depcomp) @AMDEPBACKSLASH@ +@am__fastdepCC_FALSE@ $(LIBTOOL) --tag=CC $(AM_LIBTOOLFLAGS) $(LIBTOOLFLAGS) --mode=compile $(CC) $(DEFS) $(DEFAULT_INCLUDES) $(INCLUDES) $(libXpdix_la_CPPFLAGS) $(CPPFLAGS) $(libXpdix_la_CFLAGS) $(CFLAGS) -c -o libXpdix_la-strcasestr.lo `test -f 'strcasestr.c' || echo '$(srcdir)/'`strcasestr.c + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs +install-dist_miscconfigDATA: $(dist_miscconfig_DATA) + @$(NORMAL_INSTALL) + test -z "$(miscconfigdir)" || $(MKDIR_P) "$(DESTDIR)$(miscconfigdir)" + @list='$(dist_miscconfig_DATA)'; for p in $$list; do \ + if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \ + f=$(am__strip_dir) \ + echo " $(dist_miscconfigDATA_INSTALL) '$$d$$p' '$(DESTDIR)$(miscconfigdir)/$$f'"; \ + $(dist_miscconfigDATA_INSTALL) "$$d$$p" "$(DESTDIR)$(miscconfigdir)/$$f"; \ + done + +uninstall-dist_miscconfigDATA: + @$(NORMAL_UNINSTALL) + @list='$(dist_miscconfig_DATA)'; for p in $$list; do \ + f=$(am__strip_dir) \ + echo " rm -f '$(DESTDIR)$(miscconfigdir)/$$f'"; \ + rm -f "$(DESTDIR)$(miscconfigdir)/$$f"; \ + done + +ID: $(HEADERS) $(SOURCES) $(LISP) $(TAGS_FILES) + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonemtpy = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + mkid -fID $$unique +tags: TAGS + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + if test -z "$(ETAGS_ARGS)$$tags$$unique"; then :; else \ + test -n "$$unique" || unique=$$empty_fix; \ + $(ETAGS) $(ETAGSFLAGS) $(AM_ETAGSFLAGS) $(ETAGS_ARGS) \ + $$tags $$unique; \ + fi +ctags: CTAGS +CTAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) \ + $(TAGS_FILES) $(LISP) + tags=; \ + list='$(SOURCES) $(HEADERS) $(LISP) $(TAGS_FILES)'; \ + unique=`for i in $$list; do \ + if test -f "$$i"; then echo $$i; else echo $(srcdir)/$$i; fi; \ + done | \ + $(AWK) '{ files[$$0] = 1; nonempty = 1; } \ + END { if (nonempty) { for (i in files) print i; }; }'`; \ + test -z "$(CTAGS_ARGS)$$tags$$unique" \ + || $(CTAGS) $(CTAGSFLAGS) $(AM_CTAGSFLAGS) $(CTAGS_ARGS) \ + $$tags $$unique + +GTAGS: + here=`$(am__cd) $(top_builddir) && pwd` \ + && cd $(top_srcdir) \ + && gtags -i $(GTAGS_ARGS) $$here + +distclean-tags: + -rm -f TAGS ID GTAGS GRTAGS GSYMS GPATH tags + +distdir: $(DISTFILES) + @srcdirstrip=`echo "$(srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + topsrcdirstrip=`echo "$(top_srcdir)" | sed 's/[].[^$$\\*]/\\\\&/g'`; \ + list='$(DISTFILES)'; \ + dist_files=`for file in $$list; do echo $$file; done | \ + sed -e "s|^$$srcdirstrip/||;t" \ + -e "s|^$$topsrcdirstrip/|$(top_builddir)/|;t"`; \ + case $$dist_files in \ + */*) $(MKDIR_P) `echo "$$dist_files" | \ + sed '/\//!d;s|^|$(distdir)/|;s,/[^/]*$$,,' | \ + sort -u` ;; \ + esac; \ + for file in $$dist_files; do \ + if test -f $$file || test -d $$file; then d=.; else d=$(srcdir); fi; \ + if test -d $$d/$$file; then \ + dir=`echo "/$$file" | sed -e 's,/[^/]*$$,,'`; \ + if test -d $(srcdir)/$$file && test $$d != $(srcdir); then \ + cp -pR $(srcdir)/$$file $(distdir)$$dir || exit 1; \ + fi; \ + cp -pR $$d/$$file $(distdir)$$dir || exit 1; \ + else \ + test -f $(distdir)/$$file \ + || cp -p $$d/$$file $(distdir)/$$file \ + || exit 1; \ + fi; \ + done +check-am: all-am +check: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) check-am +all-am: Makefile $(LTLIBRARIES) $(PROGRAMS) $(DATA) +installdirs: + for dir in "$(DESTDIR)$(miscconfigdir)"; do \ + test -z "$$dir" || $(MKDIR_P) "$$dir"; \ + done +install: $(BUILT_SOURCES) + $(MAKE) $(AM_MAKEFLAGS) install-am +install-exec: install-exec-am +install-data: install-data-am +uninstall: uninstall-am + +install-am: all-am + @$(MAKE) $(AM_MAKEFLAGS) install-exec-am install-data-am + +installcheck: installcheck-am +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM="$(INSTALL_STRIP_PROGRAM)" \ + install_sh_PROGRAM="$(INSTALL_STRIP_PROGRAM)" INSTALL_STRIP_FLAG=-s \ + `test -z '$(STRIP)' || \ + echo "INSTALL_PROGRAM_ENV=STRIPPROG='$(STRIP)'"` install +mostlyclean-generic: + +clean-generic: + -test -z "$(CLEANFILES)" || rm -f $(CLEANFILES) + +distclean-generic: + -test -z "$(CONFIG_CLEAN_FILES)" || rm -f $(CONFIG_CLEAN_FILES) + +maintainer-clean-generic: + @echo "This command is intended for maintainers to use" + @echo "it deletes files that may require special tools to rebuild." + -test -z "$(BUILT_SOURCES)" || rm -f $(BUILT_SOURCES) +clean: clean-am + +clean-am: clean-generic clean-libtool clean-noinstLTLIBRARIES \ + clean-noinstPROGRAMS mostlyclean-am + +distclean: distclean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +distclean-am: clean-am distclean-compile distclean-generic \ + distclean-tags + +dvi: dvi-am + +dvi-am: + +html: html-am + +info: info-am + +info-am: + +install-data-am: install-dist_miscconfigDATA + +install-dvi: install-dvi-am + +install-exec-am: + +install-html: install-html-am + +install-info: install-info-am + +install-man: + +install-pdf: install-pdf-am + +install-ps: install-ps-am + +installcheck-am: + +maintainer-clean: maintainer-clean-am + -rm -rf ./$(DEPDIR) + -rm -f Makefile +maintainer-clean-am: distclean-am maintainer-clean-generic + +mostlyclean: mostlyclean-am + +mostlyclean-am: mostlyclean-compile mostlyclean-generic \ + mostlyclean-libtool + +pdf: pdf-am + +pdf-am: + +ps: ps-am + +ps-am: + +uninstall-am: uninstall-dist_miscconfigDATA + +.MAKE: install-am install-strip + +.PHONY: CTAGS GTAGS all all-am check check-am clean clean-generic \ + clean-libtool clean-noinstLTLIBRARIES clean-noinstPROGRAMS \ + ctags distclean distclean-compile distclean-generic \ + distclean-libtool distclean-tags distdir dvi dvi-am html \ + html-am info info-am install install-am install-data \ + install-data-am install-dist_miscconfigDATA install-dvi \ + install-dvi-am install-exec install-exec-am install-html \ + install-html-am install-info install-info-am install-man \ + install-pdf install-pdf-am install-ps install-ps-am \ + install-strip installcheck installcheck-am installdirs \ + maintainer-clean maintainer-clean-generic mostlyclean \ + mostlyclean-compile mostlyclean-generic mostlyclean-libtool \ + pdf pdf-am ps ps-am tags uninstall uninstall-am \ + uninstall-dist_miscconfigDATA + + +@XSERVER_DTRACE_TRUE@Xserver-dtrace.h: $(srcdir)/Xserver.d +@XSERVER_DTRACE_TRUE@ $(DTRACE) -C -h -o $@ -s $(srcdir)/Xserver.d \ +@XSERVER_DTRACE_TRUE@ || cp Xserver-dtrace.h.in $@ + +# Generate dtrace object code for probes in libdix +@XSERVER_DTRACE_TRUE@dtrace-dix.o: $(top_srcdir)/dix/Xserver.d $(am_libdix_la_OBJECTS) +@XSERVER_DTRACE_TRUE@ $(DTRACE) -G -C -o $@ -s $(top_srcdir)/dix/Xserver.d .libs/*.o + +@XSERVER_DTRACE_TRUE@dix.O: dtrace-dix.o $(am_libdix_la_OBJECTS) +@XSERVER_DTRACE_TRUE@ ld -r -o $@ .libs/*.o + +dix.c: + touch $@ +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/xorg-server/dix/Xserver-dtrace.h.in b/xorg-server/dix/Xserver-dtrace.h.in new file mode 100644 index 000000000..26a8b4099 --- /dev/null +++ b/xorg-server/dix/Xserver-dtrace.h.in @@ -0,0 +1,100 @@ +/* Copyright 2006 Sun Microsystems, Inc. All rights reserved. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, and/or sell copies of the Software, and to permit persons + * to whom the Software is furnished to do so, provided that the above + * copyright notice(s) and this permission notice appear in all copies of + * the Software and that both the above copyright notice(s) and this + * permission notice appear in supporting documentation. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS + * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT + * OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR + * HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL + * INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING + * FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, + * NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION + * WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + * + * Except as contained in this notice, the name of a copyright holder + * shall not be used in advertising or otherwise to promote the sale, use + * or other dealings in this Software without prior written authorization + * of the copyright holder. + */ + +/* + * Generated by dtrace(1M), and then modified for backwards compatibility + * with older versions of dtrace. Used if dtrace -h fails. + * (Since _ENABLED support was added after dtrace -h, this assumes if + * dtrace -h fails, _ENABLED will too.) + */ + +#ifndef _XSERVER_DTRACE_H +#define _XSERVER_DTRACE_H + +#include + +#ifdef __cplusplus +extern "C" { +#endif + +#if _DTRACE_VERSION + +#define XSERVER_CLIENT_AUTH(arg0, arg1, arg2, arg3) \ + __dtrace_Xserver___client__auth(arg0, arg1, arg2, arg3) +#define XSERVER_CLIENT_CONNECT(arg0, arg1) \ + __dtrace_Xserver___client__connect(arg0, arg1) +#define XSERVER_CLIENT_DISCONNECT(arg0) \ + __dtrace_Xserver___client__disconnect(arg0) +#define XSERVER_REQUEST_DONE(arg0, arg1, arg2, arg3, arg4) \ + __dtrace_Xserver___request__done(arg0, arg1, arg2, arg3, arg4) +#define XSERVER_REQUEST_START(arg0, arg1, arg2, arg3, arg4) \ + __dtrace_Xserver___request__start(arg0, arg1, arg2, arg3, arg4) +#define XSERVER_RESOURCE_ALLOC(arg0, arg1, arg2, arg3) \ + __dtrace_Xserver___resource__alloc(arg0, arg1, arg2, arg3) +#define XSERVER_RESOURCE_FREE(arg0, arg1, arg2, arg3) \ + __dtrace_Xserver___resource__free(arg0, arg1, arg2, arg3) +#define XSERVER_SEND_EVENT(arg0, arg1, arg2) \ + __dtrace_Xserver___send__event(arg0, arg1, arg2) + + +extern void __dtrace_Xserver___client__auth(int, string, pid_t, zoneid_t); +extern void __dtrace_Xserver___client__connect(int, int); +extern void __dtrace_Xserver___client__disconnect(int); +extern void __dtrace_Xserver___request__done(string, uint8_t, uint32_t, int, int); +extern void __dtrace_Xserver___request__start(string, uint8_t, uint16_t, int, void *); +extern void __dtrace_Xserver___resource__alloc(uint32_t, uint32_t, void *, string); +extern void __dtrace_Xserver___resource__free(uint32_t, uint32_t, void *, string); +extern void __dtrace_Xserver___send__event(int, uint8_t, void *); + +#else + +#define XSERVER_CLIENT_AUTH(arg0, arg1, arg2, arg3) +#define XSERVER_CLIENT_CONNECT(arg0, arg1) +#define XSERVER_CLIENT_DISCONNECT(arg0) +#define XSERVER_REQUEST_DONE(arg0, arg1, arg2, arg3, arg4) +#define XSERVER_REQUEST_START(arg0, arg1, arg2, arg3, arg4) +#define XSERVER_RESOURCE_ALLOC(arg0, arg1, arg2, arg3) +#define XSERVER_RESOURCE_FREE(arg0, arg1, arg2, arg3) +#define XSERVER_SEND_EVENT(arg0, arg1, arg2) + +#endif + +#define XSERVER_CLIENT_AUTH_ENABLED() (1) +#define XSERVER_CLIENT_CONNECT_ENABLED() (1) +#define XSERVER_CLIENT_DISCONNECT_ENABLED() (1) +#define XSERVER_REQUEST_DONE_ENABLED() (1) +#define XSERVER_REQUEST_START_ENABLED() (1) +#define XSERVER_RESOURCE_ALLOC_ENABLED() (1) +#define XSERVER_RESOURCE_FREE_ENABLED() (1) +#define XSERVER_SEND_EVENT_ENABLED() (1) + +#ifdef __cplusplus +} +#endif + +#endif /* _XSERVER_DTRACE_H */ diff --git a/xorg-server/dix/Xserver.d b/xorg-server/dix/Xserver.d new file mode 100644 index 000000000..e4c9b8320 --- /dev/null +++ b/xorg-server/dix/Xserver.d @@ -0,0 +1,59 @@ +/* Copyright 2005-2006 Sun Microsystems, Inc. All rights reserved. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, and/or sell copies of the Software, and to permit persons + * to whom the Software is furnished to do so, provided that the above + * copyright notice(s) and this permission notice appear in all copies of + * the Software and that both the above copyright notice(s) and this + * permission notice appear in supporting documentation. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS + * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT + * OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR + * HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL + * INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING + * FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, + * NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION + * WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + * + * Except as contained in this notice, the name of a copyright holder + * shall not be used in advertising or otherwise to promote the sale, use + * or other dealings in this Software without prior written authorization + * of the copyright holder. + */ + +/* + * Xserver dtrace provider definition + */ + +#include + +provider Xserver { + /* reqType, data, length, client id, request buffer */ + probe request__start(string, uint8_t, uint16_t, int, void *); + /* reqType, data, sequence, client id, result */ + probe request__done(string, uint8_t, uint32_t, int, int); + /* client id, client fd */ + probe client__connect(int, int); + /* client id, client address, client pid, client zone id */ + probe client__auth(int, string, pid_t, zoneid_t); + /* client id */ + probe client__disconnect(int); + /* resource id, resource type, value, resource type name */ + probe resource__alloc(uint32_t, uint32_t, void *, string); + /* resource id, resource type, value, resource type name */ + probe resource__free(uint32_t, uint32_t, void *, string); + /* client id, event type, event* */ + probe send__event(int, uint8_t, void *); +}; + +#pragma D attributes Unstable/Unstable/Common provider Xserver provider +#pragma D attributes Private/Private/Unknown provider Xserver module +#pragma D attributes Private/Private/Unknown provider Xserver function +#pragma D attributes Unstable/Unstable/Common provider Xserver name +#pragma D attributes Unstable/Unstable/Common provider Xserver args + diff --git a/xorg-server/dix/atom.c b/xorg-server/dix/atom.c new file mode 100644 index 000000000..c968c1e5a --- /dev/null +++ b/xorg-server/dix/atom.c @@ -0,0 +1,211 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include +#include +#include "misc.h" +#include "resource.h" +#include "dix.h" + +#define InitialTableSize 100 + +typedef struct _Node { + struct _Node *left, *right; + Atom a; + unsigned int fingerPrint; + char *string; +} NodeRec, *NodePtr; + +static Atom lastAtom = None; +static NodePtr atomRoot = (NodePtr)NULL; +static unsigned long tableLength; +static NodePtr *nodeTable; + +void FreeAtom(NodePtr patom); + +_X_EXPORT Atom +MakeAtom(char *string, unsigned len, Bool makeit) +{ + NodePtr * np; + unsigned i; + int comp; + unsigned int fp = 0; + + np = &atomRoot; + for (i = 0; i < (len+1)/2; i++) + { + fp = fp * 27 + string[i]; + fp = fp * 27 + string[len - 1 - i]; + } + while (*np != (NodePtr) NULL) + { + if (fp < (*np)->fingerPrint) + np = &((*np)->left); + else if (fp > (*np)->fingerPrint) + np = &((*np)->right); + else + { /* now start testing the strings */ + comp = strncmp(string, (*np)->string, (int)len); + if ((comp < 0) || ((comp == 0) && (len < strlen((*np)->string)))) + np = &((*np)->left); + else if (comp > 0) + np = &((*np)->right); + else + return(*np)->a; + } + } + if (makeit) + { + NodePtr nd; + + nd = (NodePtr) xalloc(sizeof(NodeRec)); + if (!nd) + return BAD_RESOURCE; + if (lastAtom < XA_LAST_PREDEFINED) + { + nd->string = string; + } + else + { + nd->string = (char *) xalloc(len + 1); + if (!nd->string) { + xfree(nd); + return BAD_RESOURCE; + } + strncpy(nd->string, string, (int)len); + nd->string[len] = 0; + } + if ((lastAtom + 1) >= tableLength) { + NodePtr *table; + + table = (NodePtr *) xrealloc(nodeTable, + tableLength * (2 * sizeof(NodePtr))); + if (!table) { + if (nd->string != string) + xfree(nd->string); + xfree(nd); + return BAD_RESOURCE; + } + tableLength <<= 1; + nodeTable = table; + } + *np = nd; + nd->left = nd->right = (NodePtr) NULL; + nd->fingerPrint = fp; + nd->a = (++lastAtom); + *(nodeTable+lastAtom) = nd; + return nd->a; + } + else + return None; +} + +_X_EXPORT Bool +ValidAtom(Atom atom) +{ + return (atom != None) && (atom <= lastAtom); +} + +_X_EXPORT char * +NameForAtom(Atom atom) +{ + NodePtr node; + if (atom > lastAtom) return 0; + if ((node = nodeTable[atom]) == (NodePtr)NULL) return 0; + return node->string; +} + +void +AtomError(void) +{ + FatalError("initializing atoms"); +} + +void +FreeAtom(NodePtr patom) +{ + if(patom->left) + FreeAtom(patom->left); + if(patom->right) + FreeAtom(patom->right); + if (patom->a > XA_LAST_PREDEFINED) + xfree(patom->string); + xfree(patom); +} + +void +FreeAllAtoms(void) +{ + if(atomRoot == (NodePtr)NULL) + return; + FreeAtom(atomRoot); + atomRoot = (NodePtr)NULL; + xfree(nodeTable); + nodeTable = (NodePtr *)NULL; + lastAtom = None; +} + +void +InitAtoms(void) +{ + FreeAllAtoms(); + tableLength = InitialTableSize; + nodeTable = (NodePtr *)xalloc(InitialTableSize*sizeof(NodePtr)); + if (!nodeTable) + AtomError(); + nodeTable[None] = (NodePtr)NULL; + MakePredeclaredAtoms(); + if (lastAtom != XA_LAST_PREDEFINED) + AtomError (); +} diff --git a/xorg-server/dix/buildatoms b/xorg-server/dix/buildatoms new file mode 100644 index 000000000..dfbbca8a9 --- /dev/null +++ b/xorg-server/dix/buildatoms @@ -0,0 +1,43 @@ +#!/bin/sh +hfile=../../../include/Xatom.h +cfile=initatoms.c +rm -f $hfile $cfile +umask 222 +awk ' +BEGIN { + hfile = "'$hfile'"; + cfile = "'$cfile'"; + hformat = "#define XA_%s ((Atom) %d)\n"; + printf("#ifndef XATOM_H\n") > hfile; + printf("#define XATOM_H 1\n\n") > hfile; + printf("/* THIS IS A GENERATED FILE\n") > hfile; + printf(" *\n") > hfile; + printf(" * Do not change! Changing this file implies a protocol change!\n") > hfile; + printf(" */\n\n") > hfile; + + printf("/* THIS IS A GENERATED FILE\n") > cfile; + printf(" *\n") > cfile; + printf(" * Do not change! Changing this file implies a protocol change!\n") > cfile; + printf(" */\n\n") > cfile; + printf("#include \"X.h\"\n") > cfile; + printf("#include \"Xatom.h\"\n") > cfile; + printf("#include \"misc.h\"\n") > cfile; + printf("#include \"dix.h\"\n") > cfile; + printf("void MakePredeclaredAtoms()\n") > cfile; + printf("{\n") > cfile; + + } + +NF == 2 && $2 == "@" { + printf(hformat, $1, ++atomno) > hfile ; + printf(" if (MakeAtom(\"%s\", %d, 1) != XA_%s) AtomError();\n", $1, length($1), $1) > cfile ; + } + +END { + printf("\n") > hfile; + printf(hformat, "LAST_PREDEFINED", atomno) > hfile ; + printf("#endif /* XATOM_H */\n") > hfile; + printf("}\n") > cfile ; + } +' BuiltInAtoms +exit 0 diff --git a/xorg-server/dix/colormap.c b/xorg-server/dix/colormap.c new file mode 100644 index 000000000..8b1bad8a3 --- /dev/null +++ b/xorg-server/dix/colormap.c @@ -0,0 +1,2693 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_EVENTS +#include +#include +#include +#include +#include "misc.h" +#include "dix.h" +#include "colormapst.h" +#include "os.h" +#include "scrnintstr.h" +#include "resource.h" +#include "windowstr.h" +#include "privates.h" +#include "xace.h" + +extern XID clientErrorValue; + +static Pixel FindBestPixel( + EntryPtr /*pentFirst*/, + int /*size*/, + xrgb * /*prgb*/, + int /*channel*/ +); + +static int AllComp( + EntryPtr /*pent*/, + xrgb * /*prgb*/ +); + +static int RedComp( + EntryPtr /*pent*/, + xrgb * /*prgb*/ +); + +static int GreenComp( + EntryPtr /*pent*/, + xrgb * /*prgb*/ +); + +static int BlueComp( + EntryPtr /*pent*/, + xrgb * /*prgb*/ +); + +static void FreePixels( + ColormapPtr /*pmap*/, + int /*client*/ +); + +static void CopyFree( + int /*channel*/, + int /*client*/, + ColormapPtr /*pmapSrc*/, + ColormapPtr /*pmapDst*/ +); + +static void FreeCell( + ColormapPtr /*pmap*/, + Pixel /*i*/, + int /*channel*/ +); + +static void UpdateColors( + ColormapPtr /*pmap*/ +); + +static int AllocDirect( + int /*client*/, + ColormapPtr /*pmap*/, + int /*c*/, + int /*r*/, + int /*g*/, + int /*b*/, + Bool /*contig*/, + Pixel * /*pixels*/, + Pixel * /*prmask*/, + Pixel * /*pgmask*/, + Pixel * /*pbmask*/ +); + +static int AllocPseudo( + int /*client*/, + ColormapPtr /*pmap*/, + int /*c*/, + int /*r*/, + Bool /*contig*/, + Pixel * /*pixels*/, + Pixel * /*pmask*/, + Pixel ** /*pppixFirst*/ +); + +static Bool AllocCP( + ColormapPtr /*pmap*/, + EntryPtr /*pentFirst*/, + int /*count*/, + int /*planes*/, + Bool /*contig*/, + Pixel * /*pixels*/, + Pixel * /*pMask*/ +); + +static Bool AllocShared( + ColormapPtr /*pmap*/, + Pixel * /*ppix*/, + int /*c*/, + int /*r*/, + int /*g*/, + int /*b*/, + Pixel /*rmask*/, + Pixel /*gmask*/, + Pixel /*bmask*/, + Pixel * /*ppixFirst*/ +); + +static int FreeCo( + ColormapPtr /*pmap*/, + int /*client*/, + int /*color*/, + int /*npixIn*/, + Pixel * /*ppixIn*/, + Pixel /*mask*/ +); + +static int TellNoMap( + WindowPtr /*pwin*/, + Colormap * /*pmid*/ +); + +static void FindColorInRootCmap ( + ColormapPtr /* pmap */, + EntryPtr /* pentFirst */, + int /* size */, + xrgb* /* prgb */, + Pixel* /* pPixel */, + int /* channel */, + ColorCompareProcPtr /* comp */ +); + +#define NUMRED(vis) ((vis->redMask >> vis->offsetRed) + 1) +#define NUMGREEN(vis) ((vis->greenMask >> vis->offsetGreen) + 1) +#define NUMBLUE(vis) ((vis->blueMask >> vis->offsetBlue) + 1) +#if COMPOSITE +#define ALPHAMASK(vis) ((vis)->nplanes < 32 ? 0 : \ + (CARD32) ~((vis)->redMask|(vis)->greenMask|(vis)->blueMask)) +#else +#define ALPHAMASK(vis) 0 +#endif + +#define RGBMASK(vis) (vis->redMask | vis->greenMask | vis->blueMask | ALPHAMASK(vis)) + +/* GetNextBitsOrBreak(bits, mask, base) -- + * (Suggestion: First read the macro, then read this explanation. + * + * Either generate the next value to OR in to a pixel or break out of this + * while loop + * + * This macro is used when we're trying to generate all 2^n combinations of + * bits in mask. What we're doing here is counting in binary, except that + * the bits we use to count may not be contiguous. This macro will be + * called 2^n times, returning a different value in bits each time. Then + * it will cause us to break out of a surrounding loop. (It will always be + * called from within a while loop.) + * On call: mask is the value we want to find all the combinations for + * base has 1 bit set where the least significant bit of mask is set + * + * For example,if mask is 01010, base should be 0010 and we count like this: + * 00010 (see this isn't so hard), + * then we add base to bits and get 0100. (bits & ~mask) is (0100 & 0100) so + * we add that to bits getting (0100 + 0100) = + * 01000 for our next value. + * then we add 0010 to get + * 01010 and we're done (easy as 1, 2, 3) + */ +#define GetNextBitsOrBreak(bits, mask, base) \ + if((bits) == (mask)) \ + break; \ + (bits) += (base); \ + while((bits) & ~(mask)) \ + (bits) += ((bits) & ~(mask)); +/* ID of server as client */ +#define SERVER_ID 0 + +typedef struct _colorResource +{ + Colormap mid; + int client; +} colorResource; + +/* Invariants: + * refcnt == 0 means entry is empty + * refcnt > 0 means entry is useable by many clients, so it can't be changed + * refcnt == AllocPrivate means entry owned by one client only + * fShared should only be set if refcnt == AllocPrivate, and only in red map + */ + + +/** + * Create and initialize the color map + * + * \param mid resource to use for this colormap + * \param alloc 1 iff all entries are allocated writable + */ +_X_EXPORT int +CreateColormap (Colormap mid, ScreenPtr pScreen, VisualPtr pVisual, + ColormapPtr *ppcmap, int alloc, int client) +{ + int class, size; + unsigned long sizebytes; + ColormapPtr pmap; + EntryPtr pent; + int i; + Pixel *ppix, **pptr; + + class = pVisual->class; + if(!(class & DynamicClass) && (alloc != AllocNone) && (client != SERVER_ID)) + return (BadMatch); + + size = pVisual->ColormapEntries; + sizebytes = (size * sizeof(Entry)) + + (MAXCLIENTS * sizeof(Pixel *)) + + (MAXCLIENTS * sizeof(int)); + if ((class | DynamicClass) == DirectColor) + sizebytes *= 3; + sizebytes += sizeof(ColormapRec); + pmap = (ColormapPtr) xalloc(sizebytes); + if (!pmap) + return (BadAlloc); +#if defined(_XSERVER64) + pmap->pad0 = 0; + pmap->pad1 = 0; +#if (X_BYTE_ORDER == X_LITTLE_ENDIAN) + pmap->pad2 = 0; +#endif +#endif + pmap->red = (EntryPtr)((char *)pmap + sizeof(ColormapRec)); + sizebytes = size * sizeof(Entry); + pmap->clientPixelsRed = (Pixel **)((char *)pmap->red + sizebytes); + pmap->numPixelsRed = (int *)((char *)pmap->clientPixelsRed + + (MAXCLIENTS * sizeof(Pixel *))); + pmap->mid = mid; + pmap->flags = 0; /* start out with all flags clear */ + if(mid == pScreen->defColormap) + pmap->flags |= IsDefault; + pmap->pScreen = pScreen; + pmap->pVisual = pVisual; + pmap->class = class; + if ((class | DynamicClass) == DirectColor) + size = NUMRED(pVisual); + pmap->freeRed = size; + bzero ((char *) pmap->red, (int)sizebytes); + bzero((char *) pmap->numPixelsRed, MAXCLIENTS * sizeof(int)); + for (pptr = &pmap->clientPixelsRed[MAXCLIENTS]; --pptr >= pmap->clientPixelsRed; ) + *pptr = (Pixel *)NULL; + if (alloc == AllocAll) + { + if (class & DynamicClass) + pmap->flags |= AllAllocated; + for (pent = &pmap->red[size - 1]; pent >= pmap->red; pent--) + pent->refcnt = AllocPrivate; + pmap->freeRed = 0; + ppix = (Pixel *)xalloc(size * sizeof(Pixel)); + if (!ppix) + { + xfree(pmap); + return (BadAlloc); + } + pmap->clientPixelsRed[client] = ppix; + for(i = 0; i < size; i++) + ppix[i] = i; + pmap->numPixelsRed[client] = size; + } + + if ((class | DynamicClass) == DirectColor) + { + pmap->freeGreen = NUMGREEN(pVisual); + pmap->green = (EntryPtr)((char *)pmap->numPixelsRed + + (MAXCLIENTS * sizeof(int))); + pmap->clientPixelsGreen = (Pixel **)((char *)pmap->green + sizebytes); + pmap->numPixelsGreen = (int *)((char *)pmap->clientPixelsGreen + + (MAXCLIENTS * sizeof(Pixel *))); + pmap->freeBlue = NUMBLUE(pVisual); + pmap->blue = (EntryPtr)((char *)pmap->numPixelsGreen + + (MAXCLIENTS * sizeof(int))); + pmap->clientPixelsBlue = (Pixel **)((char *)pmap->blue + sizebytes); + pmap->numPixelsBlue = (int *)((char *)pmap->clientPixelsBlue + + (MAXCLIENTS * sizeof(Pixel *))); + + bzero ((char *) pmap->green, (int)sizebytes); + bzero ((char *) pmap->blue, (int)sizebytes); + + memmove((char *) pmap->clientPixelsGreen, + (char *) pmap->clientPixelsRed, + MAXCLIENTS * sizeof(Pixel *)); + memmove((char *) pmap->clientPixelsBlue, + (char *) pmap->clientPixelsRed, + MAXCLIENTS * sizeof(Pixel *)); + bzero((char *) pmap->numPixelsGreen, MAXCLIENTS * sizeof(int)); + bzero((char *) pmap->numPixelsBlue, MAXCLIENTS * sizeof(int)); + + /* If every cell is allocated, mark its refcnt */ + if (alloc == AllocAll) + { + size = pmap->freeGreen; + for(pent = &pmap->green[size-1]; pent >= pmap->green; pent--) + pent->refcnt = AllocPrivate; + pmap->freeGreen = 0; + ppix = (Pixel *) xalloc(size * sizeof(Pixel)); + if (!ppix) + { + xfree(pmap->clientPixelsRed[client]); + xfree(pmap); + return(BadAlloc); + } + pmap->clientPixelsGreen[client] = ppix; + for(i = 0; i < size; i++) + ppix[i] = i; + pmap->numPixelsGreen[client] = size; + + size = pmap->freeBlue; + for(pent = &pmap->blue[size-1]; pent >= pmap->blue; pent--) + pent->refcnt = AllocPrivate; + pmap->freeBlue = 0; + ppix = (Pixel *) xalloc(size * sizeof(Pixel)); + if (!ppix) + { + xfree(pmap->clientPixelsGreen[client]); + xfree(pmap->clientPixelsRed[client]); + xfree(pmap); + return(BadAlloc); + } + pmap->clientPixelsBlue[client] = ppix; + for(i = 0; i < size; i++) + ppix[i] = i; + pmap->numPixelsBlue[client] = size; + } + } + pmap->devPrivates = NULL; + pmap->flags |= BeingCreated; + + if (!AddResource(mid, RT_COLORMAP, (pointer)pmap)) + return (BadAlloc); + + /* + * Security creation/labeling check + */ + i = XaceHook(XACE_RESOURCE_ACCESS, clients[client], mid, RT_COLORMAP, + pmap, RT_NONE, NULL, DixCreateAccess); + if (i != Success) { + FreeResource(mid, RT_NONE); + return i; + } + + /* If the device wants a chance to initialize the colormap in any way, + * this is it. In specific, if this is a Static colormap, this is the + * time to fill in the colormap's values */ + if (!(*pScreen->CreateColormap)(pmap)) + { + FreeResource (mid, RT_NONE); + return BadAlloc; + } + pmap->flags &= ~BeingCreated; + *ppcmap = pmap; + return (Success); +} + +/** + * + * \param value must conform to DeleteType + */ +int +FreeColormap (pointer value, XID mid) +{ + int i; + EntryPtr pent; + ColormapPtr pmap = (ColormapPtr)value; + + if(CLIENT_ID(mid) != SERVER_ID) + { + (*pmap->pScreen->UninstallColormap) (pmap); + WalkTree(pmap->pScreen, (VisitWindowProcPtr)TellNoMap, (pointer) &mid); + } + + /* This is the device's chance to undo anything it needs to, especially + * to free any storage it allocated */ + (*pmap->pScreen->DestroyColormap)(pmap); + + if(pmap->clientPixelsRed) + { + for(i = 0; i < MAXCLIENTS; i++) + xfree(pmap->clientPixelsRed[i]); + } + + if ((pmap->class == PseudoColor) || (pmap->class == GrayScale)) + { + for(pent = &pmap->red[pmap->pVisual->ColormapEntries - 1]; + pent >= pmap->red; + pent--) + { + if(pent->fShared) + { + if (--pent->co.shco.red->refcnt == 0) + xfree(pent->co.shco.red); + if (--pent->co.shco.green->refcnt == 0) + xfree(pent->co.shco.green); + if (--pent->co.shco.blue->refcnt == 0) + xfree(pent->co.shco.blue); + } + } + } + if((pmap->class | DynamicClass) == DirectColor) + { + for(i = 0; i < MAXCLIENTS; i++) + { + xfree(pmap->clientPixelsGreen[i]); + xfree(pmap->clientPixelsBlue[i]); + } + } + + dixFreePrivates(pmap->devPrivates); + xfree(pmap); + return(Success); +} + +/* Tell window that pmid has disappeared */ +static int +TellNoMap (WindowPtr pwin, Colormap *pmid) +{ + xEvent xE; + + if (wColormap(pwin) == *pmid) + { + /* This should be call to DeliverEvent */ + xE.u.u.type = ColormapNotify; + xE.u.colormap.window = pwin->drawable.id; + xE.u.colormap.colormap = None; + xE.u.colormap.new = TRUE; + xE.u.colormap.state = ColormapUninstalled; +#ifdef PANORAMIX + if(noPanoramiXExtension || !pwin->drawable.pScreen->myNum) +#endif + DeliverEvents(pwin, &xE, 1, (WindowPtr)NULL); + if (pwin->optional) { + pwin->optional->colormap = None; + CheckWindowOptionalNeed (pwin); + } + } + + return (WT_WALKCHILDREN); +} + +/* Tell window that pmid got uninstalled */ +_X_EXPORT int +TellLostMap (WindowPtr pwin, pointer value) +{ + Colormap *pmid = (Colormap *)value; + xEvent xE; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && pwin->drawable.pScreen->myNum) + return WT_STOPWALKING; +#endif + if (wColormap(pwin) == *pmid) + { + /* This should be call to DeliverEvent */ + xE.u.u.type = ColormapNotify; + xE.u.colormap.window = pwin->drawable.id; + xE.u.colormap.colormap = *pmid; + xE.u.colormap.new = FALSE; + xE.u.colormap.state = ColormapUninstalled; + DeliverEvents(pwin, &xE, 1, (WindowPtr)NULL); + } + + return (WT_WALKCHILDREN); +} + +/* Tell window that pmid got installed */ +_X_EXPORT int +TellGainedMap (WindowPtr pwin, pointer value) +{ + Colormap *pmid = (Colormap *)value; + xEvent xE; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && pwin->drawable.pScreen->myNum) + return WT_STOPWALKING; +#endif + if (wColormap (pwin) == *pmid) + { + /* This should be call to DeliverEvent */ + xE.u.u.type = ColormapNotify; + xE.u.colormap.window = pwin->drawable.id; + xE.u.colormap.colormap = *pmid; + xE.u.colormap.new = FALSE; + xE.u.colormap.state = ColormapInstalled; + DeliverEvents(pwin, &xE, 1, (WindowPtr)NULL); + } + + return (WT_WALKCHILDREN); +} + + +int +CopyColormapAndFree (Colormap mid, ColormapPtr pSrc, int client) +{ + ColormapPtr pmap = (ColormapPtr) NULL; + int result, alloc, size; + Colormap midSrc; + ScreenPtr pScreen; + VisualPtr pVisual; + + pScreen = pSrc->pScreen; + pVisual = pSrc->pVisual; + midSrc = pSrc->mid; + alloc = ((pSrc->flags & AllAllocated) && CLIENT_ID(midSrc) == client) ? + AllocAll : AllocNone; + size = pVisual->ColormapEntries; + + /* If the create returns non-0, it failed */ + result = CreateColormap (mid, pScreen, pVisual, &pmap, alloc, client); + if(result != Success) + return(result); + if(alloc == AllocAll) + { + memmove((char *)pmap->red, (char *)pSrc->red, size * sizeof(Entry)); + if((pmap->class | DynamicClass) == DirectColor) + { + memmove((char *)pmap->green, (char *)pSrc->green, size * sizeof(Entry)); + memmove((char *)pmap->blue, (char *)pSrc->blue, size * sizeof(Entry)); + } + pSrc->flags &= ~AllAllocated; + FreePixels(pSrc, client); + UpdateColors(pmap); + return(Success); + } + + CopyFree(REDMAP, client, pSrc, pmap); + if ((pmap->class | DynamicClass) == DirectColor) + { + CopyFree(GREENMAP, client, pSrc, pmap); + CopyFree(BLUEMAP, client, pSrc, pmap); + } + if (pmap->class & DynamicClass) + UpdateColors(pmap); + /* XXX should worry about removing any RT_CMAPENTRY resource */ + return(Success); +} + +/* Helper routine for freeing large numbers of cells from a map */ +static void +CopyFree (int channel, int client, ColormapPtr pmapSrc, ColormapPtr pmapDst) +{ + int z, npix; + EntryPtr pentSrcFirst, pentDstFirst; + EntryPtr pentSrc, pentDst; + Pixel *ppix; + int nalloc; + + switch(channel) + { + default: /* so compiler can see that everything gets initialized */ + case REDMAP: + ppix = (pmapSrc->clientPixelsRed)[client]; + npix = (pmapSrc->numPixelsRed)[client]; + pentSrcFirst = pmapSrc->red; + pentDstFirst = pmapDst->red; + break; + case GREENMAP: + ppix = (pmapSrc->clientPixelsGreen)[client]; + npix = (pmapSrc->numPixelsGreen)[client]; + pentSrcFirst = pmapSrc->green; + pentDstFirst = pmapDst->green; + break; + case BLUEMAP: + ppix = (pmapSrc->clientPixelsBlue)[client]; + npix = (pmapSrc->numPixelsBlue)[client]; + pentSrcFirst = pmapSrc->blue; + pentDstFirst = pmapDst->blue; + break; + } + nalloc = 0; + if (pmapSrc->class & DynamicClass) + { + for(z = npix; --z >= 0; ppix++) + { + /* Copy entries */ + pentSrc = pentSrcFirst + *ppix; + pentDst = pentDstFirst + *ppix; + if (pentDst->refcnt > 0) + { + pentDst->refcnt++; + } + else + { + *pentDst = *pentSrc; + nalloc++; + if (pentSrc->refcnt > 0) + pentDst->refcnt = 1; + else + pentSrc->fShared = FALSE; + } + FreeCell(pmapSrc, *ppix, channel); + } + } + + /* Note that FreeCell has already fixed pmapSrc->free{Color} */ + switch(channel) + { + case REDMAP: + pmapDst->freeRed -= nalloc; + (pmapDst->clientPixelsRed)[client] = + (pmapSrc->clientPixelsRed)[client]; + (pmapSrc->clientPixelsRed)[client] = (Pixel *) NULL; + (pmapDst->numPixelsRed)[client] = (pmapSrc->numPixelsRed)[client]; + (pmapSrc->numPixelsRed)[client] = 0; + break; + case GREENMAP: + pmapDst->freeGreen -= nalloc; + (pmapDst->clientPixelsGreen)[client] = + (pmapSrc->clientPixelsGreen)[client]; + (pmapSrc->clientPixelsGreen)[client] = (Pixel *) NULL; + (pmapDst->numPixelsGreen)[client] = (pmapSrc->numPixelsGreen)[client]; + (pmapSrc->numPixelsGreen)[client] = 0; + break; + case BLUEMAP: + pmapDst->freeBlue -= nalloc; + pmapDst->clientPixelsBlue[client] = pmapSrc->clientPixelsBlue[client]; + pmapSrc->clientPixelsBlue[client] = (Pixel *) NULL; + pmapDst->numPixelsBlue[client] = pmapSrc->numPixelsBlue[client]; + pmapSrc->numPixelsBlue[client] = 0; + break; + } +} + +/* Free the ith entry in a color map. Must handle freeing of + * colors allocated through AllocColorPlanes */ +static void +FreeCell (ColormapPtr pmap, Pixel i, int channel) +{ + EntryPtr pent; + int *pCount; + + + switch (channel) + { + default: /* so compiler can see that everything gets initialized */ + case PSEUDOMAP: + case REDMAP: + pent = (EntryPtr) &pmap->red[i]; + pCount = &pmap->freeRed; + break; + case GREENMAP: + pent = (EntryPtr) &pmap->green[i]; + pCount = &pmap->freeGreen; + break; + case BLUEMAP: + pent = (EntryPtr) &pmap->blue[i]; + pCount = &pmap->freeBlue; + break; + } + /* If it's not privately allocated and it's not time to free it, just + * decrement the count */ + if (pent->refcnt > 1) + pent->refcnt--; + else + { + /* If the color type is shared, find the sharedcolor. If decremented + * refcnt is 0, free the shared cell. */ + if (pent->fShared) + { + if(--pent->co.shco.red->refcnt == 0) + xfree(pent->co.shco.red); + if(--pent->co.shco.green->refcnt == 0) + xfree(pent->co.shco.green); + if(--pent->co.shco.blue->refcnt == 0) + xfree(pent->co.shco.blue); + pent->fShared = FALSE; + } + pent->refcnt = 0; + *pCount += 1; + } +} + +static void +UpdateColors (ColormapPtr pmap) +{ + xColorItem *defs; + xColorItem *pdef; + EntryPtr pent; + VisualPtr pVisual; + int i, n, size; + + pVisual = pmap->pVisual; + size = pVisual->ColormapEntries; + defs = (xColorItem *)xalloc(size * sizeof(xColorItem)); + if (!defs) + return; + n = 0; + pdef = defs; + if (pmap->class == DirectColor) + { + for (i = 0; i < size; i++) + { + if (!pmap->red[i].refcnt && + !pmap->green[i].refcnt && + !pmap->blue[i].refcnt) + continue; + pdef->pixel = ((Pixel)i << pVisual->offsetRed) | + ((Pixel)i << pVisual->offsetGreen) | + ((Pixel)i << pVisual->offsetBlue); + pdef->red = pmap->red[i].co.local.red; + pdef->green = pmap->green[i].co.local.green; + pdef->blue = pmap->blue[i].co.local.blue; + pdef->flags = DoRed|DoGreen|DoBlue; + pdef++; + n++; + } + } + else + { + for (i = 0, pent = pmap->red; i < size; i++, pent++) + { + if (!pent->refcnt) + continue; + pdef->pixel = i; + if(pent->fShared) + { + pdef->red = pent->co.shco.red->color; + pdef->green = pent->co.shco.green->color; + pdef->blue = pent->co.shco.blue->color; + } + else + { + pdef->red = pent->co.local.red; + pdef->green = pent->co.local.green; + pdef->blue = pent->co.local.blue; + } + pdef->flags = DoRed|DoGreen|DoBlue; + pdef++; + n++; + } + } + if (n) + (*pmap->pScreen->StoreColors)(pmap, n, defs); + xfree(defs); +} + +/* Get a read-only color from a ColorMap (probably slow for large maps) + * Returns by changing the value in pred, pgreen, pblue and pPix + */ +_X_EXPORT int +AllocColor (ColormapPtr pmap, + unsigned short *pred, unsigned short *pgreen, unsigned short *pblue, + Pixel *pPix, int client) +{ + Pixel pixR, pixG, pixB; + int entries; + xrgb rgb; + int class; + VisualPtr pVisual; + int npix; + Pixel *ppix; + + pVisual = pmap->pVisual; + (*pmap->pScreen->ResolveColor) (pred, pgreen, pblue, pVisual); + rgb.red = *pred; + rgb.green = *pgreen; + rgb.blue = *pblue; + class = pmap->class; + entries = pVisual->ColormapEntries; + + /* If the colormap is being created, then we want to be able to change + * the colormap, even if it's a static type. Otherwise, we'd never be + * able to initialize static colormaps + */ + if(pmap->flags & BeingCreated) + class |= DynamicClass; + + /* If this is one of the static storage classes, and we're not initializing + * it, the best we can do is to find the closest color entry to the + * requested one and return that. + */ + switch (class) { + case StaticColor: + case StaticGray: + /* Look up all three components in the same pmap */ + *pPix = pixR = FindBestPixel(pmap->red, entries, &rgb, PSEUDOMAP); + *pred = pmap->red[pixR].co.local.red; + *pgreen = pmap->red[pixR].co.local.green; + *pblue = pmap->red[pixR].co.local.blue; + npix = pmap->numPixelsRed[client]; + ppix = (Pixel *) xrealloc(pmap->clientPixelsRed[client], + (npix + 1) * sizeof(Pixel)); + if (!ppix) + return (BadAlloc); + ppix[npix] = pixR; + pmap->clientPixelsRed[client] = ppix; + pmap->numPixelsRed[client]++; + break; + + case TrueColor: + /* Look up each component in its own map, then OR them together */ + pixR = FindBestPixel(pmap->red, NUMRED(pVisual), &rgb, REDMAP); + pixG = FindBestPixel(pmap->green, NUMGREEN(pVisual), &rgb, GREENMAP); + pixB = FindBestPixel(pmap->blue, NUMBLUE(pVisual), &rgb, BLUEMAP); + *pPix = (pixR << pVisual->offsetRed) | + (pixG << pVisual->offsetGreen) | + (pixB << pVisual->offsetBlue) | + ALPHAMASK(pVisual); + + *pred = pmap->red[pixR].co.local.red; + *pgreen = pmap->green[pixG].co.local.green; + *pblue = pmap->blue[pixB].co.local.blue; + npix = pmap->numPixelsRed[client]; + ppix = (Pixel *) xrealloc(pmap->clientPixelsRed[client], + (npix + 1) * sizeof(Pixel)); + if (!ppix) + return (BadAlloc); + ppix[npix] = pixR; + pmap->clientPixelsRed[client] = ppix; + npix = pmap->numPixelsGreen[client]; + ppix = (Pixel *) xrealloc(pmap->clientPixelsGreen[client], + (npix + 1) * sizeof(Pixel)); + if (!ppix) + return (BadAlloc); + ppix[npix] = pixG; + pmap->clientPixelsGreen[client] = ppix; + npix = pmap->numPixelsBlue[client]; + ppix = (Pixel *) xrealloc(pmap->clientPixelsBlue[client], + (npix + 1) * sizeof(Pixel)); + if (!ppix) + return (BadAlloc); + ppix[npix] = pixB; + pmap->clientPixelsBlue[client] = ppix; + pmap->numPixelsRed[client]++; + pmap->numPixelsGreen[client]++; + pmap->numPixelsBlue[client]++; + break; + + case GrayScale: + case PseudoColor: + if (pmap->mid != pmap->pScreen->defColormap && + pmap->pVisual->vid == pmap->pScreen->rootVisual) + { + ColormapPtr prootmap = (ColormapPtr) + SecurityLookupIDByType (clients[client], pmap->pScreen->defColormap, + RT_COLORMAP, DixReadAccess); + + if (pmap->class == prootmap->class) + FindColorInRootCmap (prootmap, prootmap->red, entries, &rgb, + pPix, PSEUDOMAP, AllComp); + } + if (FindColor(pmap, pmap->red, entries, &rgb, pPix, PSEUDOMAP, + client, AllComp) != Success) + return (BadAlloc); + break; + + case DirectColor: + if (pmap->mid != pmap->pScreen->defColormap && + pmap->pVisual->vid == pmap->pScreen->rootVisual) + { + ColormapPtr prootmap = (ColormapPtr) + SecurityLookupIDByType (clients[client], pmap->pScreen->defColormap, + RT_COLORMAP, DixReadAccess); + + if (pmap->class == prootmap->class) + { + pixR = (*pPix & pVisual->redMask) >> pVisual->offsetRed; + FindColorInRootCmap (prootmap, prootmap->red, entries, &rgb, + &pixR, REDMAP, RedComp); + pixG = (*pPix & pVisual->greenMask) >> pVisual->offsetGreen; + FindColorInRootCmap (prootmap, prootmap->green, entries, &rgb, + &pixG, GREENMAP, GreenComp); + pixB = (*pPix & pVisual->blueMask) >> pVisual->offsetBlue; + FindColorInRootCmap (prootmap, prootmap->blue, entries, &rgb, + &pixB, BLUEMAP, BlueComp); + *pPix = pixR | pixG | pixB; + } + } + + pixR = (*pPix & pVisual->redMask) >> pVisual->offsetRed; + if (FindColor(pmap, pmap->red, NUMRED(pVisual), &rgb, &pixR, REDMAP, + client, RedComp) != Success) + return (BadAlloc); + pixG = (*pPix & pVisual->greenMask) >> pVisual->offsetGreen; + if (FindColor(pmap, pmap->green, NUMGREEN(pVisual), &rgb, &pixG, + GREENMAP, client, GreenComp) != Success) + { + (void)FreeCo(pmap, client, REDMAP, 1, &pixR, (Pixel)0); + return (BadAlloc); + } + pixB = (*pPix & pVisual->blueMask) >> pVisual->offsetBlue; + if (FindColor(pmap, pmap->blue, NUMBLUE(pVisual), &rgb, &pixB, BLUEMAP, + client, BlueComp) != Success) + { + (void)FreeCo(pmap, client, GREENMAP, 1, &pixG, (Pixel)0); + (void)FreeCo(pmap, client, REDMAP, 1, &pixR, (Pixel)0); + return (BadAlloc); + } + *pPix = pixR | pixG | pixB | ALPHAMASK(pVisual); + + break; + } + + /* if this is the client's first pixel in this colormap, tell the + * resource manager that the client has pixels in this colormap which + * should be freed when the client dies */ + if ((pmap->numPixelsRed[client] == 1) && + (CLIENT_ID(pmap->mid) != client) && + !(pmap->flags & BeingCreated)) + { + colorResource *pcr; + + pcr = (colorResource *) xalloc(sizeof(colorResource)); + if (!pcr) + { + (void)FreeColors(pmap, client, 1, pPix, (Pixel)0); + return (BadAlloc); + } + pcr->mid = pmap->mid; + pcr->client = client; + if (!AddResource(FakeClientID(client), RT_CMAPENTRY, (pointer)pcr)) + return (BadAlloc); + } + return (Success); +} + +/* + * FakeAllocColor -- fake an AllocColor request by + * returning a free pixel if availible, otherwise returning + * the closest matching pixel. This is used by the mi + * software sprite code to recolor cursors. A nice side-effect + * is that this routine will never return failure. + */ + +_X_EXPORT void +FakeAllocColor (ColormapPtr pmap, xColorItem *item) +{ + Pixel pixR, pixG, pixB; + Pixel temp; + int entries; + xrgb rgb; + int class; + VisualPtr pVisual; + + pVisual = pmap->pVisual; + rgb.red = item->red; + rgb.green = item->green; + rgb.blue = item->blue; + (*pmap->pScreen->ResolveColor) (&rgb.red, &rgb.green, &rgb.blue, pVisual); + class = pmap->class; + entries = pVisual->ColormapEntries; + + switch (class) { + case GrayScale: + case PseudoColor: + temp = 0; + item->pixel = 0; + if (FindColor(pmap, pmap->red, entries, &rgb, &temp, PSEUDOMAP, + -1, AllComp) == Success) { + item->pixel = temp; + break; + } + /* fall through ... */ + case StaticColor: + case StaticGray: + item->pixel = FindBestPixel(pmap->red, entries, &rgb, PSEUDOMAP); + break; + + case DirectColor: + /* Look up each component in its own map, then OR them together */ + pixR = (item->pixel & pVisual->redMask) >> pVisual->offsetRed; + pixG = (item->pixel & pVisual->greenMask) >> pVisual->offsetGreen; + pixB = (item->pixel & pVisual->blueMask) >> pVisual->offsetBlue; + if (FindColor(pmap, pmap->red, NUMRED(pVisual), &rgb, &pixR, REDMAP, + -1, RedComp) != Success) + pixR = FindBestPixel(pmap->red, NUMRED(pVisual), &rgb, REDMAP) + << pVisual->offsetRed; + if (FindColor(pmap, pmap->green, NUMGREEN(pVisual), &rgb, &pixG, + GREENMAP, -1, GreenComp) != Success) + pixG = FindBestPixel(pmap->green, NUMGREEN(pVisual), &rgb, + GREENMAP) << pVisual->offsetGreen; + if (FindColor(pmap, pmap->blue, NUMBLUE(pVisual), &rgb, &pixB, BLUEMAP, + -1, BlueComp) != Success) + pixB = FindBestPixel(pmap->blue, NUMBLUE(pVisual), &rgb, BLUEMAP) + << pVisual->offsetBlue; + item->pixel = pixR | pixG | pixB; + break; + + case TrueColor: + /* Look up each component in its own map, then OR them together */ + pixR = FindBestPixel(pmap->red, NUMRED(pVisual), &rgb, REDMAP); + pixG = FindBestPixel(pmap->green, NUMGREEN(pVisual), &rgb, GREENMAP); + pixB = FindBestPixel(pmap->blue, NUMBLUE(pVisual), &rgb, BLUEMAP); + item->pixel = (pixR << pVisual->offsetRed) | + (pixG << pVisual->offsetGreen) | + (pixB << pVisual->offsetBlue); + break; + } +} + +/* free a pixel value obtained from FakeAllocColor */ +_X_EXPORT void +FakeFreeColor(ColormapPtr pmap, Pixel pixel) +{ + VisualPtr pVisual; + Pixel pixR, pixG, pixB; + + switch (pmap->class) { + case GrayScale: + case PseudoColor: + if (pmap->red[pixel].refcnt == AllocTemporary) + pmap->red[pixel].refcnt = 0; + break; + case DirectColor: + pVisual = pmap->pVisual; + pixR = (pixel & pVisual->redMask) >> pVisual->offsetRed; + pixG = (pixel & pVisual->greenMask) >> pVisual->offsetGreen; + pixB = (pixel & pVisual->blueMask) >> pVisual->offsetBlue; + if (pmap->red[pixR].refcnt == AllocTemporary) + pmap->red[pixR].refcnt = 0; + if (pmap->green[pixG].refcnt == AllocTemporary) + pmap->green[pixG].refcnt = 0; + if (pmap->blue[pixB].refcnt == AllocTemporary) + pmap->blue[pixB].refcnt = 0; + break; + } +} + +typedef unsigned short BigNumUpper; +typedef unsigned long BigNumLower; + +#define BIGNUMLOWERBITS 24 +#define BIGNUMUPPERBITS 16 +#define BIGNUMLOWER (1 << BIGNUMLOWERBITS) +#define BIGNUMUPPER (1 << BIGNUMUPPERBITS) +#define UPPERPART(i) ((i) >> BIGNUMLOWERBITS) +#define LOWERPART(i) ((i) & (BIGNUMLOWER - 1)) + +typedef struct _bignum { + BigNumUpper upper; + BigNumLower lower; +} BigNumRec, *BigNumPtr; + +#define BigNumGreater(x,y) (((x)->upper > (y)->upper) ||\ + ((x)->upper == (y)->upper && (x)->lower > (y)->lower)) + +#define UnsignedToBigNum(u,r) (((r)->upper = UPPERPART(u)), \ + ((r)->lower = LOWERPART(u))) + +#define MaxBigNum(r) (((r)->upper = BIGNUMUPPER-1), \ + ((r)->lower = BIGNUMLOWER-1)) + +static void +BigNumAdd (BigNumPtr x, BigNumPtr y, BigNumPtr r) +{ + BigNumLower lower, carry = 0; + + lower = x->lower + y->lower; + if (lower >= BIGNUMLOWER) { + lower -= BIGNUMLOWER; + carry = 1; + } + r->lower = lower; + r->upper = x->upper + y->upper + carry; +} + +static Pixel +FindBestPixel(EntryPtr pentFirst, int size, xrgb *prgb, int channel) +{ + EntryPtr pent; + Pixel pixel, final; + long dr, dg, db; + unsigned long sq; + BigNumRec minval, sum, temp; + + final = 0; + MaxBigNum(&minval); + /* look for the minimal difference */ + for (pent = pentFirst, pixel = 0; pixel < size; pent++, pixel++) + { + dr = dg = db = 0; + switch(channel) + { + case PSEUDOMAP: + dg = (long) pent->co.local.green - prgb->green; + db = (long) pent->co.local.blue - prgb->blue; + case REDMAP: + dr = (long) pent->co.local.red - prgb->red; + break; + case GREENMAP: + dg = (long) pent->co.local.green - prgb->green; + break; + case BLUEMAP: + db = (long) pent->co.local.blue - prgb->blue; + break; + } + sq = dr * dr; + UnsignedToBigNum (sq, &sum); + sq = dg * dg; + UnsignedToBigNum (sq, &temp); + BigNumAdd (&sum, &temp, &sum); + sq = db * db; + UnsignedToBigNum (sq, &temp); + BigNumAdd (&sum, &temp, &sum); + if (BigNumGreater (&minval, &sum)) + { + final = pixel; + minval = sum; + } + } + return(final); +} + +static void +FindColorInRootCmap (ColormapPtr pmap, EntryPtr pentFirst, int size, + xrgb *prgb, Pixel *pPixel, int channel, + ColorCompareProcPtr comp) +{ + EntryPtr pent; + Pixel pixel; + int count; + + if ((pixel = *pPixel) >= size) + pixel = 0; + for (pent = pentFirst + pixel, count = size; --count >= 0; pent++, pixel++) + { + if (pent->refcnt > 0 && (*comp) (pent, prgb)) + { + switch (channel) + { + case REDMAP: + pixel <<= pmap->pVisual->offsetRed; + break; + case GREENMAP: + pixel <<= pmap->pVisual->offsetGreen; + break; + case BLUEMAP: + pixel <<= pmap->pVisual->offsetBlue; + break; + default: /* PSEUDOMAP */ + break; + } + *pPixel = pixel; + } + } +} + +/* Tries to find a color in pmap that exactly matches the one requested in prgb + * if it can't it allocates one. + * Starts looking at pentFirst + *pPixel, so if you want a specific pixel, + * load *pPixel with that value, otherwise set it to 0 + */ +int +FindColor (ColormapPtr pmap, EntryPtr pentFirst, int size, xrgb *prgb, + Pixel *pPixel, int channel, int client, + ColorCompareProcPtr comp) +{ + EntryPtr pent; + Bool foundFree; + Pixel pixel, Free = 0; + int npix, count, *nump = NULL; + Pixel **pixp = NULL, *ppix; + xColorItem def; + + foundFree = FALSE; + + if((pixel = *pPixel) >= size) + pixel = 0; + /* see if there is a match, and also look for a free entry */ + for (pent = pentFirst + pixel, count = size; --count >= 0; ) + { + if (pent->refcnt > 0) + { + if ((*comp) (pent, prgb)) + { + if (client >= 0) + pent->refcnt++; + *pPixel = pixel; + switch(channel) + { + case REDMAP: + *pPixel <<= pmap->pVisual->offsetRed; + case PSEUDOMAP: + break; + case GREENMAP: + *pPixel <<= pmap->pVisual->offsetGreen; + break; + case BLUEMAP: + *pPixel <<= pmap->pVisual->offsetBlue; + break; + } + goto gotit; + } + } + else if (!foundFree && pent->refcnt == 0) + { + Free = pixel; + foundFree = TRUE; + /* If we're initializing the colormap, then we are looking for + * the first free cell we can find, not to minimize the number + * of entries we use. So don't look any further. */ + if(pmap->flags & BeingCreated) + break; + } + pixel++; + if(pixel >= size) + { + pent = pentFirst; + pixel = 0; + } + else + pent++; + } + + /* If we got here, we didn't find a match. If we also didn't find + * a free entry, we're out of luck. Otherwise, we'll usurp a free + * entry and fill it in */ + if (!foundFree) + return (BadAlloc); + pent = pentFirst + Free; + pent->fShared = FALSE; + pent->refcnt = (client >= 0) ? 1 : AllocTemporary; + + switch (channel) + { + case PSEUDOMAP: + pent->co.local.red = prgb->red; + pent->co.local.green = prgb->green; + pent->co.local.blue = prgb->blue; + def.red = prgb->red; + def.green = prgb->green; + def.blue = prgb->blue; + def.flags = (DoRed|DoGreen|DoBlue); + if (client >= 0) + pmap->freeRed--; + def.pixel = Free; + break; + + case REDMAP: + pent->co.local.red = prgb->red; + def.red = prgb->red; + def.green = pmap->green[0].co.local.green; + def.blue = pmap->blue[0].co.local.blue; + def.flags = DoRed; + if (client >= 0) + pmap->freeRed--; + def.pixel = Free << pmap->pVisual->offsetRed; + break; + + case GREENMAP: + pent->co.local.green = prgb->green; + def.red = pmap->red[0].co.local.red; + def.green = prgb->green; + def.blue = pmap->blue[0].co.local.blue; + def.flags = DoGreen; + if (client >= 0) + pmap->freeGreen--; + def.pixel = Free << pmap->pVisual->offsetGreen; + break; + + case BLUEMAP: + pent->co.local.blue = prgb->blue; + def.red = pmap->red[0].co.local.red; + def.green = pmap->green[0].co.local.green; + def.blue = prgb->blue; + def.flags = DoBlue; + if (client >= 0) + pmap->freeBlue--; + def.pixel = Free << pmap->pVisual->offsetBlue; + break; + } + (*pmap->pScreen->StoreColors) (pmap, 1, &def); + pixel = Free; + *pPixel = def.pixel; + +gotit: + if (pmap->flags & BeingCreated || client == -1) + return(Success); + /* Now remember the pixel, for freeing later */ + switch (channel) + { + case PSEUDOMAP: + case REDMAP: + nump = pmap->numPixelsRed; + pixp = pmap->clientPixelsRed; + break; + + case GREENMAP: + nump = pmap->numPixelsGreen; + pixp = pmap->clientPixelsGreen; + break; + + case BLUEMAP: + nump = pmap->numPixelsBlue; + pixp = pmap->clientPixelsBlue; + break; + } + npix = nump[client]; + ppix = (Pixel *) xrealloc (pixp[client], (npix + 1) * sizeof(Pixel)); + if (!ppix) + { + pent->refcnt--; + if (!pent->fShared) + switch (channel) + { + case PSEUDOMAP: + case REDMAP: + pmap->freeRed++; + break; + case GREENMAP: + pmap->freeGreen++; + break; + case BLUEMAP: + pmap->freeBlue++; + break; + } + return(BadAlloc); + } + ppix[npix] = pixel; + pixp[client] = ppix; + nump[client]++; + + return(Success); +} + +/* Comparison functions -- passed to FindColor to determine if an + * entry is already the color we're looking for or not */ +static int +AllComp (EntryPtr pent, xrgb *prgb) +{ + if((pent->co.local.red == prgb->red) && + (pent->co.local.green == prgb->green) && + (pent->co.local.blue == prgb->blue) ) + return (1); + return (0); +} + +static int +RedComp (EntryPtr pent, xrgb *prgb) +{ + if (pent->co.local.red == prgb->red) + return (1); + return (0); +} + +static int +GreenComp (EntryPtr pent, xrgb *prgb) +{ + if (pent->co.local.green == prgb->green) + return (1); + return (0); +} + +static int +BlueComp (EntryPtr pent, xrgb *prgb) +{ + if (pent->co.local.blue == prgb->blue) + return (1); + return (0); +} + + +/* Read the color value of a cell */ + +_X_EXPORT int +QueryColors (ColormapPtr pmap, int count, Pixel *ppixIn, xrgb *prgbList) +{ + Pixel *ppix, pixel; + xrgb *prgb; + VisualPtr pVisual; + EntryPtr pent; + Pixel i; + int errVal = Success; + + pVisual = pmap->pVisual; + if ((pmap->class | DynamicClass) == DirectColor) + { + int numred, numgreen, numblue; + Pixel rgbbad; + + numred = NUMRED(pVisual); + numgreen = NUMGREEN(pVisual); + numblue = NUMBLUE(pVisual); + rgbbad = ~RGBMASK(pVisual); + for( ppix = ppixIn, prgb = prgbList; --count >= 0; ppix++, prgb++) + { + pixel = *ppix; + if (pixel & rgbbad) { + clientErrorValue = pixel; + errVal = BadValue; + continue; + } + i = (pixel & pVisual->redMask) >> pVisual->offsetRed; + if (i >= numred) + { + clientErrorValue = pixel; + errVal = BadValue; + continue; + } + prgb->red = pmap->red[i].co.local.red; + i = (pixel & pVisual->greenMask) >> pVisual->offsetGreen; + if (i >= numgreen) + { + clientErrorValue = pixel; + errVal = BadValue; + continue; + } + prgb->green = pmap->green[i].co.local.green; + i = (pixel & pVisual->blueMask) >> pVisual->offsetBlue; + if (i >= numblue) + { + clientErrorValue = pixel; + errVal = BadValue; + continue; + } + prgb->blue = pmap->blue[i].co.local.blue; + } + } + else + { + for( ppix = ppixIn, prgb = prgbList; --count >= 0; ppix++, prgb++) + { + pixel = *ppix; + if (pixel >= pVisual->ColormapEntries) + { + clientErrorValue = pixel; + errVal = BadValue; + } + else + { + pent = (EntryPtr)&pmap->red[pixel]; + if (pent->fShared) + { + prgb->red = pent->co.shco.red->color; + prgb->green = pent->co.shco.green->color; + prgb->blue = pent->co.shco.blue->color; + } + else + { + prgb->red = pent->co.local.red; + prgb->green = pent->co.local.green; + prgb->blue = pent->co.local.blue; + } + } + } + } + return (errVal); +} + +static void +FreePixels(ColormapPtr pmap, int client) +{ + Pixel *ppix, *ppixStart; + int n; + int class; + + class = pmap->class; + ppixStart = pmap->clientPixelsRed[client]; + if (class & DynamicClass) + { + n = pmap->numPixelsRed[client]; + for (ppix = ppixStart; --n >= 0; ) + { + FreeCell(pmap, *ppix, REDMAP); + ppix++; + } + } + + xfree(ppixStart); + pmap->clientPixelsRed[client] = (Pixel *) NULL; + pmap->numPixelsRed[client] = 0; + if ((class | DynamicClass) == DirectColor) + { + ppixStart = pmap->clientPixelsGreen[client]; + if (class & DynamicClass) + for (ppix = ppixStart, n = pmap->numPixelsGreen[client]; --n >= 0;) + FreeCell(pmap, *ppix++, GREENMAP); + xfree(ppixStart); + pmap->clientPixelsGreen[client] = (Pixel *) NULL; + pmap->numPixelsGreen[client] = 0; + + ppixStart = pmap->clientPixelsBlue[client]; + if (class & DynamicClass) + for (ppix = ppixStart, n = pmap->numPixelsBlue[client]; --n >= 0; ) + FreeCell(pmap, *ppix++, BLUEMAP); + xfree(ppixStart); + pmap->clientPixelsBlue[client] = (Pixel *) NULL; + pmap->numPixelsBlue[client] = 0; + } +} + +/** + * Frees all of a client's colors and cells. + * + * \param value must conform to DeleteType + * \unused fakeid + */ +int +FreeClientPixels (pointer value, XID fakeid) +{ + ColormapPtr pmap; + colorResource *pcr = (colorResource *)value; + + pmap = (ColormapPtr) LookupIDByType(pcr->mid, RT_COLORMAP); + if (pmap) + FreePixels(pmap, pcr->client); + xfree(pcr); + return Success; +} + +int +AllocColorCells (int client, ColormapPtr pmap, int colors, int planes, + Bool contig, Pixel *ppix, Pixel *masks) +{ + Pixel rmask, gmask, bmask, *ppixFirst, r, g, b; + int n, class; + int ok; + int oldcount; + colorResource *pcr = (colorResource *)NULL; + + class = pmap->class; + if (!(class & DynamicClass)) + return (BadAlloc); /* Shouldn't try on this type */ + oldcount = pmap->numPixelsRed[client]; + if (pmap->class == DirectColor) + oldcount += pmap->numPixelsGreen[client] + pmap->numPixelsBlue[client]; + if (!oldcount && (CLIENT_ID(pmap->mid) != client)) + { + pcr = (colorResource *) xalloc(sizeof(colorResource)); + if (!pcr) + return (BadAlloc); + } + + if (pmap->class == DirectColor) + { + ok = AllocDirect (client, pmap, colors, planes, planes, planes, + contig, ppix, &rmask, &gmask, &bmask); + if(ok == Success) + { + for (r = g = b = 1, n = planes; --n >= 0; r += r, g += g, b += b) + { + while(!(rmask & r)) + r += r; + while(!(gmask & g)) + g += g; + while(!(bmask & b)) + b += b; + *masks++ = r | g | b; + } + } + } + else + { + ok = AllocPseudo (client, pmap, colors, planes, contig, ppix, &rmask, + &ppixFirst); + if(ok == Success) + { + for (r = 1, n = planes; --n >= 0; r += r) + { + while(!(rmask & r)) + r += r; + *masks++ = r; + } + } + } + + /* if this is the client's first pixels in this colormap, tell the + * resource manager that the client has pixels in this colormap which + * should be freed when the client dies */ + if ((ok == Success) && pcr) + { + pcr->mid = pmap->mid; + pcr->client = client; + if (!AddResource(FakeClientID(client), RT_CMAPENTRY, (pointer)pcr)) + ok = BadAlloc; + } else if (pcr) + xfree(pcr); + + return (ok); +} + + +int +AllocColorPlanes (int client, ColormapPtr pmap, int colors, + int r, int g, int b, Bool contig, Pixel *pixels, + Pixel *prmask, Pixel *pgmask, Pixel *pbmask) +{ + int ok; + Pixel mask, *ppixFirst; + Pixel shift; + int i; + int class; + int oldcount; + colorResource *pcr = (colorResource *)NULL; + + class = pmap->class; + if (!(class & DynamicClass)) + return (BadAlloc); /* Shouldn't try on this type */ + oldcount = pmap->numPixelsRed[client]; + if (class == DirectColor) + oldcount += pmap->numPixelsGreen[client] + pmap->numPixelsBlue[client]; + if (!oldcount && (CLIENT_ID(pmap->mid) != client)) + { + pcr = (colorResource *) xalloc(sizeof(colorResource)); + if (!pcr) + return (BadAlloc); + } + + if (class == DirectColor) + { + ok = AllocDirect (client, pmap, colors, r, g, b, contig, pixels, + prmask, pgmask, pbmask); + } + else + { + /* Allocate the proper pixels */ + /* XXX This is sort of bad, because of contig is set, we force all + * r + g + b bits to be contiguous. Should only force contiguity + * per mask + */ + ok = AllocPseudo (client, pmap, colors, r + g + b, contig, pixels, + &mask, &ppixFirst); + + if(ok == Success) + { + /* now split that mask into three */ + *prmask = *pgmask = *pbmask = 0; + shift = 1; + for (i = r; --i >= 0; shift += shift) + { + while (!(mask & shift)) + shift += shift; + *prmask |= shift; + } + for (i = g; --i >= 0; shift += shift) + { + while (!(mask & shift)) + shift += shift; + *pgmask |= shift; + } + for (i = b; --i >= 0; shift += shift) + { + while (!(mask & shift)) + shift += shift; + *pbmask |= shift; + } + + /* set up the shared color cells */ + if (!AllocShared(pmap, pixels, colors, r, g, b, + *prmask, *pgmask, *pbmask, ppixFirst)) + { + (void)FreeColors(pmap, client, colors, pixels, mask); + ok = BadAlloc; + } + } + } + + /* if this is the client's first pixels in this colormap, tell the + * resource manager that the client has pixels in this colormap which + * should be freed when the client dies */ + if ((ok == Success) && pcr) + { + pcr->mid = pmap->mid; + pcr->client = client; + if (!AddResource(FakeClientID(client), RT_CMAPENTRY, (pointer)pcr)) + ok = BadAlloc; + } else if (pcr) + xfree(pcr); + + return (ok); +} + +static int +AllocDirect (int client, ColormapPtr pmap, int c, int r, int g, int b, Bool contig, + Pixel *pixels, Pixel *prmask, Pixel *pgmask, Pixel *pbmask) +{ + Pixel *ppixRed, *ppixGreen, *ppixBlue; + Pixel *ppix, *pDst, *p; + int npix, npixR, npixG, npixB; + Bool okR, okG, okB; + Pixel *rpix = 0, *gpix = 0, *bpix = 0; + + npixR = c << r; + npixG = c << g; + npixB = c << b; + if ((r >= 32) || (g >= 32) || (b >= 32) || + (npixR > pmap->freeRed) || (npixR < c) || + (npixG > pmap->freeGreen) || (npixG < c) || + (npixB > pmap->freeBlue) || (npixB < c)) + return BadAlloc; + + /* start out with empty pixels */ + for(p = pixels; p < pixels + c; p++) + *p = 0; + + ppixRed = (Pixel *)xalloc(npixR * sizeof(Pixel)); + ppixGreen = (Pixel *)xalloc(npixG * sizeof(Pixel)); + ppixBlue = (Pixel *)xalloc(npixB * sizeof(Pixel)); + if (!ppixRed || !ppixGreen || !ppixBlue) + { + if (ppixBlue) xfree(ppixBlue); + if (ppixGreen) xfree(ppixGreen); + if (ppixRed) xfree(ppixRed); + return(BadAlloc); + } + + okR = AllocCP(pmap, pmap->red, c, r, contig, ppixRed, prmask); + okG = AllocCP(pmap, pmap->green, c, g, contig, ppixGreen, pgmask); + okB = AllocCP(pmap, pmap->blue, c, b, contig, ppixBlue, pbmask); + + if (okR && okG && okB) + { + rpix = (Pixel *) xrealloc(pmap->clientPixelsRed[client], + (pmap->numPixelsRed[client] + (c << r)) * + sizeof(Pixel)); + if (rpix) + pmap->clientPixelsRed[client] = rpix; + gpix = (Pixel *) xrealloc(pmap->clientPixelsGreen[client], + (pmap->numPixelsGreen[client] + (c << g)) * + sizeof(Pixel)); + if (gpix) + pmap->clientPixelsGreen[client] = gpix; + bpix = (Pixel *) xrealloc(pmap->clientPixelsBlue[client], + (pmap->numPixelsBlue[client] + (c << b)) * + sizeof(Pixel)); + if (bpix) + pmap->clientPixelsBlue[client] = bpix; + } + + if (!okR || !okG || !okB || !rpix || !gpix || !bpix) + { + if (okR) + for(ppix = ppixRed, npix = npixR; --npix >= 0; ppix++) + pmap->red[*ppix].refcnt = 0; + if (okG) + for(ppix = ppixGreen, npix = npixG; --npix >= 0; ppix++) + pmap->green[*ppix].refcnt = 0; + if (okB) + for(ppix = ppixBlue, npix = npixB; --npix >= 0; ppix++) + pmap->blue[*ppix].refcnt = 0; + xfree(ppixBlue); + xfree(ppixGreen); + xfree(ppixRed); + return(BadAlloc); + } + + *prmask <<= pmap->pVisual->offsetRed; + *pgmask <<= pmap->pVisual->offsetGreen; + *pbmask <<= pmap->pVisual->offsetBlue; + + ppix = rpix + pmap->numPixelsRed[client]; + for (pDst = pixels, p = ppixRed; p < ppixRed + npixR; p++) + { + *ppix++ = *p; + if(p < ppixRed + c) + *pDst++ |= *p << pmap->pVisual->offsetRed; + } + pmap->numPixelsRed[client] += npixR; + pmap->freeRed -= npixR; + + ppix = gpix + pmap->numPixelsGreen[client]; + for (pDst = pixels, p = ppixGreen; p < ppixGreen + npixG; p++) + { + *ppix++ = *p; + if(p < ppixGreen + c) + *pDst++ |= *p << pmap->pVisual->offsetGreen; + } + pmap->numPixelsGreen[client] += npixG; + pmap->freeGreen -= npixG; + + ppix = bpix + pmap->numPixelsBlue[client]; + for (pDst = pixels, p = ppixBlue; p < ppixBlue + npixB; p++) + { + *ppix++ = *p; + if(p < ppixBlue + c) + *pDst++ |= *p << pmap->pVisual->offsetBlue; + } + pmap->numPixelsBlue[client] += npixB; + pmap->freeBlue -= npixB; + + + for (pDst = pixels; pDst < pixels + c; pDst++) + *pDst |= ALPHAMASK(pmap->pVisual); + + xfree(ppixBlue); + xfree(ppixGreen); + xfree(ppixRed); + + return (Success); +} + +static int +AllocPseudo (int client, ColormapPtr pmap, int c, int r, Bool contig, + Pixel *pixels, Pixel *pmask, Pixel **pppixFirst) +{ + Pixel *ppix, *p, *pDst, *ppixTemp; + int npix; + Bool ok; + + npix = c << r; + if ((r >= 32) || (npix > pmap->freeRed) || (npix < c)) + return(BadAlloc); + if(!(ppixTemp = (Pixel *)xalloc(npix * sizeof(Pixel)))) + return(BadAlloc); + ok = AllocCP(pmap, pmap->red, c, r, contig, ppixTemp, pmask); + + if (ok) + { + + /* all the allocated pixels are added to the client pixel list, + * but only the unique ones are returned to the client */ + ppix = (Pixel *)xrealloc(pmap->clientPixelsRed[client], + (pmap->numPixelsRed[client] + npix) * sizeof(Pixel)); + if (!ppix) + { + for (p = ppixTemp; p < ppixTemp + npix; p++) + pmap->red[*p].refcnt = 0; + return (BadAlloc); + } + pmap->clientPixelsRed[client] = ppix; + ppix += pmap->numPixelsRed[client]; + *pppixFirst = ppix; + pDst = pixels; + for (p = ppixTemp; p < ppixTemp + npix; p++) + { + *ppix++ = *p; + if(p < ppixTemp + c) + *pDst++ = *p; + } + pmap->numPixelsRed[client] += npix; + pmap->freeRed -= npix; + } + xfree(ppixTemp); + return (ok ? Success : BadAlloc); +} + +/* Allocates count << planes pixels from colormap pmap for client. If + * contig, then the plane mask is made of consecutive bits. Returns + * all count << pixels in the array pixels. The first count of those + * pixels are the unique pixels. *pMask has the mask to Or with the + * unique pixels to get the rest of them. + * + * Returns True iff all pixels could be allocated + * All cells allocated will have refcnt set to AllocPrivate and shared to FALSE + * (see AllocShared for why we care) + */ +static Bool +AllocCP (ColormapPtr pmap, EntryPtr pentFirst, int count, int planes, + Bool contig, Pixel *pixels, Pixel *pMask) +{ + EntryPtr ent; + Pixel pixel, base, entries, maxp, save; + int dplanes, found; + Pixel *ppix; + Pixel mask; + Pixel finalmask; + + dplanes = pmap->pVisual->nplanes; + + /* Easy case. Allocate pixels only */ + if (planes == 0) + { + /* allocate writable entries */ + ppix = pixels; + ent = pentFirst; + pixel = 0; + while (--count >= 0) + { + /* Just find count unallocated cells */ + while (ent->refcnt) + { + ent++; + pixel++; + } + ent->refcnt = AllocPrivate; + *ppix++ = pixel; + ent->fShared = FALSE; + } + *pMask = 0; + return (TRUE); + } + else if (planes > dplanes) + { + return (FALSE); + } + + /* General case count pixels * 2 ^ planes cells to be allocated */ + + /* make room for new pixels */ + ent = pentFirst; + + /* first try for contiguous planes, since it's fastest */ + for (mask = (((Pixel)1) << planes) - 1, base = 1, dplanes -= (planes - 1); + --dplanes >= 0; + mask += mask, base += base) + { + ppix = pixels; + found = 0; + pixel = 0; + entries = pmap->pVisual->ColormapEntries - mask; + while (pixel < entries) + { + save = pixel; + maxp = pixel + mask + base; + /* check if all are free */ + while (pixel != maxp && ent[pixel].refcnt == 0) + pixel += base; + if (pixel == maxp) + { + /* this one works */ + *ppix++ = save; + found++; + if (found == count) + { + /* found enough, allocate them all */ + while (--count >= 0) + { + pixel = pixels[count]; + maxp = pixel + mask; + while (1) + { + ent[pixel].refcnt = AllocPrivate; + ent[pixel].fShared = FALSE; + if (pixel == maxp) + break; + pixel += base; + *ppix++ = pixel; + } + } + *pMask = mask; + return (TRUE); + } + } + pixel = save + 1; + if (pixel & mask) + pixel += mask; + } + } + + dplanes = pmap->pVisual->nplanes; + if (contig || planes == 1 || dplanes < 3) + return (FALSE); + + /* this will be very slow for large maps, need a better algorithm */ + + /* + we can generate the smallest and largest numbers that fits in dplanes + bits and contain exactly planes bits set as follows. First, we need to + check that it is possible to generate such a mask at all. + (Non-contiguous masks need one more bit than contiguous masks). Then + the smallest such mask consists of the rightmost planes-1 bits set, then + a zero, then a one in position planes + 1. The formula is + (3 << (planes-1)) -1 + The largest such masks consists of the leftmost planes-1 bits set, then + a zero, then a one bit in position dplanes-planes-1. If dplanes is + smaller than 32 (the number of bits in a word) then the formula is: + (1<>> + + */ + + finalmask = + (((((Pixel)1)<<(planes-1)) - 1) << (dplanes-planes+1)) + + (((Pixel)1)<<(dplanes-planes-1)); + for (mask = (((Pixel)3) << (planes -1)) - 1; mask <= finalmask; mask++) + { + /* next 3 magic statements count number of ones (HAKMEM #169) */ + pixel = (mask >> 1) & 033333333333; + pixel = mask - pixel - ((pixel >> 1) & 033333333333); + if ((((pixel + (pixel >> 3)) & 030707070707) % 077) != planes) + continue; + ppix = pixels; + found = 0; + entries = pmap->pVisual->ColormapEntries - mask; + base = lowbit (mask); + for (pixel = 0; pixel < entries; pixel++) + { + if (pixel & mask) + continue; + maxp = 0; + /* check if all are free */ + while (ent[pixel + maxp].refcnt == 0) + { + GetNextBitsOrBreak(maxp, mask, base); + } + if ((maxp < mask) || (ent[pixel + mask].refcnt != 0)) + continue; + /* this one works */ + *ppix++ = pixel; + found++; + if (found < count) + continue; + /* found enough, allocate them all */ + while (--count >= 0) + { + pixel = (pixels)[count]; + maxp = 0; + while (1) + { + ent[pixel + maxp].refcnt = AllocPrivate; + ent[pixel + maxp].fShared = FALSE; + GetNextBitsOrBreak(maxp, mask, base); + *ppix++ = pixel + maxp; + } + } + + *pMask = mask; + return (TRUE); + } + } + return (FALSE); +} + +/** + * + * \param ppixFirst First of the client's new pixels + */ +static Bool +AllocShared (ColormapPtr pmap, Pixel *ppix, int c, int r, int g, int b, + Pixel rmask, Pixel gmask, Pixel bmask, Pixel *ppixFirst) +{ + Pixel *pptr, *cptr; + int npix, z, npixClientNew, npixShared; + Pixel basemask, base, bits, common; + SHAREDCOLOR *pshared, **ppshared, **psharedList; + + npixClientNew = c << (r + g + b); + npixShared = (c << r) + (c << g) + (c << b); + psharedList = (SHAREDCOLOR **)xalloc(npixShared * + sizeof(SHAREDCOLOR *)); + if (!psharedList) + return FALSE; + ppshared = psharedList; + for (z = npixShared; --z >= 0; ) + { + if (!(ppshared[z] = (SHAREDCOLOR *)xalloc(sizeof(SHAREDCOLOR)))) + { + for (z++ ; z < npixShared; z++) + xfree(ppshared[z]); + return FALSE; + } + } + for(pptr = ppix, npix = c; --npix >= 0; pptr++) + { + basemask = ~(gmask | bmask); + common = *pptr & basemask; + if (rmask) + { + bits = 0; + base = lowbit (rmask); + while(1) + { + pshared = *ppshared++; + pshared->refcnt = 1 << (g + b); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == (common | bits)) + { + pmap->red[*cptr].fShared = TRUE; + pmap->red[*cptr].co.shco.red = pshared; + } + } + GetNextBitsOrBreak(bits, rmask, base); + } + } + else + { + pshared = *ppshared++; + pshared->refcnt = 1 << (g + b); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == common) + { + pmap->red[*cptr].fShared = TRUE; + pmap->red[*cptr].co.shco.red = pshared; + } + } + } + basemask = ~(rmask | bmask); + common = *pptr & basemask; + if (gmask) + { + bits = 0; + base = lowbit (gmask); + while(1) + { + pshared = *ppshared++; + pshared->refcnt = 1 << (r + b); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == (common | bits)) + { + pmap->red[*cptr].co.shco.green = pshared; + } + } + GetNextBitsOrBreak(bits, gmask, base); + } + } + else + { + pshared = *ppshared++; + pshared->refcnt = 1 << (g + b); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == common) + { + pmap->red[*cptr].co.shco.green = pshared; + } + } + } + basemask = ~(rmask | gmask); + common = *pptr & basemask; + if (bmask) + { + bits = 0; + base = lowbit (bmask); + while(1) + { + pshared = *ppshared++; + pshared->refcnt = 1 << (r + g); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == (common | bits)) + { + pmap->red[*cptr].co.shco.blue = pshared; + } + } + GetNextBitsOrBreak(bits, bmask, base); + } + } + else + { + pshared = *ppshared++; + pshared->refcnt = 1 << (g + b); + for (cptr = ppixFirst, z = npixClientNew; --z >= 0; cptr++) + { + if ((*cptr & basemask) == common) + { + pmap->red[*cptr].co.shco.blue = pshared; + } + } + } + } + xfree(psharedList); + return TRUE; +} + + +/** FreeColors + * Free colors and/or cells (probably slow for large numbers) + */ +_X_EXPORT int +FreeColors (ColormapPtr pmap, int client, int count, Pixel *pixels, Pixel mask) +{ + int rval, result, class; + Pixel rmask; + + class = pmap->class; + if (pmap->flags & AllAllocated) + return(BadAccess); + if ((class | DynamicClass) == DirectColor) + { + rmask = mask & RGBMASK(pmap->pVisual); + result = FreeCo(pmap, client, REDMAP, count, pixels, + mask & pmap->pVisual->redMask); + /* If any of the three calls fails, we must report that, if more + * than one fails, it's ok that we report the last one */ + rval = FreeCo(pmap, client, GREENMAP, count, pixels, + mask & pmap->pVisual->greenMask); + if(rval != Success) + result = rval; + rval = FreeCo(pmap, client, BLUEMAP, count, pixels, + mask & pmap->pVisual->blueMask); + if(rval != Success) + result = rval; + } + else + { + rmask = mask & ((((Pixel)1) << pmap->pVisual->nplanes) - 1); + result = FreeCo(pmap, client, PSEUDOMAP, count, pixels, rmask); + } + if ((mask != rmask) && count) + { + clientErrorValue = *pixels | mask; + result = BadValue; + } + /* XXX should worry about removing any RT_CMAPENTRY resource */ + return (result); +} + +/** + * Helper for FreeColors -- frees all combinations of *newpixels and mask bits + * which the client has allocated in channel colormap cells of pmap. + * doesn't change newpixels if it doesn't need to + * + * \param pmap which colormap head + * \param color which sub-map, eg, RED, BLUE, PSEUDO + * \param npixIn number of pixels passed in + * \param ppixIn number of base pixels + * \param mask mask client gave us + */ +static int +FreeCo (ColormapPtr pmap, int client, int color, int npixIn, Pixel *ppixIn, Pixel mask) +{ + Pixel *ppixClient, pixTest; + int npixClient, npixNew, npix; + Pixel bits, base, cmask, rgbbad; + Pixel *pptr, *cptr; + int n, zapped; + int errVal = Success; + int offset, numents; + + if (npixIn == 0) + return (errVal); + bits = 0; + zapped = 0; + base = lowbit (mask); + + switch(color) + { + case REDMAP: + cmask = pmap->pVisual->redMask; + rgbbad = ~RGBMASK(pmap->pVisual); + offset = pmap->pVisual->offsetRed; + numents = (cmask >> offset) + 1; + ppixClient = pmap->clientPixelsRed[client]; + npixClient = pmap->numPixelsRed[client]; + break; + case GREENMAP: + cmask = pmap->pVisual->greenMask; + rgbbad = ~RGBMASK(pmap->pVisual); + offset = pmap->pVisual->offsetGreen; + numents = (cmask >> offset) + 1; + ppixClient = pmap->clientPixelsGreen[client]; + npixClient = pmap->numPixelsGreen[client]; + break; + case BLUEMAP: + cmask = pmap->pVisual->blueMask; + rgbbad = ~RGBMASK(pmap->pVisual); + offset = pmap->pVisual->offsetBlue; + numents = (cmask >> offset) + 1; + ppixClient = pmap->clientPixelsBlue[client]; + npixClient = pmap->numPixelsBlue[client]; + break; + default: /* so compiler can see that everything gets initialized */ + case PSEUDOMAP: + cmask = ~((Pixel)0); + rgbbad = 0; + offset = 0; + numents = pmap->pVisual->ColormapEntries; + ppixClient = pmap->clientPixelsRed[client]; + npixClient = pmap->numPixelsRed[client]; + break; + } + + + /* zap all pixels which match */ + while (1) + { + /* go through pixel list */ + for (pptr = ppixIn, n = npixIn; --n >= 0; pptr++) + { + pixTest = ((*pptr | bits) & cmask) >> offset; + if ((pixTest >= numents) || (*pptr & rgbbad)) + { + clientErrorValue = *pptr | bits; + errVal = BadValue; + continue; + } + + /* find match in client list */ + for (cptr = ppixClient, npix = npixClient; + --npix >= 0 && *cptr != pixTest; + cptr++) ; + + if (npix >= 0) + { + if (pmap->class & DynamicClass) + { + FreeCell(pmap, pixTest, color); + } + *cptr = ~((Pixel)0); + zapped++; + } + else + errVal = BadAccess; + } + /* generate next bits value */ + GetNextBitsOrBreak(bits, mask, base); + } + + /* delete freed pixels from client pixel list */ + if (zapped) + { + npixNew = npixClient - zapped; + if (npixNew) + { + /* Since the list can only get smaller, we can do a copy in + * place and then realloc to a smaller size */ + pptr = cptr = ppixClient; + + /* If we have all the new pixels, we don't have to examine the + * rest of the old ones */ + for(npix = 0; npix < npixNew; cptr++) + { + if (*cptr != ~((Pixel)0)) + { + *pptr++ = *cptr; + npix++; + } + } + pptr = (Pixel *)xrealloc(ppixClient, npixNew * sizeof(Pixel)); + if (pptr) + ppixClient = pptr; + npixClient = npixNew; + } + else + { + npixClient = 0; + xfree(ppixClient); + ppixClient = (Pixel *)NULL; + } + switch(color) + { + case PSEUDOMAP: + case REDMAP: + pmap->clientPixelsRed[client] = ppixClient; + pmap->numPixelsRed[client] = npixClient; + break; + case GREENMAP: + pmap->clientPixelsGreen[client] = ppixClient; + pmap->numPixelsGreen[client] = npixClient; + break; + case BLUEMAP: + pmap->clientPixelsBlue[client] = ppixClient; + pmap->numPixelsBlue[client] = npixClient; + break; + } + } + return (errVal); +} + + + +/* Redefine color values */ +_X_EXPORT int +StoreColors (ColormapPtr pmap, int count, xColorItem *defs) +{ + Pixel pix; + xColorItem *pdef; + EntryPtr pent, pentT, pentLast; + VisualPtr pVisual; + SHAREDCOLOR *pred, *pgreen, *pblue; + int n, ChgRed, ChgGreen, ChgBlue, idef; + int class, errVal = Success; + int ok; + + + class = pmap->class; + if(!(class & DynamicClass) && !(pmap->flags & BeingCreated)) + { + return(BadAccess); + } + pVisual = pmap->pVisual; + + idef = 0; + if((class | DynamicClass) == DirectColor) + { + int numred, numgreen, numblue; + Pixel rgbbad; + + numred = NUMRED(pVisual); + numgreen = NUMGREEN(pVisual); + numblue = NUMBLUE(pVisual); + rgbbad = ~RGBMASK(pVisual); + for (pdef = defs, n = 0; n < count; pdef++, n++) + { + ok = TRUE; + (*pmap->pScreen->ResolveColor) + (&pdef->red, &pdef->green, &pdef->blue, pmap->pVisual); + + if (pdef->pixel & rgbbad) + { + errVal = BadValue; + clientErrorValue = pdef->pixel; + continue; + } + pix = (pdef->pixel & pVisual->redMask) >> pVisual->offsetRed; + if (pix >= numred) + { + errVal = BadValue; + ok = FALSE; + } + else if (pmap->red[pix].refcnt != AllocPrivate) + { + errVal = BadAccess; + ok = FALSE; + } + else if (pdef->flags & DoRed) + { + pmap->red[pix].co.local.red = pdef->red; + } + else + { + pdef->red = pmap->red[pix].co.local.red; + } + + pix = (pdef->pixel & pVisual->greenMask) >> pVisual->offsetGreen; + if (pix >= numgreen) + { + errVal = BadValue; + ok = FALSE; + } + else if (pmap->green[pix].refcnt != AllocPrivate) + { + errVal = BadAccess; + ok = FALSE; + } + else if (pdef->flags & DoGreen) + { + pmap->green[pix].co.local.green = pdef->green; + } + else + { + pdef->green = pmap->green[pix].co.local.green; + } + + pix = (pdef->pixel & pVisual->blueMask) >> pVisual->offsetBlue; + if (pix >= numblue) + { + errVal = BadValue; + ok = FALSE; + } + else if (pmap->blue[pix].refcnt != AllocPrivate) + { + errVal = BadAccess; + ok = FALSE; + } + else if (pdef->flags & DoBlue) + { + pmap->blue[pix].co.local.blue = pdef->blue; + } + else + { + pdef->blue = pmap->blue[pix].co.local.blue; + } + /* If this is an o.k. entry, then it gets added to the list + * to be sent to the hardware. If not, skip it. Once we've + * skipped one, we have to copy all the others. + */ + if(ok) + { + if(idef != n) + defs[idef] = defs[n]; + idef++; + } else + clientErrorValue = pdef->pixel; + } + } + else + { + for (pdef = defs, n = 0; n < count; pdef++, n++) + { + + ok = TRUE; + if (pdef->pixel >= pVisual->ColormapEntries) + { + clientErrorValue = pdef->pixel; + errVal = BadValue; + ok = FALSE; + } + else if (pmap->red[pdef->pixel].refcnt != AllocPrivate) + { + errVal = BadAccess; + ok = FALSE; + } + + /* If this is an o.k. entry, then it gets added to the list + * to be sent to the hardware. If not, skip it. Once we've + * skipped one, we have to copy all the others. + */ + if(ok) + { + if(idef != n) + defs[idef] = defs[n]; + idef++; + } + else + continue; + + (*pmap->pScreen->ResolveColor) + (&pdef->red, &pdef->green, &pdef->blue, pmap->pVisual); + + pent = &pmap->red[pdef->pixel]; + + if(pdef->flags & DoRed) + { + if(pent->fShared) + { + pent->co.shco.red->color = pdef->red; + if (pent->co.shco.red->refcnt > 1) + ok = FALSE; + } + else + pent->co.local.red = pdef->red; + } + else + { + if(pent->fShared) + pdef->red = pent->co.shco.red->color; + else + pdef->red = pent->co.local.red; + } + if(pdef->flags & DoGreen) + { + if(pent->fShared) + { + pent->co.shco.green->color = pdef->green; + if (pent->co.shco.green->refcnt > 1) + ok = FALSE; + } + else + pent->co.local.green = pdef->green; + } + else + { + if(pent->fShared) + pdef->green = pent->co.shco.green->color; + else + pdef->green = pent->co.local.green; + } + if(pdef->flags & DoBlue) + { + if(pent->fShared) + { + pent->co.shco.blue->color = pdef->blue; + if (pent->co.shco.blue->refcnt > 1) + ok = FALSE; + } + else + pent->co.local.blue = pdef->blue; + } + else + { + if(pent->fShared) + pdef->blue = pent->co.shco.blue->color; + else + pdef->blue = pent->co.local.blue; + } + + if(!ok) + { + /* have to run through the colormap and change anybody who + * shares this value */ + pred = pent->co.shco.red; + pgreen = pent->co.shco.green; + pblue = pent->co.shco.blue; + ChgRed = pdef->flags & DoRed; + ChgGreen = pdef->flags & DoGreen; + ChgBlue = pdef->flags & DoBlue; + pentLast = pmap->red + pVisual->ColormapEntries; + + for(pentT = pmap->red; pentT < pentLast; pentT++) + { + if(pentT->fShared && (pentT != pent)) + { + xColorItem defChg; + + /* There are, alas, devices in this world too dumb + * to read their own hardware colormaps. Sick, but + * true. So we're going to be really nice and load + * the xColorItem with the proper value for all the + * fields. We will only set the flags for those + * fields that actually change. Smart devices can + * arrange to change only those fields. Dumb devices + * can rest assured that we have provided for them, + * and can change all three fields */ + + defChg.flags = 0; + if(ChgRed && pentT->co.shco.red == pred) + { + defChg.flags |= DoRed; + } + if(ChgGreen && pentT->co.shco.green == pgreen) + { + defChg.flags |= DoGreen; + } + if(ChgBlue && pentT->co.shco.blue == pblue) + { + defChg.flags |= DoBlue; + } + if(defChg.flags != 0) + { + defChg.pixel = pentT - pmap->red; + defChg.red = pentT->co.shco.red->color; + defChg.green = pentT->co.shco.green->color; + defChg.blue = pentT->co.shco.blue->color; + (*pmap->pScreen->StoreColors) (pmap, 1, &defChg); + } + } + } + + } + } + } + /* Note that we use idef, the count of acceptable entries, and not + * count, the count of proposed entries */ + if (idef != 0) + ( *pmap->pScreen->StoreColors) (pmap, idef, defs); + return (errVal); +} + +int +IsMapInstalled(Colormap map, WindowPtr pWin) +{ + Colormap *pmaps; + int imap, nummaps, found; + + pmaps = (Colormap *) xalloc( + pWin->drawable.pScreen->maxInstalledCmaps * sizeof(Colormap)); + if(!pmaps) + return(FALSE); + nummaps = (*pWin->drawable.pScreen->ListInstalledColormaps) + (pWin->drawable.pScreen, pmaps); + found = FALSE; + for(imap = 0; imap < nummaps; imap++) + { + if(pmaps[imap] == map) + { + found = TRUE; + break; + } + } + xfree(pmaps); + return (found); +} diff --git a/xorg-server/dix/cursor.c b/xorg-server/dix/cursor.c new file mode 100644 index 000000000..0ddf9d791 --- /dev/null +++ b/xorg-server/dix/cursor.c @@ -0,0 +1,492 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "servermd.h" +#include "scrnintstr.h" +#include "dixstruct.h" +#include "cursorstr.h" +#include "dixfontstr.h" +#include "opaque.h" +#include "xace.h" + +typedef struct _GlyphShare { + FontPtr font; + unsigned short sourceChar; + unsigned short maskChar; + CursorBitsPtr bits; + struct _GlyphShare *next; +} GlyphShare, *GlyphSharePtr; + +static GlyphSharePtr sharedGlyphs = (GlyphSharePtr)NULL; + +#ifdef XFIXES +static CARD32 cursorSerial; +#endif + +static void +FreeCursorBits(CursorBitsPtr bits) +{ + if (--bits->refcnt > 0) + return; + xfree(bits->source); + xfree(bits->mask); +#ifdef ARGB_CURSOR + xfree(bits->argb); +#endif + if (bits->refcnt == 0) + { + GlyphSharePtr *prev, this; + + for (prev = &sharedGlyphs; + (this = *prev) && (this->bits != bits); + prev = &this->next) + ; + if (this) + { + *prev = this->next; + CloseFont(this->font, (Font)0); + xfree(this); + } + dixFreePrivates(bits->devPrivates); + xfree(bits); + } +} + +/** + * To be called indirectly by DeleteResource; must use exactly two args. + * + * \param value must conform to DeleteType + */ +_X_EXPORT int +FreeCursor(pointer value, XID cid) +{ + int nscr; + CursorPtr pCurs = (CursorPtr)value; + + ScreenPtr pscr; + + if ( --pCurs->refcnt > 0) + return(Success); + + for (nscr = 0; nscr < screenInfo.numScreens; nscr++) + { + pscr = screenInfo.screens[nscr]; + (void)( *pscr->UnrealizeCursor)( pscr, pCurs); + } + dixFreePrivates(pCurs->devPrivates); + FreeCursorBits(pCurs->bits); + xfree( pCurs); + return(Success); +} + + +/* + * We check for empty cursors so that we won't have to display them + */ +static void +CheckForEmptyMask(CursorBitsPtr bits) +{ + unsigned char *msk = bits->mask; + int n = BitmapBytePad(bits->width) * bits->height; + + bits->emptyMask = FALSE; + while(n--) + if(*(msk++) != 0) return; +#ifdef ARGB_CURSOR + if (bits->argb) + { + CARD32 *argb = bits->argb; + int n = bits->width * bits->height; + while (n--) + if (*argb++ & 0xff000000) return; + } +#endif + bits->emptyMask = TRUE; +} + +/** + * does nothing about the resource table, just creates the data structure. + * does not copy the src and mask bits + * + * \param psrcbits server-defined padding + * \param pmaskbits server-defined padding + * \param argb no padding + */ +int +AllocARGBCursor(unsigned char *psrcbits, unsigned char *pmaskbits, + CARD32 *argb, CursorMetricPtr cm, + unsigned foreRed, unsigned foreGreen, unsigned foreBlue, + unsigned backRed, unsigned backGreen, unsigned backBlue, + CursorPtr *ppCurs, ClientPtr client, XID cid) +{ + CursorBitsPtr bits; + CursorPtr pCurs; + int rc, nscr; + ScreenPtr pscr; + + *ppCurs = NULL; + pCurs = (CursorPtr)xalloc(sizeof(CursorRec) + sizeof(CursorBits)); + if (!pCurs) + { + xfree(psrcbits); + xfree(pmaskbits); + return BadAlloc; + } + bits = (CursorBitsPtr)((char *)pCurs + sizeof(CursorRec)); + bits->source = psrcbits; + bits->mask = pmaskbits; +#ifdef ARGB_CURSOR + bits->argb = argb; +#endif + bits->width = cm->width; + bits->height = cm->height; + bits->xhot = cm->xhot; + bits->yhot = cm->yhot; + bits->devPrivates = NULL; + bits->refcnt = -1; + CheckForEmptyMask(bits); + pCurs->bits = bits; + pCurs->refcnt = 1; +#ifdef XFIXES + pCurs->serialNumber = ++cursorSerial; + pCurs->name = None; +#endif + + pCurs->foreRed = foreRed; + pCurs->foreGreen = foreGreen; + pCurs->foreBlue = foreBlue; + + pCurs->backRed = backRed; + pCurs->backGreen = backGreen; + pCurs->backBlue = backBlue; + + pCurs->id = cid; + pCurs->devPrivates = NULL; + + /* security creation/labeling check */ + rc = XaceHook(XACE_RESOURCE_ACCESS, client, cid, RT_CURSOR, + pCurs, RT_NONE, NULL, DixCreateAccess); + if (rc != Success) { + dixFreePrivates(pCurs->devPrivates); + FreeCursorBits(bits); + xfree(pCurs); + return rc; + } + + /* + * realize the cursor for every screen + */ + for (nscr = 0; nscr < screenInfo.numScreens; nscr++) + { + pscr = screenInfo.screens[nscr]; + if (!( *pscr->RealizeCursor)( pscr, pCurs)) + { + while (--nscr >= 0) + { + pscr = screenInfo.screens[nscr]; + ( *pscr->UnrealizeCursor)( pscr, pCurs); + } + dixFreePrivates(pCurs->devPrivates); + FreeCursorBits(bits); + xfree(pCurs); + return BadAlloc; + } + } + *ppCurs = pCurs; + return rc; +} + +int +AllocGlyphCursor(Font source, unsigned sourceChar, Font mask, unsigned maskChar, + unsigned foreRed, unsigned foreGreen, unsigned foreBlue, + unsigned backRed, unsigned backGreen, unsigned backBlue, + CursorPtr *ppCurs, ClientPtr client, XID cid) +{ + FontPtr sourcefont, maskfont; + unsigned char *srcbits; + unsigned char *mskbits; + CursorMetricRec cm; + int rc; + CursorBitsPtr bits; + CursorPtr pCurs; + int nscr; + ScreenPtr pscr; + GlyphSharePtr pShare; + + rc = dixLookupResource((pointer *)&sourcefont, source, RT_FONT, client, + DixUseAccess); + if (rc != Success) + { + client->errorValue = source; + return (rc == BadValue) ? BadFont : rc; + } + rc = dixLookupResource((pointer *)&maskfont, mask, RT_FONT, client, + DixUseAccess); + if (rc != Success && mask != None) + { + client->errorValue = mask; + return (rc == BadValue) ? BadFont : rc; + } + if (sourcefont != maskfont) + pShare = (GlyphSharePtr)NULL; + else + { + for (pShare = sharedGlyphs; + pShare && + ((pShare->font != sourcefont) || + (pShare->sourceChar != sourceChar) || + (pShare->maskChar != maskChar)); + pShare = pShare->next) + ; + } + if (pShare) + { + pCurs = (CursorPtr)xalloc(sizeof(CursorRec)); + if (!pCurs) + return BadAlloc; + bits = pShare->bits; + bits->refcnt++; + } + else + { + if (!CursorMetricsFromGlyph(sourcefont, sourceChar, &cm)) + { + client->errorValue = sourceChar; + return BadValue; + } + if (!maskfont) + { + long n; + unsigned char *mskptr; + + n = BitmapBytePad(cm.width)*(long)cm.height; + mskptr = mskbits = (unsigned char *)xalloc(n); + if (!mskptr) + return BadAlloc; + while (--n >= 0) + *mskptr++ = ~0; + } + else + { + if (!CursorMetricsFromGlyph(maskfont, maskChar, &cm)) + { + client->errorValue = maskChar; + return BadValue; + } + if ((rc = ServerBitsFromGlyph(maskfont, maskChar, &cm, &mskbits))) + return rc; + } + if ((rc = ServerBitsFromGlyph(sourcefont, sourceChar, &cm, &srcbits))) + { + xfree(mskbits); + return rc; + } + if (sourcefont != maskfont) + { + pCurs = (CursorPtr)xalloc(sizeof(CursorRec) + sizeof(CursorBits)); + if (pCurs) + bits = (CursorBitsPtr)((char *)pCurs + sizeof(CursorRec)); + else + bits = (CursorBitsPtr)NULL; + } + else + { + pCurs = (CursorPtr)xalloc(sizeof(CursorRec)); + if (pCurs) + bits = (CursorBitsPtr)xalloc(sizeof(CursorBits)); + else + bits = (CursorBitsPtr)NULL; + } + if (!bits) + { + xfree(pCurs); + xfree(mskbits); + xfree(srcbits); + return BadAlloc; + } + bits->source = srcbits; + bits->mask = mskbits; +#ifdef ARGB_CURSOR + bits->argb = 0; +#endif + bits->width = cm.width; + bits->height = cm.height; + bits->xhot = cm.xhot; + bits->yhot = cm.yhot; + bits->devPrivates = NULL; + if (sourcefont != maskfont) + bits->refcnt = -1; + else + { + bits->refcnt = 1; + pShare = (GlyphSharePtr)xalloc(sizeof(GlyphShare)); + if (!pShare) + { + FreeCursorBits(bits); + return BadAlloc; + } + pShare->font = sourcefont; + sourcefont->refcnt++; + pShare->sourceChar = sourceChar; + pShare->maskChar = maskChar; + pShare->bits = bits; + pShare->next = sharedGlyphs; + sharedGlyphs = pShare; + } + } + CheckForEmptyMask(bits); + pCurs->bits = bits; + pCurs->refcnt = 1; +#ifdef XFIXES + pCurs->serialNumber = ++cursorSerial; + pCurs->name = None; +#endif + + pCurs->foreRed = foreRed; + pCurs->foreGreen = foreGreen; + pCurs->foreBlue = foreBlue; + + pCurs->backRed = backRed; + pCurs->backGreen = backGreen; + pCurs->backBlue = backBlue; + + pCurs->id = cid; + pCurs->devPrivates = NULL; + + /* security creation/labeling check */ + rc = XaceHook(XACE_RESOURCE_ACCESS, client, cid, RT_CURSOR, + pCurs, RT_NONE, NULL, DixCreateAccess); + if (rc != Success) { + dixFreePrivates(pCurs->devPrivates); + FreeCursorBits(bits); + xfree(pCurs); + return rc; + } + + /* + * realize the cursor for every screen + */ + for (nscr = 0; nscr < screenInfo.numScreens; nscr++) + { + pscr = screenInfo.screens[nscr]; + if (!( *pscr->RealizeCursor)( pscr, pCurs)) + { + while (--nscr >= 0) + { + pscr = screenInfo.screens[nscr]; + ( *pscr->UnrealizeCursor)( pscr, pCurs); + } + dixFreePrivates(pCurs->devPrivates); + FreeCursorBits(pCurs->bits); + xfree(pCurs); + return BadAlloc; + } + } + *ppCurs = pCurs; + return Success; +} + +/** CreateRootCursor + * + * look up the name of a font + * open the font + * add the font to the resource table + * make a cursor from the glyphs + * add the cursor to the resource table + *************************************************************/ + +CursorPtr +CreateRootCursor(char *unused1, unsigned int unused2) +{ + CursorPtr curs; +#ifdef NULL_ROOT_CURSOR + CursorMetricRec cm; +#else + FontPtr cursorfont; + int err; + XID fontID; +#endif + +#ifdef NULL_ROOT_CURSOR + cm.width = 0; + cm.height = 0; + cm.xhot = 0; + cm.yhot = 0; + + AllocARGBCursor(NULL, NULL, NULL, &cm, 0, 0, 0, 0, 0, 0, + &curs, serverClient, (XID)0); + + if (curs == NullCursor) + return NullCursor; +#else + fontID = FakeClientID(0); + err = OpenFont(serverClient, fontID, FontLoadAll | FontOpenSync, + (unsigned)strlen(defaultCursorFont), defaultCursorFont); + if (err != Success) + return NullCursor; + + cursorfont = (FontPtr)LookupIDByType(fontID, RT_FONT); + if (!cursorfont) + return NullCursor; + if (AllocGlyphCursor(fontID, 0, fontID, 1, 0, 0, 0, ~0, ~0, ~0, + &curs, serverClient, (XID)0) != Success) + return NullCursor; +#endif + + if (!AddResource(FakeClientID(0), RT_CURSOR, (pointer)curs)) + return NullCursor; + + return curs; +} diff --git a/xorg-server/dix/deprecated.c b/xorg-server/dix/deprecated.c new file mode 100644 index 000000000..2bb81190c --- /dev/null +++ b/xorg-server/dix/deprecated.c @@ -0,0 +1,162 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "dix.h" +#include "misc.h" +#include "dixstruct.h" + +/* + * These are deprecated compatibility functions and will be marked as such + * and removed soon! + * + * Please use the noted replacements instead. + */ + +/* replaced by dixLookupWindow */ +_X_EXPORT WindowPtr +SecurityLookupWindow(XID id, ClientPtr client, Mask access_mode) +{ + WindowPtr pWin; + int i = dixLookupWindow(&pWin, id, client, access_mode); + static int warn = 1; + if (warn > 0 && --warn) + ErrorF("Warning: LookupWindow()/SecurityLookupWindow() " + "are deprecated. Please convert your driver/module " + "to use dixLookupWindow().\n"); + return (i == Success) ? pWin : NULL; +} + +/* replaced by dixLookupWindow */ +_X_EXPORT WindowPtr +LookupWindow(XID id, ClientPtr client) +{ + return SecurityLookupWindow(id, client, DixUnknownAccess); +} + +/* replaced by dixLookupDrawable */ +_X_EXPORT pointer +SecurityLookupDrawable(XID id, ClientPtr client, Mask access_mode) +{ + DrawablePtr pDraw; + int i = dixLookupDrawable(&pDraw, id, client, M_DRAWABLE, access_mode); + static int warn = 1; + if (warn > 0 && --warn) + ErrorF("Warning: LookupDrawable()/SecurityLookupDrawable() " + "are deprecated. Please convert your driver/module " + "to use dixLookupDrawable().\n"); + return (i == Success) ? pDraw : NULL; +} + +/* replaced by dixLookupDrawable */ +_X_EXPORT pointer +LookupDrawable(XID id, ClientPtr client) +{ + return SecurityLookupDrawable(id, client, DixUnknownAccess); +} + +/* replaced by dixLookupClient */ +_X_EXPORT ClientPtr +LookupClient(XID id, ClientPtr client) +{ + ClientPtr pClient; + int i = dixLookupClient(&pClient, id, client, DixUnknownAccess); + static int warn = 1; + if (warn > 0 && --warn) + ErrorF("Warning: LookupClient() is deprecated. Please convert your " + "driver/module to use dixLookupClient().\n"); + return (i == Success) ? pClient : NULL; +} + +/* replaced by dixLookupResource */ +_X_EXPORT pointer +SecurityLookupIDByType(ClientPtr client, XID id, RESTYPE rtype, + Mask access_mode) +{ + pointer retval; + int i = dixLookupResource(&retval, id, rtype, client, access_mode); + static int warn = 1; + if (warn > 0 && --warn) + ErrorF("Warning: LookupIDByType()/SecurityLookupIDByType() " + "are deprecated. Please convert your driver/module " + "to use dixLookupResource().\n"); + return (i == Success) ? retval : NULL; +} + +/* replaced by dixLookupResource */ +_X_EXPORT pointer +SecurityLookupIDByClass(ClientPtr client, XID id, RESTYPE classes, + Mask access_mode) +{ + pointer retval; + int i = dixLookupResource(&retval, id, classes, client, access_mode); + static int warn = 1; + if (warn > 0 && --warn) + ErrorF("Warning: LookupIDByClass()/SecurityLookupIDByClass() " + "are deprecated. Please convert your driver/module " + "to use dixLookupResource().\n"); + return (i == Success) ? retval : NULL; +} + +/* replaced by dixLookupResource */ +_X_EXPORT pointer +LookupIDByType(XID id, RESTYPE rtype) +{ + return SecurityLookupIDByType(NullClient, id, rtype, DixUnknownAccess); +} + +/* replaced by dixLookupResource */ +_X_EXPORT pointer +LookupIDByClass(XID id, RESTYPE classes) +{ + return SecurityLookupIDByClass(NullClient, id, classes, DixUnknownAccess); +} + +/* end deprecated functions */ diff --git a/xorg-server/dix/devices.c b/xorg-server/dix/devices.c new file mode 100644 index 000000000..5a726afe8 --- /dev/null +++ b/xorg-server/dix/devices.c @@ -0,0 +1,2114 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "misc.h" +#include "resource.h" +#define NEED_EVENTS +#define NEED_REPLIES +#include +#include "windowstr.h" +#include "inputstr.h" +#include "scrnintstr.h" +#include "cursorstr.h" +#include "dixstruct.h" +#include "site.h" +#ifndef XKB_IN_SERVER +#define XKB_IN_SERVER +#endif +#ifdef XKB +#include +#endif +#include "privates.h" +#include "xace.h" + +#include "dispatch.h" +#include "swaprep.h" +#include "dixevents.h" + +#include +#include +#include "exglobals.h" +#include "exevents.h" + +/** @file + * This file handles input device-related stuff. + */ + +DevPrivateKey CoreDevicePrivateKey = &CoreDevicePrivateKey; + +/** + * Create a new input device and init it to sane values. The device is added + * to the server's off_devices list. + * + * @param deviceProc Callback for device control function (switch dev on/off). + * @return The newly created device. + */ +DeviceIntPtr +AddInputDevice(DeviceProc deviceProc, Bool autoStart) +{ + DeviceIntPtr dev, *prev; /* not a typo */ + DeviceIntPtr devtmp; + int devid; + char devind[MAX_DEVICES]; + + /* Find next available id */ + memset(devind, 0, sizeof(char)*MAX_DEVICES); + for (devtmp = inputInfo.devices; devtmp; devtmp = devtmp->next) + devind[devtmp->id]++; + for (devtmp = inputInfo.off_devices; devtmp; devtmp = devtmp->next) + devind[devtmp->id]++; + for (devid = 0; devid < MAX_DEVICES && devind[devid]; devid++) + ; + + if (devid >= MAX_DEVICES) + return (DeviceIntPtr)NULL; + dev = (DeviceIntPtr) xcalloc(sizeof(DeviceIntRec), 1); + if (!dev) + return (DeviceIntPtr)NULL; + dev->name = (char *)NULL; + dev->type = 0; + dev->id = devid; + dev->public.on = FALSE; + dev->public.processInputProc = (ProcessInputProc)NoopDDA; + dev->public.realInputProc = (ProcessInputProc)NoopDDA; + dev->public.enqueueInputProc = EnqueueEvent; + dev->deviceProc = deviceProc; + dev->startup = autoStart; + dev->sync.frozen = FALSE; + dev->sync.other = NullGrab; + dev->sync.state = NOT_GRABBED; + dev->sync.event = (xEvent *) NULL; + dev->sync.evcount = 0; + dev->grab = NullGrab; + dev->grabTime = currentTime; + dev->fromPassiveGrab = FALSE; + dev->key = (KeyClassPtr)NULL; + dev->valuator = (ValuatorClassPtr)NULL; + dev->button = (ButtonClassPtr)NULL; + dev->focus = (FocusClassPtr)NULL; + dev->proximity = (ProximityClassPtr)NULL; + dev->absolute = (AbsoluteClassPtr)NULL; + dev->kbdfeed = (KbdFeedbackPtr)NULL; + dev->ptrfeed = (PtrFeedbackPtr)NULL; + dev->intfeed = (IntegerFeedbackPtr)NULL; + dev->stringfeed = (StringFeedbackPtr)NULL; + dev->bell = (BellFeedbackPtr)NULL; + dev->leds = (LedFeedbackPtr)NULL; +#ifdef XKB + dev->xkb_interest = NULL; +#endif + dev->config_info = NULL; + dev->devPrivates = NULL; + dev->unwrapProc = NULL; + dev->coreEvents = TRUE; + dev->inited = FALSE; + dev->enabled = FALSE; + + /* security creation/labeling check + */ + if (XaceHook(XACE_DEVICE_ACCESS, serverClient, dev, DixCreateAccess)) { + xfree(dev); + return NULL; + } + + inputInfo.numDevices++; + + for (prev = &inputInfo.off_devices; *prev; prev = &(*prev)->next) + ; + *prev = dev; + dev->next = NULL; + + return dev; +} + +/** + * Switch device ON through the driver and push it onto the global device + * list. All clients are notified about the device being enabled. + * + * A device will send events once enabled. + * + * @param The device to be enabled. + * @return TRUE on success or FALSE otherwise. + */ +Bool +EnableDevice(DeviceIntPtr dev) +{ + DeviceIntPtr *prev; + int ret; + DeviceIntRec dummyDev; + devicePresenceNotify ev; + + for (prev = &inputInfo.off_devices; + *prev && (*prev != dev); + prev = &(*prev)->next) + ; + if ((*prev != dev) || !dev->inited || + ((ret = (*dev->deviceProc)(dev, DEVICE_ON)) != Success)) { + ErrorF("couldn't enable device %d\n", dev->id); + return FALSE; + } + dev->enabled = TRUE; + *prev = dev->next; + + for (prev = &inputInfo.devices; *prev; prev = &(*prev)->next) + ; + *prev = dev; + dev->next = NULL; + + ev.type = DevicePresenceNotify; + ev.time = currentTime.milliseconds; + ev.devchange = DeviceEnabled; + ev.deviceid = dev->id; + dummyDev.id = 0; + SendEventToAllWindows(&dummyDev, DevicePresenceNotifyMask, + (xEvent *) &ev, 1); + + return TRUE; +} + +/** + * Switch a device off through the driver and push it onto the off_devices + * list. A device will not send events while disabled. All clients are + * notified about the device being disabled. + * + * @return TRUE on success or FALSE otherwise. + */ +Bool +DisableDevice(DeviceIntPtr dev) +{ + DeviceIntPtr *prev; + DeviceIntRec dummyDev; + devicePresenceNotify ev; + + for (prev = &inputInfo.devices; + *prev && (*prev != dev); + prev = &(*prev)->next) + ; + if (*prev != dev) + return FALSE; + (void)(*dev->deviceProc)(dev, DEVICE_OFF); + dev->enabled = FALSE; + *prev = dev->next; + dev->next = inputInfo.off_devices; + inputInfo.off_devices = dev; + + ev.type = DevicePresenceNotify; + ev.time = currentTime.milliseconds; + ev.devchange = DeviceDisabled; + ev.deviceid = dev->id; + dummyDev.id = 0; + SendEventToAllWindows(&dummyDev, DevicePresenceNotifyMask, + (xEvent *) &ev, 1); + + return TRUE; +} + +/** + * Initialise a new device through the driver and tell all clients about the + * new device. + * + * The device will NOT send events until it is enabled! + * + * @return Success or an error code on failure. + */ +int +ActivateDevice(DeviceIntPtr dev) +{ + int ret = Success; + devicePresenceNotify ev; + DeviceIntRec dummyDev; + + if (!dev || !dev->deviceProc) + return BadImplementation; + + ret = (*dev->deviceProc) (dev, DEVICE_INIT); + dev->inited = (ret == Success); + + ev.type = DevicePresenceNotify; + ev.time = currentTime.milliseconds; + ev.devchange = DeviceAdded; + ev.deviceid = dev->id; + dummyDev.id = 0; + SendEventToAllWindows(&dummyDev, DevicePresenceNotifyMask, + (xEvent *) &ev, 1); + + return ret; +} + +/** + * Ring the bell. + * The actual task of ringing the bell is the job of the DDX. + */ +static void +CoreKeyboardBell(int volume, DeviceIntPtr pDev, pointer arg, int something) +{ + KeybdCtrl *ctrl = arg; + + DDXRingBell(volume, ctrl->bell_pitch, ctrl->bell_duration); +} + +static void +CoreKeyboardCtl(DeviceIntPtr pDev, KeybdCtrl *ctrl) +{ + return; +} + +/** + * Device control function for the Virtual Core Keyboard. + */ +static int +CoreKeyboardProc(DeviceIntPtr pDev, int what) +{ + CARD8 *modMap; + KeySymsRec keySyms; +#ifdef XKB + XkbComponentNamesRec names; +#endif + + switch (what) { + case DEVICE_INIT: + keySyms.minKeyCode = 8; + keySyms.maxKeyCode = 255; + keySyms.mapWidth = 4; + keySyms.map = (KeySym *)xcalloc(sizeof(KeySym), + (keySyms.maxKeyCode - + keySyms.minKeyCode + 1) * + keySyms.mapWidth); + if (!keySyms.map) { + ErrorF("Couldn't allocate core keymap\n"); + return BadAlloc; + } + + modMap = (CARD8 *)xalloc(MAP_LENGTH); + if (!modMap) { + ErrorF("Couldn't allocate core modifier map\n"); + return BadAlloc; + } + bzero((char *)modMap, MAP_LENGTH); + +#ifdef XKB + if (!noXkbExtension) { + bzero(&names, sizeof(names)); + XkbSetRulesDflts("base", "pc105", "us", NULL, NULL); + XkbInitKeyboardDeviceStruct(pDev, &names, &keySyms, modMap, + CoreKeyboardBell, CoreKeyboardCtl); + } + else +#endif + { + /* FIXME Our keymap here isn't exactly useful. */ + InitKeyboardDeviceStruct((DevicePtr)pDev, &keySyms, modMap, + CoreKeyboardBell, CoreKeyboardCtl); + } + + xfree(keySyms.map); + xfree(modMap); + + break; + + case DEVICE_CLOSE: + dixSetPrivate(&pDev->devPrivates, CoreDevicePrivateKey, NULL); + break; + + default: + break; + } + return Success; +} + +/** + * Device control function for the Virtual Core Pointer. + */ +static int +CorePointerProc(DeviceIntPtr pDev, int what) +{ + BYTE map[33]; + int i = 0; + + switch (what) { + case DEVICE_INIT: + for (i = 1; i <= 32; i++) + map[i] = i; + InitPointerDeviceStruct((DevicePtr)pDev, map, 32, + GetMotionHistory, (PtrCtrlProcPtr)NoopDDA, + GetMotionHistorySize(), 2); + pDev->valuator->axisVal[0] = screenInfo.screens[0]->width / 2; + pDev->valuator->lastx = pDev->valuator->axisVal[0]; + pDev->valuator->axisVal[1] = screenInfo.screens[0]->height / 2; + pDev->valuator->lasty = pDev->valuator->axisVal[1]; + break; + + case DEVICE_CLOSE: + dixSetPrivate(&pDev->devPrivates, CoreDevicePrivateKey, NULL); + break; + + default: + break; + } + + return Success; +} + +/** + * Initialise the two core devices, VCP and VCK (see events.c). + * The devices are activated but not enabled. + * Note that the server MUST have two core devices at all times, even if there + * is no physical device connected. + */ +void +InitCoreDevices(void) +{ + DeviceIntPtr dev; + + if (!inputInfo.keyboard) { + dev = AddInputDevice(CoreKeyboardProc, TRUE); + if (!dev) + FatalError("Failed to allocate core keyboard"); + dev->name = strdup("Virtual core keyboard"); +#ifdef XKB + dev->public.processInputProc = CoreProcessKeyboardEvent; + dev->public.realInputProc = CoreProcessKeyboardEvent; + if (!noXkbExtension) + XkbSetExtension(dev, ProcessKeyboardEvent); +#else + dev->public.processInputProc = ProcessKeyboardEvent; + dev->public.realInputProc = ProcessKeyboardEvent; +#endif + dev->ActivateGrab = ActivateKeyboardGrab; + dev->DeactivateGrab = DeactivateKeyboardGrab; + dev->coreEvents = FALSE; + (void)ActivateDevice(dev); + inputInfo.keyboard = dev; + } + + if (!inputInfo.pointer) { + dev = AddInputDevice(CorePointerProc, TRUE); + if (!dev) + FatalError("Failed to allocate core pointer"); + dev->name = strdup("Virtual core pointer"); +#ifdef XKB + dev->public.processInputProc = CoreProcessPointerEvent; + dev->public.realInputProc = CoreProcessPointerEvent; + if (!noXkbExtension) + XkbSetExtension(dev, ProcessPointerEvent); +#else + dev->public.processInputProc = ProcessPointerEvent; + dev->public.realInputProc = ProcessPointerEvent; +#endif + dev->ActivateGrab = ActivatePointerGrab; + dev->DeactivateGrab = DeactivatePointerGrab; + dev->coreEvents = FALSE; + (void)ActivateDevice(dev); + inputInfo.pointer = dev; + } +} + +/** + * Activate all switched-off devices and then enable all those devices. + * + * Will return an error if no core keyboard or core pointer is present. + * In theory this should never happen if you call InitCoreDevices() first. + * + * @return Success or error code on failure. + */ +int +InitAndStartDevices(void) +{ + DeviceIntPtr dev, next; + + for (dev = inputInfo.off_devices; dev; dev = dev->next) { + DebugF("(dix) initialising device %d\n", dev->id); + if (!dev->inited) + ActivateDevice(dev); + } + for (dev = inputInfo.off_devices; dev; dev = next) + { + DebugF("(dix) enabling device %d\n", dev->id); + next = dev->next; + if (dev->inited && dev->startup) + (void)EnableDevice(dev); + } + for (dev = inputInfo.devices; + dev && (dev != inputInfo.keyboard); + dev = dev->next) + ; + if (!dev || (dev != inputInfo.keyboard)) { + ErrorF("No core keyboard\n"); + return BadImplementation; + } + for (dev = inputInfo.devices; + dev && (dev != inputInfo.pointer); + dev = dev->next) + ; + if (!dev || (dev != inputInfo.pointer)) { + ErrorF("No core pointer\n"); + return BadImplementation; + } + return Success; +} + +/** + * Close down a device and free all resources. + * Once closed down, the driver will probably not expect you that you'll ever + * enable it again and free associated structs. If you want the device to just + * be disabled, DisableDevice(). + * Don't call this function directly, use RemoveDevice() instead. + */ +static void +CloseDevice(DeviceIntPtr dev) +{ + KbdFeedbackPtr k, knext; + PtrFeedbackPtr p, pnext; + IntegerFeedbackPtr i, inext; + StringFeedbackPtr s, snext; + BellFeedbackPtr b, bnext; + LedFeedbackPtr l, lnext; + + if (dev->inited) + (void)(*dev->deviceProc)(dev, DEVICE_CLOSE); + + xfree(dev->name); + + if (dev->key) { +#ifdef XKB + if (dev->key->xkbInfo) + XkbFreeInfo(dev->key->xkbInfo); +#endif + dev->key->xkbInfo = NULL; + xfree(dev->key->curKeySyms.map); + xfree(dev->key->modifierKeyMap); + xfree(dev->key); + dev->key = NULL; + } + + if (dev->valuator) { + /* Counterpart to 'biggest hack ever' in init. */ + if (dev->valuator->motion && + dev->valuator->GetMotionProc == GetMotionHistory) + xfree(dev->valuator->motion); + xfree(dev->valuator); + } + + if (dev->button) { +#ifdef XKB + if (dev->button->xkb_acts) + xfree(dev->button->xkb_acts); +#endif + xfree(dev->button); + } + + if (dev->focus) { + xfree(dev->focus->trace); + xfree(dev->focus); + } + + if (dev->proximity) + xfree(dev->proximity); + + for (k = dev->kbdfeed; k; k = knext) { + knext = k->next; +#ifdef XKB + if (k->xkb_sli) + XkbFreeSrvLedInfo(k->xkb_sli); +#endif + xfree(k); + } + + for (p = dev->ptrfeed; p; p = pnext) { + pnext = p->next; + xfree(p); + } + + for (i = dev->intfeed; i; i = inext) { + inext = i->next; + xfree(i); + } + + for (s = dev->stringfeed; s; s = snext) { + snext = s->next; + xfree(s->ctrl.symbols_supported); + xfree(s->ctrl.symbols_displayed); + xfree(s); + } + + for (b = dev->bell; b; b = bnext) { + bnext = b->next; + xfree(b); + } + + for (l = dev->leds; l; l = lnext) { + lnext = l->next; +#ifdef XKB + if (l->xkb_sli) + XkbFreeSrvLedInfo(l->xkb_sli); +#endif + xfree(l); + } + +#ifdef XKB + while (dev->xkb_interest) + XkbRemoveResourceClient((DevicePtr)dev,dev->xkb_interest->resource); +#endif + + xfree(dev->sync.event); + dixFreePrivates(dev->devPrivates); + xfree(dev); +} + +/** + * Shut down all devices, free all resources, etc. + * Only useful if you're shutting down the server! + */ +void +CloseDownDevices(void) +{ + DeviceIntPtr dev, next; + + for (dev = inputInfo.devices; dev; dev = next) + { + next = dev->next; + DeleteInputDeviceRequest(dev); + } + for (dev = inputInfo.off_devices; dev; dev = next) + { + next = dev->next; + DeleteInputDeviceRequest(dev); + } + inputInfo.devices = NULL; + inputInfo.off_devices = NULL; + inputInfo.keyboard = NULL; + inputInfo.pointer = NULL; +} + +/** + * Remove a device from the device list, closes it and thus frees all + * resources. + * Removes both enabled and disabled devices and notifies all devices about + * the removal of the device. + */ +int +RemoveDevice(DeviceIntPtr dev) +{ + DeviceIntPtr prev,tmp,next; + int ret = BadMatch; + devicePresenceNotify ev; + DeviceIntRec dummyDev; + int deviceid; + + DebugF("(dix) removing device %d\n", dev->id); + + if (!dev || dev == inputInfo.keyboard || dev == inputInfo.pointer) + return BadImplementation; + + deviceid = dev->id; + DisableDevice(dev); + + prev = NULL; + for (tmp = inputInfo.devices; tmp; (prev = tmp), (tmp = next)) { + next = tmp->next; + if (tmp == dev) { + CloseDevice(tmp); + + if (prev==NULL) + inputInfo.devices = next; + else + prev->next = next; + + ret = Success; + } + } + + prev = NULL; + for (tmp = inputInfo.off_devices; tmp; (prev = tmp), (tmp = next)) { + next = tmp->next; + if (tmp == dev) { + CloseDevice(tmp); + + if (prev == NULL) + inputInfo.off_devices = next; + else + prev->next = next; + + ret = Success; + } + } + + if (ret == Success) { + inputInfo.numDevices--; + ev.type = DevicePresenceNotify; + ev.time = currentTime.milliseconds; + ev.devchange = DeviceRemoved; + ev.deviceid = deviceid; + dummyDev.id = 0; + SendEventToAllWindows(&dummyDev, DevicePresenceNotifyMask, + (xEvent *) &ev, 1); + } + + return ret; +} + +int +NumMotionEvents(void) +{ + return inputInfo.pointer->valuator->numMotionEvents; +} + +void +RegisterPointerDevice(DeviceIntPtr device) +{ + RegisterOtherDevice(device); +} + +void +RegisterKeyboardDevice(DeviceIntPtr device) +{ + RegisterOtherDevice(device); +} + +int +dixLookupDevice(DeviceIntPtr *pDev, int id, ClientPtr client, Mask access_mode) +{ + DeviceIntPtr dev; + int rc; + *pDev = NULL; + + for (dev=inputInfo.devices; dev; dev=dev->next) { + if (dev->id == (CARD8)id) + goto found; + } + for (dev=inputInfo.off_devices; dev; dev=dev->next) { + if (dev->id == (CARD8)id) + goto found; + } + return BadDevice; + +found: + rc = XaceHook(XACE_DEVICE_ACCESS, client, dev, access_mode); + if (rc == Success) + *pDev = dev; + return rc; +} + +void +QueryMinMaxKeyCodes(KeyCode *minCode, KeyCode *maxCode) +{ + if (inputInfo.keyboard) { + *minCode = inputInfo.keyboard->key->curKeySyms.minKeyCode; + *maxCode = inputInfo.keyboard->key->curKeySyms.maxKeyCode; + } +} + +Bool +SetKeySymsMap(KeySymsPtr dst, KeySymsPtr src) +{ + int i, j; + int rowDif = src->minKeyCode - dst->minKeyCode; + + /* if keysym map size changes, grow map first */ + if (src->mapWidth < dst->mapWidth) + { + for (i = src->minKeyCode; i <= src->maxKeyCode; i++) + { +#define SI(r, c) (((r-src->minKeyCode)*src->mapWidth) + (c)) +#define DI(r, c) (((r - dst->minKeyCode)*dst->mapWidth) + (c)) + for (j = 0; j < src->mapWidth; j++) + dst->map[DI(i, j)] = src->map[SI(i, j)]; + for (j = src->mapWidth; j < dst->mapWidth; j++) + dst->map[DI(i, j)] = NoSymbol; +#undef SI +#undef DI + } + return TRUE; + } + else if (src->mapWidth > dst->mapWidth) + { + KeySym *map; + int bytes = sizeof(KeySym) * src->mapWidth * + (dst->maxKeyCode - dst->minKeyCode + 1); + map = (KeySym *)xalloc(bytes); + if (!map) + return FALSE; + bzero((char *)map, bytes); + if (dst->map) + { + for (i = 0; i <= dst->maxKeyCode-dst->minKeyCode; i++) + memmove((char *)&map[i*src->mapWidth], + (char *)&dst->map[i*dst->mapWidth], + dst->mapWidth * sizeof(KeySym)); + xfree(dst->map); + } + dst->mapWidth = src->mapWidth; + dst->map = map; + } + memmove((char *)&dst->map[rowDif * dst->mapWidth], + (char *)src->map, + (int)(src->maxKeyCode - src->minKeyCode + 1) * + dst->mapWidth * sizeof(KeySym)); + return TRUE; +} + +static Bool +InitModMap(KeyClassPtr keyc) +{ + int i, j; + CARD8 keysPerModifier[8]; + CARD8 mask; + + keyc->maxKeysPerModifier = 0; + for (i = 0; i < 8; i++) + keysPerModifier[i] = 0; + for (i = 8; i < MAP_LENGTH; i++) + { + for (j = 0, mask = 1; j < 8; j++, mask <<= 1) + { + if (mask & keyc->modifierMap[i]) + { + if (++keysPerModifier[j] > keyc->maxKeysPerModifier) + keyc->maxKeysPerModifier = keysPerModifier[j]; + } + } + } + keyc->modifierKeyMap = (KeyCode *)xalloc(8*keyc->maxKeysPerModifier); + if (!keyc->modifierKeyMap && keyc->maxKeysPerModifier) + return (FALSE); + bzero((char *)keyc->modifierKeyMap, 8*(int)keyc->maxKeysPerModifier); + for (i = 0; i < 8; i++) + keysPerModifier[i] = 0; + for (i = 8; i < MAP_LENGTH; i++) + { + for (j = 0, mask = 1; j < 8; j++, mask <<= 1) + { + if (mask & keyc->modifierMap[i]) + { + keyc->modifierKeyMap[(j*keyc->maxKeysPerModifier) + + keysPerModifier[j]] = i; + keysPerModifier[j]++; + } + } + } + return TRUE; +} + +_X_EXPORT Bool +InitKeyClassDeviceStruct(DeviceIntPtr dev, KeySymsPtr pKeySyms, CARD8 pModifiers[]) +{ + int i; + KeyClassPtr keyc; + + keyc = (KeyClassPtr)xalloc(sizeof(KeyClassRec)); + if (!keyc) + return FALSE; + keyc->curKeySyms.map = (KeySym *)NULL; + keyc->curKeySyms.mapWidth = 0; + keyc->curKeySyms.minKeyCode = pKeySyms->minKeyCode; + keyc->curKeySyms.maxKeyCode = pKeySyms->maxKeyCode; + keyc->modifierKeyMap = (KeyCode *)NULL; + keyc->state = 0; + keyc->prev_state = 0; + if (pModifiers) + memmove((char *)keyc->modifierMap, (char *)pModifiers, MAP_LENGTH); + else + bzero((char *)keyc->modifierMap, MAP_LENGTH); + bzero((char *)keyc->down, DOWN_LENGTH); + bzero((char *)keyc->postdown, DOWN_LENGTH); + for (i = 0; i < 8; i++) + keyc->modifierKeyCount[i] = 0; + if (!SetKeySymsMap(&keyc->curKeySyms, pKeySyms) || !InitModMap(keyc)) + { + xfree(keyc->curKeySyms.map); + xfree(keyc->modifierKeyMap); + xfree(keyc); + return FALSE; + } + dev->key = keyc; +#ifdef XKB + dev->key->xkbInfo= NULL; + if (!noXkbExtension) XkbInitDevice(dev); +#endif + return TRUE; +} + +_X_EXPORT Bool +InitButtonClassDeviceStruct(DeviceIntPtr dev, int numButtons, + CARD8 *map) +{ + ButtonClassPtr butc; + int i; + + butc = (ButtonClassPtr)xalloc(sizeof(ButtonClassRec)); + if (!butc) + return FALSE; + butc->numButtons = numButtons; + for (i = 1; i <= numButtons; i++) + butc->map[i] = map[i]; + butc->buttonsDown = 0; + butc->state = 0; + butc->motionMask = 0; + bzero((char *)butc->down, DOWN_LENGTH); +#ifdef XKB + butc->xkb_acts= NULL; +#endif + dev->button = butc; + return TRUE; +} + +_X_EXPORT Bool +InitValuatorClassDeviceStruct(DeviceIntPtr dev, int numAxes, + ValuatorMotionProcPtr motionProc, + int numMotionEvents, int mode) +{ + int i; + ValuatorClassPtr valc; + + if (!dev) + return FALSE; + + valc = (ValuatorClassPtr)xalloc(sizeof(ValuatorClassRec) + + numAxes * sizeof(AxisInfo) + + numAxes * sizeof(unsigned int)); + if (!valc) + return FALSE; + + valc->motion = NULL; + valc->first_motion = 0; + valc->last_motion = 0; + valc->GetMotionProc = motionProc; + + valc->numMotionEvents = numMotionEvents; + valc->motionHintWindow = NullWindow; + valc->numAxes = numAxes; + valc->mode = mode; + valc->axes = (AxisInfoPtr)(valc + 1); + valc->axisVal = (int *)(valc->axes + numAxes); + valc->lastx = 0; + valc->lasty = 0; + valc->dxremaind = 0; + valc->dyremaind = 0; + dev->valuator = valc; + + /* biggest hack ever. */ + if (motionProc == GetMotionHistory) + AllocateMotionHistory(dev); + + for (i=0; iaxisVal[i]=0; + } + return TRUE; +} + +_X_EXPORT Bool +InitAbsoluteClassDeviceStruct(DeviceIntPtr dev) +{ + AbsoluteClassPtr abs; + + abs = (AbsoluteClassPtr)xalloc(sizeof(AbsoluteClassRec)); + if (!abs) + return FALSE; + + /* we don't do anything sensible with these, but should */ + abs->min_x = -1; + abs->min_y = -1; + abs->max_x = -1; + abs->max_y = -1; + abs->flip_x = 0; + abs->flip_y = 0; + abs->rotation = 0; + abs->button_threshold = 0; + + abs->offset_x = 0; + abs->offset_y = 0; + abs->width = -1; + abs->height = -1; + abs->following = 0; + abs->screen = 0; + + dev->absolute = abs; + + return TRUE; +} + +_X_EXPORT Bool +InitFocusClassDeviceStruct(DeviceIntPtr dev) +{ + FocusClassPtr focc; + + focc = (FocusClassPtr)xalloc(sizeof(FocusClassRec)); + if (!focc) + return FALSE; + focc->win = PointerRootWin; + focc->revert = None; + focc->time = currentTime; + focc->trace = (WindowPtr *)NULL; + focc->traceSize = 0; + focc->traceGood = 0; + dev->focus = focc; + return TRUE; +} + +_X_EXPORT Bool +InitKbdFeedbackClassDeviceStruct(DeviceIntPtr dev, BellProcPtr bellProc, + KbdCtrlProcPtr controlProc) +{ + KbdFeedbackPtr feedc; + + feedc = (KbdFeedbackPtr)xalloc(sizeof(KbdFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->BellProc = bellProc; + feedc->CtrlProc = controlProc; +#ifdef XKB + defaultKeyboardControl.autoRepeat = TRUE; +#endif + feedc->ctrl = defaultKeyboardControl; + feedc->ctrl.id = 0; + if ((feedc->next = dev->kbdfeed) != 0) + feedc->ctrl.id = dev->kbdfeed->ctrl.id + 1; + dev->kbdfeed = feedc; +#ifdef XKB + feedc->xkb_sli= NULL; + if (!noXkbExtension) + XkbFinishDeviceInit(dev); +#endif + (*dev->kbdfeed->CtrlProc)(dev,&dev->kbdfeed->ctrl); + return TRUE; +} + +_X_EXPORT Bool +InitPtrFeedbackClassDeviceStruct(DeviceIntPtr dev, PtrCtrlProcPtr controlProc) +{ + PtrFeedbackPtr feedc; + + feedc = (PtrFeedbackPtr)xalloc(sizeof(PtrFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->CtrlProc = controlProc; + feedc->ctrl = defaultPointerControl; + feedc->ctrl.id = 0; + if ( (feedc->next = dev->ptrfeed) ) + feedc->ctrl.id = dev->ptrfeed->ctrl.id + 1; + dev->ptrfeed = feedc; + (*controlProc)(dev, &feedc->ctrl); + return TRUE; +} + + +static LedCtrl defaultLedControl = { + DEFAULT_LEDS, DEFAULT_LEDS_MASK, 0}; + +static BellCtrl defaultBellControl = { + DEFAULT_BELL, + DEFAULT_BELL_PITCH, + DEFAULT_BELL_DURATION, + 0}; + +static IntegerCtrl defaultIntegerControl = { + DEFAULT_INT_RESOLUTION, + DEFAULT_INT_MIN_VALUE, + DEFAULT_INT_MAX_VALUE, + DEFAULT_INT_DISPLAYED, + 0}; + +_X_EXPORT Bool +InitStringFeedbackClassDeviceStruct ( + DeviceIntPtr dev, StringCtrlProcPtr controlProc, + int max_symbols, int num_symbols_supported, KeySym *symbols) +{ + int i; + StringFeedbackPtr feedc; + + feedc = (StringFeedbackPtr)xalloc(sizeof(StringFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->CtrlProc = controlProc; + feedc->ctrl.num_symbols_supported = num_symbols_supported; + feedc->ctrl.num_symbols_displayed = 0; + feedc->ctrl.max_symbols = max_symbols; + feedc->ctrl.symbols_supported = (KeySym *) + xalloc (sizeof (KeySym) * num_symbols_supported); + feedc->ctrl.symbols_displayed = (KeySym *) + xalloc (sizeof (KeySym) * max_symbols); + if (!feedc->ctrl.symbols_supported || !feedc->ctrl.symbols_displayed) + { + if (feedc->ctrl.symbols_supported) + xfree(feedc->ctrl.symbols_supported); + if (feedc->ctrl.symbols_displayed) + xfree(feedc->ctrl.symbols_displayed); + xfree(feedc); + return FALSE; + } + for (i=0; ictrl.symbols_supported+i) = *symbols++; + for (i=0; ictrl.symbols_displayed+i) = (KeySym) NULL; + feedc->ctrl.id = 0; + if ( (feedc->next = dev->stringfeed) ) + feedc->ctrl.id = dev->stringfeed->ctrl.id + 1; + dev->stringfeed = feedc; + (*controlProc)(dev, &feedc->ctrl); + return TRUE; +} + +_X_EXPORT Bool +InitBellFeedbackClassDeviceStruct (DeviceIntPtr dev, BellProcPtr bellProc, + BellCtrlProcPtr controlProc) +{ + BellFeedbackPtr feedc; + + feedc = (BellFeedbackPtr)xalloc(sizeof(BellFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->CtrlProc = controlProc; + feedc->BellProc = bellProc; + feedc->ctrl = defaultBellControl; + feedc->ctrl.id = 0; + if ( (feedc->next = dev->bell) ) + feedc->ctrl.id = dev->bell->ctrl.id + 1; + dev->bell = feedc; + (*controlProc)(dev, &feedc->ctrl); + return TRUE; +} + +_X_EXPORT Bool +InitLedFeedbackClassDeviceStruct (DeviceIntPtr dev, LedCtrlProcPtr controlProc) +{ + LedFeedbackPtr feedc; + + feedc = (LedFeedbackPtr)xalloc(sizeof(LedFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->CtrlProc = controlProc; + feedc->ctrl = defaultLedControl; + feedc->ctrl.id = 0; + if ( (feedc->next = dev->leds) ) + feedc->ctrl.id = dev->leds->ctrl.id + 1; +#ifdef XKB + feedc->xkb_sli= NULL; +#endif + dev->leds = feedc; + (*controlProc)(dev, &feedc->ctrl); + return TRUE; +} + +_X_EXPORT Bool +InitIntegerFeedbackClassDeviceStruct (DeviceIntPtr dev, IntegerCtrlProcPtr controlProc) +{ + IntegerFeedbackPtr feedc; + + feedc = (IntegerFeedbackPtr)xalloc(sizeof(IntegerFeedbackClassRec)); + if (!feedc) + return FALSE; + feedc->CtrlProc = controlProc; + feedc->ctrl = defaultIntegerControl; + feedc->ctrl.id = 0; + if ( (feedc->next = dev->intfeed) ) + feedc->ctrl.id = dev->intfeed->ctrl.id + 1; + dev->intfeed = feedc; + (*controlProc)(dev, &feedc->ctrl); + return TRUE; +} + +_X_EXPORT Bool +InitPointerDeviceStruct(DevicePtr device, CARD8 *map, int numButtons, + ValuatorMotionProcPtr motionProc, + PtrCtrlProcPtr controlProc, int numMotionEvents, + int numAxes) +{ + DeviceIntPtr dev = (DeviceIntPtr)device; + + return(InitButtonClassDeviceStruct(dev, numButtons, map) && + InitValuatorClassDeviceStruct(dev, numAxes, motionProc, + numMotionEvents, 0) && + InitPtrFeedbackClassDeviceStruct(dev, controlProc)); +} + +_X_EXPORT Bool +InitKeyboardDeviceStruct(DevicePtr device, KeySymsPtr pKeySyms, + CARD8 pModifiers[], BellProcPtr bellProc, + KbdCtrlProcPtr controlProc) +{ + DeviceIntPtr dev = (DeviceIntPtr)device; + + return(InitKeyClassDeviceStruct(dev, pKeySyms, pModifiers) && + InitFocusClassDeviceStruct(dev) && + InitKbdFeedbackClassDeviceStruct(dev, bellProc, controlProc)); +} + +_X_EXPORT void +SendMappingNotify(unsigned request, unsigned firstKeyCode, unsigned count, + ClientPtr client) +{ + int i; + xEvent event; + + event.u.u.type = MappingNotify; + event.u.mappingNotify.request = request; + if (request == MappingKeyboard) + { + event.u.mappingNotify.firstKeyCode = firstKeyCode; + event.u.mappingNotify.count = count; + } +#ifdef XKB + if (!noXkbExtension && + ((request == MappingKeyboard) || (request == MappingModifier))) + XkbApplyMappingChange(inputInfo.keyboard, request, firstKeyCode, count, + client); +#endif + + /* 0 is the server client */ + for (i=1; iclientState == ClientStateRunning) + { +#ifdef XKB + if (!noXkbExtension && + (request == MappingKeyboard) && + (clients[i]->xkbClientFlags != 0) && + (clients[i]->mapNotifyMask&XkbKeySymsMask)) + continue; +#endif + event.u.u.sequenceNumber = clients[i]->sequence; + WriteEventsToClient(clients[i], 1, &event); + } + } +} + +/* + * n-squared algorithm. n < 255 and don't want to copy the whole thing and + * sort it to do the checking. How often is it called? Just being lazy? + */ +Bool +BadDeviceMap(BYTE *buff, int length, unsigned low, unsigned high, XID *errval) +{ + int i, j; + + for (i = 0; i < length; i++) + if (buff[i]) /* only check non-zero elements */ + { + if ((low > buff[i]) || (high < buff[i])) + { + *errval = buff[i]; + return TRUE; + } + for (j = i + 1; j < length; j++) + if (buff[i] == buff[j]) + { + *errval = buff[i]; + return TRUE; + } + } + return FALSE; +} + +Bool +AllModifierKeysAreUp(dev, map1, per1, map2, per2) + DeviceIntPtr dev; + CARD8 *map1, *map2; + int per1, per2; +{ + int i, j, k; + CARD8 *down = dev->key->down; + + for (i = 8; --i >= 0; map2 += per2) + { + for (j = per1; --j >= 0; map1++) + { + if (*map1 && BitIsOn(down, *map1)) + { + for (k = per2; (--k >= 0) && (*map1 != map2[k]);) + ; + if (k < 0) + return FALSE; + } + } + } + return TRUE; +} + +static int +DoSetModifierMapping(ClientPtr client, KeyCode *inputMap, + int numKeyPerModifier, xSetModifierMappingReply *rep) +{ + DeviceIntPtr pDev = NULL; + int rc, i = 0, inputMapLen = numKeyPerModifier * 8; + + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) { + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && pDev->key) { + for (i = 0; i < inputMapLen; i++) { + /* Check that all the new modifiers fall within the advertised + * keycode range, and are okay with the DDX. */ + if (inputMap[i] && ((inputMap[i] < pDev->key->curKeySyms.minKeyCode || + inputMap[i] > pDev->key->curKeySyms.maxKeyCode) || + !LegalModifier(inputMap[i], pDev))) { + client->errorValue = inputMap[i]; + return BadValue; + } + } + + rc = XaceHook(XACE_DEVICE_ACCESS, client, pDev, DixManageAccess); + if (rc != Success) + return rc; + + /* None of the modifiers (old or new) may be down while we change + * the map. */ + if (!AllModifierKeysAreUp(pDev, pDev->key->modifierKeyMap, + pDev->key->maxKeysPerModifier, + inputMap, numKeyPerModifier) || + !AllModifierKeysAreUp(pDev, inputMap, numKeyPerModifier, + pDev->key->modifierKeyMap, + pDev->key->maxKeysPerModifier)) { + rep->success = MappingBusy; + return Success; + } + } + } + + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) { + + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && pDev->key) { + bzero(pDev->key->modifierMap, MAP_LENGTH); + + /* Annoyingly, we lack a modifierKeyMap size, so we have to just free + * and re-alloc it every time. */ + if (pDev->key->modifierKeyMap) + xfree(pDev->key->modifierKeyMap); + + if (inputMapLen) { + pDev->key->modifierKeyMap = (KeyCode *) xalloc(inputMapLen); + if (!pDev->key->modifierKeyMap) + return BadAlloc; + + memcpy(pDev->key->modifierKeyMap, inputMap, inputMapLen); + pDev->key->maxKeysPerModifier = numKeyPerModifier; + + for (i = 0; i < inputMapLen; i++) { + if (inputMap[i]) { + pDev->key->modifierMap[inputMap[i]] |= + (1 << (((unsigned int)i) / numKeyPerModifier)); + } + } + } + else { + pDev->key->modifierKeyMap = NULL; + pDev->key->maxKeysPerModifier = 0; + } + } + } + + rep->success = Success; + return Success; +} + +int +ProcSetModifierMapping(ClientPtr client) +{ + xSetModifierMappingReply rep; + DeviceIntPtr dev; + int rc; + REQUEST(xSetModifierMappingReq); + REQUEST_AT_LEAST_SIZE(xSetModifierMappingReq); + + if (client->req_len != ((stuff->numKeyPerModifier << 1) + + (sizeof (xSetModifierMappingReq) >> 2))) + return BadLength; + + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + + rc = DoSetModifierMapping(client, (KeyCode *)&stuff[1], + stuff->numKeyPerModifier, &rep); + if (rc != Success) + return rc; + + SendMappingNotify(MappingModifier, 0, 0, client); + for (dev = inputInfo.devices; dev; dev = dev->next) + if (dev->key && dev->coreEvents) + SendDeviceMappingNotify(client, MappingModifier, 0, 0, dev); + WriteReplyToClient(client, sizeof(xSetModifierMappingReply), &rep); + return client->noClientException; +} + +int +ProcGetModifierMapping(ClientPtr client) +{ + xGetModifierMappingReply rep; + KeyClassPtr keyc = inputInfo.keyboard->key; + int rc; + REQUEST_SIZE_MATCH(xReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.keyboard, + DixGetAttrAccess); + if (rc != Success) + return rc; + + rep.type = X_Reply; + rep.numKeyPerModifier = keyc->maxKeysPerModifier; + rep.sequenceNumber = client->sequence; + /* length counts 4 byte quantities - there are 8 modifiers 1 byte big */ + rep.length = keyc->maxKeysPerModifier << 1; + + WriteReplyToClient(client, sizeof(xGetModifierMappingReply), &rep); + + /* Use the (modified by DDX) map that SetModifierMapping passed in */ + (void)WriteToClient(client, (int)(keyc->maxKeysPerModifier << 3), + (char *)keyc->modifierKeyMap); + return client->noClientException; +} + +int +ProcChangeKeyboardMapping(ClientPtr client) +{ + REQUEST(xChangeKeyboardMappingReq); + unsigned len; + KeySymsRec keysyms; + KeySymsPtr curKeySyms = &inputInfo.keyboard->key->curKeySyms; + DeviceIntPtr pDev = NULL; + int rc; + REQUEST_AT_LEAST_SIZE(xChangeKeyboardMappingReq); + + len = client->req_len - (sizeof(xChangeKeyboardMappingReq) >> 2); + if (len != (stuff->keyCodes * stuff->keySymsPerKeyCode)) + return BadLength; + + if ((stuff->firstKeyCode < curKeySyms->minKeyCode) || + (stuff->firstKeyCode > curKeySyms->maxKeyCode)) { + client->errorValue = stuff->firstKeyCode; + return BadValue; + + } + if (((unsigned)(stuff->firstKeyCode + stuff->keyCodes - 1) > + curKeySyms->maxKeyCode) || (stuff->keySymsPerKeyCode == 0)) { + client->errorValue = stuff->keySymsPerKeyCode; + return BadValue; + } + + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) { + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && pDev->key) { + rc = XaceHook(XACE_DEVICE_ACCESS, client, pDev, DixManageAccess); + if (rc != Success) + return rc; + } + } + + keysyms.minKeyCode = stuff->firstKeyCode; + keysyms.maxKeyCode = stuff->firstKeyCode + stuff->keyCodes - 1; + keysyms.mapWidth = stuff->keySymsPerKeyCode; + keysyms.map = (KeySym *)&stuff[1]; + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && pDev->key) + if (!SetKeySymsMap(&pDev->key->curKeySyms, &keysyms)) + return BadAlloc; + + SendMappingNotify(MappingKeyboard, stuff->firstKeyCode, stuff->keyCodes, + client); + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) + if (pDev->key && pDev->coreEvents) + SendDeviceMappingNotify(client, MappingKeyboard, + stuff->firstKeyCode, stuff->keyCodes, + pDev); + + return client->noClientException; +} + +static int +DoSetPointerMapping(ClientPtr client, DeviceIntPtr device, BYTE *map, int n) +{ + int rc, i = 0; + DeviceIntPtr dev = NULL; + + if (!device || !device->button) + return BadDevice; + + for (dev = inputInfo.devices; dev; dev = dev->next) { + if ((dev->coreEvents || dev == inputInfo.pointer) && dev->button) { + rc = XaceHook(XACE_DEVICE_ACCESS, client, dev, DixManageAccess); + if (rc != Success) + return rc; + } + } + + for (dev = inputInfo.devices; dev; dev = dev->next) { + if ((dev->coreEvents || dev == inputInfo.pointer) && dev->button) { + for (i = 0; i < n; i++) { + if ((device->button->map[i + 1] != map[i]) && + BitIsOn(device->button->down, i + 1)) { + return MappingBusy; + } + } + } + } + + for (dev = inputInfo.devices; dev; dev = dev->next) { + if ((dev->coreEvents || dev == inputInfo.pointer) && dev->button) { + for (i = 0; i < n; i++) + dev->button->map[i + 1] = map[i]; + } + } + + return Success; +} + +int +ProcSetPointerMapping(ClientPtr client) +{ + BYTE *map; + int ret; + xSetPointerMappingReply rep; + REQUEST(xSetPointerMappingReq); + REQUEST_AT_LEAST_SIZE(xSetPointerMappingReq); + + if (client->req_len != (sizeof(xSetPointerMappingReq)+stuff->nElts+3) >> 2) + return BadLength; + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + rep.success = MappingSuccess; + map = (BYTE *)&stuff[1]; + + /* So we're bounded here by the number of core buttons. This check + * probably wants disabling through XFixes. */ + if (stuff->nElts != inputInfo.pointer->button->numButtons) { + client->errorValue = stuff->nElts; + return BadValue; + } + if (BadDeviceMap(&map[0], (int)stuff->nElts, 1, 255, &client->errorValue)) + return BadValue; + + ret = DoSetPointerMapping(client, inputInfo.pointer, map, stuff->nElts); + if (ret != Success) { + rep.success = ret; + WriteReplyToClient(client, sizeof(xSetPointerMappingReply), &rep); + return Success; + } + + /* FIXME: Send mapping notifies for all the extended devices as well. */ + SendMappingNotify(MappingPointer, 0, 0, client); + WriteReplyToClient(client, sizeof(xSetPointerMappingReply), &rep); + return Success; +} + +int +ProcGetKeyboardMapping(ClientPtr client) +{ + xGetKeyboardMappingReply rep; + KeySymsPtr curKeySyms = &inputInfo.keyboard->key->curKeySyms; + int rc; + REQUEST(xGetKeyboardMappingReq); + REQUEST_SIZE_MATCH(xGetKeyboardMappingReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.keyboard, + DixGetAttrAccess); + if (rc != Success) + return rc; + + if ((stuff->firstKeyCode < curKeySyms->minKeyCode) || + (stuff->firstKeyCode > curKeySyms->maxKeyCode)) { + client->errorValue = stuff->firstKeyCode; + return BadValue; + } + if (stuff->firstKeyCode + stuff->count > + (unsigned)(curKeySyms->maxKeyCode + 1)) { + client->errorValue = stuff->count; + return BadValue; + } + + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.keySymsPerKeyCode = curKeySyms->mapWidth; + /* length is a count of 4 byte quantities and KeySyms are 4 bytes */ + rep.length = (curKeySyms->mapWidth * stuff->count); + WriteReplyToClient(client, sizeof(xGetKeyboardMappingReply), &rep); + client->pSwapReplyFunc = (ReplySwapPtr) CopySwap32Write; + WriteSwappedDataToClient( + client, + curKeySyms->mapWidth * stuff->count * sizeof(KeySym), + &curKeySyms->map[(stuff->firstKeyCode - curKeySyms->minKeyCode) * + curKeySyms->mapWidth]); + + return client->noClientException; +} + +int +ProcGetPointerMapping(ClientPtr client) +{ + xGetPointerMappingReply rep; + ButtonClassPtr butc = inputInfo.pointer->button; + int rc; + REQUEST_SIZE_MATCH(xReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.pointer, + DixGetAttrAccess); + if (rc != Success) + return rc; + + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.nElts = butc->numButtons; + rep.length = ((unsigned)rep.nElts + (4-1))/4; + WriteReplyToClient(client, sizeof(xGetPointerMappingReply), &rep); + (void)WriteToClient(client, (int)rep.nElts, (char *)&butc->map[1]); + return Success; +} + +void +NoteLedState(DeviceIntPtr keybd, int led, Bool on) +{ + KeybdCtrl *ctrl = &keybd->kbdfeed->ctrl; + if (on) + ctrl->leds |= ((Leds)1 << (led - 1)); + else + ctrl->leds &= ~((Leds)1 << (led - 1)); +} + +_X_EXPORT int +Ones(unsigned long mask) /* HACKMEM 169 */ +{ + unsigned long y; + + y = (mask >> 1) &033333333333; + y = mask - y - ((y >>1) & 033333333333); + return (((y + (y >> 3)) & 030707070707) % 077); +} + +static int +DoChangeKeyboardControl (ClientPtr client, DeviceIntPtr keybd, XID *vlist, + BITS32 vmask) +{ +#define DO_ALL (-1) + KeybdCtrl ctrl; + int t; + int led = DO_ALL; + int key = DO_ALL; + BITS32 index2; + int mask = vmask, i; + + ctrl = keybd->kbdfeed->ctrl; + while (vmask) { + index2 = (BITS32) lowbit (vmask); + vmask &= ~index2; + switch (index2) { + case KBKeyClickPercent: + t = (INT8)*vlist; + vlist++; + if (t == -1) { + t = defaultKeyboardControl.click; + } + else if (t < 0 || t > 100) { + client->errorValue = t; + return BadValue; + } + ctrl.click = t; + break; + case KBBellPercent: + t = (INT8)*vlist; + vlist++; + if (t == -1) { + t = defaultKeyboardControl.bell; + } + else if (t < 0 || t > 100) { + client->errorValue = t; + return BadValue; + } + ctrl.bell = t; + break; + case KBBellPitch: + t = (INT16)*vlist; + vlist++; + if (t == -1) { + t = defaultKeyboardControl.bell_pitch; + } + else if (t < 0) { + client->errorValue = t; + return BadValue; + } + ctrl.bell_pitch = t; + break; + case KBBellDuration: + t = (INT16)*vlist; + vlist++; + if (t == -1) + t = defaultKeyboardControl.bell_duration; + else if (t < 0) { + client->errorValue = t; + return BadValue; + } + ctrl.bell_duration = t; + break; + case KBLed: + led = (CARD8)*vlist; + vlist++; + if (led < 1 || led > 32) { + client->errorValue = led; + return BadValue; + } + if (!(mask & KBLedMode)) + return BadMatch; + break; + case KBLedMode: + t = (CARD8)*vlist; + vlist++; + if (t == LedModeOff) { + if (led == DO_ALL) + ctrl.leds = 0x0; + else + ctrl.leds &= ~(((Leds)(1)) << (led - 1)); + } + else if (t == LedModeOn) { + if (led == DO_ALL) + ctrl.leds = ~0L; + else + ctrl.leds |= (((Leds)(1)) << (led - 1)); + } + else { + client->errorValue = t; + return BadValue; + } +#ifdef XKB + if (!noXkbExtension) { + XkbEventCauseRec cause; + XkbSetCauseCoreReq(&cause,X_ChangeKeyboardControl,client); + XkbSetIndicators(keybd,((led == DO_ALL) ? ~0L : (1L<<(led-1))), + ctrl.leds, &cause); + ctrl.leds = keybd->kbdfeed->ctrl.leds; + } +#endif + break; + case KBKey: + key = (KeyCode)*vlist; + vlist++; + if ((KeyCode)key < inputInfo.keyboard->key->curKeySyms.minKeyCode || + (KeyCode)key > inputInfo.keyboard->key->curKeySyms.maxKeyCode) { + client->errorValue = key; + return BadValue; + } + if (!(mask & KBAutoRepeatMode)) + return BadMatch; + break; + case KBAutoRepeatMode: + i = (key >> 3); + mask = (1 << (key & 7)); + t = (CARD8)*vlist; + vlist++; +#ifdef XKB + if (!noXkbExtension && key != DO_ALL) + XkbDisableComputedAutoRepeats(keybd,key); +#endif + if (t == AutoRepeatModeOff) { + if (key == DO_ALL) + ctrl.autoRepeat = FALSE; + else + ctrl.autoRepeats[i] &= ~mask; + } + else if (t == AutoRepeatModeOn) { + if (key == DO_ALL) + ctrl.autoRepeat = TRUE; + else + ctrl.autoRepeats[i] |= mask; + } + else if (t == AutoRepeatModeDefault) { + if (key == DO_ALL) + ctrl.autoRepeat = defaultKeyboardControl.autoRepeat; + else + ctrl.autoRepeats[i] = + (ctrl.autoRepeats[i] & ~mask) | + (defaultKeyboardControl.autoRepeats[i] & mask); + } + else { + client->errorValue = t; + return BadValue; + } + break; + default: + client->errorValue = mask; + return BadValue; + } + } + keybd->kbdfeed->ctrl = ctrl; + +#ifdef XKB + /* The XKB RepeatKeys control and core protocol global autorepeat */ + /* value are linked */ + if (!noXkbExtension) + XkbSetRepeatKeys(keybd, key, keybd->kbdfeed->ctrl.autoRepeat); + else +#endif + (*keybd->kbdfeed->CtrlProc)(keybd, &keybd->kbdfeed->ctrl); + + return Success; + +#undef DO_ALL +} + +int +ProcChangeKeyboardControl (ClientPtr client) +{ + XID *vlist; + BITS32 vmask; + int ret = Success, error = Success; + DeviceIntPtr pDev = NULL; + REQUEST(xChangeKeyboardControlReq); + + REQUEST_AT_LEAST_SIZE(xChangeKeyboardControlReq); + + vmask = stuff->mask; + vlist = (XID *)&stuff[1]; + + if (client->req_len != (sizeof(xChangeKeyboardControlReq)>>2)+Ones(vmask)) + return BadLength; + + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) { + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && + pDev->kbdfeed && pDev->kbdfeed->CtrlProc) { + ret = XaceHook(XACE_DEVICE_ACCESS, client, pDev, DixManageAccess); + if (ret != Success) + return ret; + } + } + + for (pDev = inputInfo.devices; pDev; pDev = pDev->next) { + if ((pDev->coreEvents || pDev == inputInfo.keyboard) && + pDev->kbdfeed && pDev->kbdfeed->CtrlProc) { + ret = DoChangeKeyboardControl(client, pDev, vlist, vmask); + if (ret != Success) + error = ret; + } + } + + return error; +} + +int +ProcGetKeyboardControl (ClientPtr client) +{ + int rc, i; + KeybdCtrl *ctrl = &inputInfo.keyboard->kbdfeed->ctrl; + xGetKeyboardControlReply rep; + REQUEST_SIZE_MATCH(xReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.keyboard, + DixGetAttrAccess); + if (rc != Success) + return rc; + + rep.type = X_Reply; + rep.length = 5; + rep.sequenceNumber = client->sequence; + rep.globalAutoRepeat = ctrl->autoRepeat; + rep.keyClickPercent = ctrl->click; + rep.bellPercent = ctrl->bell; + rep.bellPitch = ctrl->bell_pitch; + rep.bellDuration = ctrl->bell_duration; + rep.ledMask = ctrl->leds; + for (i = 0; i < 32; i++) + rep.map[i] = ctrl->autoRepeats[i]; + WriteReplyToClient(client, sizeof(xGetKeyboardControlReply), &rep); + return Success; +} + +int +ProcBell(ClientPtr client) +{ + DeviceIntPtr keybd = inputInfo.keyboard; + int base = keybd->kbdfeed->ctrl.bell; + int newpercent; + int rc; + REQUEST(xBellReq); + REQUEST_SIZE_MATCH(xBellReq); + + if (!keybd->kbdfeed->BellProc) + return BadDevice; + + if (stuff->percent < -100 || stuff->percent > 100) { + client->errorValue = stuff->percent; + return BadValue; + } + + newpercent = (base * stuff->percent) / 100; + if (stuff->percent < 0) + newpercent = base + newpercent; + else + newpercent = base - newpercent + stuff->percent; + + for (keybd = inputInfo.devices; keybd; keybd = keybd->next) { + if ((keybd->coreEvents || keybd == inputInfo.keyboard) && + keybd->kbdfeed && keybd->kbdfeed->BellProc) { + + rc = XaceHook(XACE_DEVICE_ACCESS, client, keybd, DixBellAccess); + if (rc != Success) + return rc; +#ifdef XKB + if (!noXkbExtension) + XkbHandleBell(FALSE, FALSE, keybd, newpercent, + &keybd->kbdfeed->ctrl, 0, None, NULL, client); + else +#endif + (*keybd->kbdfeed->BellProc)(newpercent, keybd, + &keybd->kbdfeed->ctrl, 0); + } + } + + return Success; +} + +int +ProcChangePointerControl(ClientPtr client) +{ + DeviceIntPtr mouse = inputInfo.pointer; + PtrCtrl ctrl; /* might get BadValue part way through */ + int rc; + REQUEST(xChangePointerControlReq); + REQUEST_SIZE_MATCH(xChangePointerControlReq); + + if (!mouse->ptrfeed->CtrlProc) + return BadDevice; + + ctrl = mouse->ptrfeed->ctrl; + if ((stuff->doAccel != xTrue) && (stuff->doAccel != xFalse)) { + client->errorValue = stuff->doAccel; + return(BadValue); + } + if ((stuff->doThresh != xTrue) && (stuff->doThresh != xFalse)) { + client->errorValue = stuff->doThresh; + return(BadValue); + } + if (stuff->doAccel) { + if (stuff->accelNum == -1) { + ctrl.num = defaultPointerControl.num; + } + else if (stuff->accelNum < 0) { + client->errorValue = stuff->accelNum; + return BadValue; + } + else { + ctrl.num = stuff->accelNum; + } + + if (stuff->accelDenum == -1) { + ctrl.den = defaultPointerControl.den; + } + else if (stuff->accelDenum <= 0) { + client->errorValue = stuff->accelDenum; + return BadValue; + } + else { + ctrl.den = stuff->accelDenum; + } + } + if (stuff->doThresh) { + if (stuff->threshold == -1) { + ctrl.threshold = defaultPointerControl.threshold; + } + else if (stuff->threshold < 0) { + client->errorValue = stuff->threshold; + return BadValue; + } + else { + ctrl.threshold = stuff->threshold; + } + } + + for (mouse = inputInfo.devices; mouse; mouse = mouse->next) { + if ((mouse->coreEvents || mouse == inputInfo.pointer) && + mouse->ptrfeed && mouse->ptrfeed->CtrlProc) { + rc = XaceHook(XACE_DEVICE_ACCESS, client, mouse, DixManageAccess); + if (rc != Success) + return rc; + } + } + + for (mouse = inputInfo.devices; mouse; mouse = mouse->next) { + if ((mouse->coreEvents || mouse == inputInfo.pointer) && + mouse->ptrfeed && mouse->ptrfeed->CtrlProc) { + mouse->ptrfeed->ctrl = ctrl; + (*mouse->ptrfeed->CtrlProc)(mouse, &mouse->ptrfeed->ctrl); + } + } + + return Success; +} + +int +ProcGetPointerControl(ClientPtr client) +{ + PtrCtrl *ctrl = &inputInfo.pointer->ptrfeed->ctrl; + xGetPointerControlReply rep; + int rc; + REQUEST_SIZE_MATCH(xReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.pointer, + DixGetAttrAccess); + if (rc != Success) + return rc; + + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + rep.threshold = ctrl->threshold; + rep.accelNumerator = ctrl->num; + rep.accelDenominator = ctrl->den; + WriteReplyToClient(client, sizeof(xGenericReply), &rep); + return Success; +} + +void +MaybeStopHint(DeviceIntPtr dev, ClientPtr client) +{ + GrabPtr grab = dev->grab; + + if ((grab && SameClient(grab, client) && + ((grab->eventMask & PointerMotionHintMask) || + (grab->ownerEvents && + (EventMaskForClient(dev->valuator->motionHintWindow, client) & + PointerMotionHintMask)))) || + (!grab && + (EventMaskForClient(dev->valuator->motionHintWindow, client) & + PointerMotionHintMask))) + dev->valuator->motionHintWindow = NullWindow; +} + +int +ProcGetMotionEvents(ClientPtr client) +{ + WindowPtr pWin; + xTimecoord * coords = (xTimecoord *) NULL; + xGetMotionEventsReply rep; + int i, count, xmin, xmax, ymin, ymax, rc; + unsigned long nEvents; + DeviceIntPtr mouse = inputInfo.pointer; + TimeStamp start, stop; + REQUEST(xGetMotionEventsReq); + REQUEST_SIZE_MATCH(xGetMotionEventsReq); + + rc = dixLookupWindow(&pWin, stuff->window, client, DixGetAttrAccess); + if (rc != Success) + return rc; + rc = XaceHook(XACE_DEVICE_ACCESS, client, mouse, DixReadAccess); + if (rc != Success) + return rc; + + if (mouse->valuator->motionHintWindow) + MaybeStopHint(mouse, client); + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + nEvents = 0; + start = ClientTimeToServerTime(stuff->start); + stop = ClientTimeToServerTime(stuff->stop); + if ((CompareTimeStamps(start, stop) != LATER) && + (CompareTimeStamps(start, currentTime) != LATER) && + mouse->valuator->numMotionEvents) + { + if (CompareTimeStamps(stop, currentTime) == LATER) + stop = currentTime; + coords = (xTimecoord *)xalloc(mouse->valuator->numMotionEvents + * sizeof(xTimecoord)); + if (!coords) + return BadAlloc; + count = (*mouse->valuator->GetMotionProc) (mouse, coords, + start.milliseconds, + stop.milliseconds, + pWin->drawable.pScreen); + xmin = pWin->drawable.x - wBorderWidth (pWin); + xmax = pWin->drawable.x + (int)pWin->drawable.width + + wBorderWidth (pWin); + ymin = pWin->drawable.y - wBorderWidth (pWin); + ymax = pWin->drawable.y + (int)pWin->drawable.height + + wBorderWidth (pWin); + for (i = 0; i < count; i++) + if ((xmin <= coords[i].x) && (coords[i].x < xmax) && + (ymin <= coords[i].y) && (coords[i].y < ymax)) + { + coords[nEvents].time = coords[i].time; + coords[nEvents].x = coords[i].x - pWin->drawable.x; + coords[nEvents].y = coords[i].y - pWin->drawable.y; + nEvents++; + } + } + rep.length = nEvents * (sizeof(xTimecoord) >> 2); + rep.nEvents = nEvents; + WriteReplyToClient(client, sizeof(xGetMotionEventsReply), &rep); + if (nEvents) + { + client->pSwapReplyFunc = (ReplySwapPtr) SwapTimeCoordWrite; + WriteSwappedDataToClient(client, nEvents * sizeof(xTimecoord), + (char *)coords); + } + if (coords) + xfree(coords); + return Success; +} + +int +ProcQueryKeymap(ClientPtr client) +{ + xQueryKeymapReply rep; + int rc, i; + CARD8 *down = inputInfo.keyboard->key->down; + + REQUEST_SIZE_MATCH(xReq); + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.length = 2; + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.keyboard, + DixReadAccess); + if (rc != Success) + return rc; + + for (i = 0; i<32; i++) + rep.map[i] = down[i]; + + WriteReplyToClient(client, sizeof(xQueryKeymapReply), &rep); + return Success; +} diff --git a/xorg-server/dix/dispatch.c b/xorg-server/dix/dispatch.c new file mode 100644 index 000000000..b91385596 --- /dev/null +++ b/xorg-server/dix/dispatch.c @@ -0,0 +1,3761 @@ +/************************************************************ + +Copyright 1987, 1989, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987, 1989 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + +/* The panoramix components contained the following notice */ +/***************************************************************** + +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ + +/* XSERVER_DTRACE additions: + * Copyright 2005-2006 Sun Microsystems, Inc. All rights reserved. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, and/or sell copies of the Software, and to permit persons + * to whom the Software is furnished to do so, provided that the above + * copyright notice(s) and this permission notice appear in all copies of + * the Software and that both the above copyright notice(s) and this + * permission notice appear in supporting documentation. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS + * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT + * OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR + * HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL + * INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING + * FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, + * NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION + * WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + * + * Except as contained in this notice, the name of a copyright holder + * shall not be used in advertising or otherwise to promote the sale, use + * or other dealings in this Software without prior written authorization + * of the copyright holder. + */ + + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#ifdef PANORAMIX_DEBUG +#include +int ProcInitialConnection(); +#endif + +#include "windowstr.h" +#include +#include "dixfontstr.h" +#include "gcstruct.h" +#include "selection.h" +#include "colormapst.h" +#include "cursorstr.h" +#include "scrnintstr.h" +#include "opaque.h" +#include "input.h" +#include "servermd.h" +#include "extnsionst.h" +#include "dixfont.h" +#include "dispatch.h" +#include "swaprep.h" +#include "swapreq.h" +#ifdef PANORAMIX +#include "panoramiX.h" +#include "panoramiXsrv.h" +#endif +#include "privates.h" +#include "xace.h" +#ifdef XAPPGROUP +#include "appgroup.h" +#endif +#ifdef XKB +#ifndef XKB_IN_SERVER +#define XKB_IN_SERVER +#endif +#include "inputstr.h" +#include +#endif + +#ifdef XSERVER_DTRACE +#include "registry.h" +#include +typedef const char *string; +#include "Xserver-dtrace.h" +#endif + +#define mskcnt ((MAXCLIENTS + 31) / 32) +#define BITMASK(i) (1U << ((i) & 31)) +#define MASKIDX(i) ((i) >> 5) +#define MASKWORD(buf, i) buf[MASKIDX(i)] +#define BITSET(buf, i) MASKWORD(buf, i) |= BITMASK(i) +#define BITCLEAR(buf, i) MASKWORD(buf, i) &= ~BITMASK(i) +#define GETBIT(buf, i) (MASKWORD(buf, i) & BITMASK(i)) + +extern xConnSetupPrefix connSetupPrefix; +extern char *ConnectionInfo; + +static ClientPtr grabClient; +#define GrabNone 0 +#define GrabActive 1 +#define GrabKickout 2 +static int grabState = GrabNone; +static long grabWaiters[mskcnt]; +_X_EXPORT CallbackListPtr ServerGrabCallback = NULL; +HWEventQueuePtr checkForInput[2]; +extern int connBlockScreenStart; + +static void KillAllClients(void); + +static int nextFreeClientID; /* always MIN free client ID */ + +static int nClients; /* number of authorized clients */ + +_X_EXPORT CallbackListPtr ClientStateCallback; + +/* dispatchException & isItTimeToYield must be declared volatile since they + * are modified by signal handlers - otherwise optimizer may assume it doesn't + * need to actually check value in memory when used and may miss changes from + * signal handlers. + */ +_X_EXPORT volatile char dispatchException = 0; +_X_EXPORT volatile char isItTimeToYield; + +/* Various of the DIX function interfaces were not designed to allow + * the client->errorValue to be set on BadValue and other errors. + * Rather than changing interfaces and breaking untold code we introduce + * a new global that dispatch can use. + */ +XID clientErrorValue; /* XXX this is a kludge */ + +#define SAME_SCREENS(a, b) (\ + (a.pScreen == b.pScreen)) + +_X_EXPORT void +SetInputCheck(HWEventQueuePtr c0, HWEventQueuePtr c1) +{ + checkForInput[0] = c0; + checkForInput[1] = c1; +} + +_X_EXPORT void +UpdateCurrentTime(void) +{ + TimeStamp systime; + + /* To avoid time running backwards, we must call GetTimeInMillis before + * calling ProcessInputEvents. + */ + systime.months = currentTime.months; + systime.milliseconds = GetTimeInMillis(); + if (systime.milliseconds < currentTime.milliseconds) + systime.months++; + if (*checkForInput[0] != *checkForInput[1]) + ProcessInputEvents(); + if (CompareTimeStamps(systime, currentTime) == LATER) + currentTime = systime; +} + +/* Like UpdateCurrentTime, but can't call ProcessInputEvents */ +_X_EXPORT void +UpdateCurrentTimeIf(void) +{ + TimeStamp systime; + + systime.months = currentTime.months; + systime.milliseconds = GetTimeInMillis(); + if (systime.milliseconds < currentTime.milliseconds) + systime.months++; + if (*checkForInput[0] == *checkForInput[1]) + currentTime = systime; +} + +#ifdef SMART_SCHEDULE + +#undef SMART_DEBUG + +#define SMART_SCHEDULE_DEFAULT_INTERVAL 20 /* ms */ +#define SMART_SCHEDULE_MAX_SLICE 200 /* ms */ + +Bool SmartScheduleDisable = FALSE; +long SmartScheduleSlice = SMART_SCHEDULE_DEFAULT_INTERVAL; +long SmartScheduleInterval = SMART_SCHEDULE_DEFAULT_INTERVAL; +long SmartScheduleMaxSlice = SMART_SCHEDULE_MAX_SLICE; +long SmartScheduleTime; +static ClientPtr SmartLastClient; +static int SmartLastIndex[SMART_MAX_PRIORITY-SMART_MIN_PRIORITY+1]; + +#ifdef SMART_DEBUG +long SmartLastPrint; +#endif + +void Dispatch(void); +void InitProcVectors(void); + +static int +SmartScheduleClient (int *clientReady, int nready) +{ + ClientPtr pClient; + int i; + int client; + int bestPrio, best = 0; + int bestRobin, robin; + long now = SmartScheduleTime; + long idle; + + bestPrio = -0x7fffffff; + bestRobin = 0; + idle = 2 * SmartScheduleSlice; + for (i = 0; i < nready; i++) + { + client = clientReady[i]; + pClient = clients[client]; + /* Praise clients which are idle */ + if ((now - pClient->smart_check_tick) >= idle) + { + if (pClient->smart_priority < 0) + pClient->smart_priority++; + } + pClient->smart_check_tick = now; + + /* check priority to select best client */ + robin = (pClient->index - SmartLastIndex[pClient->smart_priority-SMART_MIN_PRIORITY]) & 0xff; + if (pClient->smart_priority > bestPrio || + (pClient->smart_priority == bestPrio && robin > bestRobin)) + { + bestPrio = pClient->smart_priority; + bestRobin = robin; + best = client; + } +#ifdef SMART_DEBUG + if ((now - SmartLastPrint) >= 5000) + fprintf (stderr, " %2d: %3d", client, pClient->smart_priority); +#endif + } +#ifdef SMART_DEBUG + if ((now - SmartLastPrint) >= 5000) + { + fprintf (stderr, " use %2d\n", best); + SmartLastPrint = now; + } +#endif + pClient = clients[best]; + SmartLastIndex[bestPrio-SMART_MIN_PRIORITY] = pClient->index; + /* + * Set current client pointer + */ + if (SmartLastClient != pClient) + { + pClient->smart_start_tick = now; + SmartLastClient = pClient; + } + /* + * Adjust slice + */ + if (nready == 1) + { + /* + * If it's been a long time since another client + * has run, bump the slice up to get maximal + * performance from a single client + */ + if ((now - pClient->smart_start_tick) > 1000 && + SmartScheduleSlice < SmartScheduleMaxSlice) + { + SmartScheduleSlice += SmartScheduleInterval; + } + } + else + { + SmartScheduleSlice = SmartScheduleInterval; + } + return best; +} +#endif + +#define MAJOROP ((xReq *)client->requestBuffer)->reqType + +void +Dispatch(void) +{ + int *clientReady; /* array of request ready clients */ + int result; + ClientPtr client; + int nready; + HWEventQueuePtr* icheck = checkForInput; +#ifdef SMART_SCHEDULE + long start_tick; +#endif + + nextFreeClientID = 1; + nClients = 0; + + clientReady = (int *) xalloc(sizeof(int) * MaxClients); + if (!clientReady) + return; + + while (!dispatchException) + { + if (*icheck[0] != *icheck[1]) + { + ProcessInputEvents(); + FlushIfCriticalOutputPending(); + } + + nready = WaitForSomething(clientReady); + +#ifdef SMART_SCHEDULE + if (nready && !SmartScheduleDisable) + { + clientReady[0] = SmartScheduleClient (clientReady, nready); + nready = 1; + } +#endif + /***************** + * Handle events in round robin fashion, doing input between + * each round + *****************/ + + while (!dispatchException && (--nready >= 0)) + { + client = clients[clientReady[nready]]; + if (! client) + { + /* KillClient can cause this to happen */ + continue; + } + /* GrabServer activation can cause this to be true */ + if (grabState == GrabKickout) + { + grabState = GrabActive; + break; + } + isItTimeToYield = FALSE; + +#ifdef XPRINT + requestingClient = client; +#endif +#ifdef SMART_SCHEDULE + start_tick = SmartScheduleTime; +#endif + while (!isItTimeToYield) + { + if (*icheck[0] != *icheck[1]) + ProcessInputEvents(); + + FlushIfCriticalOutputPending(); +#ifdef SMART_SCHEDULE + if (!SmartScheduleDisable && + (SmartScheduleTime - start_tick) >= SmartScheduleSlice) + { + /* Penalize clients which consume ticks */ + if (client->smart_priority > SMART_MIN_PRIORITY) + client->smart_priority--; + break; + } +#endif + /* now, finally, deal with client requests */ + + result = ReadRequestFromClient(client); + if (result <= 0) + { + if (result < 0) + CloseDownClient(client); + break; + } + + client->sequence++; +#ifdef DEBUG + if (client->requestLogIndex == MAX_REQUEST_LOG) + client->requestLogIndex = 0; + client->requestLog[client->requestLogIndex] = MAJOROP; + client->requestLogIndex++; +#endif +#ifdef XSERVER_DTRACE + XSERVER_REQUEST_START(LookupMajorName(MAJOROP), MAJOROP, + ((xReq *)client->requestBuffer)->length, + client->index, client->requestBuffer); +#endif + if (result > (maxBigRequestSize << 2)) + result = BadLength; + else { + result = XaceHookDispatch(client, MAJOROP); + if (result == Success) + result = (* client->requestVector[MAJOROP])(client); + XaceHookAuditEnd(client, result); + } +#ifdef XSERVER_DTRACE + XSERVER_REQUEST_DONE(LookupMajorName(MAJOROP), MAJOROP, + client->sequence, client->index, result); +#endif + + if (result != Success) + { + if (client->noClientException != Success) + CloseDownClient(client); + else + SendErrorToClient(client, MAJOROP, + MinorOpcodeOfRequest(client), + client->errorValue, result); + break; + } + } + FlushAllOutput(); +#ifdef SMART_SCHEDULE + client = clients[clientReady[nready]]; + if (client) + client->smart_stop_tick = SmartScheduleTime; +#endif +#ifdef XPRINT + requestingClient = NULL; +#endif + } + dispatchException &= ~DE_PRIORITYCHANGE; + } +#if defined(DDXBEFORERESET) + ddxBeforeReset (); +#endif + KillAllClients(); + xfree(clientReady); + dispatchException &= ~DE_RESET; +} + +#undef MAJOROP + +_X_EXPORT int +ProcBadRequest(ClientPtr client) +{ + return (BadRequest); +} + +int +ProcCreateWindow(ClientPtr client) +{ + WindowPtr pParent, pWin; + REQUEST(xCreateWindowReq); + int len, rc; + + REQUEST_AT_LEAST_SIZE(xCreateWindowReq); + + LEGAL_NEW_RESOURCE(stuff->wid, client); + rc = dixLookupWindow(&pParent, stuff->parent, client, DixAddAccess); + if (rc != Success) + return rc; + len = client->req_len - (sizeof(xCreateWindowReq) >> 2); + if (Ones(stuff->mask) != len) + return BadLength; + if (!stuff->width || !stuff->height) + { + client->errorValue = 0; + return BadValue; + } + pWin = CreateWindow(stuff->wid, pParent, stuff->x, + stuff->y, stuff->width, stuff->height, + stuff->borderWidth, stuff->class, + stuff->mask, (XID *) &stuff[1], + (int)stuff->depth, + client, stuff->visual, &rc); + if (pWin) + { + Mask mask = pWin->eventMask; + + pWin->eventMask = 0; /* subterfuge in case AddResource fails */ + if (!AddResource(stuff->wid, RT_WINDOW, (pointer)pWin)) + return BadAlloc; + pWin->eventMask = mask; + } + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; +} + +int +ProcChangeWindowAttributes(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xChangeWindowAttributesReq); + int result, len, rc; + Mask access_mode = 0; + + REQUEST_AT_LEAST_SIZE(xChangeWindowAttributesReq); + access_mode |= (stuff->valueMask & CWEventMask) ? DixReceiveAccess : 0; + access_mode |= (stuff->valueMask & ~CWEventMask) ? DixSetAttrAccess : 0; + rc = dixLookupWindow(&pWin, stuff->window, client, access_mode); + if (rc != Success) + return rc; + len = client->req_len - (sizeof(xChangeWindowAttributesReq) >> 2); + if (len != Ones(stuff->valueMask)) + return BadLength; + result = ChangeWindowAttributes(pWin, + stuff->valueMask, + (XID *) &stuff[1], + client); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); +} + +int +ProcGetWindowAttributes(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + xGetWindowAttributesReply wa; + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixGetAttrAccess); + if (rc != Success) + return rc; + GetWindowAttributes(pWin, client, &wa); + WriteReplyToClient(client, sizeof(xGetWindowAttributesReply), &wa); + return(client->noClientException); +} + +int +ProcDestroyWindow(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixDestroyAccess); + if (rc != Success) + return rc; + if (pWin->parent) { + rc = dixLookupWindow(&pWin, pWin->parent->drawable.id, client, + DixRemoveAccess); + if (rc != Success) + return rc; + FreeResource(stuff->id, RT_NONE); + } + return(client->noClientException); +} + +int +ProcDestroySubwindows(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixRemoveAccess); + if (rc != Success) + return rc; + DestroySubwindows(pWin, client); + return(client->noClientException); +} + +int +ProcChangeSaveSet(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xChangeSaveSetReq); + int result, rc; + + REQUEST_SIZE_MATCH(xChangeSaveSetReq); + rc = dixLookupWindow(&pWin, stuff->window, client, DixManageAccess); + if (rc != Success) + return rc; + if (client->clientAsMask == (CLIENT_BITS(pWin->drawable.id))) + return BadMatch; + if ((stuff->mode == SetModeInsert) || (stuff->mode == SetModeDelete)) + { + result = AlterSaveSetForClient(client, pWin, stuff->mode, FALSE, TRUE); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); + } + else + { + client->errorValue = stuff->mode; + return( BadValue ); + } +} + +int +ProcReparentWindow(ClientPtr client) +{ + WindowPtr pWin, pParent; + REQUEST(xReparentWindowReq); + int result, rc; + + REQUEST_SIZE_MATCH(xReparentWindowReq); + rc = dixLookupWindow(&pWin, stuff->window, client, DixManageAccess); + if (rc != Success) + return rc; + rc = dixLookupWindow(&pParent, stuff->parent, client, DixAddAccess); + if (rc != Success) + return rc; + if (SAME_SCREENS(pWin->drawable, pParent->drawable)) + { + if ((pWin->backgroundState == ParentRelative) && + (pParent->drawable.depth != pWin->drawable.depth)) + return BadMatch; + if ((pWin->drawable.class != InputOnly) && + (pParent->drawable.class == InputOnly)) + return BadMatch; + result = ReparentWindow(pWin, pParent, + (short)stuff->x, (short)stuff->y, client); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); + } + else + return (BadMatch); +} + +int +ProcMapWindow(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixShowAccess); + if (rc != Success) + return rc; + MapWindow(pWin, client); + /* update cache to say it is mapped */ + return(client->noClientException); +} + +int +ProcMapSubwindows(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixListAccess); + if (rc != Success) + return rc; + MapSubwindows(pWin, client); + /* update cache to say it is mapped */ + return(client->noClientException); +} + +int +ProcUnmapWindow(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixHideAccess); + if (rc != Success) + return rc; + UnmapWindow(pWin, FALSE); + /* update cache to say it is mapped */ + return(client->noClientException); +} + +int +ProcUnmapSubwindows(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xResourceReq); + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixListAccess); + if (rc != Success) + return rc; + UnmapSubwindows(pWin); + return(client->noClientException); +} + +int +ProcConfigureWindow(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xConfigureWindowReq); + int result; + int len, rc; + + REQUEST_AT_LEAST_SIZE(xConfigureWindowReq); + rc = dixLookupWindow(&pWin, stuff->window, client, + DixManageAccess|DixSetAttrAccess); + if (rc != Success) + return rc; + len = client->req_len - (sizeof(xConfigureWindowReq) >> 2); + if (Ones((Mask)stuff->mask) != len) + return BadLength; + result = ConfigureWindow(pWin, (Mask)stuff->mask, (XID *) &stuff[1], + client); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); +} + +int +ProcCirculateWindow(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xCirculateWindowReq); + int rc; + + REQUEST_SIZE_MATCH(xCirculateWindowReq); + if ((stuff->direction != RaiseLowest) && + (stuff->direction != LowerHighest)) + { + client->errorValue = stuff->direction; + return BadValue; + } + rc = dixLookupWindow(&pWin, stuff->window, client, DixManageAccess); + if (rc != Success) + return rc; + CirculateWindow(pWin, (int)stuff->direction, client); + return(client->noClientException); +} + +static int +GetGeometry(ClientPtr client, xGetGeometryReply *rep) +{ + DrawablePtr pDraw; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupDrawable(&pDraw, stuff->id, client, M_ANY, DixGetAttrAccess); + if (rc != Success) + return rc; + + rep->type = X_Reply; + rep->length = 0; + rep->sequenceNumber = client->sequence; + rep->root = WindowTable[pDraw->pScreen->myNum]->drawable.id; + rep->depth = pDraw->depth; + rep->width = pDraw->width; + rep->height = pDraw->height; + + /* XXX - Because the pixmap-implementation of the multibuffer extension + * may have the buffer-id's drawable resource value be a pointer + * to the buffer's window instead of the buffer itself + * (this happens if the buffer is the displayed buffer), + * we also have to check that the id matches before we can + * truly say that it is a DRAWABLE_WINDOW. + */ + + if ((pDraw->type == UNDRAWABLE_WINDOW) || + ((pDraw->type == DRAWABLE_WINDOW) && (stuff->id == pDraw->id))) + { + WindowPtr pWin = (WindowPtr)pDraw; + rep->x = pWin->origin.x - wBorderWidth (pWin); + rep->y = pWin->origin.y - wBorderWidth (pWin); + rep->borderWidth = pWin->borderWidth; + } + else /* DRAWABLE_PIXMAP or DRAWABLE_BUFFER */ + { + rep->x = rep->y = rep->borderWidth = 0; + } + + return Success; +} + + +int +ProcGetGeometry(ClientPtr client) +{ + xGetGeometryReply rep; + int status; + + if ((status = GetGeometry(client, &rep)) != Success) + return status; + + WriteReplyToClient(client, sizeof(xGetGeometryReply), &rep); + return(client->noClientException); +} + + +int +ProcQueryTree(ClientPtr client) +{ + xQueryTreeReply reply; + int rc, numChildren = 0; + WindowPtr pChild, pWin, pHead; + Window *childIDs = (Window *)NULL; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixListAccess); + if (rc != Success) + return rc; + reply.type = X_Reply; + reply.root = WindowTable[pWin->drawable.pScreen->myNum]->drawable.id; + reply.sequenceNumber = client->sequence; + if (pWin->parent) + reply.parent = pWin->parent->drawable.id; + else + reply.parent = (Window)None; + pHead = RealChildHead(pWin); + for (pChild = pWin->lastChild; pChild != pHead; pChild = pChild->prevSib) + numChildren++; + if (numChildren) + { + int curChild = 0; + + childIDs = (Window *) xalloc(numChildren * sizeof(Window)); + if (!childIDs) + return BadAlloc; + for (pChild = pWin->lastChild; pChild != pHead; pChild = pChild->prevSib) + childIDs[curChild++] = pChild->drawable.id; + } + + reply.nChildren = numChildren; + reply.length = (numChildren * sizeof(Window)) >> 2; + + WriteReplyToClient(client, sizeof(xQueryTreeReply), &reply); + if (numChildren) + { + client->pSwapReplyFunc = (ReplySwapPtr) Swap32Write; + WriteSwappedDataToClient(client, numChildren * sizeof(Window), childIDs); + xfree(childIDs); + } + + return(client->noClientException); +} + +int +ProcInternAtom(ClientPtr client) +{ + Atom atom; + char *tchar; + REQUEST(xInternAtomReq); + + REQUEST_FIXED_SIZE(xInternAtomReq, stuff->nbytes); + if ((stuff->onlyIfExists != xTrue) && (stuff->onlyIfExists != xFalse)) + { + client->errorValue = stuff->onlyIfExists; + return(BadValue); + } + tchar = (char *) &stuff[1]; + atom = MakeAtom(tchar, stuff->nbytes, !stuff->onlyIfExists); + if (atom != BAD_RESOURCE) + { + xInternAtomReply reply; + reply.type = X_Reply; + reply.length = 0; + reply.sequenceNumber = client->sequence; + reply.atom = atom; + WriteReplyToClient(client, sizeof(xInternAtomReply), &reply); + return(client->noClientException); + } + else + return (BadAlloc); +} + +int +ProcGetAtomName(ClientPtr client) +{ + char *str; + xGetAtomNameReply reply; + int len; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + if ( (str = NameForAtom(stuff->id)) ) + { + len = strlen(str); + reply.type = X_Reply; + reply.length = (len + 3) >> 2; + reply.sequenceNumber = client->sequence; + reply.nameLength = len; + WriteReplyToClient(client, sizeof(xGetAtomNameReply), &reply); + (void)WriteToClient(client, len, str); + return(client->noClientException); + } + else + { + client->errorValue = stuff->id; + return (BadAtom); + } +} + +int +ProcGrabServer(ClientPtr client) +{ + int rc; + REQUEST_SIZE_MATCH(xReq); + if (grabState != GrabNone && client != grabClient) + { + ResetCurrentRequest(client); + client->sequence--; + BITSET(grabWaiters, client->index); + IgnoreClient(client); + return(client->noClientException); + } + rc = OnlyListenToOneClient(client); + if (rc != Success) + return rc; + grabState = GrabKickout; + grabClient = client; + + if (ServerGrabCallback) + { + ServerGrabInfoRec grabinfo; + grabinfo.client = client; + grabinfo.grabstate = SERVER_GRABBED; + CallCallbacks(&ServerGrabCallback, (pointer)&grabinfo); + } + + return(client->noClientException); +} + +static void +UngrabServer(ClientPtr client) +{ + int i; + + grabState = GrabNone; + ListenToAllClients(); + for (i = mskcnt; --i >= 0 && !grabWaiters[i]; ) + ; + if (i >= 0) + { + i <<= 5; + while (!GETBIT(grabWaiters, i)) + i++; + BITCLEAR(grabWaiters, i); + AttendClient(clients[i]); + } + + if (ServerGrabCallback) + { + ServerGrabInfoRec grabinfo; + grabinfo.client = client; + grabinfo.grabstate = SERVER_UNGRABBED; + CallCallbacks(&ServerGrabCallback, (pointer)&grabinfo); + } +} + +int +ProcUngrabServer(ClientPtr client) +{ + REQUEST_SIZE_MATCH(xReq); + UngrabServer(client); + return(client->noClientException); +} + +int +ProcTranslateCoords(ClientPtr client) +{ + REQUEST(xTranslateCoordsReq); + + WindowPtr pWin, pDst; + xTranslateCoordsReply rep; + int rc; + + REQUEST_SIZE_MATCH(xTranslateCoordsReq); + rc = dixLookupWindow(&pWin, stuff->srcWid, client, DixGetAttrAccess); + if (rc != Success) + return rc; + rc = dixLookupWindow(&pDst, stuff->dstWid, client, DixGetAttrAccess); + if (rc != Success) + return rc; + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + if (!SAME_SCREENS(pWin->drawable, pDst->drawable)) + { + rep.sameScreen = xFalse; + rep.child = None; + rep.dstX = rep.dstY = 0; + } + else + { + INT16 x, y; + rep.sameScreen = xTrue; + rep.child = None; + /* computing absolute coordinates -- adjust to destination later */ + x = pWin->drawable.x + stuff->srcX; + y = pWin->drawable.y + stuff->srcY; + pWin = pDst->firstChild; + while (pWin) + { +#ifdef SHAPE + BoxRec box; +#endif + if ((pWin->mapped) && + (x >= pWin->drawable.x - wBorderWidth (pWin)) && + (x < pWin->drawable.x + (int)pWin->drawable.width + + wBorderWidth (pWin)) && + (y >= pWin->drawable.y - wBorderWidth (pWin)) && + (y < pWin->drawable.y + (int)pWin->drawable.height + + wBorderWidth (pWin)) +#ifdef SHAPE + /* When a window is shaped, a further check + * is made to see if the point is inside + * borderSize + */ + && (!wBoundingShape(pWin) || + POINT_IN_REGION(pWin->drawable.pScreen, + &pWin->borderSize, x, y, &box)) + + && (!wInputShape(pWin) || + POINT_IN_REGION(pWin->drawable.pScreen, + wInputShape(pWin), + x - pWin->drawable.x, + y - pWin->drawable.y, &box)) +#endif + ) + { + rep.child = pWin->drawable.id; + pWin = (WindowPtr) NULL; + } + else + pWin = pWin->nextSib; + } + /* adjust to destination coordinates */ + rep.dstX = x - pDst->drawable.x; + rep.dstY = y - pDst->drawable.y; + } + WriteReplyToClient(client, sizeof(xTranslateCoordsReply), &rep); + return(client->noClientException); +} + +int +ProcOpenFont(ClientPtr client) +{ + int err; + REQUEST(xOpenFontReq); + + REQUEST_FIXED_SIZE(xOpenFontReq, stuff->nbytes); + client->errorValue = stuff->fid; + LEGAL_NEW_RESOURCE(stuff->fid, client); + err = OpenFont(client, stuff->fid, (Mask) 0, + stuff->nbytes, (char *)&stuff[1]); + if (err == Success) + { + return(client->noClientException); + } + else + return err; +} + +int +ProcCloseFont(ClientPtr client) +{ + FontPtr pFont; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + pFont = (FontPtr)SecurityLookupIDByType(client, stuff->id, RT_FONT, + DixDestroyAccess); + if ( pFont != (FontPtr)NULL) /* id was valid */ + { + FreeResource(stuff->id, RT_NONE); + return(client->noClientException); + } + else + { + client->errorValue = stuff->id; + return (BadFont); + } +} + +int +ProcQueryFont(ClientPtr client) +{ + xQueryFontReply *reply; + FontPtr pFont; + GC *pGC; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + client->errorValue = stuff->id; /* EITHER font or gc */ + rc = dixLookupResource((pointer *)&pFont, stuff->id, RT_FONT, client, + DixGetAttrAccess); + if (rc == BadValue) { + rc = dixLookupResource((pointer *)&pGC, stuff->id, RT_GC, client, + DixGetAttrAccess); + if (rc == Success) + pFont = pGC->font; + } + if (rc != Success) + return (rc == BadValue) ? BadFont: rc; + + { + xCharInfo *pmax = FONTINKMAX(pFont); + xCharInfo *pmin = FONTINKMIN(pFont); + int nprotoxcistructs; + int rlength; + + nprotoxcistructs = ( + pmax->rightSideBearing == pmin->rightSideBearing && + pmax->leftSideBearing == pmin->leftSideBearing && + pmax->descent == pmin->descent && + pmax->ascent == pmin->ascent && + pmax->characterWidth == pmin->characterWidth) ? + 0 : N2dChars(pFont); + + rlength = sizeof(xQueryFontReply) + + FONTINFONPROPS(FONTCHARSET(pFont)) * sizeof(xFontProp) + + nprotoxcistructs * sizeof(xCharInfo); + reply = (xQueryFontReply *)xalloc(rlength); + if(!reply) + { + return(BadAlloc); + } + + reply->type = X_Reply; + reply->length = (rlength - sizeof(xGenericReply)) >> 2; + reply->sequenceNumber = client->sequence; + QueryFont( pFont, reply, nprotoxcistructs); + + WriteReplyToClient(client, rlength, reply); + xfree(reply); + return(client->noClientException); + } +} + +int +ProcQueryTextExtents(ClientPtr client) +{ + xQueryTextExtentsReply reply; + FontPtr pFont; + GC *pGC; + ExtentInfoRec info; + unsigned long length; + int rc; + REQUEST(xQueryTextExtentsReq); + REQUEST_AT_LEAST_SIZE(xQueryTextExtentsReq); + + client->errorValue = stuff->fid; /* EITHER font or gc */ + rc = dixLookupResource((pointer *)&pFont, stuff->fid, RT_FONT, client, + DixGetAttrAccess); + if (rc == BadValue) { + rc = dixLookupResource((pointer *)&pGC, stuff->fid, RT_GC, client, + DixGetAttrAccess); + if (rc == Success) + pFont = pGC->font; + } + if (rc != Success) + return (rc == BadValue) ? BadFont: rc; + + length = client->req_len - (sizeof(xQueryTextExtentsReq) >> 2); + length = length << 1; + if (stuff->oddLength) + { + if (length == 0) + return(BadLength); + length--; + } + if (!QueryTextExtents(pFont, length, (unsigned char *)&stuff[1], &info)) + return(BadAlloc); + reply.type = X_Reply; + reply.length = 0; + reply.sequenceNumber = client->sequence; + reply.drawDirection = info.drawDirection; + reply.fontAscent = info.fontAscent; + reply.fontDescent = info.fontDescent; + reply.overallAscent = info.overallAscent; + reply.overallDescent = info.overallDescent; + reply.overallWidth = info.overallWidth; + reply.overallLeft = info.overallLeft; + reply.overallRight = info.overallRight; + WriteReplyToClient(client, sizeof(xQueryTextExtentsReply), &reply); + return(client->noClientException); +} + +int +ProcListFonts(ClientPtr client) +{ + REQUEST(xListFontsReq); + + REQUEST_FIXED_SIZE(xListFontsReq, stuff->nbytes); + + return ListFonts(client, (unsigned char *) &stuff[1], stuff->nbytes, + stuff->maxNames); +} + +int +ProcListFontsWithInfo(ClientPtr client) +{ + REQUEST(xListFontsWithInfoReq); + + REQUEST_FIXED_SIZE(xListFontsWithInfoReq, stuff->nbytes); + + return StartListFontsWithInfo(client, stuff->nbytes, + (unsigned char *) &stuff[1], stuff->maxNames); +} + +/** + * + * \param value must conform to DeleteType + */ +int +dixDestroyPixmap(pointer value, XID pid) +{ + PixmapPtr pPixmap = (PixmapPtr)value; + return (*pPixmap->drawable.pScreen->DestroyPixmap)(pPixmap); +} + +int +ProcCreatePixmap(ClientPtr client) +{ + PixmapPtr pMap; + DrawablePtr pDraw; + REQUEST(xCreatePixmapReq); + DepthPtr pDepth; + int i, rc; + + REQUEST_SIZE_MATCH(xCreatePixmapReq); + client->errorValue = stuff->pid; + LEGAL_NEW_RESOURCE(stuff->pid, client); + + rc = dixLookupDrawable(&pDraw, stuff->drawable, client, M_ANY, + DixGetAttrAccess); + if (rc != Success) + return rc; + + if (!stuff->width || !stuff->height) + { + client->errorValue = 0; + return BadValue; + } + if (stuff->width > 32767 || stuff->height > 32767) + { + /* It is allowed to try and allocate a pixmap which is larger than + * 32767 in either dimension. However, all of the framebuffer code + * is buggy and does not reliably draw to such big pixmaps, basically + * because the Region data structure operates with signed shorts + * for the rectangles in it. + * + * Furthermore, several places in the X server computes the + * size in bytes of the pixmap and tries to store it in an + * integer. This integer can overflow and cause the allocated size + * to be much smaller. + * + * So, such big pixmaps are rejected here with a BadAlloc + */ + return BadAlloc; + } + if (stuff->depth != 1) + { + pDepth = pDraw->pScreen->allowedDepths; + for (i=0; ipScreen->numDepths; i++, pDepth++) + if (pDepth->depth == stuff->depth) + goto CreatePmap; + client->errorValue = stuff->depth; + return BadValue; + } +CreatePmap: + pMap = (PixmapPtr)(*pDraw->pScreen->CreatePixmap) + (pDraw->pScreen, stuff->width, + stuff->height, stuff->depth, 0); + if (pMap) + { + pMap->drawable.serialNumber = NEXT_SERIAL_NUMBER; + pMap->drawable.id = stuff->pid; + /* security creation/labeling check */ + rc = XaceHook(XACE_RESOURCE_ACCESS, client, stuff->pid, RT_PIXMAP, + pMap, RT_NONE, NULL, DixCreateAccess); + if (rc != Success) { + (*pDraw->pScreen->DestroyPixmap)(pMap); + return rc; + } + if (AddResource(stuff->pid, RT_PIXMAP, (pointer)pMap)) + return(client->noClientException); + (*pDraw->pScreen->DestroyPixmap)(pMap); + } + return (BadAlloc); +} + +int +ProcFreePixmap(ClientPtr client) +{ + PixmapPtr pMap; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupResource((pointer *)&pMap, stuff->id, RT_PIXMAP, client, + DixDestroyAccess); + if (rc == Success) + { + FreeResource(stuff->id, RT_NONE); + return(client->noClientException); + } + else + { + client->errorValue = stuff->id; + return (rc == BadValue) ? BadPixmap : rc; + } +} + +int +ProcCreateGC(ClientPtr client) +{ + int error, rc; + GC *pGC; + DrawablePtr pDraw; + unsigned len; + REQUEST(xCreateGCReq); + + REQUEST_AT_LEAST_SIZE(xCreateGCReq); + client->errorValue = stuff->gc; + LEGAL_NEW_RESOURCE(stuff->gc, client); + rc = dixLookupDrawable(&pDraw, stuff->drawable, client, 0, + DixGetAttrAccess); + if (rc != Success) + return rc; + + len = client->req_len - (sizeof(xCreateGCReq) >> 2); + if (len != Ones(stuff->mask)) + return BadLength; + pGC = (GC *)CreateGC(pDraw, stuff->mask, (XID *) &stuff[1], &error, + stuff->gc, client); + if (error != Success) + return error; + if (!AddResource(stuff->gc, RT_GC, (pointer)pGC)) + return (BadAlloc); + return(client->noClientException); +} + +int +ProcChangeGC(ClientPtr client) +{ + GC *pGC; + int result; + unsigned len; + REQUEST(xChangeGCReq); + REQUEST_AT_LEAST_SIZE(xChangeGCReq); + + result = dixLookupGC(&pGC, stuff->gc, client, DixSetAttrAccess); + if (result != Success) + return result; + + len = client->req_len - (sizeof(xChangeGCReq) >> 2); + if (len != Ones(stuff->mask)) + return BadLength; + + result = dixChangeGC(client, pGC, stuff->mask, (CARD32 *) &stuff[1], 0); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return(result); + } +} + +int +ProcCopyGC(ClientPtr client) +{ + GC *dstGC; + GC *pGC; + int result; + REQUEST(xCopyGCReq); + REQUEST_SIZE_MATCH(xCopyGCReq); + + result = dixLookupGC(&pGC, stuff->srcGC, client, DixGetAttrAccess); + if (result != Success) + return result; + result = dixLookupGC(&dstGC, stuff->dstGC, client, DixSetAttrAccess); + if (result != Success) + return result; + if ((dstGC->pScreen != pGC->pScreen) || (dstGC->depth != pGC->depth)) + return (BadMatch); + result = CopyGC(pGC, dstGC, stuff->mask); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return(result); + } +} + +int +ProcSetDashes(ClientPtr client) +{ + GC *pGC; + int result; + REQUEST(xSetDashesReq); + + REQUEST_FIXED_SIZE(xSetDashesReq, stuff->nDashes); + if (stuff->nDashes == 0) + { + client->errorValue = 0; + return BadValue; + } + + result = dixLookupGC(&pGC,stuff->gc, client, DixSetAttrAccess); + if (result != Success) + return result; + + result = SetDashes(pGC, stuff->dashOffset, stuff->nDashes, + (unsigned char *)&stuff[1]); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return(result); + } +} + +int +ProcSetClipRectangles(ClientPtr client) +{ + int nr, result; + GC *pGC; + REQUEST(xSetClipRectanglesReq); + + REQUEST_AT_LEAST_SIZE(xSetClipRectanglesReq); + if ((stuff->ordering != Unsorted) && (stuff->ordering != YSorted) && + (stuff->ordering != YXSorted) && (stuff->ordering != YXBanded)) + { + client->errorValue = stuff->ordering; + return BadValue; + } + result = dixLookupGC(&pGC,stuff->gc, client, DixSetAttrAccess); + if (result != Success) + return result; + + nr = (client->req_len << 2) - sizeof(xSetClipRectanglesReq); + if (nr & 4) + return(BadLength); + nr >>= 3; + result = SetClipRects(pGC, stuff->xOrigin, stuff->yOrigin, + nr, (xRectangle *)&stuff[1], (int)stuff->ordering); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); +} + +int +ProcFreeGC(ClientPtr client) +{ + GC *pGC; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupGC(&pGC, stuff->id, client, DixDestroyAccess); + if (rc != Success) + return rc; + + FreeResource(stuff->id, RT_NONE); + return(client->noClientException); +} + +int +ProcClearToBackground(ClientPtr client) +{ + REQUEST(xClearAreaReq); + WindowPtr pWin; + int rc; + + REQUEST_SIZE_MATCH(xClearAreaReq); + rc = dixLookupWindow(&pWin, stuff->window, client, DixWriteAccess); + if (rc != Success) + return rc; + if (pWin->drawable.class == InputOnly) + { + client->errorValue = stuff->window; + return (BadMatch); + } + if ((stuff->exposures != xTrue) && (stuff->exposures != xFalse)) + { + client->errorValue = stuff->exposures; + return(BadValue); + } + (*pWin->drawable.pScreen->ClearToBackground)(pWin, stuff->x, stuff->y, + stuff->width, stuff->height, + (Bool)stuff->exposures); + return(client->noClientException); +} + +int +ProcCopyArea(ClientPtr client) +{ + DrawablePtr pDst; + DrawablePtr pSrc; + GC *pGC; + REQUEST(xCopyAreaReq); + RegionPtr pRgn; + int rc; + + REQUEST_SIZE_MATCH(xCopyAreaReq); + + VALIDATE_DRAWABLE_AND_GC(stuff->dstDrawable, pDst, DixWriteAccess); + if (stuff->dstDrawable != stuff->srcDrawable) + { + rc = dixLookupDrawable(&pSrc, stuff->srcDrawable, client, 0, + DixReadAccess); + if (rc != Success) + return rc; + if ((pDst->pScreen != pSrc->pScreen) || (pDst->depth != pSrc->depth)) + { + client->errorValue = stuff->dstDrawable; + return (BadMatch); + } + } + else + pSrc = pDst; + + pRgn = (*pGC->ops->CopyArea)(pSrc, pDst, pGC, stuff->srcX, stuff->srcY, + stuff->width, stuff->height, + stuff->dstX, stuff->dstY); + if (pGC->graphicsExposures) + { + (*pDst->pScreen->SendGraphicsExpose) + (client, pRgn, stuff->dstDrawable, X_CopyArea, 0); + if (pRgn) + REGION_DESTROY(pDst->pScreen, pRgn); + } + + return(client->noClientException); +} + +int +ProcCopyPlane(ClientPtr client) +{ + DrawablePtr psrcDraw, pdstDraw; + GC *pGC; + REQUEST(xCopyPlaneReq); + RegionPtr pRgn; + int rc; + + REQUEST_SIZE_MATCH(xCopyPlaneReq); + + VALIDATE_DRAWABLE_AND_GC(stuff->dstDrawable, pdstDraw, DixWriteAccess); + if (stuff->dstDrawable != stuff->srcDrawable) + { + rc = dixLookupDrawable(&psrcDraw, stuff->srcDrawable, client, 0, + DixReadAccess); + if (rc != Success) + return rc; + + if (pdstDraw->pScreen != psrcDraw->pScreen) + { + client->errorValue = stuff->dstDrawable; + return (BadMatch); + } + } + else + psrcDraw = pdstDraw; + + /* Check to see if stuff->bitPlane has exactly ONE good bit set */ + if(stuff->bitPlane == 0 || (stuff->bitPlane & (stuff->bitPlane - 1)) || + (stuff->bitPlane > (1L << (psrcDraw->depth - 1)))) + { + client->errorValue = stuff->bitPlane; + return(BadValue); + } + + pRgn = (*pGC->ops->CopyPlane)(psrcDraw, pdstDraw, pGC, stuff->srcX, stuff->srcY, + stuff->width, stuff->height, + stuff->dstX, stuff->dstY, stuff->bitPlane); + if (pGC->graphicsExposures) + { + (*pdstDraw->pScreen->SendGraphicsExpose) + (client, pRgn, stuff->dstDrawable, X_CopyPlane, 0); + if (pRgn) + REGION_DESTROY(pdstDraw->pScreen, pRgn); + } + return(client->noClientException); +} + +int +ProcPolyPoint(ClientPtr client) +{ + int npoint; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyPointReq); + + REQUEST_AT_LEAST_SIZE(xPolyPointReq); + if ((stuff->coordMode != CoordModeOrigin) && + (stuff->coordMode != CoordModePrevious)) + { + client->errorValue = stuff->coordMode; + return BadValue; + } + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + npoint = ((client->req_len << 2) - sizeof(xPolyPointReq)) >> 2; + if (npoint) + (*pGC->ops->PolyPoint)(pDraw, pGC, stuff->coordMode, npoint, + (xPoint *) &stuff[1]); + return (client->noClientException); +} + +int +ProcPolyLine(ClientPtr client) +{ + int npoint; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyLineReq); + + REQUEST_AT_LEAST_SIZE(xPolyLineReq); + if ((stuff->coordMode != CoordModeOrigin) && + (stuff->coordMode != CoordModePrevious)) + { + client->errorValue = stuff->coordMode; + return BadValue; + } + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + npoint = ((client->req_len << 2) - sizeof(xPolyLineReq)) >> 2; + if (npoint > 1) + (*pGC->ops->Polylines)(pDraw, pGC, stuff->coordMode, npoint, + (DDXPointPtr) &stuff[1]); + return(client->noClientException); +} + +int +ProcPolySegment(ClientPtr client) +{ + int nsegs; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolySegmentReq); + + REQUEST_AT_LEAST_SIZE(xPolySegmentReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + nsegs = (client->req_len << 2) - sizeof(xPolySegmentReq); + if (nsegs & 4) + return(BadLength); + nsegs >>= 3; + if (nsegs) + (*pGC->ops->PolySegment)(pDraw, pGC, nsegs, (xSegment *) &stuff[1]); + return (client->noClientException); +} + +int +ProcPolyRectangle (ClientPtr client) +{ + int nrects; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyRectangleReq); + + REQUEST_AT_LEAST_SIZE(xPolyRectangleReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + nrects = (client->req_len << 2) - sizeof(xPolyRectangleReq); + if (nrects & 4) + return(BadLength); + nrects >>= 3; + if (nrects) + (*pGC->ops->PolyRectangle)(pDraw, pGC, + nrects, (xRectangle *) &stuff[1]); + return(client->noClientException); +} + +int +ProcPolyArc(ClientPtr client) +{ + int narcs; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyArcReq); + + REQUEST_AT_LEAST_SIZE(xPolyArcReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + narcs = (client->req_len << 2) - sizeof(xPolyArcReq); + if (narcs % sizeof(xArc)) + return(BadLength); + narcs /= sizeof(xArc); + if (narcs) + (*pGC->ops->PolyArc)(pDraw, pGC, narcs, (xArc *) &stuff[1]); + return (client->noClientException); +} + +int +ProcFillPoly(ClientPtr client) +{ + int things; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xFillPolyReq); + + REQUEST_AT_LEAST_SIZE(xFillPolyReq); + if ((stuff->shape != Complex) && (stuff->shape != Nonconvex) && + (stuff->shape != Convex)) + { + client->errorValue = stuff->shape; + return BadValue; + } + if ((stuff->coordMode != CoordModeOrigin) && + (stuff->coordMode != CoordModePrevious)) + { + client->errorValue = stuff->coordMode; + return BadValue; + } + + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + things = ((client->req_len << 2) - sizeof(xFillPolyReq)) >> 2; + if (things) + (*pGC->ops->FillPolygon) (pDraw, pGC, stuff->shape, + stuff->coordMode, things, + (DDXPointPtr) &stuff[1]); + return(client->noClientException); +} + +int +ProcPolyFillRectangle(ClientPtr client) +{ + int things; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyFillRectangleReq); + + REQUEST_AT_LEAST_SIZE(xPolyFillRectangleReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + things = (client->req_len << 2) - sizeof(xPolyFillRectangleReq); + if (things & 4) + return(BadLength); + things >>= 3; + + if (things) + (*pGC->ops->PolyFillRect) (pDraw, pGC, things, + (xRectangle *) &stuff[1]); + return (client->noClientException); +} + +int +ProcPolyFillArc(ClientPtr client) +{ + int narcs; + GC *pGC; + DrawablePtr pDraw; + REQUEST(xPolyFillArcReq); + + REQUEST_AT_LEAST_SIZE(xPolyFillArcReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + narcs = (client->req_len << 2) - sizeof(xPolyFillArcReq); + if (narcs % sizeof(xArc)) + return(BadLength); + narcs /= sizeof(xArc); + if (narcs) + (*pGC->ops->PolyFillArc) (pDraw, pGC, narcs, (xArc *) &stuff[1]); + return (client->noClientException); +} + +#ifdef MATCH_CLIENT_ENDIAN + +int +ServerOrder (void) +{ + int whichbyte = 1; + + if (*((char *) &whichbyte)) + return LSBFirst; + return MSBFirst; +} + +#define ClientOrder(client) ((client)->swapped ? !ServerOrder() : ServerOrder()) + +void +ReformatImage (char *base, int nbytes, int bpp, int order) +{ + switch (bpp) { + case 1: /* yuck */ + if (BITMAP_BIT_ORDER != order) + BitOrderInvert ((unsigned char *) base, nbytes); +#if IMAGE_BYTE_ORDER != BITMAP_BIT_ORDER && BITMAP_SCANLINE_UNIT != 8 + ReformatImage (base, nbytes, BITMAP_SCANLINE_UNIT, order); +#endif + break; + case 4: + break; /* yuck */ + case 8: + break; + case 16: + if (IMAGE_BYTE_ORDER != order) + TwoByteSwap ((unsigned char *) base, nbytes); + break; + case 32: + if (IMAGE_BYTE_ORDER != order) + FourByteSwap ((unsigned char *) base, nbytes); + break; + } +} +#else +#define ReformatImage(b,n,bpp,o) +#endif + +/* 64-bit server notes: the protocol restricts padding of images to + * 8-, 16-, or 32-bits. We would like to have 64-bits for the server + * to use internally. Removes need for internal alignment checking. + * All of the PutImage functions could be changed individually, but + * as currently written, they call other routines which require things + * to be 64-bit padded on scanlines, so we changed things here. + * If an image would be padded differently for 64- versus 32-, then + * copy each scanline to a 64-bit padded scanline. + * Also, we need to make sure that the image is aligned on a 64-bit + * boundary, even if the scanlines are padded to our satisfaction. + */ +int +ProcPutImage(ClientPtr client) +{ + GC *pGC; + DrawablePtr pDraw; + long length; /* length of scanline server padded */ + long lengthProto; /* length of scanline protocol padded */ + char *tmpImage; + REQUEST(xPutImageReq); + + REQUEST_AT_LEAST_SIZE(xPutImageReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + if (stuff->format == XYBitmap) + { + if ((stuff->depth != 1) || + (stuff->leftPad >= (unsigned int)screenInfo.bitmapScanlinePad)) + return BadMatch; + length = BitmapBytePad(stuff->width + stuff->leftPad); + } + else if (stuff->format == XYPixmap) + { + if ((pDraw->depth != stuff->depth) || + (stuff->leftPad >= (unsigned int)screenInfo.bitmapScanlinePad)) + return BadMatch; + length = BitmapBytePad(stuff->width + stuff->leftPad); + length *= stuff->depth; + } + else if (stuff->format == ZPixmap) + { + if ((pDraw->depth != stuff->depth) || (stuff->leftPad != 0)) + return BadMatch; + length = PixmapBytePad(stuff->width, stuff->depth); + } + else + { + client->errorValue = stuff->format; + return BadValue; + } + + tmpImage = (char *)&stuff[1]; + lengthProto = length; + + if (((((lengthProto * stuff->height) + (unsigned)3) >> 2) + + (sizeof(xPutImageReq) >> 2)) != client->req_len) + return BadLength; + + ReformatImage (tmpImage, lengthProto * stuff->height, + stuff->format == ZPixmap ? BitsPerPixel (stuff->depth) : 1, + ClientOrder(client)); + + (*pGC->ops->PutImage) (pDraw, pGC, stuff->depth, stuff->dstX, stuff->dstY, + stuff->width, stuff->height, + stuff->leftPad, stuff->format, tmpImage); + + return (client->noClientException); +} + +static int +DoGetImage(ClientPtr client, int format, Drawable drawable, + int x, int y, int width, int height, + Mask planemask, xGetImageReply **im_return) +{ + DrawablePtr pDraw; + int nlines, linesPerBuf, rc; + int linesDone; + long widthBytesLine, length; + Mask plane = 0; + char *pBuf; + xGetImageReply xgi; + RegionPtr pVisibleRegion = NULL; + + if ((format != XYPixmap) && (format != ZPixmap)) + { + client->errorValue = format; + return(BadValue); + } + rc = dixLookupDrawable(&pDraw, drawable, client, 0, DixReadAccess); + if (rc != Success) + return rc; + + if(pDraw->type == DRAWABLE_WINDOW) + { + if( /* check for being viewable */ + !((WindowPtr) pDraw)->realized || + /* check for being on screen */ + pDraw->x + x < 0 || + pDraw->x + x + width > pDraw->pScreen->width || + pDraw->y + y < 0 || + pDraw->y + y + height > pDraw->pScreen->height || + /* check for being inside of border */ + x < - wBorderWidth((WindowPtr)pDraw) || + x + width > wBorderWidth((WindowPtr)pDraw) + (int)pDraw->width || + y < -wBorderWidth((WindowPtr)pDraw) || + y + height > wBorderWidth ((WindowPtr)pDraw) + (int)pDraw->height + ) + return(BadMatch); + xgi.visual = wVisual (((WindowPtr) pDraw)); + } + else + { + if(x < 0 || + x+width > (int)pDraw->width || + y < 0 || + y+height > (int)pDraw->height + ) + return(BadMatch); + xgi.visual = None; + } + + xgi.type = X_Reply; + xgi.sequenceNumber = client->sequence; + xgi.depth = pDraw->depth; + if(format == ZPixmap) + { + widthBytesLine = PixmapBytePad(width, pDraw->depth); + length = widthBytesLine * height; + + } + else + { + widthBytesLine = BitmapBytePad(width); + plane = ((Mask)1) << (pDraw->depth - 1); + /* only planes asked for */ + length = widthBytesLine * height * + Ones(planemask & (plane | (plane - 1))); + + } + + xgi.length = length; + + if (im_return) { + pBuf = (char *)xalloc(sz_xGetImageReply + length); + if (!pBuf) + return (BadAlloc); + if (widthBytesLine == 0) + linesPerBuf = 0; + else + linesPerBuf = height; + *im_return = (xGetImageReply *)pBuf; + *(xGetImageReply *)pBuf = xgi; + pBuf += sz_xGetImageReply; + } else { + xgi.length = (xgi.length + 3) >> 2; + if (widthBytesLine == 0 || height == 0) + linesPerBuf = 0; + else if (widthBytesLine >= IMAGE_BUFSIZE) + linesPerBuf = 1; + else + { + linesPerBuf = IMAGE_BUFSIZE / widthBytesLine; + if (linesPerBuf > height) + linesPerBuf = height; + } + length = linesPerBuf * widthBytesLine; + if (linesPerBuf < height) + { + /* we have to make sure intermediate buffers don't need padding */ + while ((linesPerBuf > 1) && + (length & ((1L << LOG2_BYTES_PER_SCANLINE_PAD)-1))) + { + linesPerBuf--; + length -= widthBytesLine; + } + while (length & ((1L << LOG2_BYTES_PER_SCANLINE_PAD)-1)) + { + linesPerBuf++; + length += widthBytesLine; + } + } + if(!(pBuf = (char *) xalloc(length))) + return (BadAlloc); + WriteReplyToClient(client, sizeof (xGetImageReply), &xgi); + } + + if (pDraw->type == DRAWABLE_WINDOW) + { + pVisibleRegion = NotClippedByChildren((WindowPtr)pDraw); + if (pVisibleRegion) + { + REGION_TRANSLATE(pDraw->pScreen, pVisibleRegion, + -pDraw->x, -pDraw->y); + } + } + + if (linesPerBuf == 0) + { + /* nothing to do */ + } + else if (format == ZPixmap) + { + linesDone = 0; + while (height - linesDone > 0) + { + nlines = min(linesPerBuf, height - linesDone); + (*pDraw->pScreen->GetImage) (pDraw, + x, + y + linesDone, + width, + nlines, + format, + planemask, + (pointer) pBuf); + if (pVisibleRegion) + XaceCensorImage(client, pVisibleRegion, widthBytesLine, + pDraw, x, y + linesDone, width, + nlines, format, pBuf); + + /* Note that this is NOT a call to WriteSwappedDataToClient, + as we do NOT byte swap */ + if (!im_return) + { + ReformatImage (pBuf, (int)(nlines * widthBytesLine), + BitsPerPixel (pDraw->depth), + ClientOrder(client)); + +/* Don't split me, gcc pukes when you do */ + (void)WriteToClient(client, + (int)(nlines * widthBytesLine), + pBuf); + } + linesDone += nlines; + } + } + else /* XYPixmap */ + { + for (; plane; plane >>= 1) + { + if (planemask & plane) + { + linesDone = 0; + while (height - linesDone > 0) + { + nlines = min(linesPerBuf, height - linesDone); + (*pDraw->pScreen->GetImage) (pDraw, + x, + y + linesDone, + width, + nlines, + format, + plane, + (pointer)pBuf); + if (pVisibleRegion) + XaceCensorImage(client, pVisibleRegion, + widthBytesLine, + pDraw, x, y + linesDone, width, + nlines, format, pBuf); + + /* Note: NOT a call to WriteSwappedDataToClient, + as we do NOT byte swap */ + if (im_return) { + pBuf += nlines * widthBytesLine; + } else { + ReformatImage (pBuf, + (int)(nlines * widthBytesLine), + 1, + ClientOrder (client)); + +/* Don't split me, gcc pukes when you do */ + (void)WriteToClient(client, + (int)(nlines * widthBytesLine), + pBuf); + } + linesDone += nlines; + } + } + } + } + if (pVisibleRegion) + REGION_DESTROY(pDraw->pScreen, pVisibleRegion); + if (!im_return) + xfree(pBuf); + return (client->noClientException); +} + +int +ProcGetImage(ClientPtr client) +{ + REQUEST(xGetImageReq); + + REQUEST_SIZE_MATCH(xGetImageReq); + + return DoGetImage(client, stuff->format, stuff->drawable, + stuff->x, stuff->y, + (int)stuff->width, (int)stuff->height, + stuff->planeMask, (xGetImageReply **)NULL); +} + +int +ProcPolyText(ClientPtr client) +{ + int err; + REQUEST(xPolyTextReq); + DrawablePtr pDraw; + GC *pGC; + + REQUEST_AT_LEAST_SIZE(xPolyTextReq); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + + err = PolyText(client, + pDraw, + pGC, + (unsigned char *)&stuff[1], + ((unsigned char *) stuff) + (client->req_len << 2), + stuff->x, + stuff->y, + stuff->reqType, + stuff->drawable); + + if (err == Success) + { + return(client->noClientException); + } + else + return err; +} + +int +ProcImageText8(ClientPtr client) +{ + int err; + DrawablePtr pDraw; + GC *pGC; + + REQUEST(xImageTextReq); + + REQUEST_FIXED_SIZE(xImageTextReq, stuff->nChars); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + + err = ImageText(client, + pDraw, + pGC, + stuff->nChars, + (unsigned char *)&stuff[1], + stuff->x, + stuff->y, + stuff->reqType, + stuff->drawable); + + if (err == Success) + { + return(client->noClientException); + } + else + return err; +} + +int +ProcImageText16(ClientPtr client) +{ + int err; + DrawablePtr pDraw; + GC *pGC; + + REQUEST(xImageTextReq); + + REQUEST_FIXED_SIZE(xImageTextReq, stuff->nChars << 1); + VALIDATE_DRAWABLE_AND_GC(stuff->drawable, pDraw, DixWriteAccess); + + err = ImageText(client, + pDraw, + pGC, + stuff->nChars, + (unsigned char *)&stuff[1], + stuff->x, + stuff->y, + stuff->reqType, + stuff->drawable); + + if (err == Success) + { + return(client->noClientException); + } + else + return err; +} + + +int +ProcCreateColormap(ClientPtr client) +{ + VisualPtr pVisual; + ColormapPtr pmap; + Colormap mid; + WindowPtr pWin; + ScreenPtr pScreen; + REQUEST(xCreateColormapReq); + int i, result; + + REQUEST_SIZE_MATCH(xCreateColormapReq); + + if ((stuff->alloc != AllocNone) && (stuff->alloc != AllocAll)) + { + client->errorValue = stuff->alloc; + return(BadValue); + } + mid = stuff->mid; + LEGAL_NEW_RESOURCE(mid, client); + result = dixLookupWindow(&pWin, stuff->window, client, DixGetAttrAccess); + if (result != Success) + return result; + + pScreen = pWin->drawable.pScreen; + for (i = 0, pVisual = pScreen->visuals; + i < pScreen->numVisuals; + i++, pVisual++) + { + if (pVisual->vid != stuff->visual) + continue; + result = CreateColormap(mid, pScreen, pVisual, &pmap, + (int)stuff->alloc, client->index); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); + } + client->errorValue = stuff->visual; + return(BadMatch); +} + +int +ProcFreeColormap(ClientPtr client) +{ + ColormapPtr pmap; + int rc; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupResource((pointer *)&pmap, stuff->id, RT_COLORMAP, client, + DixDestroyAccess); + if (rc == Success) + { + /* Freeing a default colormap is a no-op */ + if (!(pmap->flags & IsDefault)) + FreeResource(stuff->id, RT_NONE); + return (client->noClientException); + } + else + { + client->errorValue = stuff->id; + return (rc == BadValue) ? BadColor : rc; + } +} + + +int +ProcCopyColormapAndFree(ClientPtr client) +{ + Colormap mid; + ColormapPtr pSrcMap; + REQUEST(xCopyColormapAndFreeReq); + int rc; + + REQUEST_SIZE_MATCH(xCopyColormapAndFreeReq); + mid = stuff->mid; + LEGAL_NEW_RESOURCE(mid, client); + rc = dixLookupResource((pointer *)&pSrcMap, stuff->srcCmap, RT_COLORMAP, + client, DixReadAccess|DixRemoveAccess); + if (rc == Success) + { + rc = CopyColormapAndFree(mid, pSrcMap, client->index); + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } + else + { + client->errorValue = stuff->srcCmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcInstallColormap(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupResource((pointer *)&pcmp, stuff->id, RT_COLORMAP, client, + DixInstallAccess); + if (rc != Success) + goto out; + + rc = XaceHook(XACE_SCREEN_ACCESS, client, pcmp->pScreen, DixSetAttrAccess); + if (rc != Success) + goto out; + + (*(pcmp->pScreen->InstallColormap)) (pcmp); + + rc = client->noClientException; +out: + client->errorValue = stuff->id; + return (rc == BadValue) ? BadColor : rc; +} + +int +ProcUninstallColormap(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupResource((pointer *)&pcmp, stuff->id, RT_COLORMAP, client, + DixUninstallAccess); + if (rc != Success) + goto out; + + rc = XaceHook(XACE_SCREEN_ACCESS, client, pcmp->pScreen, DixSetAttrAccess); + if (rc != Success) + goto out; + + if(pcmp->mid != pcmp->pScreen->defColormap) + (*(pcmp->pScreen->UninstallColormap)) (pcmp); + + rc = client->noClientException; +out: + client->errorValue = stuff->id; + return (rc == BadValue) ? BadColor : rc; +} + +int +ProcListInstalledColormaps(ClientPtr client) +{ + xListInstalledColormapsReply *preply; + int nummaps, rc; + WindowPtr pWin; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupWindow(&pWin, stuff->id, client, DixGetAttrAccess); + if (rc != Success) + goto out; + + rc = XaceHook(XACE_SCREEN_ACCESS, client, pWin->drawable.pScreen, + DixGetAttrAccess); + if (rc != Success) + goto out; + + preply = (xListInstalledColormapsReply *) + xalloc(sizeof(xListInstalledColormapsReply) + + pWin->drawable.pScreen->maxInstalledCmaps * + sizeof(Colormap)); + if(!preply) + return(BadAlloc); + + preply->type = X_Reply; + preply->sequenceNumber = client->sequence; + nummaps = (*pWin->drawable.pScreen->ListInstalledColormaps) + (pWin->drawable.pScreen, (Colormap *)&preply[1]); + preply->nColormaps = nummaps; + preply->length = nummaps; + WriteReplyToClient(client, sizeof (xListInstalledColormapsReply), preply); + client->pSwapReplyFunc = (ReplySwapPtr) Swap32Write; + WriteSwappedDataToClient(client, nummaps * sizeof(Colormap), &preply[1]); + xfree(preply); + rc = client->noClientException; +out: + return rc; +} + +int +ProcAllocColor (ClientPtr client) +{ + ColormapPtr pmap; + int rc; + xAllocColorReply acr; + REQUEST(xAllocColorReq); + + REQUEST_SIZE_MATCH(xAllocColorReq); + rc = dixLookupResource((pointer *)&pmap, stuff->cmap, RT_COLORMAP, client, + DixAddAccess); + if (rc == Success) + { + acr.type = X_Reply; + acr.length = 0; + acr.sequenceNumber = client->sequence; + acr.red = stuff->red; + acr.green = stuff->green; + acr.blue = stuff->blue; + acr.pixel = 0; + if( (rc = AllocColor(pmap, &acr.red, &acr.green, &acr.blue, + &acr.pixel, client->index)) ) + { + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } +#ifdef PANORAMIX + if (noPanoramiXExtension || !pmap->pScreen->myNum) +#endif + WriteReplyToClient(client, sizeof(xAllocColorReply), &acr); + return (client->noClientException); + + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcAllocNamedColor (ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xAllocNamedColorReq); + + REQUEST_FIXED_SIZE(xAllocNamedColorReq, stuff->nbytes); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixAddAccess); + if (rc == Success) + { + xAllocNamedColorReply ancr; + + ancr.type = X_Reply; + ancr.length = 0; + ancr.sequenceNumber = client->sequence; + + if(OsLookupColor(pcmp->pScreen->myNum, (char *)&stuff[1], stuff->nbytes, + &ancr.exactRed, &ancr.exactGreen, &ancr.exactBlue)) + { + ancr.screenRed = ancr.exactRed; + ancr.screenGreen = ancr.exactGreen; + ancr.screenBlue = ancr.exactBlue; + ancr.pixel = 0; + if( (rc = AllocColor(pcmp, + &ancr.screenRed, &ancr.screenGreen, &ancr.screenBlue, + &ancr.pixel, client->index)) ) + { + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } +#ifdef PANORAMIX + if (noPanoramiXExtension || !pcmp->pScreen->myNum) +#endif + WriteReplyToClient(client, sizeof (xAllocNamedColorReply), &ancr); + return (client->noClientException); + } + else + return(BadName); + + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcAllocColorCells (ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xAllocColorCellsReq); + + REQUEST_SIZE_MATCH(xAllocColorCellsReq); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixAddAccess); + if (rc == Success) + { + xAllocColorCellsReply accr; + int npixels, nmasks; + long length; + Pixel *ppixels, *pmasks; + + npixels = stuff->colors; + if (!npixels) + { + client->errorValue = npixels; + return (BadValue); + } + if (stuff->contiguous != xTrue && stuff->contiguous != xFalse) + { + client->errorValue = stuff->contiguous; + return (BadValue); + } + nmasks = stuff->planes; + length = ((long)npixels + (long)nmasks) * sizeof(Pixel); + ppixels = (Pixel *)xalloc(length); + if(!ppixels) + return(BadAlloc); + pmasks = ppixels + npixels; + + if( (rc = AllocColorCells(client->index, pcmp, npixels, nmasks, + (Bool)stuff->contiguous, ppixels, pmasks)) ) + { + xfree(ppixels); + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } +#ifdef PANORAMIX + if (noPanoramiXExtension || !pcmp->pScreen->myNum) +#endif + { + accr.type = X_Reply; + accr.length = length >> 2; + accr.sequenceNumber = client->sequence; + accr.nPixels = npixels; + accr.nMasks = nmasks; + WriteReplyToClient(client, sizeof (xAllocColorCellsReply), &accr); + client->pSwapReplyFunc = (ReplySwapPtr) Swap32Write; + WriteSwappedDataToClient(client, length, ppixels); + } + xfree(ppixels); + return (client->noClientException); + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcAllocColorPlanes(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xAllocColorPlanesReq); + + REQUEST_SIZE_MATCH(xAllocColorPlanesReq); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixAddAccess); + if (rc == Success) + { + xAllocColorPlanesReply acpr; + int npixels; + long length; + Pixel *ppixels; + + npixels = stuff->colors; + if (!npixels) + { + client->errorValue = npixels; + return (BadValue); + } + if (stuff->contiguous != xTrue && stuff->contiguous != xFalse) + { + client->errorValue = stuff->contiguous; + return (BadValue); + } + acpr.type = X_Reply; + acpr.sequenceNumber = client->sequence; + acpr.nPixels = npixels; + length = (long)npixels * sizeof(Pixel); + ppixels = (Pixel *)xalloc(length); + if(!ppixels) + return(BadAlloc); + if( (rc = AllocColorPlanes(client->index, pcmp, npixels, + (int)stuff->red, (int)stuff->green, (int)stuff->blue, + (Bool)stuff->contiguous, ppixels, + &acpr.redMask, &acpr.greenMask, &acpr.blueMask)) ) + { + xfree(ppixels); + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } + acpr.length = length >> 2; +#ifdef PANORAMIX + if (noPanoramiXExtension || !pcmp->pScreen->myNum) +#endif + { + WriteReplyToClient(client, sizeof(xAllocColorPlanesReply), &acpr); + client->pSwapReplyFunc = (ReplySwapPtr) Swap32Write; + WriteSwappedDataToClient(client, length, ppixels); + } + xfree(ppixels); + return (client->noClientException); + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcFreeColors(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xFreeColorsReq); + + REQUEST_AT_LEAST_SIZE(xFreeColorsReq); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixRemoveAccess); + if (rc == Success) + { + int count; + + if(pcmp->flags & AllAllocated) + return(BadAccess); + count = ((client->req_len << 2)- sizeof(xFreeColorsReq)) >> 2; + rc = FreeColors(pcmp, client->index, count, + (Pixel *)&stuff[1], (Pixel)stuff->planeMask); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return rc; + } + + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcStoreColors (ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xStoreColorsReq); + + REQUEST_AT_LEAST_SIZE(xStoreColorsReq); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixWriteAccess); + if (rc == Success) + { + int count; + + count = (client->req_len << 2) - sizeof(xStoreColorsReq); + if (count % sizeof(xColorItem)) + return(BadLength); + count /= sizeof(xColorItem); + rc = StoreColors(pcmp, count, (xColorItem *)&stuff[1]); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return rc; + } + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcStoreNamedColor (ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xStoreNamedColorReq); + + REQUEST_FIXED_SIZE(xStoreNamedColorReq, stuff->nbytes); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixWriteAccess); + if (rc == Success) + { + xColorItem def; + + if(OsLookupColor(pcmp->pScreen->myNum, (char *)&stuff[1], + stuff->nbytes, &def.red, &def.green, &def.blue)) + { + def.flags = stuff->flags; + def.pixel = stuff->pixel; + rc = StoreColors(pcmp, 1, &def); + if (client->noClientException != Success) + return(client->noClientException); + else + return rc; + } + return (BadName); + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcQueryColors(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xQueryColorsReq); + + REQUEST_AT_LEAST_SIZE(xQueryColorsReq); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixReadAccess); + if (rc == Success) + { + int count; + xrgb *prgbs; + xQueryColorsReply qcr; + + count = ((client->req_len << 2) - sizeof(xQueryColorsReq)) >> 2; + prgbs = (xrgb *)xalloc(count * sizeof(xrgb)); + if(!prgbs && count) + return(BadAlloc); + if( (rc = QueryColors(pcmp, count, (Pixel *)&stuff[1], prgbs)) ) + { + if (prgbs) xfree(prgbs); + if (client->noClientException != Success) + return(client->noClientException); + else + { + client->errorValue = clientErrorValue; + return rc; + } + } + qcr.type = X_Reply; + qcr.length = (count * sizeof(xrgb)) >> 2; + qcr.sequenceNumber = client->sequence; + qcr.nColors = count; + WriteReplyToClient(client, sizeof(xQueryColorsReply), &qcr); + if (count) + { + client->pSwapReplyFunc = (ReplySwapPtr) SQColorsExtend; + WriteSwappedDataToClient(client, count * sizeof(xrgb), prgbs); + } + if (prgbs) xfree(prgbs); + return(client->noClientException); + + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcLookupColor(ClientPtr client) +{ + ColormapPtr pcmp; + int rc; + REQUEST(xLookupColorReq); + + REQUEST_FIXED_SIZE(xLookupColorReq, stuff->nbytes); + rc = dixLookupResource((pointer *)&pcmp, stuff->cmap, RT_COLORMAP, client, + DixReadAccess); + if (rc == Success) + { + xLookupColorReply lcr; + + if(OsLookupColor(pcmp->pScreen->myNum, (char *)&stuff[1], stuff->nbytes, + &lcr.exactRed, &lcr.exactGreen, &lcr.exactBlue)) + { + lcr.type = X_Reply; + lcr.length = 0; + lcr.sequenceNumber = client->sequence; + lcr.screenRed = lcr.exactRed; + lcr.screenGreen = lcr.exactGreen; + lcr.screenBlue = lcr.exactBlue; + (*pcmp->pScreen->ResolveColor)(&lcr.screenRed, + &lcr.screenGreen, + &lcr.screenBlue, + pcmp->pVisual); + WriteReplyToClient(client, sizeof(xLookupColorReply), &lcr); + return(client->noClientException); + } + return (BadName); + } + else + { + client->errorValue = stuff->cmap; + return (rc == BadValue) ? BadColor : rc; + } +} + +int +ProcCreateCursor (ClientPtr client) +{ + CursorPtr pCursor; + PixmapPtr src; + PixmapPtr msk; + unsigned char * srcbits; + unsigned char * mskbits; + unsigned short width, height; + long n; + CursorMetricRec cm; + int rc; + + REQUEST(xCreateCursorReq); + + REQUEST_SIZE_MATCH(xCreateCursorReq); + LEGAL_NEW_RESOURCE(stuff->cid, client); + + rc = dixLookupResource((pointer *)&src, stuff->source, RT_PIXMAP, client, + DixReadAccess); + if (rc != Success) { + client->errorValue = stuff->source; + return (rc == BadValue) ? BadPixmap : rc; + } + + rc = dixLookupResource((pointer *)&msk, stuff->mask, RT_PIXMAP, client, + DixReadAccess); + if (rc != Success) + { + if (stuff->mask != None) + { + client->errorValue = stuff->mask; + return (rc == BadValue) ? BadPixmap : rc; + } + } + else if ( src->drawable.width != msk->drawable.width + || src->drawable.height != msk->drawable.height + || src->drawable.depth != 1 + || msk->drawable.depth != 1) + return (BadMatch); + + width = src->drawable.width; + height = src->drawable.height; + + if ( stuff->x > width + || stuff->y > height ) + return (BadMatch); + + n = BitmapBytePad(width)*height; + srcbits = (unsigned char *)xalloc(n); + if (!srcbits) + return (BadAlloc); + mskbits = (unsigned char *)xalloc(n); + if (!mskbits) + { + xfree(srcbits); + return (BadAlloc); + } + + /* zeroing the (pad) bits helps some ddx cursor handling */ + bzero((char *)srcbits, n); + (* src->drawable.pScreen->GetImage)( (DrawablePtr)src, 0, 0, width, height, + XYPixmap, 1, (pointer)srcbits); + if ( msk == (PixmapPtr)NULL) + { + unsigned char *bits = mskbits; + while (--n >= 0) + *bits++ = ~0; + } + else + { + /* zeroing the (pad) bits helps some ddx cursor handling */ + bzero((char *)mskbits, n); + (* msk->drawable.pScreen->GetImage)( (DrawablePtr)msk, 0, 0, width, + height, XYPixmap, 1, (pointer)mskbits); + } + cm.width = width; + cm.height = height; + cm.xhot = stuff->x; + cm.yhot = stuff->y; + rc = AllocARGBCursor(srcbits, mskbits, NULL, &cm, + stuff->foreRed, stuff->foreGreen, stuff->foreBlue, + stuff->backRed, stuff->backGreen, stuff->backBlue, + &pCursor, client, stuff->cid); + + if (rc != Success) + return rc; + if (!AddResource(stuff->cid, RT_CURSOR, (pointer)pCursor)) + return BadAlloc; + + return client->noClientException; +} + +int +ProcCreateGlyphCursor (ClientPtr client) +{ + CursorPtr pCursor; + int res; + + REQUEST(xCreateGlyphCursorReq); + + REQUEST_SIZE_MATCH(xCreateGlyphCursorReq); + LEGAL_NEW_RESOURCE(stuff->cid, client); + + res = AllocGlyphCursor(stuff->source, stuff->sourceChar, + stuff->mask, stuff->maskChar, + stuff->foreRed, stuff->foreGreen, stuff->foreBlue, + stuff->backRed, stuff->backGreen, stuff->backBlue, + &pCursor, client, stuff->cid); + if (res != Success) + return res; + if (AddResource(stuff->cid, RT_CURSOR, (pointer)pCursor)) + return client->noClientException; + return BadAlloc; +} + + +int +ProcFreeCursor (ClientPtr client) +{ + CursorPtr pCursor; + int rc; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupResource((pointer *)&pCursor, stuff->id, RT_CURSOR, client, + DixDestroyAccess); + if (rc == Success) + { + FreeResource(stuff->id, RT_NONE); + return (client->noClientException); + } + else + { + client->errorValue = stuff->id; + return (rc == BadValue) ? BadCursor : rc; + } +} + +int +ProcQueryBestSize (ClientPtr client) +{ + xQueryBestSizeReply reply; + DrawablePtr pDraw; + ScreenPtr pScreen; + int rc; + REQUEST(xQueryBestSizeReq); + REQUEST_SIZE_MATCH(xQueryBestSizeReq); + + if ((stuff->class != CursorShape) && + (stuff->class != TileShape) && + (stuff->class != StippleShape)) + { + client->errorValue = stuff->class; + return(BadValue); + } + + rc = dixLookupDrawable(&pDraw, stuff->drawable, client, M_ANY, + DixGetAttrAccess); + if (rc != Success) + return rc; + if (stuff->class != CursorShape && pDraw->type == UNDRAWABLE_WINDOW) + return (BadMatch); + pScreen = pDraw->pScreen; + rc = XaceHook(XACE_SCREEN_ACCESS, client, pScreen, DixGetAttrAccess); + if (rc != Success) + return rc; + (* pScreen->QueryBestSize)(stuff->class, &stuff->width, + &stuff->height, pScreen); + reply.type = X_Reply; + reply.length = 0; + reply.sequenceNumber = client->sequence; + reply.width = stuff->width; + reply.height = stuff->height; + WriteReplyToClient(client, sizeof(xQueryBestSizeReply), &reply); + return (client->noClientException); +} + + +int +ProcSetScreenSaver (ClientPtr client) +{ + int rc, i, blankingOption, exposureOption; + REQUEST(xSetScreenSaverReq); + REQUEST_SIZE_MATCH(xSetScreenSaverReq); + + for (i = 0; i < screenInfo.numScreens; i++) { + rc = XaceHook(XACE_SCREENSAVER_ACCESS, client, screenInfo.screens[i], + DixSetAttrAccess); + if (rc != Success) + return rc; + } + + blankingOption = stuff->preferBlank; + if ((blankingOption != DontPreferBlanking) && + (blankingOption != PreferBlanking) && + (blankingOption != DefaultBlanking)) + { + client->errorValue = blankingOption; + return BadValue; + } + exposureOption = stuff->allowExpose; + if ((exposureOption != DontAllowExposures) && + (exposureOption != AllowExposures) && + (exposureOption != DefaultExposures)) + { + client->errorValue = exposureOption; + return BadValue; + } + if (stuff->timeout < -1) + { + client->errorValue = stuff->timeout; + return BadValue; + } + if (stuff->interval < -1) + { + client->errorValue = stuff->interval; + return BadValue; + } + + if (blankingOption == DefaultBlanking) + ScreenSaverBlanking = defaultScreenSaverBlanking; + else + ScreenSaverBlanking = blankingOption; + if (exposureOption == DefaultExposures) + ScreenSaverAllowExposures = defaultScreenSaverAllowExposures; + else + ScreenSaverAllowExposures = exposureOption; + + if (stuff->timeout >= 0) + ScreenSaverTime = stuff->timeout * MILLI_PER_SECOND; + else + ScreenSaverTime = defaultScreenSaverTime; + if (stuff->interval >= 0) + ScreenSaverInterval = stuff->interval * MILLI_PER_SECOND; + else + ScreenSaverInterval = defaultScreenSaverInterval; + + SetScreenSaverTimer(); + return (client->noClientException); +} + +int +ProcGetScreenSaver(ClientPtr client) +{ + xGetScreenSaverReply rep; + int rc, i; + REQUEST_SIZE_MATCH(xReq); + + for (i = 0; i < screenInfo.numScreens; i++) { + rc = XaceHook(XACE_SCREENSAVER_ACCESS, client, screenInfo.screens[i], + DixGetAttrAccess); + if (rc != Success) + return rc; + } + + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + rep.timeout = ScreenSaverTime / MILLI_PER_SECOND; + rep.interval = ScreenSaverInterval / MILLI_PER_SECOND; + rep.preferBlanking = ScreenSaverBlanking; + rep.allowExposures = ScreenSaverAllowExposures; + WriteReplyToClient(client, sizeof(xGetScreenSaverReply), &rep); + return (client->noClientException); +} + +int +ProcChangeHosts(ClientPtr client) +{ + REQUEST(xChangeHostsReq); + int result; + + REQUEST_FIXED_SIZE(xChangeHostsReq, stuff->hostLength); + + if(stuff->mode == HostInsert) + result = AddHost(client, (int)stuff->hostFamily, + stuff->hostLength, (pointer)&stuff[1]); + else if (stuff->mode == HostDelete) + result = RemoveHost(client, (int)stuff->hostFamily, + stuff->hostLength, (pointer)&stuff[1]); + else + { + client->errorValue = stuff->mode; + return BadValue; + } + if (!result) + result = client->noClientException; + return (result); +} + +int +ProcListHosts(ClientPtr client) +{ + xListHostsReply reply; + int len, nHosts, result; + pointer pdata; + /* REQUEST(xListHostsReq); */ + + REQUEST_SIZE_MATCH(xListHostsReq); + + /* untrusted clients can't list hosts */ + result = XaceHook(XACE_SERVER_ACCESS, client, DixReadAccess); + if (result != Success) + return result; + + result = GetHosts(&pdata, &nHosts, &len, &reply.enabled); + if (result != Success) + return(result); + reply.type = X_Reply; + reply.sequenceNumber = client->sequence; + reply.nHosts = nHosts; + reply.length = len >> 2; + WriteReplyToClient(client, sizeof(xListHostsReply), &reply); + if (nHosts) + { + client->pSwapReplyFunc = (ReplySwapPtr) SLHostsExtend; + WriteSwappedDataToClient(client, len, pdata); + } + xfree(pdata); + return (client->noClientException); +} + +int +ProcChangeAccessControl(ClientPtr client) +{ + int result; + REQUEST(xSetAccessControlReq); + + REQUEST_SIZE_MATCH(xSetAccessControlReq); + if ((stuff->mode != EnableAccess) && (stuff->mode != DisableAccess)) + { + client->errorValue = stuff->mode; + return BadValue; + } + result = ChangeAccessControl(client, stuff->mode == EnableAccess); + if (!result) + result = client->noClientException; + return (result); +} + +/********************* + * CloseDownRetainedResources + * + * Find all clients that are gone and have terminated in RetainTemporary + * and destroy their resources. + *********************/ + +static void +CloseDownRetainedResources(void) +{ + int i; + ClientPtr client; + + for (i=1; icloseDownMode == RetainTemporary) + && (client->clientGone)) + CloseDownClient(client); + } +} + +int +ProcKillClient(ClientPtr client) +{ + REQUEST(xResourceReq); + ClientPtr killclient; + int rc; + + REQUEST_SIZE_MATCH(xResourceReq); + if (stuff->id == AllTemporary) + { + CloseDownRetainedResources(); + return (client->noClientException); + } + + rc = dixLookupClient(&killclient, stuff->id, client, DixDestroyAccess); + if (rc == Success) { + CloseDownClient(killclient); + /* if an LBX proxy gets killed, isItTimeToYield will be set */ + if (isItTimeToYield || (client == killclient)) + { + /* force yield and return Success, so that Dispatch() + * doesn't try to touch client + */ + isItTimeToYield = TRUE; + return (Success); + } + return (client->noClientException); + } + else + return rc; +} + +int +ProcSetFontPath(ClientPtr client) +{ + unsigned char *ptr; + unsigned long nbytes, total; + long nfonts; + int n, result; + int error; + REQUEST(xSetFontPathReq); + + REQUEST_AT_LEAST_SIZE(xSetFontPathReq); + + nbytes = (client->req_len << 2) - sizeof(xSetFontPathReq); + total = nbytes; + ptr = (unsigned char *)&stuff[1]; + nfonts = stuff->nFonts; + while (--nfonts >= 0) + { + if ((total == 0) || (total < (n = (*ptr + 1)))) + return(BadLength); + total -= n; + ptr += n; + } + if (total >= 4) + return(BadLength); + result = SetFontPath(client, stuff->nFonts, (unsigned char *)&stuff[1], + &error); + if (!result) + { + result = client->noClientException; + client->errorValue = error; + } + return (result); +} + +int +ProcGetFontPath(ClientPtr client) +{ + xGetFontPathReply reply; + int rc, stringLens, numpaths; + unsigned char *bufferStart; + /* REQUEST (xReq); */ + + REQUEST_SIZE_MATCH(xReq); + rc = GetFontPath(client, &numpaths, &stringLens, &bufferStart); + if (rc != Success) + return rc; + + reply.type = X_Reply; + reply.sequenceNumber = client->sequence; + reply.length = (stringLens + numpaths + 3) >> 2; + reply.nPaths = numpaths; + + WriteReplyToClient(client, sizeof(xGetFontPathReply), &reply); + if (stringLens || numpaths) + (void)WriteToClient(client, stringLens + numpaths, (char *)bufferStart); + return(client->noClientException); +} + +int +ProcChangeCloseDownMode(ClientPtr client) +{ + int rc; + REQUEST(xSetCloseDownModeReq); + REQUEST_SIZE_MATCH(xSetCloseDownModeReq); + + rc = XaceHook(XACE_CLIENT_ACCESS, client, client, DixManageAccess); + if (rc != Success) + return rc; + + if ((stuff->mode == AllTemporary) || + (stuff->mode == RetainPermanent) || + (stuff->mode == RetainTemporary)) + { + client->closeDownMode = stuff->mode; + return (client->noClientException); + } + else + { + client->errorValue = stuff->mode; + return (BadValue); + } +} + +int ProcForceScreenSaver(ClientPtr client) +{ + int rc; + REQUEST(xForceScreenSaverReq); + + REQUEST_SIZE_MATCH(xForceScreenSaverReq); + + if ((stuff->mode != ScreenSaverReset) && + (stuff->mode != ScreenSaverActive)) + { + client->errorValue = stuff->mode; + return BadValue; + } + rc = dixSaveScreens(client, SCREEN_SAVER_FORCER, (int)stuff->mode); + if (rc != Success) + return rc; + return client->noClientException; +} + +int ProcNoOperation(ClientPtr client) +{ + REQUEST_AT_LEAST_SIZE(xReq); + + /* noop -- don't do anything */ + return(client->noClientException); +} + +void +InitProcVectors(void) +{ + int i; + for (i = 0; i<256; i++) + { + if(!ProcVector[i]) + { + ProcVector[i] = SwappedProcVector[i] = ProcBadRequest; + ReplySwapVector[i] = ReplyNotSwappd; + } + } + for(i = LASTEvent; i < 128; i++) + { + EventSwapVector[i] = NotImplemented; + } + +} + +/********************** + * CloseDownClient + * + * Client can either mark his resources destroy or retain. If retained and + * then killed again, the client is really destroyed. + *********************/ + +char dispatchExceptionAtReset = DE_RESET; + +void +CloseDownClient(ClientPtr client) +{ + Bool really_close_down = client->clientGone || + client->closeDownMode == DestroyAll; + + if (!client->clientGone) + { + /* ungrab server if grabbing client dies */ + if (grabState != GrabNone && grabClient == client) + { + UngrabServer(client); + } + BITCLEAR(grabWaiters, client->index); + DeleteClientFromAnySelections(client); + ReleaseActiveGrabs(client); + DeleteClientFontStuff(client); + if (!really_close_down) + { + /* This frees resources that should never be retained + * no matter what the close down mode is. Actually we + * could do this unconditionally, but it's probably + * better not to traverse all the client's resources + * twice (once here, once a few lines down in + * FreeClientResources) in the common case of + * really_close_down == TRUE. + */ + FreeClientNeverRetainResources(client); + client->clientState = ClientStateRetained; + if (ClientStateCallback) + { + NewClientInfoRec clientinfo; + + clientinfo.client = client; + clientinfo.prefix = (xConnSetupPrefix *)NULL; + clientinfo.setup = (xConnSetup *) NULL; + CallCallbacks((&ClientStateCallback), (pointer)&clientinfo); + } + } + client->clientGone = TRUE; /* so events aren't sent to client */ + if (ClientIsAsleep(client)) + ClientSignal (client); + ProcessWorkQueueZombies(); + CloseDownConnection(client); + + /* If the client made it to the Running stage, nClients has + * been incremented on its behalf, so we need to decrement it + * now. If it hasn't gotten to Running, nClients has *not* + * been incremented, so *don't* decrement it. + */ + if (client->clientState != ClientStateInitial && + client->clientState != ClientStateAuthenticating ) + { + --nClients; + } + } + + if (really_close_down) + { + if (client->clientState == ClientStateRunning && nClients == 0) + dispatchException |= dispatchExceptionAtReset; + + client->clientState = ClientStateGone; + if (ClientStateCallback) + { + NewClientInfoRec clientinfo; + + clientinfo.client = client; + clientinfo.prefix = (xConnSetupPrefix *)NULL; + clientinfo.setup = (xConnSetup *) NULL; + CallCallbacks((&ClientStateCallback), (pointer)&clientinfo); + } + FreeClientResources(client); +#ifdef XSERVER_DTRACE + XSERVER_CLIENT_DISCONNECT(client->index); +#endif + if (client->index < nextFreeClientID) + nextFreeClientID = client->index; + clients[client->index] = NullClient; +#ifdef SMART_SCHEDULE + SmartLastClient = NullClient; +#endif + dixFreePrivates(client->devPrivates); + xfree(client); + + while (!clients[currentMaxClients-1]) + currentMaxClients--; + } +} + +static void +KillAllClients(void) +{ + int i; + for (i=1; icloseDownMode = DestroyAll; + CloseDownClient(clients[i]); + } +} + +void InitClient(ClientPtr client, int i, pointer ospriv) +{ + client->index = i; + client->sequence = 0; + client->clientAsMask = ((Mask)i) << CLIENTOFFSET; + client->clientGone = FALSE; + client->closeDownMode = i ? DestroyAll : RetainPermanent; + client->numSaved = 0; + client->saveSet = (SaveSetElt *)NULL; + client->noClientException = Success; +#ifdef DEBUG + client->requestLogIndex = 0; +#endif + client->requestVector = InitialVector; + client->osPrivate = ospriv; + client->swapped = FALSE; + client->big_requests = FALSE; + client->priority = 0; + client->clientState = ClientStateInitial; + client->devPrivates = NULL; +#ifdef XKB + if (!noXkbExtension) { + client->xkbClientFlags = 0; + client->mapNotifyMask = 0; + QueryMinMaxKeyCodes(&client->minKC,&client->maxKC); + } +#endif + client->replyBytesRemaining = 0; +#ifdef XAPPGROUP + client->appgroup = NULL; +#endif + client->fontResFunc = NULL; +#ifdef SMART_SCHEDULE + client->smart_priority = 0; + client->smart_start_tick = SmartScheduleTime; + client->smart_stop_tick = SmartScheduleTime; + client->smart_check_tick = SmartScheduleTime; +#endif +} + +/************************ + * int NextAvailableClient(ospriv) + * + * OS dependent portion can't assign client id's because of CloseDownModes. + * Returns NULL if there are no free clients. + *************************/ + +ClientPtr NextAvailableClient(pointer ospriv) +{ + int i; + ClientPtr client; + xReq data; + + i = nextFreeClientID; + if (i == MAXCLIENTS) + return (ClientPtr)NULL; + clients[i] = client = (ClientPtr)xalloc(sizeof(ClientRec)); + if (!client) + return (ClientPtr)NULL; + InitClient(client, i, ospriv); + if (!InitClientResources(client)) + { + xfree(client); + return (ClientPtr)NULL; + } + data.reqType = 1; + data.length = (sz_xReq + sz_xConnClientPrefix) >> 2; + if (!InsertFakeRequest(client, (char *)&data, sz_xReq)) + { + FreeClientResources(client); + xfree(client); + return (ClientPtr)NULL; + } + if (i == currentMaxClients) + currentMaxClients++; + while ((nextFreeClientID < MAXCLIENTS) && clients[nextFreeClientID]) + nextFreeClientID++; + if (ClientStateCallback) + { + NewClientInfoRec clientinfo; + + clientinfo.client = client; + clientinfo.prefix = (xConnSetupPrefix *)NULL; + clientinfo.setup = (xConnSetup *) NULL; + CallCallbacks((&ClientStateCallback), (pointer)&clientinfo); + } + return(client); +} + +int +ProcInitialConnection(ClientPtr client) +{ + REQUEST(xReq); + xConnClientPrefix *prefix; + int whichbyte = 1; + + prefix = (xConnClientPrefix *)((char *)stuff + sz_xReq); + if ((prefix->byteOrder != 'l') && (prefix->byteOrder != 'B')) + return (client->noClientException = -1); + if (((*(char *) &whichbyte) && (prefix->byteOrder == 'B')) || + (!(*(char *) &whichbyte) && (prefix->byteOrder == 'l'))) + { + client->swapped = TRUE; + SwapConnClientPrefix(prefix); + } + stuff->reqType = 2; + stuff->length += ((prefix->nbytesAuthProto + (unsigned)3) >> 2) + + ((prefix->nbytesAuthString + (unsigned)3) >> 2); + if (client->swapped) + { + swaps(&stuff->length, whichbyte); + } + ResetCurrentRequest(client); + return (client->noClientException); +} + +static int +SendConnSetup(ClientPtr client, char *reason) +{ + xWindowRoot *root; + int i; + int numScreens; + char* lConnectionInfo; + xConnSetupPrefix* lconnSetupPrefix; + + if (reason) + { + xConnSetupPrefix csp; + + csp.success = xFalse; + csp.lengthReason = strlen(reason); + csp.length = (csp.lengthReason + (unsigned)3) >> 2; + csp.majorVersion = X_PROTOCOL; + csp.minorVersion = X_PROTOCOL_REVISION; + if (client->swapped) + WriteSConnSetupPrefix(client, &csp); + else + (void)WriteToClient(client, sz_xConnSetupPrefix, (char *) &csp); + (void)WriteToClient(client, (int)csp.lengthReason, reason); + return (client->noClientException = -1); + } + + numScreens = screenInfo.numScreens; + lConnectionInfo = ConnectionInfo; + lconnSetupPrefix = &connSetupPrefix; + + /* We're about to start speaking X protocol back to the client by + * sending the connection setup info. This means the authorization + * step is complete, and we can count the client as an + * authorized one. + */ + nClients++; + + client->requestVector = client->swapped ? SwappedProcVector : ProcVector; + client->sequence = 0; +#ifdef XAPPGROUP + XagConnectionInfo (client, &lconnSetupPrefix, &lConnectionInfo, &numScreens); +#endif + ((xConnSetup *)lConnectionInfo)->ridBase = client->clientAsMask; + ((xConnSetup *)lConnectionInfo)->ridMask = RESOURCE_ID_MASK; +#ifdef MATCH_CLIENT_ENDIAN + ((xConnSetup *)lConnectionInfo)->imageByteOrder = ClientOrder (client); + ((xConnSetup *)lConnectionInfo)->bitmapBitOrder = ClientOrder (client); +#endif + /* fill in the "currentInputMask" */ + root = (xWindowRoot *)(lConnectionInfo + connBlockScreenStart); +#ifdef PANORAMIX + if (noPanoramiXExtension) + numScreens = screenInfo.numScreens; + else + numScreens = ((xConnSetup *)ConnectionInfo)->numRoots; +#endif + + for (i=0; icurrentInputMask = WindowTable[i]->eventMask | + wOtherEventMasks (WindowTable[i]); + pDepth = (xDepth *)(root + 1); + for (j = 0; j < root->nDepths; j++) + { + pDepth = (xDepth *)(((char *)(pDepth + 1)) + + pDepth->nVisuals * sizeof(xVisualType)); + } + root = (xWindowRoot *)pDepth; + } + + if (client->swapped) + { + WriteSConnSetupPrefix(client, lconnSetupPrefix); + WriteSConnectionInfo(client, + (unsigned long)(lconnSetupPrefix->length << 2), + lConnectionInfo); + } + else + { + (void)WriteToClient(client, sizeof(xConnSetupPrefix), + (char *) lconnSetupPrefix); + (void)WriteToClient(client, (int)(lconnSetupPrefix->length << 2), + lConnectionInfo); + } + client->clientState = ClientStateRunning; + if (ClientStateCallback) + { + NewClientInfoRec clientinfo; + + clientinfo.client = client; + clientinfo.prefix = lconnSetupPrefix; + clientinfo.setup = (xConnSetup *)lConnectionInfo; + CallCallbacks((&ClientStateCallback), (pointer)&clientinfo); + } + return (client->noClientException); +} + +int +ProcEstablishConnection(ClientPtr client) +{ + char *reason, *auth_proto, *auth_string; + xConnClientPrefix *prefix; + REQUEST(xReq); + + prefix = (xConnClientPrefix *)((char *)stuff + sz_xReq); + auth_proto = (char *)prefix + sz_xConnClientPrefix; + auth_string = auth_proto + ((prefix->nbytesAuthProto + 3) & ~3); + if ((prefix->majorVersion != X_PROTOCOL) || + (prefix->minorVersion != X_PROTOCOL_REVISION)) + reason = "Protocol version mismatch"; + else + reason = ClientAuthorized(client, + (unsigned short)prefix->nbytesAuthProto, + auth_proto, + (unsigned short)prefix->nbytesAuthString, + auth_string); + /* + * If Kerberos is being used for this client, the clientState + * will be set to ClientStateAuthenticating at this point. + * More messages need to be exchanged among the X server, Kerberos + * server, and client to figure out if everyone is authorized. + * So we don't want to send the connection setup info yet, since + * the auth step isn't really done. + */ + if (client->clientState == ClientStateCheckingSecurity) + client->clientState = ClientStateCheckedSecurity; + else if (client->clientState != ClientStateAuthenticating) + return(SendConnSetup(client, reason)); + return(client->noClientException); +} + +_X_EXPORT void +SendErrorToClient(ClientPtr client, unsigned majorCode, unsigned minorCode, + XID resId, int errorCode) +{ + xError rep; + + rep.type = X_Error; + rep.sequenceNumber = client->sequence; + rep.errorCode = errorCode; + rep.majorCode = majorCode; + rep.minorCode = minorCode; + rep.resourceID = resId; + + WriteEventsToClient (client, 1, (xEvent *)&rep); +} + +void +MarkClientException(ClientPtr client) +{ + client->noClientException = -1; +} diff --git a/xorg-server/dix/dispatch.h b/xorg-server/dix/dispatch.h new file mode 100644 index 000000000..dd07096af --- /dev/null +++ b/xorg-server/dix/dispatch.h @@ -0,0 +1,146 @@ +/************************************************************ + +Copyright 1996 by Thomas E. Dickey + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of the above listed +copyright holder(s) not be used in advertising or publicity pertaining +to distribution of the software without specific, written prior +permission. + +THE ABOVE LISTED COPYRIGHT HOLDER(S) DISCLAIM ALL WARRANTIES WITH REGARD +TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY +AND FITNESS, IN NO EVENT SHALL THE ABOVE LISTED COPYRIGHT HOLDER(S) BE +LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES +WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN +ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF +OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +********************************************************/ + +/* + * This prototypes the dispatch.c module (except for functions declared in + * global headers), plus related dispatch procedures from devices.c, events.c, + * extension.c, property.c. + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#ifndef DISPATCH_H +#define DISPATCH_H 1 + +DISPATCH_PROC(InitClientPrivates); +DISPATCH_PROC(ProcAllocColor); +DISPATCH_PROC(ProcAllocColorCells); +DISPATCH_PROC(ProcAllocColorPlanes); +DISPATCH_PROC(ProcAllocNamedColor); +DISPATCH_PROC(ProcBell); +DISPATCH_PROC(ProcChangeAccessControl); +DISPATCH_PROC(ProcChangeCloseDownMode); +DISPATCH_PROC(ProcChangeGC); +DISPATCH_PROC(ProcChangeHosts); +DISPATCH_PROC(ProcChangeKeyboardControl); +DISPATCH_PROC(ProcChangeKeyboardMapping); +DISPATCH_PROC(ProcChangePointerControl); +DISPATCH_PROC(ProcChangeProperty); +DISPATCH_PROC(ProcChangeSaveSet); +DISPATCH_PROC(ProcChangeWindowAttributes); +DISPATCH_PROC(ProcCirculateWindow); +DISPATCH_PROC(ProcClearToBackground); +DISPATCH_PROC(ProcCloseFont); +DISPATCH_PROC(ProcConfigureWindow); +DISPATCH_PROC(ProcConvertSelection); +DISPATCH_PROC(ProcCopyArea); +DISPATCH_PROC(ProcCopyColormapAndFree); +DISPATCH_PROC(ProcCopyGC); +DISPATCH_PROC(ProcCopyPlane); +DISPATCH_PROC(ProcCreateColormap); +DISPATCH_PROC(ProcCreateCursor); +DISPATCH_PROC(ProcCreateGC); +DISPATCH_PROC(ProcCreateGlyphCursor); +DISPATCH_PROC(ProcCreatePixmap); +DISPATCH_PROC(ProcCreateWindow); +DISPATCH_PROC(ProcDeleteProperty); +DISPATCH_PROC(ProcDestroySubwindows); +DISPATCH_PROC(ProcDestroyWindow); +DISPATCH_PROC(ProcEstablishConnection); +DISPATCH_PROC(ProcFillPoly); +DISPATCH_PROC(ProcForceScreenSaver); +DISPATCH_PROC(ProcFreeColormap); +DISPATCH_PROC(ProcFreeColors); +DISPATCH_PROC(ProcFreeCursor); +DISPATCH_PROC(ProcFreeGC); +DISPATCH_PROC(ProcFreePixmap); +DISPATCH_PROC(ProcGetAtomName); +DISPATCH_PROC(ProcGetFontPath); +DISPATCH_PROC(ProcGetGeometry); +DISPATCH_PROC(ProcGetImage); +DISPATCH_PROC(ProcGetKeyboardControl); +DISPATCH_PROC(ProcGetKeyboardMapping); +DISPATCH_PROC(ProcGetModifierMapping); +DISPATCH_PROC(ProcGetMotionEvents); +DISPATCH_PROC(ProcGetPointerControl); +DISPATCH_PROC(ProcGetPointerMapping); +DISPATCH_PROC(ProcGetProperty); +DISPATCH_PROC(ProcGetScreenSaver); +DISPATCH_PROC(ProcGetSelectionOwner); +DISPATCH_PROC(ProcGetWindowAttributes); +DISPATCH_PROC(ProcGrabServer); +DISPATCH_PROC(ProcImageText16); +DISPATCH_PROC(ProcImageText8); +DISPATCH_PROC(ProcInitialConnection); +DISPATCH_PROC(ProcInstallColormap); +DISPATCH_PROC(ProcInternAtom); +DISPATCH_PROC(ProcKillClient); +DISPATCH_PROC(ProcListExtensions); +DISPATCH_PROC(ProcListFonts); +DISPATCH_PROC(ProcListFontsWithInfo); +DISPATCH_PROC(ProcListHosts); +DISPATCH_PROC(ProcListInstalledColormaps); +DISPATCH_PROC(ProcListProperties); +DISPATCH_PROC(ProcLookupColor); +DISPATCH_PROC(ProcMapSubwindows); +DISPATCH_PROC(ProcMapWindow); +DISPATCH_PROC(ProcNoOperation); +DISPATCH_PROC(ProcOpenFont); +DISPATCH_PROC(ProcPolyArc); +DISPATCH_PROC(ProcPolyFillArc); +DISPATCH_PROC(ProcPolyFillRectangle); +DISPATCH_PROC(ProcPolyLine); +DISPATCH_PROC(ProcPolyPoint); +DISPATCH_PROC(ProcPolyRectangle); +DISPATCH_PROC(ProcPolySegment); +DISPATCH_PROC(ProcPolyText); +DISPATCH_PROC(ProcPutImage); +DISPATCH_PROC(ProcQueryBestSize); +DISPATCH_PROC(ProcQueryColors); +DISPATCH_PROC(ProcQueryExtension); +DISPATCH_PROC(ProcQueryFont); +DISPATCH_PROC(ProcQueryKeymap); +DISPATCH_PROC(ProcQueryTextExtents); +DISPATCH_PROC(ProcQueryTree); +DISPATCH_PROC(ProcReparentWindow); +DISPATCH_PROC(ProcRotateProperties); +DISPATCH_PROC(ProcSetClipRectangles); +DISPATCH_PROC(ProcSetDashes); +DISPATCH_PROC(ProcSetFontPath); +DISPATCH_PROC(ProcSetModifierMapping); +DISPATCH_PROC(ProcSetPointerMapping); +DISPATCH_PROC(ProcSetScreenSaver); +DISPATCH_PROC(ProcSetSelectionOwner); +DISPATCH_PROC(ProcStoreColors); +DISPATCH_PROC(ProcStoreNamedColor); +DISPATCH_PROC(ProcTranslateCoords); +DISPATCH_PROC(ProcUngrabServer); +DISPATCH_PROC(ProcUninstallColormap); +DISPATCH_PROC(ProcUnmapSubwindows); +DISPATCH_PROC(ProcUnmapWindow); + +#endif /* DISPATCH_H */ diff --git a/xorg-server/dix/dix.c b/xorg-server/dix/dix.c new file mode 100644 index 000000000..e69de29bb diff --git a/xorg-server/dix/dixfonts.c b/xorg-server/dix/dixfonts.c new file mode 100644 index 000000000..e9a3f3963 --- /dev/null +++ b/xorg-server/dix/dixfonts.c @@ -0,0 +1,2102 @@ +/************************************************************************ +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +************************************************************************/ +/* The panoramix components contained the following notice */ +/* +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ + +#define NEED_REPLIES +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include +#include "scrnintstr.h" +#include "resource.h" +#include "dixstruct.h" +#include "cursorstr.h" +#include "misc.h" +#include "opaque.h" +#include "dixfontstr.h" +#include "closestr.h" +#include "dixfont.h" +#include "xace.h" + +#ifdef DEBUG +#include +#endif + +#ifdef PANORAMIX +#include "panoramiX.h" +#endif + +#ifdef XF86BIGFONT +#define _XF86BIGFONT_SERVER_ +#include +#endif + +#define QUERYCHARINFO(pci, pr) *(pr) = (pci)->metrics + +extern pointer fosNaturalParams; +extern FontPtr defaultFont; + +static FontPathElementPtr *font_path_elements = (FontPathElementPtr *) 0; +static int num_fpes = 0; +_X_EXPORT FPEFunctions *fpe_functions = (FPEFunctions *) 0; +static int num_fpe_types = 0; + +static unsigned char *font_path_string; + +static int num_slept_fpes = 0; +static int size_slept_fpes = 0; +static FontPathElementPtr *slept_fpes = (FontPathElementPtr *) 0; +static FontPatternCachePtr patternCache; + +_X_EXPORT int +FontToXError(err) + int err; +{ + switch (err) { + case Successful: + return Success; + case AllocError: + return BadAlloc; + case BadFontName: + return BadName; + case BadFontPath: + case BadFontFormat: /* is there something better? */ + case BadCharRange: + return BadValue; + default: + return err; + } +} + + +/* + * adding RT_FONT prevents conflict with default cursor font + */ +Bool +SetDefaultFont(char *defaultfontname) +{ + int err; + FontPtr pf; + XID fid; + + fid = FakeClientID(0); + err = OpenFont(serverClient, fid, FontLoadAll | FontOpenSync, + (unsigned) strlen(defaultfontname), defaultfontname); + if (err != Success) + return FALSE; + pf = (FontPtr) LookupIDByType(fid, RT_FONT); + if (pf == (FontPtr) NULL) + return FALSE; + defaultFont = pf; + return TRUE; +} + +/* + * note that the font wakeup queue is not refcounted. this is because + * an fpe needs to be added when it's inited, and removed when it's finally + * freed, in order to handle any data that isn't requested, like FS events. + * + * since the only thing that should call these routines is the renderer's + * init_fpe() and free_fpe(), there shouldn't be any problem in using + * freed data. + */ +void +QueueFontWakeup(FontPathElementPtr fpe) +{ + int i; + FontPathElementPtr *new; + + for (i = 0; i < num_slept_fpes; i++) { + if (slept_fpes[i] == fpe) { + return; + } + } + if (num_slept_fpes == size_slept_fpes) { + new = (FontPathElementPtr *) + xrealloc(slept_fpes, + sizeof(FontPathElementPtr) * (size_slept_fpes + 4)); + if (!new) + return; + slept_fpes = new; + size_slept_fpes += 4; + } + slept_fpes[num_slept_fpes] = fpe; + num_slept_fpes++; +} + +void +RemoveFontWakeup(FontPathElementPtr fpe) +{ + int i, + j; + + for (i = 0; i < num_slept_fpes; i++) { + if (slept_fpes[i] == fpe) { + for (j = i; j < num_slept_fpes; j++) { + slept_fpes[j] = slept_fpes[j + 1]; + } + num_slept_fpes--; + return; + } + } +} + +void +FontWakeup(pointer data, int count, pointer LastSelectMask) +{ + int i; + FontPathElementPtr fpe; + + if (count < 0) + return; + /* wake up any fpe's that may be waiting for information */ + for (i = 0; i < num_slept_fpes; i++) { + fpe = slept_fpes[i]; + (void) (*fpe_functions[fpe->type].wakeup_fpe) (fpe, LastSelectMask); + } +} + +/* XXX -- these two funcs may want to be broken into macros */ +static void +UseFPE(FontPathElementPtr fpe) +{ + fpe->refcount++; +} + +static void +FreeFPE (FontPathElementPtr fpe) +{ + fpe->refcount--; + if (fpe->refcount == 0) { + (*fpe_functions[fpe->type].free_fpe) (fpe); + xfree(fpe->name); + xfree(fpe); + } +} + +static Bool +doOpenFont(ClientPtr client, OFclosurePtr c) +{ + FontPtr pfont = NullFont; + FontPathElementPtr fpe = NULL; + ScreenPtr pScr; + int err = Successful; + int i; + char *alias, + *newname; + int newlen; + int aliascount = 20; + /* + * Decide at runtime what FontFormat to use. + */ + Mask FontFormat = + + ((screenInfo.imageByteOrder == LSBFirst) ? + BitmapFormatByteOrderLSB : BitmapFormatByteOrderMSB) | + + ((screenInfo.bitmapBitOrder == LSBFirst) ? + BitmapFormatBitOrderLSB : BitmapFormatBitOrderMSB) | + + BitmapFormatImageRectMin | + +#if GLYPHPADBYTES == 1 + BitmapFormatScanlinePad8 | +#endif + +#if GLYPHPADBYTES == 2 + BitmapFormatScanlinePad16 | +#endif + +#if GLYPHPADBYTES == 4 + BitmapFormatScanlinePad32 | +#endif + +#if GLYPHPADBYTES == 8 + BitmapFormatScanlinePad64 | +#endif + + BitmapFormatScanlineUnit8; + + if (client->clientGone) + { + if (c->current_fpe < c->num_fpes) + { + fpe = c->fpe_list[c->current_fpe]; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + } + err = Successful; + goto bail; + } + while (c->current_fpe < c->num_fpes) { + fpe = c->fpe_list[c->current_fpe]; + err = (*fpe_functions[fpe->type].open_font) + ((pointer) client, fpe, c->flags, + c->fontname, c->fnamelen, FontFormat, + BitmapFormatMaskByte | + BitmapFormatMaskBit | + BitmapFormatMaskImageRectangle | + BitmapFormatMaskScanLinePad | + BitmapFormatMaskScanLineUnit, + c->fontid, &pfont, &alias, + c->non_cachable_font && c->non_cachable_font->fpe == fpe ? + c->non_cachable_font : + (FontPtr)0); + + if (err == FontNameAlias && alias) { + newlen = strlen(alias); + newname = (char *) xrealloc(c->fontname, newlen); + if (!newname) { + err = AllocError; + break; + } + memmove(newname, alias, newlen); + c->fontname = newname; + c->fnamelen = newlen; + c->current_fpe = 0; + if (--aliascount <= 0) + break; + continue; + } + if (err == BadFontName) { + c->current_fpe++; + continue; + } + if (err == Suspended) { + if (!c->slept) { + c->slept = TRUE; + ClientSleep(client, (ClientSleepProcPtr)doOpenFont, (pointer) c); + } + return TRUE; + } + break; + } + + if (err != Successful) + goto bail; + if (!pfont) { + err = BadFontName; + goto bail; + } + /* check values for firstCol, lastCol, firstRow, and lastRow */ + if (pfont->info.firstCol > pfont->info.lastCol || + pfont->info.firstRow > pfont->info.lastRow || + pfont->info.lastCol - pfont->info.firstCol > 255) { + err = AllocError; + goto bail; + } + if (!pfont->fpe) + pfont->fpe = fpe; + pfont->refcnt++; + if (pfont->refcnt == 1) { + UseFPE(pfont->fpe); + for (i = 0; i < screenInfo.numScreens; i++) { + pScr = screenInfo.screens[i]; + if (pScr->RealizeFont) + { + if (!(*pScr->RealizeFont) (pScr, pfont)) + { + CloseFont (pfont, (Font) 0); + err = AllocError; + goto bail; + } + } + } + } + if (!AddResource(c->fontid, RT_FONT, (pointer) pfont)) { + err = AllocError; + goto bail; + } + if (patternCache && pfont != c->non_cachable_font) + CacheFontPattern(patternCache, c->origFontName, c->origFontNameLen, + pfont); +bail: + if (err != Successful && c->client != serverClient) { + SendErrorToClient(c->client, X_OpenFont, 0, + c->fontid, FontToXError(err)); + } + if (c->slept) + ClientWakeup(c->client); + for (i = 0; i < c->num_fpes; i++) { + FreeFPE(c->fpe_list[i]); + } + xfree(c->fpe_list); + xfree(c->fontname); + xfree(c); + return TRUE; +} + +int +OpenFont(ClientPtr client, XID fid, Mask flags, unsigned lenfname, char *pfontname) +{ + OFclosurePtr c; + int i; + FontPtr cached = (FontPtr)0; + +#ifdef FONTDEBUG + char *f; + f = (char *)xalloc(lenfname + 1); + memmove(f, pfontname, lenfname); + f[lenfname] = '\0'; + ErrorF("OpenFont: fontname is \"%s\"\n", f); + xfree(f); +#endif + if (!lenfname || lenfname > XLFDMAXFONTNAMELEN) + return BadName; + if (patternCache) + { + + /* + ** Check name cache. If we find a cached version of this font that + ** is cachable, immediately satisfy the request with it. If we find + ** a cached version of this font that is non-cachable, we do not + ** satisfy the request with it. Instead, we pass the FontPtr to the + ** FPE's open_font code (the fontfile FPE in turn passes the + ** information to the rasterizer; the fserve FPE ignores it). + ** + ** Presumably, the font is marked non-cachable because the FPE has + ** put some licensing restrictions on it. If the FPE, using + ** whatever logic it relies on, determines that it is willing to + ** share this existing font with the client, then it has the option + ** to return the FontPtr we passed it as the newly-opened font. + ** This allows the FPE to exercise its licensing logic without + ** having to create another instance of a font that already exists. + */ + + cached = FindCachedFontPattern(patternCache, pfontname, lenfname); + if (cached && cached->info.cachable) + { + if (!AddResource(fid, RT_FONT, (pointer) cached)) + return BadAlloc; + cached->refcnt++; + return Success; + } + } + c = (OFclosurePtr) xalloc(sizeof(OFclosureRec)); + if (!c) + return BadAlloc; + c->fontname = (char *) xalloc(lenfname); + c->origFontName = pfontname; + c->origFontNameLen = lenfname; + if (!c->fontname) { + xfree(c); + return BadAlloc; + } + /* + * copy the current FPE list, so that if it gets changed by another client + * while we're blocking, the request still appears atomic + */ + c->fpe_list = (FontPathElementPtr *) + xalloc(sizeof(FontPathElementPtr) * num_fpes); + if (!c->fpe_list) { + xfree(c->fontname); + xfree(c); + return BadAlloc; + } + memmove(c->fontname, pfontname, lenfname); + for (i = 0; i < num_fpes; i++) { + c->fpe_list[i] = font_path_elements[i]; + UseFPE(c->fpe_list[i]); + } + c->client = client; + c->fontid = fid; + c->current_fpe = 0; + c->num_fpes = num_fpes; + c->fnamelen = lenfname; + c->slept = FALSE; + c->flags = flags; + c->non_cachable_font = cached; + + (void) doOpenFont(client, c); + return Success; +} + +/** + * Decrement font's ref count, and free storage if ref count equals zero + * + * \param value must conform to DeleteType + */ +_X_EXPORT int +CloseFont(pointer value, XID fid) +{ + int nscr; + ScreenPtr pscr; + FontPathElementPtr fpe; + FontPtr pfont = (FontPtr)value; + + if (pfont == NullFont) + return (Success); + if (--pfont->refcnt == 0) { + if (patternCache) + RemoveCachedFontPattern (patternCache, pfont); + /* + * since the last reference is gone, ask each screen to free any + * storage it may have allocated locally for it. + */ + for (nscr = 0; nscr < screenInfo.numScreens; nscr++) { + pscr = screenInfo.screens[nscr]; + if (pscr->UnrealizeFont) + (*pscr->UnrealizeFont) (pscr, pfont); + } + if (pfont == defaultFont) + defaultFont = NULL; +#ifdef XF86BIGFONT + XF86BigfontFreeFontShm(pfont); +#endif + fpe = pfont->fpe; + (*fpe_functions[fpe->type].close_font) (fpe, pfont); + FreeFPE(fpe); + } + return (Success); +} + + +/***====================================================================***/ + +/** + * Sets up pReply as the correct QueryFontReply for pFont with the first + * nProtoCCIStructs char infos. + * + * \param pReply caller must allocate this storage + */ +void +QueryFont(FontPtr pFont, xQueryFontReply *pReply, int nProtoCCIStructs) +{ + FontPropPtr pFP; + int r, + c, + i; + xFontProp *prFP; + xCharInfo *prCI; + xCharInfo *charInfos[256]; + unsigned char chars[512]; + int ninfos; + unsigned long ncols; + unsigned long count; + + /* pr->length set in dispatch */ + pReply->minCharOrByte2 = pFont->info.firstCol; + pReply->defaultChar = pFont->info.defaultCh; + pReply->maxCharOrByte2 = pFont->info.lastCol; + pReply->drawDirection = pFont->info.drawDirection; + pReply->allCharsExist = pFont->info.allExist; + pReply->minByte1 = pFont->info.firstRow; + pReply->maxByte1 = pFont->info.lastRow; + pReply->fontAscent = pFont->info.fontAscent; + pReply->fontDescent = pFont->info.fontDescent; + + pReply->minBounds = pFont->info.ink_minbounds; + pReply->maxBounds = pFont->info.ink_maxbounds; + + pReply->nFontProps = pFont->info.nprops; + pReply->nCharInfos = nProtoCCIStructs; + + for (i = 0, pFP = pFont->info.props, prFP = (xFontProp *) (&pReply[1]); + i < pFont->info.nprops; + i++, pFP++, prFP++) { + prFP->name = pFP->name; + prFP->value = pFP->value; + } + + ninfos = 0; + ncols = (unsigned long) (pFont->info.lastCol - pFont->info.firstCol + 1); + prCI = (xCharInfo *) (prFP); + for (r = pFont->info.firstRow; + ninfos < nProtoCCIStructs && r <= (int)pFont->info.lastRow; + r++) { + i = 0; + for (c = pFont->info.firstCol; c <= (int)pFont->info.lastCol; c++) { + chars[i++] = r; + chars[i++] = c; + } + (*pFont->get_metrics) (pFont, ncols, chars, + TwoD16Bit, &count, charInfos); + i = 0; + for (i = 0; i < (int) count && ninfos < nProtoCCIStructs; i++) { + *prCI = *charInfos[i]; + prCI++; + ninfos++; + } + } + return; +} + +static Bool +doListFontsAndAliases(ClientPtr client, LFclosurePtr c) +{ + FontPathElementPtr fpe; + int err = Successful; + FontNamesPtr names = NULL; + char *name, *resolved=NULL; + int namelen, resolvedlen; + int nnames; + int stringLens; + int i; + xListFontsReply reply; + char *bufptr; + char *bufferStart; + int aliascount = 0; + + if (client->clientGone) + { + if (c->current.current_fpe < c->num_fpes) + { + fpe = c->fpe_list[c->current.current_fpe]; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + } + err = Successful; + goto bail; + } + + if (!c->current.patlen) + goto finish; + + while (c->current.current_fpe < c->num_fpes) { + fpe = c->fpe_list[c->current.current_fpe]; + err = Successful; + + if (!fpe_functions[fpe->type].start_list_fonts_and_aliases) + { + /* This FPE doesn't support/require list_fonts_and_aliases */ + + err = (*fpe_functions[fpe->type].list_fonts) + ((pointer) c->client, fpe, c->current.pattern, + c->current.patlen, c->current.max_names - c->names->nnames, + c->names); + + if (err == Suspended) { + if (!c->slept) { + c->slept = TRUE; + ClientSleep(client, + (ClientSleepProcPtr)doListFontsAndAliases, + (pointer) c); + } + return TRUE; + } + + err = BadFontName; + } + else + { + /* Start of list_fonts_and_aliases functionality. Modeled + after list_fonts_with_info in that it resolves aliases, + except that the information collected from FPEs is just + names, not font info. Each list_next_font_or_alias() + returns either a name into name/namelen or an alias into + name/namelen and its target name into resolved/resolvedlen. + The code at this level then resolves the alias by polling + the FPEs. */ + + if (!c->current.list_started) { + err = (*fpe_functions[fpe->type].start_list_fonts_and_aliases) + ((pointer) c->client, fpe, c->current.pattern, + c->current.patlen, c->current.max_names - c->names->nnames, + &c->current.private); + if (err == Suspended) { + if (!c->slept) { + ClientSleep(client, + (ClientSleepProcPtr)doListFontsAndAliases, + (pointer) c); + c->slept = TRUE; + } + return TRUE; + } + if (err == Successful) + c->current.list_started = TRUE; + } + if (err == Successful) { + char *tmpname; + name = 0; + err = (*fpe_functions[fpe->type].list_next_font_or_alias) + ((pointer) c->client, fpe, &name, &namelen, &tmpname, + &resolvedlen, c->current.private); + if (err == Suspended) { + if (!c->slept) { + ClientSleep(client, + (ClientSleepProcPtr)doListFontsAndAliases, + (pointer) c); + c->slept = TRUE; + } + return TRUE; + } + if (err == FontNameAlias) { + if (resolved) xfree(resolved); + resolved = (char *) xalloc(resolvedlen + 1); + if (resolved) + memmove(resolved, tmpname, resolvedlen + 1); + } + } + + if (err == Successful) + { + if (c->haveSaved) + { + if (c->savedName) + (void)AddFontNamesName(c->names, c->savedName, + c->savedNameLen); + } + else + (void)AddFontNamesName(c->names, name, namelen); + } + + /* + * When we get an alias back, save our state and reset back to + * the start of the FPE looking for the specified name. As + * soon as a real font is found for the alias, pop back to the + * old state + */ + else if (err == FontNameAlias) { + char tmp_pattern[XLFDMAXFONTNAMELEN]; + /* + * when an alias recurses, we need to give + * the last FPE a chance to clean up; so we call + * it again, and assume that the error returned + * is BadFontName, indicating the alias resolution + * is complete. + */ + memmove(tmp_pattern, resolved, resolvedlen); + if (c->haveSaved) + { + char *tmpname; + int tmpnamelen; + + tmpname = 0; + (void) (*fpe_functions[fpe->type].list_next_font_or_alias) + ((pointer) c->client, fpe, &tmpname, &tmpnamelen, + &tmpname, &tmpnamelen, c->current.private); + if (--aliascount <= 0) + { + err = BadFontName; + goto ContBadFontName; + } + } + else + { + c->saved = c->current; + c->haveSaved = TRUE; + if (c->savedName) + xfree(c->savedName); + c->savedName = (char *)xalloc(namelen + 1); + if (c->savedName) + memmove(c->savedName, name, namelen + 1); + c->savedNameLen = namelen; + aliascount = 20; + } + memmove(c->current.pattern, tmp_pattern, resolvedlen); + c->current.patlen = resolvedlen; + c->current.max_names = c->names->nnames + 1; + c->current.current_fpe = -1; + c->current.private = 0; + err = BadFontName; + } + } + /* + * At the end of this FPE, step to the next. If we've finished + * processing an alias, pop state back. If we've collected enough + * font names, quit. + */ + if (err == BadFontName) { + ContBadFontName: ; + c->current.list_started = FALSE; + c->current.current_fpe++; + err = Successful; + if (c->haveSaved) + { + if (c->names->nnames == c->current.max_names || + c->current.current_fpe == c->num_fpes) { + c->haveSaved = FALSE; + c->current = c->saved; + /* Give the saved namelist a chance to clean itself up */ + continue; + } + } + if (c->names->nnames == c->current.max_names) + break; + } + } + + /* + * send the reply + */ + if (err != Successful) { + SendErrorToClient(client, X_ListFonts, 0, 0, FontToXError(err)); + goto bail; + } + +finish: + + names = c->names; + nnames = names->nnames; + client = c->client; + stringLens = 0; + for (i = 0; i < nnames; i++) + stringLens += (names->length[i] <= 255) ? names->length[i] : 0; + + reply.type = X_Reply; + reply.length = (stringLens + nnames + 3) >> 2; + reply.nFonts = nnames; + reply.sequenceNumber = client->sequence; + + bufptr = bufferStart = (char *) xalloc(reply.length << 2); + + if (!bufptr && reply.length) { + SendErrorToClient(client, X_ListFonts, 0, 0, BadAlloc); + goto bail; + } + /* + * since WriteToClient long word aligns things, copy to temp buffer and + * write all at once + */ + for (i = 0; i < nnames; i++) { + if (names->length[i] > 255) + reply.nFonts--; + else + { + *bufptr++ = names->length[i]; + memmove( bufptr, names->names[i], names->length[i]); + bufptr += names->length[i]; + } + } + nnames = reply.nFonts; + reply.length = (stringLens + nnames + 3) >> 2; + client->pSwapReplyFunc = ReplySwapVector[X_ListFonts]; + WriteSwappedDataToClient(client, sizeof(xListFontsReply), &reply); + (void) WriteToClient(client, stringLens + nnames, bufferStart); + xfree(bufferStart); + +bail: + if (c->slept) + ClientWakeup(client); + for (i = 0; i < c->num_fpes; i++) + FreeFPE(c->fpe_list[i]); + xfree(c->fpe_list); + if (c->savedName) xfree(c->savedName); + FreeFontNames(names); + xfree(c); + if (resolved) xfree(resolved); + return TRUE; +} + +int +ListFonts(ClientPtr client, unsigned char *pattern, unsigned length, + unsigned max_names) +{ + int i; + LFclosurePtr c; + + /* + * The right error to return here would be BadName, however the + * specification does not allow for a Name error on this request. + * Perhaps a better solution would be to return a nil list, i.e. + * a list containing zero fontnames. + */ + if (length > XLFDMAXFONTNAMELEN) + return BadAlloc; + + i = XaceHook(XACE_SERVER_ACCESS, client, DixGetAttrAccess); + if (i != Success) + return i; + + if (!(c = (LFclosurePtr) xalloc(sizeof *c))) + return BadAlloc; + c->fpe_list = (FontPathElementPtr *) + xalloc(sizeof(FontPathElementPtr) * num_fpes); + if (!c->fpe_list) { + xfree(c); + return BadAlloc; + } + c->names = MakeFontNamesRecord(max_names < 100 ? max_names : 100); + if (!c->names) + { + xfree(c->fpe_list); + xfree(c); + return BadAlloc; + } + memmove( c->current.pattern, pattern, length); + for (i = 0; i < num_fpes; i++) { + c->fpe_list[i] = font_path_elements[i]; + UseFPE(c->fpe_list[i]); + } + c->client = client; + c->num_fpes = num_fpes; + c->current.patlen = length; + c->current.current_fpe = 0; + c->current.max_names = max_names; + c->current.list_started = FALSE; + c->current.private = 0; + c->haveSaved = FALSE; + c->slept = FALSE; + c->savedName = 0; + doListFontsAndAliases(client, c); + return Success; +} + +int +doListFontsWithInfo(ClientPtr client, LFWIclosurePtr c) +{ + FontPathElementPtr fpe; + int err = Successful; + char *name; + int namelen; + int numFonts; + FontInfoRec fontInfo, + *pFontInfo; + xListFontsWithInfoReply *reply; + int length; + xFontProp *pFP; + int i; + int aliascount = 0; + xListFontsWithInfoReply finalReply; + + if (client->clientGone) + { + if (c->current.current_fpe < c->num_fpes) + { + fpe = c->fpe_list[c->current.current_fpe]; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + } + err = Successful; + goto bail; + } + client->pSwapReplyFunc = ReplySwapVector[X_ListFontsWithInfo]; + if (!c->current.patlen) + goto finish; + while (c->current.current_fpe < c->num_fpes) + { + fpe = c->fpe_list[c->current.current_fpe]; + err = Successful; + if (!c->current.list_started) + { + err = (*fpe_functions[fpe->type].start_list_fonts_with_info) + (client, fpe, c->current.pattern, c->current.patlen, + c->current.max_names, &c->current.private); + if (err == Suspended) + { + if (!c->slept) + { + ClientSleep(client, (ClientSleepProcPtr)doListFontsWithInfo, c); + c->slept = TRUE; + } + return TRUE; + } + if (err == Successful) + c->current.list_started = TRUE; + } + if (err == Successful) + { + name = 0; + pFontInfo = &fontInfo; + err = (*fpe_functions[fpe->type].list_next_font_with_info) + (client, fpe, &name, &namelen, &pFontInfo, + &numFonts, c->current.private); + if (err == Suspended) + { + if (!c->slept) + { + ClientSleep(client, + (ClientSleepProcPtr)doListFontsWithInfo, + c); + c->slept = TRUE; + } + return TRUE; + } + } + /* + * When we get an alias back, save our state and reset back to the + * start of the FPE looking for the specified name. As soon as a real + * font is found for the alias, pop back to the old state + */ + if (err == FontNameAlias) + { + /* + * when an alias recurses, we need to give + * the last FPE a chance to clean up; so we call + * it again, and assume that the error returned + * is BadFontName, indicating the alias resolution + * is complete. + */ + if (c->haveSaved) + { + char *tmpname; + int tmpnamelen; + FontInfoPtr tmpFontInfo; + + tmpname = 0; + tmpFontInfo = &fontInfo; + (void) (*fpe_functions[fpe->type].list_next_font_with_info) + (client, fpe, &tmpname, &tmpnamelen, &tmpFontInfo, + &numFonts, c->current.private); + if (--aliascount <= 0) + { + err = BadFontName; + goto ContBadFontName; + } + } + else + { + c->saved = c->current; + c->haveSaved = TRUE; + c->savedNumFonts = numFonts; + if (c->savedName) + xfree(c->savedName); + c->savedName = (char *)xalloc(namelen + 1); + if (c->savedName) + memmove(c->savedName, name, namelen + 1); + aliascount = 20; + } + memmove(c->current.pattern, name, namelen); + c->current.patlen = namelen; + c->current.max_names = 1; + c->current.current_fpe = 0; + c->current.private = 0; + c->current.list_started = FALSE; + } + /* + * At the end of this FPE, step to the next. If we've finished + * processing an alias, pop state back. If we've sent enough font + * names, quit. Always wait for BadFontName to let the FPE + * have a chance to clean up. + */ + else if (err == BadFontName) + { + ContBadFontName: ; + c->current.list_started = FALSE; + c->current.current_fpe++; + err = Successful; + if (c->haveSaved) + { + if (c->current.max_names == 0 || + c->current.current_fpe == c->num_fpes) + { + c->haveSaved = FALSE; + c->saved.max_names -= (1 - c->current.max_names); + c->current = c->saved; + } + } + else if (c->current.max_names == 0) + break; + } + else if (err == Successful) + { + length = sizeof(*reply) + pFontInfo->nprops * sizeof(xFontProp); + reply = c->reply; + if (c->length < length) + { + reply = (xListFontsWithInfoReply *) xrealloc(c->reply, length); + if (!reply) + { + err = AllocError; + break; + } + c->reply = reply; + c->length = length; + } + if (c->haveSaved) + { + numFonts = c->savedNumFonts; + name = c->savedName; + namelen = strlen(name); + } + reply->type = X_Reply; + reply->length = (sizeof *reply - sizeof(xGenericReply) + + pFontInfo->nprops * sizeof(xFontProp) + + namelen + 3) >> 2; + reply->sequenceNumber = client->sequence; + reply->nameLength = namelen; + reply->minBounds = pFontInfo->ink_minbounds; + reply->maxBounds = pFontInfo->ink_maxbounds; + reply->minCharOrByte2 = pFontInfo->firstCol; + reply->maxCharOrByte2 = pFontInfo->lastCol; + reply->defaultChar = pFontInfo->defaultCh; + reply->nFontProps = pFontInfo->nprops; + reply->drawDirection = pFontInfo->drawDirection; + reply->minByte1 = pFontInfo->firstRow; + reply->maxByte1 = pFontInfo->lastRow; + reply->allCharsExist = pFontInfo->allExist; + reply->fontAscent = pFontInfo->fontAscent; + reply->fontDescent = pFontInfo->fontDescent; + reply->nReplies = numFonts; + pFP = (xFontProp *) (reply + 1); + for (i = 0; i < pFontInfo->nprops; i++) + { + pFP->name = pFontInfo->props[i].name; + pFP->value = pFontInfo->props[i].value; + pFP++; + } + WriteSwappedDataToClient(client, length, reply); + (void) WriteToClient(client, namelen, name); + if (pFontInfo == &fontInfo) + { + xfree(fontInfo.props); + xfree(fontInfo.isStringProp); + } + --c->current.max_names; + } + } +finish: + length = sizeof(xListFontsWithInfoReply); + bzero((char *) &finalReply, sizeof(xListFontsWithInfoReply)); + finalReply.type = X_Reply; + finalReply.sequenceNumber = client->sequence; + finalReply.length = (sizeof(xListFontsWithInfoReply) + - sizeof(xGenericReply)) >> 2; + WriteSwappedDataToClient(client, length, &finalReply); +bail: + if (c->slept) + ClientWakeup(client); + for (i = 0; i < c->num_fpes; i++) + FreeFPE(c->fpe_list[i]); + xfree(c->reply); + xfree(c->fpe_list); + if (c->savedName) xfree(c->savedName); + xfree(c); + return TRUE; +} + +int +StartListFontsWithInfo(ClientPtr client, int length, unsigned char *pattern, + int max_names) +{ + int i; + LFWIclosurePtr c; + + /* + * The right error to return here would be BadName, however the + * specification does not allow for a Name error on this request. + * Perhaps a better solution would be to return a nil list, i.e. + * a list containing zero fontnames. + */ + if (length > XLFDMAXFONTNAMELEN) + return BadAlloc; + + i = XaceHook(XACE_SERVER_ACCESS, client, DixGetAttrAccess); + if (i != Success) + return i; + + if (!(c = (LFWIclosurePtr) xalloc(sizeof *c))) + goto badAlloc; + c->fpe_list = (FontPathElementPtr *) + xalloc(sizeof(FontPathElementPtr) * num_fpes); + if (!c->fpe_list) + { + xfree(c); + goto badAlloc; + } + memmove(c->current.pattern, pattern, length); + for (i = 0; i < num_fpes; i++) + { + c->fpe_list[i] = font_path_elements[i]; + UseFPE(c->fpe_list[i]); + } + c->client = client; + c->num_fpes = num_fpes; + c->reply = 0; + c->length = 0; + c->current.patlen = length; + c->current.current_fpe = 0; + c->current.max_names = max_names; + c->current.list_started = FALSE; + c->current.private = 0; + c->savedNumFonts = 0; + c->haveSaved = FALSE; + c->slept = FALSE; + c->savedName = 0; + doListFontsWithInfo(client, c); + return Success; +badAlloc: + return BadAlloc; +} + +#define TextEltHeader 2 +#define FontShiftSize 5 +static XID clearGC[] = { CT_NONE }; +#define clearGCmask (GCClipMask) + +int +doPolyText(ClientPtr client, PTclosurePtr c) +{ + FontPtr pFont = c->pGC->font, oldpFont; + Font fid, oldfid; + int err = Success, lgerr; /* err is in X error, not font error, space */ + enum { NEVER_SLEPT, START_SLEEP, SLEEPING } client_state = NEVER_SLEPT; + FontPathElementPtr fpe; + GC *origGC = NULL; + + if (client->clientGone) + { + fpe = c->pGC->font->fpe; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + + if (c->slept) + { + /* Client has died, but we cannot bail out right now. We + need to clean up after the work we did when going to + sleep. Setting the drawable pointer to 0 makes this + happen without any attempts to render or perform other + unnecessary activities. */ + c->pDraw = (DrawablePtr)0; + } + else + { + err = Success; + goto bail; + } + } + + /* Make sure our drawable hasn't disappeared while we slept. */ + if (c->slept && + c->pDraw && + c->pDraw != (DrawablePtr)SecurityLookupIDByClass(client, c->did, + RC_DRAWABLE, DixWriteAccess)) + { + /* Our drawable has disappeared. Treat like client died... ask + the FPE code to clean up after client and avoid further + rendering while we clean up after ourself. */ + fpe = c->pGC->font->fpe; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + c->pDraw = (DrawablePtr)0; + } + + client_state = c->slept ? SLEEPING : NEVER_SLEPT; + + while (c->endReq - c->pElt > TextEltHeader) + { + if (*c->pElt == FontChange) + { + if (c->endReq - c->pElt < FontShiftSize) + { + err = BadLength; + goto bail; + } + + oldpFont = pFont; + oldfid = fid; + + fid = ((Font)*(c->pElt+4)) /* big-endian */ + | ((Font)*(c->pElt+3)) << 8 + | ((Font)*(c->pElt+2)) << 16 + | ((Font)*(c->pElt+1)) << 24; + pFont = (FontPtr)SecurityLookupIDByType(client, fid, RT_FONT, + DixReadAccess); + if (!pFont) + { + client->errorValue = fid; + err = BadFont; + /* restore pFont and fid for step 4 (described below) */ + pFont = oldpFont; + fid = oldfid; + + /* If we're in START_SLEEP mode, the following step + shortens the request... in the unlikely event that + the fid somehow becomes valid before we come through + again to actually execute the polytext, which would + then mess up our refcounting scheme badly. */ + c->err = err; + c->endReq = c->pElt; + + goto bail; + } + + /* Step 3 (described below) on our new font */ + if (client_state == START_SLEEP) + pFont->refcnt++; + else + { + if (pFont != c->pGC->font && c->pDraw) + { + ChangeGC( c->pGC, GCFont, &fid); + ValidateGC(c->pDraw, c->pGC); + if (c->reqType == X_PolyText8) + c->polyText = (PolyTextPtr) c->pGC->ops->PolyText8; + else + c->polyText = (PolyTextPtr) c->pGC->ops->PolyText16; + } + + /* Undo the refcnt++ we performed when going to sleep */ + if (client_state == SLEEPING) + (void)CloseFont(c->pGC->font, (Font)0); + } + c->pElt += FontShiftSize; + } + else /* print a string */ + { + unsigned char *pNextElt; + pNextElt = c->pElt + TextEltHeader + (*c->pElt)*c->itemSize; + if ( pNextElt > c->endReq) + { + err = BadLength; + goto bail; + } + if (client_state == START_SLEEP) + { + c->pElt = pNextElt; + continue; + } + if (c->pDraw) + { + lgerr = LoadGlyphs(client, c->pGC->font, *c->pElt, c->itemSize, + c->pElt + TextEltHeader); + } + else lgerr = Successful; + + if (lgerr == Suspended) + { + if (!c->slept) { + int len; + GC *pGC; + PTclosurePtr new_closure; + + /* We're putting the client to sleep. We need to do a few things + to ensure successful and atomic-appearing execution of the + remainder of the request. First, copy the remainder of the + request into a safe malloc'd area. Second, create a scratch GC + to use for the remainder of the request. Third, mark all fonts + referenced in the remainder of the request to prevent their + deallocation. Fourth, make the original GC look like the + request has completed... set its font to the final font value + from this request. These GC manipulations are for the unlikely + (but possible) event that some other client is using the GC. + Steps 3 and 4 are performed by running this procedure through + the remainder of the request in a special no-render mode + indicated by client_state = START_SLEEP. */ + + /* Step 1 */ + /* Allocate a malloc'd closure structure to replace + the local one we were passed */ + new_closure = (PTclosurePtr) xalloc(sizeof(PTclosureRec)); + if (!new_closure) + { + err = BadAlloc; + goto bail; + } + *new_closure = *c; + c = new_closure; + + len = c->endReq - c->pElt; + c->data = (unsigned char *)xalloc(len); + if (!c->data) + { + xfree(c); + err = BadAlloc; + goto bail; + } + memmove(c->data, c->pElt, len); + c->pElt = c->data; + c->endReq = c->pElt + len; + + /* Step 2 */ + + pGC = GetScratchGC(c->pGC->depth, c->pGC->pScreen); + if (!pGC) + { + xfree(c->data); + xfree(c); + err = BadAlloc; + goto bail; + } + if ((err = CopyGC(c->pGC, pGC, GCFunction | + GCPlaneMask | GCForeground | + GCBackground | GCFillStyle | + GCTile | GCStipple | + GCTileStipXOrigin | + GCTileStipYOrigin | GCFont | + GCSubwindowMode | GCClipXOrigin | + GCClipYOrigin | GCClipMask)) != + Success) + { + FreeScratchGC(pGC); + xfree(c->data); + xfree(c); + err = BadAlloc; + goto bail; + } + origGC = c->pGC; + c->pGC = pGC; + ValidateGC(c->pDraw, c->pGC); + + c->slept = TRUE; + ClientSleep(client, + (ClientSleepProcPtr)doPolyText, + (pointer) c); + + /* Set up to perform steps 3 and 4 */ + client_state = START_SLEEP; + continue; /* on to steps 3 and 4 */ + } + return TRUE; + } + else if (lgerr != Successful) + { + err = FontToXError(lgerr); + goto bail; + } + if (c->pDraw) + { + c->xorg += *((INT8 *)(c->pElt + 1)); /* must be signed */ + c->xorg = (* c->polyText)(c->pDraw, c->pGC, c->xorg, c->yorg, + *c->pElt, c->pElt + TextEltHeader); + } + c->pElt = pNextElt; + } + } + +bail: + + if (client_state == START_SLEEP) + { + /* Step 4 */ + if (pFont != origGC->font) + { + ChangeGC(origGC, GCFont, &fid); + ValidateGC(c->pDraw, origGC); + } + + /* restore pElt pointer for execution of remainder of the request */ + c->pElt = c->data; + return TRUE; + } + + if (c->err != Success) err = c->err; + if (err != Success && c->client != serverClient) { +#ifdef PANORAMIX + if (noPanoramiXExtension || !c->pGC->pScreen->myNum) +#endif + SendErrorToClient(c->client, c->reqType, 0, 0, err); + } + if (c->slept) + { + ClientWakeup(c->client); + ChangeGC(c->pGC, clearGCmask, clearGC); + + /* Unreference the font from the scratch GC */ + CloseFont(c->pGC->font, (Font)0); + c->pGC->font = NullFont; + + FreeScratchGC(c->pGC); + xfree(c->data); + xfree(c); + } + return TRUE; +} + +int +PolyText(ClientPtr client, DrawablePtr pDraw, GC *pGC, unsigned char *pElt, + unsigned char *endReq, int xorg, int yorg, int reqType, XID did) +{ + PTclosureRec local_closure; + + local_closure.pElt = pElt; + local_closure.endReq = endReq; + local_closure.client = client; + local_closure.pDraw = pDraw; + local_closure.xorg = xorg; + local_closure.yorg = yorg; + if ((local_closure.reqType = reqType) == X_PolyText8) + { + local_closure.polyText = (PolyTextPtr) pGC->ops->PolyText8; + local_closure.itemSize = 1; + } + else + { + local_closure.polyText = (PolyTextPtr) pGC->ops->PolyText16; + local_closure.itemSize = 2; + } + local_closure.pGC = pGC; + local_closure.did = did; + local_closure.err = Success; + local_closure.slept = FALSE; + + (void) doPolyText(client, &local_closure); + return Success; +} + + +#undef TextEltHeader +#undef FontShiftSize + +int +doImageText(ClientPtr client, ITclosurePtr c) +{ + int err = Success, lgerr; /* err is in X error, not font error, space */ + FontPathElementPtr fpe; + + if (client->clientGone) + { + fpe = c->pGC->font->fpe; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + err = Success; + goto bail; + } + + /* Make sure our drawable hasn't disappeared while we slept. */ + if (c->slept && + c->pDraw && + c->pDraw != (DrawablePtr)SecurityLookupIDByClass(client, c->did, + RC_DRAWABLE, DixWriteAccess)) + { + /* Our drawable has disappeared. Treat like client died... ask + the FPE code to clean up after client. */ + fpe = c->pGC->font->fpe; + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + err = Success; + goto bail; + } + + lgerr = LoadGlyphs(client, c->pGC->font, c->nChars, c->itemSize, c->data); + if (lgerr == Suspended) + { + if (!c->slept) { + GC *pGC; + unsigned char *data; + ITclosurePtr new_closure; + + /* We're putting the client to sleep. We need to + save some state. Similar problem to that handled + in doPolyText, but much simpler because the + request structure is much simpler. */ + + new_closure = (ITclosurePtr) xalloc(sizeof(ITclosureRec)); + if (!new_closure) + { + err = BadAlloc; + goto bail; + } + *new_closure = *c; + c = new_closure; + + data = (unsigned char *)xalloc(c->nChars * c->itemSize); + if (!data) + { + xfree(c); + err = BadAlloc; + goto bail; + } + memmove(data, c->data, c->nChars * c->itemSize); + c->data = data; + + pGC = GetScratchGC(c->pGC->depth, c->pGC->pScreen); + if (!pGC) + { + xfree(c->data); + xfree(c); + err = BadAlloc; + goto bail; + } + if ((err = CopyGC(c->pGC, pGC, GCFunction | GCPlaneMask | + GCForeground | GCBackground | GCFillStyle | + GCTile | GCStipple | GCTileStipXOrigin | + GCTileStipYOrigin | GCFont | + GCSubwindowMode | GCClipXOrigin | + GCClipYOrigin | GCClipMask)) != Success) + { + FreeScratchGC(pGC); + xfree(c->data); + xfree(c); + err = BadAlloc; + goto bail; + } + c->pGC = pGC; + ValidateGC(c->pDraw, c->pGC); + + c->slept = TRUE; + ClientSleep(client, (ClientSleepProcPtr)doImageText, (pointer) c); + } + return TRUE; + } + else if (lgerr != Successful) + { + err = FontToXError(lgerr); + goto bail; + } + if (c->pDraw) + { + (* c->imageText)(c->pDraw, c->pGC, c->xorg, c->yorg, + c->nChars, c->data); + } + +bail: + + if (err != Success && c->client != serverClient) { + SendErrorToClient(c->client, c->reqType, 0, 0, err); + } + if (c->slept) + { + ClientWakeup(c->client); + ChangeGC(c->pGC, clearGCmask, clearGC); + + /* Unreference the font from the scratch GC */ + CloseFont(c->pGC->font, (Font)0); + c->pGC->font = NullFont; + + FreeScratchGC(c->pGC); + xfree(c->data); + xfree(c); + } + return TRUE; +} + +int +ImageText(ClientPtr client, DrawablePtr pDraw, GC *pGC, int nChars, + unsigned char *data, int xorg, int yorg, int reqType, XID did) +{ + ITclosureRec local_closure; + + local_closure.client = client; + local_closure.pDraw = pDraw; + local_closure.pGC = pGC; + local_closure.nChars = nChars; + local_closure.data = data; + local_closure.xorg = xorg; + local_closure.yorg = yorg; + if ((local_closure.reqType = reqType) == X_ImageText8) + { + local_closure.imageText = (ImageTextPtr) pGC->ops->ImageText8; + local_closure.itemSize = 1; + } + else + { + local_closure.imageText = (ImageTextPtr) pGC->ops->ImageText16; + local_closure.itemSize = 2; + } + local_closure.did = did; + local_closure.slept = FALSE; + + (void) doImageText(client, &local_closure); + return Success; +} + + +/* does the necessary magic to figure out the fpe type */ +static int +DetermineFPEType(char *pathname) +{ + int i; + + for (i = 0; i < num_fpe_types; i++) { + if ((*fpe_functions[i].name_check) (pathname)) + return i; + } + return -1; +} + + +static void +FreeFontPath(FontPathElementPtr *list, int n, Bool force) +{ + int i; + + for (i = 0; i < n; i++) { + if (force) { + /* Sanity check that all refcounts will be 0 by the time + we get to the end of the list. */ + int found = 1; /* the first reference is us */ + int j; + for (j = i+1; j < n; j++) { + if (list[j] == list[i]) + found++; + } + if (list[i]->refcount != found) { + list[i]->refcount = found; /* ensure it will get freed */ + } + } + FreeFPE(list[i]); + } + xfree((char *) list); +} + +static FontPathElementPtr +find_existing_fpe(FontPathElementPtr *list, int num, unsigned char *name, int len) +{ + FontPathElementPtr fpe; + int i; + + for (i = 0; i < num; i++) { + fpe = list[i]; + if (fpe->name_length == len && memcmp(name, fpe->name, len) == 0) + return fpe; + } + return (FontPathElementPtr) 0; +} + + +static int +SetFontPathElements(int npaths, unsigned char *paths, int *bad, Bool persist) +{ + int i, err = 0; + int valid_paths = 0; + unsigned int len; + unsigned char *cp = paths; + FontPathElementPtr fpe = NULL, *fplist; + + fplist = (FontPathElementPtr *) + xalloc(sizeof(FontPathElementPtr) * npaths); + if (!fplist) { + *bad = 0; + return BadAlloc; + } + for (i = 0; i < num_fpe_types; i++) { + if (fpe_functions[i].set_path_hook) + (*fpe_functions[i].set_path_hook) (); + } + for (i = 0; i < npaths; i++) + { + len = (unsigned int) (*cp++); + + if (len == 0) + { + if (persist) + ErrorF ("Removing empty element from the valid list of fontpaths\n"); + err = BadValue; + } + else + { + /* if it's already in our active list, just reset it */ + /* + * note that this can miss FPE's in limbo -- may be worth catching + * them, though it'd muck up refcounting + */ + fpe = find_existing_fpe(font_path_elements, num_fpes, cp, len); + if (fpe) + { + err = (*fpe_functions[fpe->type].reset_fpe) (fpe); + if (err == Successful) + { + UseFPE(fpe);/* since it'll be decref'd later when freed + * from the old list */ + } + else + fpe = 0; + } + /* if error or can't do it, act like it's a new one */ + if (!fpe) + { + fpe = (FontPathElementPtr) xalloc(sizeof(FontPathElementRec)); + if (!fpe) + { + err = BadAlloc; + goto bail; + } + fpe->name = (char *) xalloc(len + 1); + if (!fpe->name) + { + xfree(fpe); + err = BadAlloc; + goto bail; + } + fpe->refcount = 1; + + strncpy(fpe->name, (char *) cp, (int) len); + fpe->name[len] = '\0'; + fpe->name_length = len; + fpe->type = DetermineFPEType(fpe->name); + if (fpe->type == -1) + err = BadValue; + else + err = (*fpe_functions[fpe->type].init_fpe) (fpe); + if (err != Successful) + { + if (persist) + { + ErrorF("Could not init font path element %s, removing from list!\n", + fpe->name); + } + xfree (fpe->name); + xfree (fpe); + } + } + } + if (err != Successful) + { + if (!persist) + goto bail; + } + else + { + fplist[valid_paths++] = fpe; + } + cp += len; + } + + FreeFontPath(font_path_elements, num_fpes, FALSE); + font_path_elements = fplist; + if (patternCache) + EmptyFontPatternCache(patternCache); + num_fpes = valid_paths; + + return Success; +bail: + *bad = i; + while (--valid_paths >= 0) + FreeFPE(fplist[valid_paths]); + xfree(fplist); + return FontToXError(err); +} + +/* XXX -- do we need to pass error down to each renderer? */ +int +SetFontPath(ClientPtr client, int npaths, unsigned char *paths, int *error) +{ + int err = XaceHook(XACE_SERVER_ACCESS, client, DixManageAccess); + if (err != Success) + return err; + + if (npaths == 0) { + if (SetDefaultFontPath(defaultFontPath) != Success) + return BadValue; + } else { + err = SetFontPathElements(npaths, paths, error, FALSE); + } + return err; +} + +int +SetDefaultFontPath(char *path) +{ + unsigned char *cp, + *pp, + *nump, + *newpath; + int num = 1, + len, + err, + size = 0, + bad; + + /* get enough for string, plus values -- use up commas */ + len = strlen(path) + 1; + nump = cp = newpath = (unsigned char *) xalloc(len); + if (!newpath) + return BadAlloc; + pp = (unsigned char *) path; + cp++; + while (*pp) { + if (*pp == ',') { + *nump = (unsigned char) size; + nump = cp++; + pp++; + num++; + size = 0; + } else { + *cp++ = *pp++; + size++; + } + } + *nump = (unsigned char) size; + + err = SetFontPathElements(num, newpath, &bad, TRUE); + + xfree(newpath); + + return err; +} + +int +GetFontPath(ClientPtr client, int *count, int *length, unsigned char **result) +{ + int i; + unsigned char *c; + int len; + FontPathElementPtr fpe; + + i = XaceHook(XACE_SERVER_ACCESS, client, DixGetAttrAccess); + if (i != Success) + return i; + + len = 0; + for (i = 0; i < num_fpes; i++) { + fpe = font_path_elements[i]; + len += fpe->name_length + 1; + } + font_path_string = (unsigned char *) xrealloc(font_path_string, len); + if (!font_path_string) + return BadAlloc; + + c = font_path_string; + *length = 0; + for (i = 0; i < num_fpes; i++) { + fpe = font_path_elements[i]; + *c = fpe->name_length; + *length += *c++; + memmove(c, fpe->name, fpe->name_length); + c += fpe->name_length; + } + *count = num_fpes; + *result = font_path_string; + return Success; +} + +_X_EXPORT int +LoadGlyphs(ClientPtr client, FontPtr pfont, unsigned nchars, int item_size, unsigned char *data) +{ + if (fpe_functions[pfont->fpe->type].load_glyphs) + return (*fpe_functions[pfont->fpe->type].load_glyphs) + (client, pfont, 0, nchars, item_size, data); + else + return Successful; +} + +void +DeleteClientFontStuff(ClientPtr client) +{ + int i; + FontPathElementPtr fpe; + + for (i = 0; i < num_fpes; i++) + { + fpe = font_path_elements[i]; + if (fpe_functions[fpe->type].client_died) + (*fpe_functions[fpe->type].client_died) ((pointer) client, fpe); + } +} + +void +InitFonts (void) +{ + patternCache = MakeFontPatternCache(); + +#ifndef BUILTIN_FONTS + if (screenInfo.numScreens > screenInfo.numVideoScreens) { + PrinterFontRegisterFpeFunctions(); + FontFileCheckRegisterFpeFunctions(); + check_fs_register_fpe_functions(); + } else +#endif + { +#ifdef BUILTIN_FONTS + BuiltinRegisterFpeFunctions(); +#else + FontFileRegisterFpeFunctions(); +#endif +#ifndef NOFONTSERVERACCESS + fs_register_fpe_functions(); +#endif + } +} + +int +GetDefaultPointSize () +{ + return 120; +} + + +FontResolutionPtr +GetClientResolutions (int *num) +{ +#ifdef XPRINT + if (requestingClient && requestingClient->fontResFunc != NULL && + !requestingClient->clientGone) + { + return (*requestingClient->fontResFunc)(requestingClient, num); + } + else +#endif + { + static struct _FontResolution res; + ScreenPtr pScreen; + + pScreen = screenInfo.screens[0]; + res.x_resolution = (pScreen->width * 25.4) / pScreen->mmWidth; + /* + * XXX - we'll want this as long as bitmap instances are prevalent + so that we can match them from scalable fonts + */ + if (res.x_resolution < 88) + res.x_resolution = 75; + else + res.x_resolution = 100; + res.y_resolution = (pScreen->height * 25.4) / pScreen->mmHeight; + if (res.y_resolution < 88) + res.y_resolution = 75; + else + res.y_resolution = 100; + res.point_size = 120; + *num = 1; + return &res; + } +} + +/* + * returns the type index of the new fpe + * + * should be called (only once!) by each type of fpe when initialized + */ + +int +RegisterFPEFunctions(NameCheckFunc name_func, + InitFpeFunc init_func, + FreeFpeFunc free_func, + ResetFpeFunc reset_func, + OpenFontFunc open_func, + CloseFontFunc close_func, + ListFontsFunc list_func, + StartLfwiFunc start_lfwi_func, + NextLfwiFunc next_lfwi_func, + WakeupFpeFunc wakeup_func, + ClientDiedFunc client_died, + LoadGlyphsFunc load_glyphs, + StartLaFunc start_list_alias_func, + NextLaFunc next_list_alias_func, + SetPathFunc set_path_func) +{ + FPEFunctions *new; + + /* grow the list */ + new = (FPEFunctions *) xrealloc(fpe_functions, + (num_fpe_types + 1) * sizeof(FPEFunctions)); + if (!new) + return -1; + fpe_functions = new; + + fpe_functions[num_fpe_types].name_check = name_func; + fpe_functions[num_fpe_types].open_font = open_func; + fpe_functions[num_fpe_types].close_font = close_func; + fpe_functions[num_fpe_types].wakeup_fpe = wakeup_func; + fpe_functions[num_fpe_types].list_fonts = list_func; + fpe_functions[num_fpe_types].start_list_fonts_with_info = + start_lfwi_func; + fpe_functions[num_fpe_types].list_next_font_with_info = + next_lfwi_func; + fpe_functions[num_fpe_types].init_fpe = init_func; + fpe_functions[num_fpe_types].free_fpe = free_func; + fpe_functions[num_fpe_types].reset_fpe = reset_func; + fpe_functions[num_fpe_types].client_died = client_died; + fpe_functions[num_fpe_types].load_glyphs = load_glyphs; + fpe_functions[num_fpe_types].start_list_fonts_and_aliases = + start_list_alias_func; + fpe_functions[num_fpe_types].list_next_font_or_alias = + next_list_alias_func; + fpe_functions[num_fpe_types].set_path_hook = set_path_func; + + return num_fpe_types++; +} + +void +FreeFonts(void) +{ + if (patternCache) { + FreeFontPatternCache(patternCache); + patternCache = 0; + } + FreeFontPath(font_path_elements, num_fpes, TRUE); + font_path_elements = 0; + num_fpes = 0; + xfree(fpe_functions); + num_fpe_types = 0; + fpe_functions = (FPEFunctions *) 0; +} + +/* convenience functions for FS interface */ + +FontPtr +find_old_font(XID id) +{ + return (FontPtr) SecurityLookupIDByType(NullClient, id, RT_NONE, + DixUnknownAccess); +} + +Font +GetNewFontClientID() +{ + return FakeClientID(0); +} + +int +StoreFontClientFont(FontPtr pfont, Font id) +{ + return AddResource(id, RT_NONE, (pointer) pfont); +} + +void +DeleteFontClientID(Font id) +{ + FreeResource(id, RT_NONE); +} + +int +client_auth_generation(ClientPtr client) +{ + return 0; +} + +static int fs_handlers_installed = 0; +static unsigned int last_server_gen; + +int +init_fs_handlers(FontPathElementPtr fpe, BlockHandlerProcPtr block_handler) +{ + /* if server has reset, make sure the b&w handlers are reinstalled */ + if (last_server_gen < serverGeneration) { + last_server_gen = serverGeneration; + fs_handlers_installed = 0; + } + if (fs_handlers_installed == 0) { + if (!RegisterBlockAndWakeupHandlers(block_handler, + FontWakeup, (pointer) 0)) + return AllocError; + fs_handlers_installed++; + } + QueueFontWakeup(fpe); + return Successful; +} + +void +remove_fs_handlers(FontPathElementPtr fpe, BlockHandlerProcPtr block_handler, Bool all) +{ + if (all) { + /* remove the handlers if no one else is using them */ + if (--fs_handlers_installed == 0) { + RemoveBlockAndWakeupHandlers(block_handler, FontWakeup, + (pointer) 0); + } + } + RemoveFontWakeup(fpe); +} diff --git a/xorg-server/dix/dixutils.c b/xorg-server/dix/dixutils.c new file mode 100644 index 000000000..aaf510623 --- /dev/null +++ b/xorg-server/dix/dixutils.c @@ -0,0 +1,898 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +/* + +(c)Copyright 1988,1991 Adobe Systems Incorporated. All rights reserved. + +Permission to use, copy, modify, distribute, and sublicense this software and its +documentation for any purpose and without fee is hereby granted, provided that +the above copyright notices appear in all copies and that both those copyright +notices and this permission notice appear in supporting documentation and that +the name of Adobe Systems Incorporated not be used in advertising or publicity +pertaining to distribution of the software without specific, written prior +permission. No trademark license to use the Adobe trademarks is hereby +granted. If the Adobe trademark "Display PostScript"(tm) is used to describe +this software, its functionality or for any other purpose, such use shall be +limited to a statement that this software works in conjunction with the Display +PostScript system. Proper trademark attribution to reflect Adobe's ownership +of the trademark shall be given whenever any such reference to the Display +PostScript system is made. + +ADOBE MAKES NO REPRESENTATIONS ABOUT THE SUITABILITY OF THE SOFTWARE FOR ANY +PURPOSE. IT IS PROVIDED "AS IS" WITHOUT EXPRESS OR IMPLIED WARRANTY. ADOBE +DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING ALL IMPLIED +WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NON- +INFRINGEMENT OF THIRD PARTY RIGHTS. IN NO EVENT SHALL ADOBE BE LIABLE TO YOU +OR ANY OTHER PARTY FOR ANY SPECIAL, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY +DAMAGES WHATSOEVER WHETHER IN AN ACTION OF CONTRACT,NEGLIGENCE, STRICT +LIABILITY OR ANY OTHER ACTION ARISING OUT OF OR IN CONNECTION WITH THE USE OR +PERFORMANCE OF THIS SOFTWARE. ADOBE WILL NOT PROVIDE ANY TRAINING OR OTHER +SUPPORT FOR THE SOFTWARE. + +Adobe, PostScript, and Display PostScript are trademarks of Adobe Systems +Incorporated which may be registered in certain jurisdictions. + +Author: Adobe Systems Incorporated + +*/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "misc.h" +#include "windowstr.h" +#include "dixstruct.h" +#include "pixmapstr.h" +#include "scrnintstr.h" +#define XK_LATIN1 +#include +#include "xace.h" + +/* + * CompareTimeStamps returns -1, 0, or +1 depending on if the first + * argument is less than, equal to or greater than the second argument. + */ + +_X_EXPORT int +CompareTimeStamps(TimeStamp a, TimeStamp b) +{ + if (a.months < b.months) + return EARLIER; + if (a.months > b.months) + return LATER; + if (a.milliseconds < b.milliseconds) + return EARLIER; + if (a.milliseconds > b.milliseconds) + return LATER; + return SAMETIME; +} + +/* + * convert client times to server TimeStamps + */ + +#define HALFMONTH ((unsigned long) 1<<31) +_X_EXPORT TimeStamp +ClientTimeToServerTime(CARD32 c) +{ + TimeStamp ts; + if (c == CurrentTime) + return currentTime; + ts.months = currentTime.months; + ts.milliseconds = c; + if (c > currentTime.milliseconds) + { + if (((unsigned long) c - currentTime.milliseconds) > HALFMONTH) + ts.months -= 1; + } + else if (c < currentTime.milliseconds) + { + if (((unsigned long)currentTime.milliseconds - c) > HALFMONTH) + ts.months += 1; + } + return ts; +} + +/* + * ISO Latin-1 case conversion routine + * + * this routine always null-terminates the result, so + * beware of too-small buffers + */ + +static unsigned char +ISOLatin1ToLower (unsigned char source) +{ + unsigned char dest; + if ((source >= XK_A) && (source <= XK_Z)) + dest = source + (XK_a - XK_A); + else if ((source >= XK_Agrave) && (source <= XK_Odiaeresis)) + dest = source + (XK_agrave - XK_Agrave); + else if ((source >= XK_Ooblique) && (source <= XK_Thorn)) + dest = source + (XK_oslash - XK_Ooblique); + else + dest = source; + return dest; +} + + +_X_EXPORT void +CopyISOLatin1Lowered(unsigned char *dest, unsigned char *source, int length) +{ + int i; + + for (i = 0; i < length; i++, source++, dest++) + *dest = ISOLatin1ToLower (*source); + *dest = '\0'; +} + +int +CompareISOLatin1Lowered(unsigned char *s1, int s1len, + unsigned char *s2, int s2len) +{ + unsigned char c1, c2; + + for (;;) + { + /* note -- compare against zero so that -1 ignores len */ + c1 = s1len-- ? *s1++ : '\0'; + c2 = s2len-- ? *s2++ : '\0'; + if (!c1 || + (c1 != c2 && + (c1 = ISOLatin1ToLower (c1)) != (c2 = ISOLatin1ToLower (c2)))) + break; + } + return (int) c1 - (int) c2; +} + +/* + * dixLookupWindow and dixLookupDrawable: + * Look up the window/drawable taking into account the client doing the + * lookup, the type of drawable desired, and the type of access desired. + * Return Success with *pDraw set if the window/drawable exists and the client + * is allowed access, else return an error code with *pDraw set to NULL. The + * access mask values are defined in resource.h. The type mask values are + * defined in pixmap.h, with zero equivalent to M_DRAWABLE. + */ +_X_EXPORT int +dixLookupDrawable(DrawablePtr *pDraw, XID id, ClientPtr client, + Mask type, Mask access) +{ + DrawablePtr pTmp; + int rc; + + *pDraw = NULL; + client->errorValue = id; + + if (id == INVALID) + return BadDrawable; + + rc = dixLookupResource((pointer *)&pTmp, id, RC_DRAWABLE, client, access); + + if (rc == BadValue) + return BadDrawable; + if (rc != Success) + return rc; + if (!((1 << pTmp->type) & (type ? type : M_DRAWABLE))) + return BadMatch; + + *pDraw = pTmp; + return Success; +} + +_X_EXPORT int +dixLookupWindow(WindowPtr *pWin, XID id, ClientPtr client, Mask access) +{ + int rc; + rc = dixLookupDrawable((DrawablePtr*)pWin, id, client, M_WINDOW, access); + return (rc == BadDrawable) ? BadWindow : rc; +} + +_X_EXPORT int +dixLookupGC(GCPtr *pGC, XID id, ClientPtr client, Mask access) +{ + GCPtr pTmp = (GCPtr)SecurityLookupIDByType(client, id, RT_GC, access); + if (pTmp) { + *pGC = pTmp; + return Success; + } + client->errorValue = id; + *pGC = NULL; + return BadGC; +} + +_X_EXPORT int +dixLookupClient(ClientPtr *pClient, XID rid, ClientPtr client, Mask access) +{ + pointer pRes; + int rc = BadValue, clientIndex = CLIENT_ID(rid); + + if (!clientIndex || !clients[clientIndex] || (rid & SERVER_BIT)) + goto bad; + + rc = dixLookupResource(&pRes, rid, RC_ANY, client, DixGetAttrAccess); + if (rc != Success) + goto bad; + + rc = XaceHook(XACE_CLIENT_ACCESS, client, clients[clientIndex], access); + if (rc != Success) + goto bad; + + *pClient = clients[clientIndex]; + return Success; +bad: + client->errorValue = rid; + *pClient = NULL; + return rc; +} + +int +AlterSaveSetForClient(ClientPtr client, WindowPtr pWin, unsigned mode, + Bool toRoot, Bool remap) +{ + int numnow; + SaveSetElt *pTmp = NULL; + int j; + + numnow = client->numSaved; + j = 0; + if (numnow) + { + pTmp = client->saveSet; + while ((j < numnow) && (SaveSetWindow(pTmp[j]) != (pointer)pWin)) + j++; + } + if (mode == SetModeInsert) + { + if (j < numnow) /* duplicate */ + return(Success); + numnow++; + pTmp = (SaveSetElt *)xrealloc(client->saveSet, sizeof(*pTmp) * numnow); + if (!pTmp) + return(BadAlloc); + client->saveSet = pTmp; + client->numSaved = numnow; + SaveSetAssignWindow(client->saveSet[numnow - 1], pWin); + SaveSetAssignToRoot(client->saveSet[numnow - 1], toRoot); + SaveSetAssignRemap(client->saveSet[numnow - 1], remap); + return(Success); + } + else if ((mode == SetModeDelete) && (j < numnow)) + { + while (j < numnow-1) + { + pTmp[j] = pTmp[j+1]; + j++; + } + numnow--; + if (numnow) + { + pTmp = (SaveSetElt *)xrealloc(client->saveSet, sizeof(*pTmp) * numnow); + if (pTmp) + client->saveSet = pTmp; + } + else + { + xfree(client->saveSet); + client->saveSet = (SaveSetElt *)NULL; + } + client->numSaved = numnow; + return(Success); + } + return(Success); +} + +void +DeleteWindowFromAnySaveSet(WindowPtr pWin) +{ + int i; + ClientPtr client; + + for (i = 0; i< currentMaxClients; i++) + { + client = clients[i]; + if (client && client->numSaved) + (void)AlterSaveSetForClient(client, pWin, SetModeDelete, FALSE, TRUE); + } +} + +/* No-op Don't Do Anything : sometimes we need to be able to call a procedure + * that doesn't do anything. For example, on screen with only static + * colormaps, if someone calls install colormap, it's easier to have a dummy + * procedure to call than to check if there's a procedure + */ +_X_EXPORT void +NoopDDA(void) +{ +} + +typedef struct _BlockHandler { + BlockHandlerProcPtr BlockHandler; + WakeupHandlerProcPtr WakeupHandler; + pointer blockData; + Bool deleted; +} BlockHandlerRec, *BlockHandlerPtr; + +static BlockHandlerPtr handlers; +static int numHandlers; +static int sizeHandlers; +static Bool inHandler; +static Bool handlerDeleted; + +/** + * + * \param pTimeout DIX doesn't want to know how OS represents time + * \param pReadMask nor how it represents the det of descriptors + */ +void +BlockHandler(pointer pTimeout, pointer pReadmask) +{ + int i, j; + + ++inHandler; + for (i = 0; i < screenInfo.numScreens; i++) + (* screenInfo.screens[i]->BlockHandler)(i, + screenInfo.screens[i]->blockData, + pTimeout, pReadmask); + for (i = 0; i < numHandlers; i++) + (*handlers[i].BlockHandler) (handlers[i].blockData, + pTimeout, pReadmask); + if (handlerDeleted) + { + for (i = 0; i < numHandlers;) + if (handlers[i].deleted) + { + for (j = i; j < numHandlers - 1; j++) + handlers[j] = handlers[j+1]; + numHandlers--; + } + else + i++; + handlerDeleted = FALSE; + } + --inHandler; +} + +/** + * + * \param result 32 bits of undefined result from the wait + * \param pReadmask the resulting descriptor mask + */ +void +WakeupHandler(int result, pointer pReadmask) +{ + int i, j; + + ++inHandler; + for (i = numHandlers - 1; i >= 0; i--) + (*handlers[i].WakeupHandler) (handlers[i].blockData, + result, pReadmask); + for (i = 0; i < screenInfo.numScreens; i++) + (* screenInfo.screens[i]->WakeupHandler)(i, + screenInfo.screens[i]->wakeupData, + result, pReadmask); + if (handlerDeleted) + { + for (i = 0; i < numHandlers;) + if (handlers[i].deleted) + { + for (j = i; j < numHandlers - 1; j++) + handlers[j] = handlers[j+1]; + numHandlers--; + } + else + i++; + handlerDeleted = FALSE; + } + --inHandler; +} + +/** + * Reentrant with BlockHandler and WakeupHandler, except wakeup won't + * get called until next time + */ +_X_EXPORT Bool +RegisterBlockAndWakeupHandlers (BlockHandlerProcPtr blockHandler, + WakeupHandlerProcPtr wakeupHandler, + pointer blockData) +{ + BlockHandlerPtr new; + + if (numHandlers >= sizeHandlers) + { + new = (BlockHandlerPtr) xrealloc (handlers, (numHandlers + 1) * + sizeof (BlockHandlerRec)); + if (!new) + return FALSE; + handlers = new; + sizeHandlers = numHandlers + 1; + } + handlers[numHandlers].BlockHandler = blockHandler; + handlers[numHandlers].WakeupHandler = wakeupHandler; + handlers[numHandlers].blockData = blockData; + handlers[numHandlers].deleted = FALSE; + numHandlers = numHandlers + 1; + return TRUE; +} + +_X_EXPORT void +RemoveBlockAndWakeupHandlers (BlockHandlerProcPtr blockHandler, + WakeupHandlerProcPtr wakeupHandler, + pointer blockData) +{ + int i; + + for (i = 0; i < numHandlers; i++) + if (handlers[i].BlockHandler == blockHandler && + handlers[i].WakeupHandler == wakeupHandler && + handlers[i].blockData == blockData) + { + if (inHandler) + { + handlerDeleted = TRUE; + handlers[i].deleted = TRUE; + } + else + { + for (; i < numHandlers - 1; i++) + handlers[i] = handlers[i+1]; + numHandlers--; + } + break; + } +} + +void +InitBlockAndWakeupHandlers (void) +{ + xfree (handlers); + handlers = (BlockHandlerPtr) 0; + numHandlers = 0; + sizeHandlers = 0; +} + +/* + * A general work queue. Perform some task before the server + * sleeps for input. + */ + +WorkQueuePtr workQueue; +static WorkQueuePtr *workQueueLast = &workQueue; + +void +ProcessWorkQueue(void) +{ + WorkQueuePtr q, *p; + + p = &workQueue; + /* + * Scan the work queue once, calling each function. Those + * which return TRUE are removed from the queue, otherwise + * they will be called again. This must be reentrant with + * QueueWorkProc. + */ + while ((q = *p)) + { + if ((*q->function) (q->client, q->closure)) + { + /* remove q from the list */ + *p = q->next; /* don't fetch until after func called */ + xfree (q); + } + else + { + p = &q->next; /* don't fetch until after func called */ + } + } + workQueueLast = p; +} + +void +ProcessWorkQueueZombies(void) +{ + WorkQueuePtr q, *p; + + p = &workQueue; + while ((q = *p)) + { + if (q->client && q->client->clientGone) + { + (void) (*q->function) (q->client, q->closure); + /* remove q from the list */ + *p = q->next; /* don't fetch until after func called */ + xfree (q); + } + else + { + p = &q->next; /* don't fetch until after func called */ + } + } + workQueueLast = p; +} + +_X_EXPORT Bool +QueueWorkProc ( + Bool (*function)(ClientPtr /* pClient */, pointer /* closure */), + ClientPtr client, pointer closure) +{ + WorkQueuePtr q; + + q = (WorkQueuePtr) xalloc (sizeof *q); + if (!q) + return FALSE; + q->function = function; + q->client = client; + q->closure = closure; + q->next = NULL; + *workQueueLast = q; + workQueueLast = &q->next; + return TRUE; +} + +/* + * Manage a queue of sleeping clients, awakening them + * when requested, by using the OS functions IgnoreClient + * and AttendClient. Note that this *ignores* the troubles + * with request data interleaving itself with events, but + * we'll leave that until a later time. + */ + +typedef struct _SleepQueue { + struct _SleepQueue *next; + ClientPtr client; + ClientSleepProcPtr function; + pointer closure; +} SleepQueueRec, *SleepQueuePtr; + +static SleepQueuePtr sleepQueue = NULL; + +_X_EXPORT Bool +ClientSleep (ClientPtr client, ClientSleepProcPtr function, pointer closure) +{ + SleepQueuePtr q; + + q = (SleepQueuePtr) xalloc (sizeof *q); + if (!q) + return FALSE; + + IgnoreClient (client); + q->next = sleepQueue; + q->client = client; + q->function = function; + q->closure = closure; + sleepQueue = q; + return TRUE; +} + +Bool +ClientSignal (ClientPtr client) +{ + SleepQueuePtr q; + + for (q = sleepQueue; q; q = q->next) + if (q->client == client) + { + return QueueWorkProc (q->function, q->client, q->closure); + } + return FALSE; +} + +_X_EXPORT void +ClientWakeup (ClientPtr client) +{ + SleepQueuePtr q, *prev; + + prev = &sleepQueue; + while ( (q = *prev) ) + { + if (q->client == client) + { + *prev = q->next; + xfree (q); + if (client->clientGone) + /* Oops -- new zombie cleanup code ensures this only + * happens from inside CloseDownClient; don't want to + * recurse here... + */ + /* CloseDownClient(client) */; + else + AttendClient (client); + break; + } + prev = &q->next; + } +} + +Bool +ClientIsAsleep (ClientPtr client) +{ + SleepQueuePtr q; + + for (q = sleepQueue; q; q = q->next) + if (q->client == client) + return TRUE; + return FALSE; +} + +/* + * Generic Callback Manager + */ + +/* ===== Private Procedures ===== */ + +static int numCallbackListsToCleanup = 0; +static CallbackListPtr **listsToCleanup = NULL; + +static Bool +_AddCallback( + CallbackListPtr *pcbl, + CallbackProcPtr callback, + pointer data) +{ + CallbackPtr cbr; + + cbr = (CallbackPtr) xalloc(sizeof(CallbackRec)); + if (!cbr) + return FALSE; + cbr->proc = callback; + cbr->data = data; + cbr->next = (*pcbl)->list; + cbr->deleted = FALSE; + (*pcbl)->list = cbr; + return TRUE; +} + +static Bool +_DeleteCallback( + CallbackListPtr *pcbl, + CallbackProcPtr callback, + pointer data) +{ + CallbackListPtr cbl = *pcbl; + CallbackPtr cbr, pcbr; + + for (pcbr = NULL, cbr = cbl->list; + cbr != NULL; + pcbr = cbr, cbr = cbr->next) + { + if ((cbr->proc == callback) && (cbr->data == data)) + break; + } + if (cbr != NULL) + { + if (cbl->inCallback) + { + ++(cbl->numDeleted); + cbr->deleted = TRUE; + } + else + { + if (pcbr == NULL) + cbl->list = cbr->next; + else + pcbr->next = cbr->next; + xfree(cbr); + } + return TRUE; + } + return FALSE; +} + +static void +_CallCallbacks( + CallbackListPtr *pcbl, + pointer call_data) +{ + CallbackListPtr cbl = *pcbl; + CallbackPtr cbr, pcbr; + + ++(cbl->inCallback); + for (cbr = cbl->list; cbr != NULL; cbr = cbr->next) + { + (*(cbr->proc)) (pcbl, cbr->data, call_data); + } + --(cbl->inCallback); + + if (cbl->inCallback) return; + + /* Was the entire list marked for deletion? */ + + if (cbl->deleted) + { + DeleteCallbackList(pcbl); + return; + } + + /* Were some individual callbacks on the list marked for deletion? + * If so, do the deletions. + */ + + if (cbl->numDeleted) + { + for (pcbr = NULL, cbr = cbl->list; (cbr != NULL) && cbl->numDeleted; ) + { + if (cbr->deleted) + { + if (pcbr) + { + cbr = cbr->next; + xfree(pcbr->next); + pcbr->next = cbr; + } else + { + cbr = cbr->next; + xfree(cbl->list); + cbl->list = cbr; + } + cbl->numDeleted--; + } + else /* this one wasn't deleted */ + { + pcbr = cbr; + cbr = cbr->next; + } + } + } +} + +static void +_DeleteCallbackList( + CallbackListPtr *pcbl) +{ + CallbackListPtr cbl = *pcbl; + CallbackPtr cbr, nextcbr; + int i; + + if (cbl->inCallback) + { + cbl->deleted = TRUE; + return; + } + + for (i = 0; i < numCallbackListsToCleanup; i++) + { + if (listsToCleanup[i] == pcbl) + { + listsToCleanup[i] = NULL; + break; + } + } + + for (cbr = cbl->list; cbr != NULL; cbr = nextcbr) + { + nextcbr = cbr->next; + xfree(cbr); + } + xfree(cbl); + *pcbl = NULL; +} + +static Bool +CreateCallbackList(CallbackListPtr *pcbl) +{ + CallbackListPtr cbl; + int i; + + if (!pcbl) return FALSE; + cbl = (CallbackListPtr) xalloc(sizeof(CallbackListRec)); + if (!cbl) return FALSE; + cbl->inCallback = 0; + cbl->deleted = FALSE; + cbl->numDeleted = 0; + cbl->list = NULL; + *pcbl = cbl; + + for (i = 0; i < numCallbackListsToCleanup; i++) + { + if (!listsToCleanup[i]) + { + listsToCleanup[i] = pcbl; + return TRUE; + } + } + + listsToCleanup = (CallbackListPtr **)xnfrealloc(listsToCleanup, + sizeof(CallbackListPtr *) * (numCallbackListsToCleanup+1)); + listsToCleanup[numCallbackListsToCleanup] = pcbl; + numCallbackListsToCleanup++; + return TRUE; +} + +/* ===== Public Procedures ===== */ + +_X_EXPORT Bool +AddCallback(CallbackListPtr *pcbl, CallbackProcPtr callback, pointer data) +{ + if (!pcbl) return FALSE; + if (!*pcbl) + { /* list hasn't been created yet; go create it */ + if (!CreateCallbackList(pcbl)) + return FALSE; + } + return _AddCallback(pcbl, callback, data); +} + +_X_EXPORT Bool +DeleteCallback(CallbackListPtr *pcbl, CallbackProcPtr callback, pointer data) +{ + if (!pcbl || !*pcbl) return FALSE; + return _DeleteCallback(pcbl, callback, data); +} + +void +CallCallbacks(CallbackListPtr *pcbl, pointer call_data) +{ + if (!pcbl || !*pcbl) return; + _CallCallbacks(pcbl, call_data); +} + +void +DeleteCallbackList(CallbackListPtr *pcbl) +{ + if (!pcbl || !*pcbl) return; + _DeleteCallbackList(pcbl); +} + +void +InitCallbackManager(void) +{ + int i; + + for (i = 0; i < numCallbackListsToCleanup; i++) + { + DeleteCallbackList(listsToCleanup[i]); + } + if (listsToCleanup) xfree(listsToCleanup); + + numCallbackListsToCleanup = 0; + listsToCleanup = NULL; +} diff --git a/xorg-server/dix/events.c b/xorg-server/dix/events.c new file mode 100644 index 000000000..4a8e480c8 --- /dev/null +++ b/xorg-server/dix/events.c @@ -0,0 +1,5145 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + +/* The panoramix components contained the following notice */ +/***************************************************************** + +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ + +/***************************************************************** + +Copyright 2003-2005 Sun Microsystems, Inc. + +All rights reserved. + +Permission is hereby granted, free of charge, to any person obtaining a +copy of this software and associated documentation files (the +"Software"), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, and/or sell copies of the Software, and to permit persons +to whom the Software is furnished to do so, provided that the above +copyright notice(s) and this permission notice appear in all copies of +the Software and that both the above copyright notice(s) and this +permission notice appear in supporting documentation. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT +OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR +HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL +INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING +FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, +NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION +WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + +Except as contained in this notice, the name of a copyright holder +shall not be used in advertising or otherwise to promote the sale, use +or other dealings in this Software without prior written authorization +of the copyright holder. + +******************************************************************/ + +/** @file + * This file handles event delivery and a big part of the server-side protocol + * handling (the parts for input devices). + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "misc.h" +#include "resource.h" +#define NEED_EVENTS +#define NEED_REPLIES +#include +#include "windowstr.h" +#include "inputstr.h" +#include "scrnintstr.h" +#include "cursorstr.h" + +#include "dixstruct.h" +#ifdef PANORAMIX +#include "panoramiX.h" +#include "panoramiXsrv.h" +#endif +#include "globals.h" + +#ifdef XKB +#include +#include +extern Bool XkbFilterEvents(ClientPtr, int, xEvent *); +#endif + +#include "xace.h" + +#ifdef XSERVER_DTRACE +#include +typedef const char *string; +#include "Xserver-dtrace.h" +#endif + +#ifdef XEVIE +extern WindowPtr *WindowTable; +extern int xevieFlag; +extern int xevieClientIndex; +extern DeviceIntPtr xeviemouse; +extern DeviceIntPtr xeviekb; +extern Mask xevieMask; +extern Mask xevieFilters[128]; +extern int xevieEventSent; +extern int xevieKBEventSent; +int xeviegrabState = 0; +#endif + +#include +#include "exglobals.h" +#include "exevents.h" +#include "exglobals.h" +#include "extnsionst.h" + +#include "dixevents.h" +#include "dixgrabs.h" +#include "dispatch.h" +/** + * Extension events type numbering starts at EXTENSION_EVENT_BASE. + */ +#define EXTENSION_EVENT_BASE 64 + +#define NoSuchEvent 0x80000000 /* so doesn't match NoEventMask */ +#define StructureAndSubMask ( StructureNotifyMask | SubstructureNotifyMask ) +#define AllButtonsMask ( \ + Button1Mask | Button2Mask | Button3Mask | Button4Mask | Button5Mask ) +#define MotionMask ( \ + PointerMotionMask | Button1MotionMask | \ + Button2MotionMask | Button3MotionMask | Button4MotionMask | \ + Button5MotionMask | ButtonMotionMask ) +#define PropagateMask ( \ + KeyPressMask | KeyReleaseMask | ButtonPressMask | ButtonReleaseMask | \ + MotionMask ) +#define PointerGrabMask ( \ + ButtonPressMask | ButtonReleaseMask | \ + EnterWindowMask | LeaveWindowMask | \ + PointerMotionHintMask | KeymapStateMask | \ + MotionMask ) +#define AllModifiersMask ( \ + ShiftMask | LockMask | ControlMask | Mod1Mask | Mod2Mask | \ + Mod3Mask | Mod4Mask | Mod5Mask ) +#define AllEventMasks (lastEventMask|(lastEventMask-1)) +/* + * The following relies on the fact that the ButtonMotionMasks are equal + * to the corresponding ButtonMasks from the current modifier/button state. + */ +#define Motion_Filter(class) (PointerMotionMask | \ + (class)->state | (class)->motionMask) + + +#define WID(w) ((w) ? ((w)->drawable.id) : 0) + +#define XE_KBPTR (xE->u.keyButtonPointer) + + +#define rClient(obj) (clients[CLIENT_ID((obj)->resource)]) + +_X_EXPORT CallbackListPtr EventCallback; +_X_EXPORT CallbackListPtr DeviceEventCallback; + +#define DNPMCOUNT 8 + +Mask DontPropagateMasks[DNPMCOUNT]; +static int DontPropagateRefCnts[DNPMCOUNT]; + +/** + * Main input device struct. + * inputInfo.pointer + * is the core pointer. Referred to as "virtual core pointer", "VCP", + * "core pointer" or inputInfo.pointer. There is exactly one core pointer, + * but multiple devices may send core events. If a device generates core + * events, those events will appear to originate from the core pointer. + * + * inputInfo.keyboard + * is the core keyboard ("virtual core keyboard", "VCK", "core keyboard"). + * See inputInfo.pointer. + * + * inputInfo.devices + * linked list containing all devices including VCK and VCP. The VCK will + * always be the first entry, the VCP the second entry in the device list. + * + * inputInfo.off_devices + * Devices that have not been initialized and are thus turned off. + * + * inputInfo.numDevices + * Total number of devices. + */ +_X_EXPORT InputInfo inputInfo; + +static struct { + QdEventPtr pending, *pendtail; + DeviceIntPtr replayDev; /* kludgy rock to put flag for */ + WindowPtr replayWin; /* ComputeFreezes */ + Bool playingEvents; + TimeStamp time; +} syncEvents; + +/* + * The window trace information is used to avoid having to compute all the + * windows between the root and the current pointer window each time a button + * or key goes down. The grabs on each of those windows must be checked. + * + * @see XYToWindow() for a documentation on how the array is set up. + */ +static WindowPtr *spriteTrace = (WindowPtr *)NULL; +#define ROOT spriteTrace[0] +static int spriteTraceSize = 0; +static int spriteTraceGood; + +/** + * DIX sprite information. This is the sprite as seen from the DIX. It does + * not represent the actual sprite rendered to the screen. + * + */ +static struct { + CursorPtr current; + BoxRec hotLimits; /* logical constraints of hot spot */ + Bool confined; /* confined to screen */ +#if defined(SHAPE) || defined(PANORAMIX) + RegionPtr hotShape; /* additional logical shape constraint */ +#endif + BoxRec physLimits; /* physical constraints of hot spot */ + WindowPtr win; /* window of logical position */ + HotSpot hot; /* logical pointer position */ + HotSpot hotPhys; /* physical pointer position */ +#ifdef PANORAMIX + ScreenPtr screen; /* all others are in Screen 0 coordinates */ + RegionRec Reg1; /* Region 1 for confining motion */ + RegionRec Reg2; /* Region 2 for confining virtual motion */ + WindowPtr windows[MAXSCREENS]; + WindowPtr confineWin; /* confine window */ +#endif +} sprite; /* info about the cursor sprite */ + +#ifdef XEVIE +_X_EXPORT WindowPtr xeviewin; +_X_EXPORT HotSpot xeviehot; +#endif + +static void DoEnterLeaveEvents( + WindowPtr fromWin, + WindowPtr toWin, + int mode +); + +static WindowPtr XYToWindow( + int x, + int y +); + +/** + * Max event opcode. + */ +extern int lastEvent; + +static Mask lastEventMask; + +#ifdef XINPUT +extern int DeviceMotionNotify; +#endif + +#define CantBeFiltered NoEventMask +static Mask filters[128] = +{ + NoSuchEvent, /* 0 */ + NoSuchEvent, /* 1 */ + KeyPressMask, /* KeyPress */ + KeyReleaseMask, /* KeyRelease */ + ButtonPressMask, /* ButtonPress */ + ButtonReleaseMask, /* ButtonRelease */ + PointerMotionMask, /* MotionNotify (initial state) */ + EnterWindowMask, /* EnterNotify */ + LeaveWindowMask, /* LeaveNotify */ + FocusChangeMask, /* FocusIn */ + FocusChangeMask, /* FocusOut */ + KeymapStateMask, /* KeymapNotify */ + ExposureMask, /* Expose */ + CantBeFiltered, /* GraphicsExpose */ + CantBeFiltered, /* NoExpose */ + VisibilityChangeMask, /* VisibilityNotify */ + SubstructureNotifyMask, /* CreateNotify */ + StructureAndSubMask, /* DestroyNotify */ + StructureAndSubMask, /* UnmapNotify */ + StructureAndSubMask, /* MapNotify */ + SubstructureRedirectMask, /* MapRequest */ + StructureAndSubMask, /* ReparentNotify */ + StructureAndSubMask, /* ConfigureNotify */ + SubstructureRedirectMask, /* ConfigureRequest */ + StructureAndSubMask, /* GravityNotify */ + ResizeRedirectMask, /* ResizeRequest */ + StructureAndSubMask, /* CirculateNotify */ + SubstructureRedirectMask, /* CirculateRequest */ + PropertyChangeMask, /* PropertyNotify */ + CantBeFiltered, /* SelectionClear */ + CantBeFiltered, /* SelectionRequest */ + CantBeFiltered, /* SelectionNotify */ + ColormapChangeMask, /* ColormapNotify */ + CantBeFiltered, /* ClientMessage */ + CantBeFiltered /* MappingNotify */ +}; + +static CARD8 criticalEvents[32] = +{ + 0x7c /* key and button events */ +}; + +#ifdef PANORAMIX +static void ConfineToShape(RegionPtr shape, int *px, int *py); +static void PostNewCursor(void); + +#define SyntheticMotion(x, y) \ + PostSyntheticMotion(x, y, noPanoramiXExtension ? 0 : \ + sprite.screen->myNum, \ + syncEvents.playingEvents ? \ + syncEvents.time.milliseconds : \ + currentTime.milliseconds); + +static Bool +XineramaSetCursorPosition( + int x, + int y, + Bool generateEvent +){ + ScreenPtr pScreen; + BoxRec box; + int i; + + /* x,y are in Screen 0 coordinates. We need to decide what Screen + to send the message too and what the coordinates relative to + that screen are. */ + + pScreen = sprite.screen; + x += panoramiXdataPtr[0].x; + y += panoramiXdataPtr[0].y; + + if(!POINT_IN_REGION(pScreen, &XineramaScreenRegions[pScreen->myNum], + x, y, &box)) + { + FOR_NSCREENS(i) + { + if(i == pScreen->myNum) + continue; + if(POINT_IN_REGION(pScreen, &XineramaScreenRegions[i], x, y, &box)) + { + pScreen = screenInfo.screens[i]; + break; + } + } + } + + sprite.screen = pScreen; + sprite.hotPhys.x = x - panoramiXdataPtr[0].x; + sprite.hotPhys.y = y - panoramiXdataPtr[0].y; + x -= panoramiXdataPtr[pScreen->myNum].x; + y -= panoramiXdataPtr[pScreen->myNum].y; + + return (*pScreen->SetCursorPosition)(pScreen, x, y, generateEvent); +} + + +static void +XineramaConstrainCursor(void) +{ + ScreenPtr pScreen = sprite.screen; + BoxRec newBox = sprite.physLimits; + + /* Translate the constraining box to the screen + the sprite is actually on */ + newBox.x1 += panoramiXdataPtr[0].x - panoramiXdataPtr[pScreen->myNum].x; + newBox.x2 += panoramiXdataPtr[0].x - panoramiXdataPtr[pScreen->myNum].x; + newBox.y1 += panoramiXdataPtr[0].y - panoramiXdataPtr[pScreen->myNum].y; + newBox.y2 += panoramiXdataPtr[0].y - panoramiXdataPtr[pScreen->myNum].y; + + (* pScreen->ConstrainCursor)(pScreen, &newBox); +} + +static void +XineramaCheckPhysLimits( + CursorPtr cursor, + Bool generateEvents +){ + HotSpot new; + + if (!cursor) + return; + + new = sprite.hotPhys; + + /* I don't care what the DDX has to say about it */ + sprite.physLimits = sprite.hotLimits; + + /* constrain the pointer to those limits */ + if (new.x < sprite.physLimits.x1) + new.x = sprite.physLimits.x1; + else + if (new.x >= sprite.physLimits.x2) + new.x = sprite.physLimits.x2 - 1; + if (new.y < sprite.physLimits.y1) + new.y = sprite.physLimits.y1; + else + if (new.y >= sprite.physLimits.y2) + new.y = sprite.physLimits.y2 - 1; + + if (sprite.hotShape) /* more work if the shape is a mess */ + ConfineToShape(sprite.hotShape, &new.x, &new.y); + + if((new.x != sprite.hotPhys.x) || (new.y != sprite.hotPhys.y)) + { + XineramaSetCursorPosition (new.x, new.y, generateEvents); + if (!generateEvents) + SyntheticMotion(new.x, new.y); + } + + /* Tell DDX what the limits are */ + XineramaConstrainCursor(); +} + + +static Bool +XineramaSetWindowPntrs(WindowPtr pWin) +{ + if(pWin == WindowTable[0]) { + memcpy(sprite.windows, WindowTable, + PanoramiXNumScreens*sizeof(WindowPtr)); + } else { + PanoramiXRes *win; + int i; + + win = (PanoramiXRes*)LookupIDByType(pWin->drawable.id, XRT_WINDOW); + + if(!win) + return FALSE; + + for(i = 0; i < PanoramiXNumScreens; i++) { + sprite.windows[i] = LookupIDByType(win->info[i].id, RT_WINDOW); + if(!sprite.windows[i]) /* window is being unmapped */ + return FALSE; + } + } + return TRUE; +} + +static void +XineramaCheckVirtualMotion( + QdEventPtr qe, + WindowPtr pWin +){ + + if (qe) + { + sprite.hot.pScreen = qe->pScreen; /* should always be Screen 0 */ + sprite.hot.x = qe->event->u.keyButtonPointer.rootX; + sprite.hot.y = qe->event->u.keyButtonPointer.rootY; + pWin = inputInfo.pointer->grab ? inputInfo.pointer->grab->confineTo : + NullWindow; + } + if (pWin) + { + int x, y, off_x, off_y, i; + BoxRec lims; + + if(!XineramaSetWindowPntrs(pWin)) + return; + + i = PanoramiXNumScreens - 1; + + REGION_COPY(sprite.screen, &sprite.Reg2, + &sprite.windows[i]->borderSize); + off_x = panoramiXdataPtr[i].x; + off_y = panoramiXdataPtr[i].y; + + while(i--) { + x = off_x - panoramiXdataPtr[i].x; + y = off_y - panoramiXdataPtr[i].y; + + if(x || y) + REGION_TRANSLATE(sprite.screen, &sprite.Reg2, x, y); + + REGION_UNION(sprite.screen, &sprite.Reg2, &sprite.Reg2, + &sprite.windows[i]->borderSize); + + off_x = panoramiXdataPtr[i].x; + off_y = panoramiXdataPtr[i].y; + } + + lims = *REGION_EXTENTS(sprite.screen, &sprite.Reg2); + + if (sprite.hot.x < lims.x1) + sprite.hot.x = lims.x1; + else if (sprite.hot.x >= lims.x2) + sprite.hot.x = lims.x2 - 1; + if (sprite.hot.y < lims.y1) + sprite.hot.y = lims.y1; + else if (sprite.hot.y >= lims.y2) + sprite.hot.y = lims.y2 - 1; + + if (REGION_NUM_RECTS(&sprite.Reg2) > 1) + ConfineToShape(&sprite.Reg2, &sprite.hot.x, &sprite.hot.y); + + if (qe) + { + qe->pScreen = sprite.hot.pScreen; + qe->event->u.keyButtonPointer.rootX = sprite.hot.x; + qe->event->u.keyButtonPointer.rootY = sprite.hot.y; + } + } +#ifdef XEVIE + xeviehot.x = sprite.hot.x; + xeviehot.y = sprite.hot.y; +#endif +} + + +static Bool +XineramaCheckMotion(xEvent *xE) +{ + WindowPtr prevSpriteWin = sprite.win; + + if (xE && !syncEvents.playingEvents) + { + /* Motion events entering DIX get translated to Screen 0 + coordinates. Replayed events have already been + translated since they've entered DIX before */ + XE_KBPTR.rootX += panoramiXdataPtr[sprite.screen->myNum].x - + panoramiXdataPtr[0].x; + XE_KBPTR.rootY += panoramiXdataPtr[sprite.screen->myNum].y - + panoramiXdataPtr[0].y; + sprite.hot.x = XE_KBPTR.rootX; + sprite.hot.y = XE_KBPTR.rootY; + if (sprite.hot.x < sprite.physLimits.x1) + sprite.hot.x = sprite.physLimits.x1; + else if (sprite.hot.x >= sprite.physLimits.x2) + sprite.hot.x = sprite.physLimits.x2 - 1; + if (sprite.hot.y < sprite.physLimits.y1) + sprite.hot.y = sprite.physLimits.y1; + else if (sprite.hot.y >= sprite.physLimits.y2) + sprite.hot.y = sprite.physLimits.y2 - 1; + + if (sprite.hotShape) + ConfineToShape(sprite.hotShape, &sprite.hot.x, &sprite.hot.y); + + sprite.hotPhys = sprite.hot; + if ((sprite.hotPhys.x != XE_KBPTR.rootX) || + (sprite.hotPhys.y != XE_KBPTR.rootY)) + { + XineramaSetCursorPosition( + sprite.hotPhys.x, sprite.hotPhys.y, FALSE); + } + XE_KBPTR.rootX = sprite.hot.x; + XE_KBPTR.rootY = sprite.hot.y; + } + +#ifdef XEVIE + xeviehot.x = sprite.hot.x; + xeviehot.y = sprite.hot.y; + xeviewin = +#endif + sprite.win = XYToWindow(sprite.hot.x, sprite.hot.y); + + if (sprite.win != prevSpriteWin) + { + if (prevSpriteWin != NullWindow) { + if (!xE) + UpdateCurrentTimeIf(); + DoEnterLeaveEvents(prevSpriteWin, sprite.win, NotifyNormal); + } + PostNewCursor(); + return FALSE; + } + return TRUE; +} + + +static void +XineramaConfineCursorToWindow(WindowPtr pWin, Bool generateEvents) +{ + + if (syncEvents.playingEvents) + { + XineramaCheckVirtualMotion((QdEventPtr)NULL, pWin); + SyntheticMotion(sprite.hot.x, sprite.hot.y); + } + else + { + int x, y, off_x, off_y, i; + + if(!XineramaSetWindowPntrs(pWin)) + return; + + i = PanoramiXNumScreens - 1; + + REGION_COPY(sprite.screen, &sprite.Reg1, + &sprite.windows[i]->borderSize); + off_x = panoramiXdataPtr[i].x; + off_y = panoramiXdataPtr[i].y; + + while(i--) { + x = off_x - panoramiXdataPtr[i].x; + y = off_y - panoramiXdataPtr[i].y; + + if(x || y) + REGION_TRANSLATE(sprite.screen, &sprite.Reg1, x, y); + + REGION_UNION(sprite.screen, &sprite.Reg1, &sprite.Reg1, + &sprite.windows[i]->borderSize); + + off_x = panoramiXdataPtr[i].x; + off_y = panoramiXdataPtr[i].y; + } + + sprite.hotLimits = *REGION_EXTENTS(sprite.screen, &sprite.Reg1); + + if(REGION_NUM_RECTS(&sprite.Reg1) > 1) + sprite.hotShape = &sprite.Reg1; + else + sprite.hotShape = NullRegion; + + sprite.confined = FALSE; + sprite.confineWin = (pWin == WindowTable[0]) ? NullWindow : pWin; + + XineramaCheckPhysLimits(sprite.current, generateEvents); + } +} + + +static void +XineramaChangeToCursor(CursorPtr cursor) +{ + if (cursor != sprite.current) + { + if ((sprite.current->bits->xhot != cursor->bits->xhot) || + (sprite.current->bits->yhot != cursor->bits->yhot)) + XineramaCheckPhysLimits(cursor, FALSE); + (*sprite.screen->DisplayCursor)(sprite.screen, cursor); + FreeCursor(sprite.current, (Cursor)0); + sprite.current = cursor; + sprite.current->refcnt++; + } +} + +#else +#define SyntheticMotion(x, y) \ + PostSyntheticMotion(x, y, \ + 0, \ + syncEvents.playingEvents ? \ + syncEvents.time.milliseconds : \ + currentTime.milliseconds); + +#endif /* PANORAMIX */ + +void +SetMaskForEvent(Mask mask, int event) +{ + if ((event < LASTEvent) || (event >= 128)) + FatalError("SetMaskForEvent: bogus event number"); + filters[event] = mask; +} + +_X_EXPORT void +SetCriticalEvent(int event) +{ + if (event >= 128) + FatalError("SetCriticalEvent: bogus event number"); + criticalEvents[event >> 3] |= 1 << (event & 7); +} + +#ifdef SHAPE +static void +ConfineToShape(RegionPtr shape, int *px, int *py) +{ + BoxRec box; + int x = *px, y = *py; + int incx = 1, incy = 1; + + if (POINT_IN_REGION(sprite.hot.pScreen, shape, x, y, &box)) + return; + box = *REGION_EXTENTS(sprite.hot.pScreen, shape); + /* this is rather crude */ + do { + x += incx; + if (x >= box.x2) + { + incx = -1; + x = *px - 1; + } + else if (x < box.x1) + { + incx = 1; + x = *px; + y += incy; + if (y >= box.y2) + { + incy = -1; + y = *py - 1; + } + else if (y < box.y1) + return; /* should never get here! */ + } + } while (!POINT_IN_REGION(sprite.hot.pScreen, shape, x, y, &box)); + *px = x; + *py = y; +} +#endif + +static void +CheckPhysLimits( + CursorPtr cursor, + Bool generateEvents, + Bool confineToScreen, + ScreenPtr pScreen) +{ + HotSpot new; + + if (!cursor) + return; + new = sprite.hotPhys; + if (pScreen) + new.pScreen = pScreen; + else + pScreen = new.pScreen; + (*pScreen->CursorLimits) (pScreen, cursor, &sprite.hotLimits, + &sprite.physLimits); + sprite.confined = confineToScreen; + (* pScreen->ConstrainCursor)(pScreen, &sprite.physLimits); + if (new.x < sprite.physLimits.x1) + new.x = sprite.physLimits.x1; + else + if (new.x >= sprite.physLimits.x2) + new.x = sprite.physLimits.x2 - 1; + if (new.y < sprite.physLimits.y1) + new.y = sprite.physLimits.y1; + else + if (new.y >= sprite.physLimits.y2) + new.y = sprite.physLimits.y2 - 1; +#ifdef SHAPE + if (sprite.hotShape) + ConfineToShape(sprite.hotShape, &new.x, &new.y); +#endif + if ((pScreen != sprite.hotPhys.pScreen) || + (new.x != sprite.hotPhys.x) || (new.y != sprite.hotPhys.y)) + { + if (pScreen != sprite.hotPhys.pScreen) + sprite.hotPhys = new; + (*pScreen->SetCursorPosition) (pScreen, new.x, new.y, generateEvents); + if (!generateEvents) + SyntheticMotion(new.x, new.y); + } +} + +static void +CheckVirtualMotion( + QdEventPtr qe, + WindowPtr pWin) +{ +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + XineramaCheckVirtualMotion(qe, pWin); + return; + } +#endif + if (qe) + { + sprite.hot.pScreen = qe->pScreen; + sprite.hot.x = qe->event->u.keyButtonPointer.rootX; + sprite.hot.y = qe->event->u.keyButtonPointer.rootY; + pWin = inputInfo.pointer->grab ? inputInfo.pointer->grab->confineTo : + NullWindow; + } + if (pWin) + { + BoxRec lims; + + if (sprite.hot.pScreen != pWin->drawable.pScreen) + { + sprite.hot.pScreen = pWin->drawable.pScreen; + sprite.hot.x = sprite.hot.y = 0; + } + lims = *REGION_EXTENTS(pWin->drawable.pScreen, &pWin->borderSize); + if (sprite.hot.x < lims.x1) + sprite.hot.x = lims.x1; + else if (sprite.hot.x >= lims.x2) + sprite.hot.x = lims.x2 - 1; + if (sprite.hot.y < lims.y1) + sprite.hot.y = lims.y1; + else if (sprite.hot.y >= lims.y2) + sprite.hot.y = lims.y2 - 1; +#ifdef SHAPE + if (wBoundingShape(pWin)) + ConfineToShape(&pWin->borderSize, &sprite.hot.x, &sprite.hot.y); +#endif + if (qe) + { + qe->pScreen = sprite.hot.pScreen; + qe->event->u.keyButtonPointer.rootX = sprite.hot.x; + qe->event->u.keyButtonPointer.rootY = sprite.hot.y; + } + } +#ifdef XEVIE + xeviehot.x = sprite.hot.x; + xeviehot.y = sprite.hot.y; +#endif + ROOT = WindowTable[sprite.hot.pScreen->myNum]; +} + +static void +ConfineCursorToWindow(WindowPtr pWin, Bool generateEvents, Bool confineToScreen) +{ + ScreenPtr pScreen = pWin->drawable.pScreen; + +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + XineramaConfineCursorToWindow(pWin, generateEvents); + return; + } +#endif + + if (syncEvents.playingEvents) + { + CheckVirtualMotion((QdEventPtr)NULL, pWin); + SyntheticMotion(sprite.hot.x, sprite.hot.y); + } + else + { + sprite.hotLimits = *REGION_EXTENTS( pScreen, &pWin->borderSize); +#ifdef SHAPE + sprite.hotShape = wBoundingShape(pWin) ? &pWin->borderSize + : NullRegion; +#endif + CheckPhysLimits(sprite.current, generateEvents, confineToScreen, + pScreen); + } +} + +_X_EXPORT Bool +PointerConfinedToScreen(void) +{ + return sprite.confined; +} + +/** + * Update the sprite cursor to the given cursor. + * + * ChangeToCursor() will display the new cursor and free the old cursor (if + * applicable). If the provided cursor is already the updated cursor, nothing + * happens. + */ +static void +ChangeToCursor(CursorPtr cursor) +{ +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + XineramaChangeToCursor(cursor); + return; + } +#endif + + if (cursor != sprite.current) + { + if ((sprite.current->bits->xhot != cursor->bits->xhot) || + (sprite.current->bits->yhot != cursor->bits->yhot)) + CheckPhysLimits(cursor, FALSE, sprite.confined, + (ScreenPtr)NULL); + (*sprite.hotPhys.pScreen->DisplayCursor) (sprite.hotPhys.pScreen, + cursor); + FreeCursor(sprite.current, (Cursor)0); + sprite.current = cursor; + sprite.current->refcnt++; + } +} + +/** + * @returns true if b is a descendent of a + */ +Bool +IsParent(WindowPtr a, WindowPtr b) +{ + for (b = b->parent; b; b = b->parent) + if (b == a) return TRUE; + return FALSE; +} + +/** + * Update the cursor displayed on the screen. + * + * Called whenever a cursor may have changed shape or position. + */ +static void +PostNewCursor(void) +{ + WindowPtr win; + GrabPtr grab = inputInfo.pointer->grab; + + if (syncEvents.playingEvents) + return; + if (grab) + { + if (grab->cursor) + { + ChangeToCursor(grab->cursor); + return; + } + if (IsParent(grab->window, sprite.win)) + win = sprite.win; + else + win = grab->window; + } + else + win = sprite.win; + for (; win; win = win->parent) + if (win->optional && win->optional->cursor != NullCursor) + { + ChangeToCursor(win->optional->cursor); + return; + } +} + +/** + * @return root window of current active screen. + */ +_X_EXPORT WindowPtr +GetCurrentRootWindow(void) +{ + return ROOT; +} + +/** + * @return window underneath the cursor sprite. + */ +_X_EXPORT WindowPtr +GetSpriteWindow(void) +{ + return sprite.win; +} + +/** + * @return current sprite cursor. + */ +_X_EXPORT CursorPtr +GetSpriteCursor(void) +{ + return sprite.current; +} + +/** + * Set x/y current sprite position in screen coordinates. + */ +_X_EXPORT void +GetSpritePosition(int *px, int *py) +{ + *px = sprite.hotPhys.x; + *py = sprite.hotPhys.y; +} + +#ifdef PANORAMIX +_X_EXPORT int +XineramaGetCursorScreen(void) +{ + if(!noPanoramiXExtension) { + return sprite.screen->myNum; + } else { + return 0; + } +} +#endif /* PANORAMIX */ + +#define TIMESLOP (5 * 60 * 1000) /* 5 minutes */ + +static void +MonthChangedOrBadTime(xEvent *xE) +{ + /* If the ddx/OS is careless about not processing timestamped events from + * different sources in sorted order, then it's possible for time to go + * backwards when it should not. Here we ensure a decent time. + */ + if ((currentTime.milliseconds - XE_KBPTR.time) > TIMESLOP) + currentTime.months++; + else + XE_KBPTR.time = currentTime.milliseconds; +} + +#define NoticeTime(xE) { \ + if ((xE)->u.keyButtonPointer.time < currentTime.milliseconds) \ + MonthChangedOrBadTime(xE); \ + currentTime.milliseconds = (xE)->u.keyButtonPointer.time; \ + lastDeviceEventTime = currentTime; } + +void +NoticeEventTime(xEvent *xE) +{ + if (!syncEvents.playingEvents) + NoticeTime(xE); +} + +/************************************************************************** + * The following procedures deal with synchronous events * + **************************************************************************/ + +void +EnqueueEvent(xEvent *xE, DeviceIntPtr device, int count) +{ + QdEventPtr tail = *syncEvents.pendtail; + QdEventPtr qe; + xEvent *qxE; + + NoticeTime(xE); + +#ifdef XKB + /* Fix for key repeating bug. */ + if (device->key != NULL && device->key->xkbInfo != NULL && + xE->u.u.type == KeyRelease) + AccessXCancelRepeatKey(device->key->xkbInfo, xE->u.u.detail); +#endif + + if (DeviceEventCallback) + { + DeviceEventInfoRec eventinfo; + /* The RECORD spec says that the root window field of motion events + * must be valid. At this point, it hasn't been filled in yet, so + * we do it here. The long expression below is necessary to get + * the current root window; the apparently reasonable alternative + * GetCurrentRootWindow()->drawable.id doesn't give you the right + * answer on the first motion event after a screen change because + * the data that GetCurrentRootWindow relies on hasn't been + * updated yet. + */ + if (xE->u.u.type == MotionNotify) + XE_KBPTR.root = + WindowTable[sprite.hotPhys.pScreen->myNum]->drawable.id; + eventinfo.events = xE; + eventinfo.count = count; + CallCallbacks(&DeviceEventCallback, (pointer)&eventinfo); + } + if (xE->u.u.type == MotionNotify) + { +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + XE_KBPTR.rootX += panoramiXdataPtr[sprite.screen->myNum].x - + panoramiXdataPtr[0].x; + XE_KBPTR.rootY += panoramiXdataPtr[sprite.screen->myNum].y - + panoramiXdataPtr[0].y; + } +#endif + sprite.hotPhys.x = XE_KBPTR.rootX; + sprite.hotPhys.y = XE_KBPTR.rootY; + /* do motion compression, but not if from different devices */ + if (tail && + (tail->event->u.u.type == MotionNotify) && + (tail->device == device) && + (tail->pScreen == sprite.hotPhys.pScreen)) + { + tail->event->u.keyButtonPointer.rootX = sprite.hotPhys.x; + tail->event->u.keyButtonPointer.rootY = sprite.hotPhys.y; + tail->event->u.keyButtonPointer.time = XE_KBPTR.time; + tail->months = currentTime.months; + return; + } + } + qe = (QdEventPtr)xalloc(sizeof(QdEventRec) + (count * sizeof(xEvent))); + if (!qe) + return; + qe->next = (QdEventPtr)NULL; + qe->device = device; + qe->pScreen = sprite.hotPhys.pScreen; + qe->months = currentTime.months; + qe->event = (xEvent *)(qe + 1); + qe->evcount = count; + for (qxE = qe->event; --count >= 0; qxE++, xE++) + *qxE = *xE; + if (tail) + syncEvents.pendtail = &tail->next; + *syncEvents.pendtail = qe; +} + +static void +PlayReleasedEvents(void) +{ + QdEventPtr *prev, qe; + DeviceIntPtr dev; + + prev = &syncEvents.pending; + while ( (qe = *prev) ) + { + if (!qe->device->sync.frozen) + { + *prev = qe->next; + if (*syncEvents.pendtail == *prev) + syncEvents.pendtail = prev; + if (qe->event->u.u.type == MotionNotify) + CheckVirtualMotion(qe, NullWindow); + syncEvents.time.months = qe->months; + syncEvents.time.milliseconds = qe->event->u.keyButtonPointer.time; +#ifdef PANORAMIX + /* Translate back to the sprite screen since processInputProc + will translate from sprite screen to screen 0 upon reentry + to the DIX layer */ + if(!noPanoramiXExtension) { + qe->event->u.keyButtonPointer.rootX += + panoramiXdataPtr[0].x - + panoramiXdataPtr[sprite.screen->myNum].x; + qe->event->u.keyButtonPointer.rootY += + panoramiXdataPtr[0].y - + panoramiXdataPtr[sprite.screen->myNum].y; + } +#endif + (*qe->device->public.processInputProc)(qe->event, qe->device, + qe->evcount); + xfree(qe); + for (dev = inputInfo.devices; dev && dev->sync.frozen; dev = dev->next) + ; + if (!dev) + break; + /* Playing the event may have unfrozen another device. */ + /* So to play it safe, restart at the head of the queue */ + prev = &syncEvents.pending; + } + else + prev = &qe->next; + } +} + +static void +FreezeThaw(DeviceIntPtr dev, Bool frozen) +{ + dev->sync.frozen = frozen; + if (frozen) + dev->public.processInputProc = dev->public.enqueueInputProc; + else + dev->public.processInputProc = dev->public.realInputProc; +} + +static void +ComputeFreezes(void) +{ + DeviceIntPtr replayDev = syncEvents.replayDev; + int i; + WindowPtr w; + xEvent *xE; + int count; + GrabPtr grab; + DeviceIntPtr dev; + + for (dev = inputInfo.devices; dev; dev = dev->next) + FreezeThaw(dev, dev->sync.other || (dev->sync.state >= FROZEN)); + if (syncEvents.playingEvents || (!replayDev && !syncEvents.pending)) + return; + syncEvents.playingEvents = TRUE; + if (replayDev) + { + xE = replayDev->sync.event; + count = replayDev->sync.evcount; + syncEvents.replayDev = (DeviceIntPtr)NULL; + + w = XYToWindow( XE_KBPTR.rootX, XE_KBPTR.rootY); + for (i = 0; i < spriteTraceGood; i++) + { + if (syncEvents.replayWin == spriteTrace[i]) + { + if (!CheckDeviceGrabs(replayDev, xE, i+1, count)) { + if (replayDev->focus) + DeliverFocusedEvent(replayDev, xE, w, count); + else + DeliverDeviceEvents(w, xE, NullGrab, NullWindow, + replayDev, count); + } + goto playmore; + } + } + /* must not still be in the same stack */ + if (replayDev->focus) + DeliverFocusedEvent(replayDev, xE, w, count); + else + DeliverDeviceEvents(w, xE, NullGrab, NullWindow, replayDev, count); + } +playmore: + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (!dev->sync.frozen) + { + PlayReleasedEvents(); + break; + } + } + syncEvents.playingEvents = FALSE; + /* the following may have been skipped during replay, so do it now */ + if ((grab = inputInfo.pointer->grab) && grab->confineTo) + { + if (grab->confineTo->drawable.pScreen != sprite.hotPhys.pScreen) + sprite.hotPhys.x = sprite.hotPhys.y = 0; + ConfineCursorToWindow(grab->confineTo, TRUE, TRUE); + } + else + ConfineCursorToWindow(WindowTable[sprite.hotPhys.pScreen->myNum], + TRUE, FALSE); + PostNewCursor(); +} + +#ifdef RANDR +void +ScreenRestructured (ScreenPtr pScreen) +{ + GrabPtr grab; + + if ((grab = inputInfo.pointer->grab) && grab->confineTo) + { + if (grab->confineTo->drawable.pScreen != sprite.hotPhys.pScreen) + sprite.hotPhys.x = sprite.hotPhys.y = 0; + ConfineCursorToWindow(grab->confineTo, TRUE, TRUE); + } + else + ConfineCursorToWindow(WindowTable[sprite.hotPhys.pScreen->myNum], + TRUE, FALSE); +} +#endif + +static void +CheckGrabForSyncs(DeviceIntPtr thisDev, Bool thisMode, Bool otherMode) +{ + GrabPtr grab = thisDev->grab; + DeviceIntPtr dev; + + if (thisMode == GrabModeSync) + thisDev->sync.state = FROZEN_NO_EVENT; + else + { /* free both if same client owns both */ + thisDev->sync.state = THAWED; + if (thisDev->sync.other && + (CLIENT_BITS(thisDev->sync.other->resource) == + CLIENT_BITS(grab->resource))) + thisDev->sync.other = NullGrab; + } + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev != thisDev) + { + if (otherMode == GrabModeSync) + dev->sync.other = grab; + else + { /* free both if same client owns both */ + if (dev->sync.other && + (CLIENT_BITS(dev->sync.other->resource) == + CLIENT_BITS(grab->resource))) + dev->sync.other = NullGrab; + } + } + } + ComputeFreezes(); +} + +/** + * Activate a pointer grab on the given device. A pointer grab will cause all + * core pointer events to be delivered to the grabbing client only. Can cause + * the cursor to change if a grab cursor is set. + * + * As a pointer grab can only be issued on the core devices, mouse is always + * inputInfo.pointer. Extension devices are set up for ActivateKeyboardGrab(). + * + * @param mouse The device to grab. + * @param grab The grab structure, needs to be setup. + * @param autoGrab True if the grab was caused by a button down event and not + * explicitely by a client. + */ +void +ActivatePointerGrab(DeviceIntPtr mouse, GrabPtr grab, + TimeStamp time, Bool autoGrab) +{ + WindowPtr oldWin = (mouse->grab) ? mouse->grab->window + : sprite.win; + + if (grab->confineTo) + { + if (grab->confineTo->drawable.pScreen != sprite.hotPhys.pScreen) + sprite.hotPhys.x = sprite.hotPhys.y = 0; + ConfineCursorToWindow(grab->confineTo, FALSE, TRUE); + } + DoEnterLeaveEvents(oldWin, grab->window, NotifyGrab); + mouse->valuator->motionHintWindow = NullWindow; + if (syncEvents.playingEvents) + mouse->grabTime = syncEvents.time; + else + mouse->grabTime = time; + if (grab->cursor) + grab->cursor->refcnt++; + mouse->activeGrab = *grab; + mouse->grab = &mouse->activeGrab; + mouse->fromPassiveGrab = autoGrab; + PostNewCursor(); + CheckGrabForSyncs(mouse,(Bool)grab->pointerMode, (Bool)grab->keyboardMode); +} + +/** + * Delete grab on given device, update the sprite. + * + * As a pointer grab can only be issued on the core devices, mouse is always + * inputInfo.pointer. Extension devices are set up for ActivateKeyboardGrab(). + */ +void +DeactivatePointerGrab(DeviceIntPtr mouse) +{ + GrabPtr grab = mouse->grab; + DeviceIntPtr dev; + + mouse->valuator->motionHintWindow = NullWindow; + mouse->grab = NullGrab; + mouse->sync.state = NOT_GRABBED; + mouse->fromPassiveGrab = FALSE; + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev->sync.other == grab) + dev->sync.other = NullGrab; + } + DoEnterLeaveEvents(grab->window, sprite.win, NotifyUngrab); + if (grab->confineTo) + ConfineCursorToWindow(ROOT, FALSE, FALSE); + PostNewCursor(); + if (grab->cursor) + FreeCursor(grab->cursor, (Cursor)0); + ComputeFreezes(); +} + +/** + * Activate a keyboard grab on the given device. + * + * Extension devices have ActivateKeyboardGrab() set as their grabbing proc. + */ +void +ActivateKeyboardGrab(DeviceIntPtr keybd, GrabPtr grab, TimeStamp time, Bool passive) +{ + WindowPtr oldWin; + + if (keybd->grab) + oldWin = keybd->grab->window; + else if (keybd->focus) + oldWin = keybd->focus->win; + else + oldWin = sprite.win; + if (oldWin == FollowKeyboardWin) + oldWin = inputInfo.keyboard->focus->win; + if (keybd->valuator) + keybd->valuator->motionHintWindow = NullWindow; + DoFocusEvents(keybd, oldWin, grab->window, NotifyGrab); + if (syncEvents.playingEvents) + keybd->grabTime = syncEvents.time; + else + keybd->grabTime = time; + keybd->activeGrab = *grab; + keybd->grab = &keybd->activeGrab; + keybd->fromPassiveGrab = passive; + CheckGrabForSyncs(keybd, (Bool)grab->keyboardMode, (Bool)grab->pointerMode); +} + +/** + * Delete keyboard grab for the given device. + */ +void +DeactivateKeyboardGrab(DeviceIntPtr keybd) +{ + GrabPtr grab = keybd->grab; + DeviceIntPtr dev; + WindowPtr focusWin = keybd->focus ? keybd->focus->win + : sprite.win; + + if (focusWin == FollowKeyboardWin) + focusWin = inputInfo.keyboard->focus->win; + if (keybd->valuator) + keybd->valuator->motionHintWindow = NullWindow; + keybd->grab = NullGrab; + keybd->sync.state = NOT_GRABBED; + keybd->fromPassiveGrab = FALSE; + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev->sync.other == grab) + dev->sync.other = NullGrab; + } + DoFocusEvents(keybd, grab->window, focusWin, NotifyUngrab); + ComputeFreezes(); +} + +void +AllowSome(ClientPtr client, TimeStamp time, DeviceIntPtr thisDev, int newState) +{ + Bool thisGrabbed, otherGrabbed, othersFrozen, thisSynced; + TimeStamp grabTime; + DeviceIntPtr dev; + + thisGrabbed = thisDev->grab && SameClient(thisDev->grab, client); + thisSynced = FALSE; + otherGrabbed = FALSE; + othersFrozen = TRUE; + grabTime = thisDev->grabTime; + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev == thisDev) + continue; + if (dev->grab && SameClient(dev->grab, client)) + { + if (!(thisGrabbed || otherGrabbed) || + (CompareTimeStamps(dev->grabTime, grabTime) == LATER)) + grabTime = dev->grabTime; + otherGrabbed = TRUE; + if (thisDev->sync.other == dev->grab) + thisSynced = TRUE; + if (dev->sync.state < FROZEN) + othersFrozen = FALSE; + } + else if (!dev->sync.other || !SameClient(dev->sync.other, client)) + othersFrozen = FALSE; + } + if (!((thisGrabbed && thisDev->sync.state >= FROZEN) || thisSynced)) + return; + if ((CompareTimeStamps(time, currentTime) == LATER) || + (CompareTimeStamps(time, grabTime) == EARLIER)) + return; + switch (newState) + { + case THAWED: /* Async */ + if (thisGrabbed) + thisDev->sync.state = THAWED; + if (thisSynced) + thisDev->sync.other = NullGrab; + ComputeFreezes(); + break; + case FREEZE_NEXT_EVENT: /* Sync */ + if (thisGrabbed) + { + thisDev->sync.state = FREEZE_NEXT_EVENT; + if (thisSynced) + thisDev->sync.other = NullGrab; + ComputeFreezes(); + } + break; + case THAWED_BOTH: /* AsyncBoth */ + if (othersFrozen) + { + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev->grab && SameClient(dev->grab, client)) + dev->sync.state = THAWED; + if (dev->sync.other && SameClient(dev->sync.other, client)) + dev->sync.other = NullGrab; + } + ComputeFreezes(); + } + break; + case FREEZE_BOTH_NEXT_EVENT: /* SyncBoth */ + if (othersFrozen) + { + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev->grab && SameClient(dev->grab, client)) + dev->sync.state = FREEZE_BOTH_NEXT_EVENT; + if (dev->sync.other && SameClient(dev->sync.other, client)) + dev->sync.other = NullGrab; + } + ComputeFreezes(); + } + break; + case NOT_GRABBED: /* Replay */ + if (thisGrabbed && thisDev->sync.state == FROZEN_WITH_EVENT) + { + if (thisSynced) + thisDev->sync.other = NullGrab; + syncEvents.replayDev = thisDev; + syncEvents.replayWin = thisDev->grab->window; + (*thisDev->DeactivateGrab)(thisDev); + syncEvents.replayDev = (DeviceIntPtr)NULL; + } + break; + case THAW_OTHERS: /* AsyncOthers */ + if (othersFrozen) + { + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev == thisDev) + continue; + if (dev->grab && SameClient(dev->grab, client)) + dev->sync.state = THAWED; + if (dev->sync.other && SameClient(dev->sync.other, client)) + dev->sync.other = NullGrab; + } + ComputeFreezes(); + } + break; + } +} + +/** + * Server-side protocol handling for AllowEvents request. + * + * Release some events from a frozen device. Only applicable for core devices. + */ +int +ProcAllowEvents(ClientPtr client) +{ + TimeStamp time; + DeviceIntPtr mouse = inputInfo.pointer; + DeviceIntPtr keybd = inputInfo.keyboard; + REQUEST(xAllowEventsReq); + + REQUEST_SIZE_MATCH(xAllowEventsReq); + time = ClientTimeToServerTime(stuff->time); + switch (stuff->mode) + { + case ReplayPointer: + AllowSome(client, time, mouse, NOT_GRABBED); + break; + case SyncPointer: + AllowSome(client, time, mouse, FREEZE_NEXT_EVENT); + break; + case AsyncPointer: + AllowSome(client, time, mouse, THAWED); + break; + case ReplayKeyboard: + AllowSome(client, time, keybd, NOT_GRABBED); + break; + case SyncKeyboard: + AllowSome(client, time, keybd, FREEZE_NEXT_EVENT); + break; + case AsyncKeyboard: + AllowSome(client, time, keybd, THAWED); + break; + case SyncBoth: + AllowSome(client, time, keybd, FREEZE_BOTH_NEXT_EVENT); + break; + case AsyncBoth: + AllowSome(client, time, keybd, THAWED_BOTH); + break; + default: + client->errorValue = stuff->mode; + return BadValue; + } + return Success; +} + +/** + * Deactivate grabs from any device that has been grabbed by the client. + */ +void +ReleaseActiveGrabs(ClientPtr client) +{ + DeviceIntPtr dev; + Bool done; + + /* XXX CloseDownClient should remove passive grabs before + * releasing active grabs. + */ + do { + done = TRUE; + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev->grab && SameClient(dev->grab, client)) + { + (*dev->DeactivateGrab)(dev); + done = FALSE; + } + } + } while (!done); +} + +/************************************************************************** + * The following procedures deal with delivering events * + **************************************************************************/ + +/** + * Deliver the given events to the given client. + * + * More than one event may be delivered at a time. This is the case with + * DeviceMotionNotifies which may be followed by DeviceValuator events. + * + * TryClientEvents() is the last station before actually writing the events to + * the socket. Anything that is not filtered here, will get delivered to the + * client. + * An event is only delivered if + * - mask and filter match up. + * - no other client has a grab on the device that caused the event. + * + * + * @param client The target client to deliver to. + * @param pEvents The events to be delivered. + * @param count Number of elements in pEvents. + * @param mask Event mask as set by the window. + * @param filter Mask based on event type. + * @param grab Possible grab on the device that caused the event. + * + * @return 1 if event was delivered, 0 if not or -1 if grab was not set by the + * client. + */ +_X_EXPORT int +TryClientEvents (ClientPtr client, xEvent *pEvents, int count, Mask mask, + Mask filter, GrabPtr grab) +{ + int i; + int type; + +#ifdef DEBUG_EVENTS + ErrorF("Event([%d, %d], mask=0x%x), client=%d", + pEvents->u.u.type, pEvents->u.u.detail, mask, client->index); +#endif + if ((client) && (client != serverClient) && (!client->clientGone) && + ((filter == CantBeFiltered) || (mask & filter))) + { + if (grab && !SameClient(grab, client)) + return -1; /* don't send, but notify caller */ + type = pEvents->u.u.type; + if (type == MotionNotify) + { + if (mask & PointerMotionHintMask) + { + if (WID(inputInfo.pointer->valuator->motionHintWindow) == + pEvents->u.keyButtonPointer.event) + { +#ifdef DEBUG_EVENTS + ErrorF("\n"); + ErrorF("motionHintWindow == keyButtonPointer.event\n"); +#endif + return 1; /* don't send, but pretend we did */ + } + pEvents->u.u.detail = NotifyHint; + } + else + { + pEvents->u.u.detail = NotifyNormal; + } + } +#ifdef XINPUT + else + { + if ((type == DeviceMotionNotify) && + MaybeSendDeviceMotionNotifyHint + ((deviceKeyButtonPointer*)pEvents, mask) != 0) + return 1; + } +#endif + type &= 0177; + if (type != KeymapNotify) + { + /* all extension events must have a sequence number */ + for (i = 0; i < count; i++) + pEvents[i].u.u.sequenceNumber = client->sequence; + } + + if (BitIsOn(criticalEvents, type)) + { +#ifdef SMART_SCHEDULE + if (client->smart_priority < SMART_MAX_PRIORITY) + client->smart_priority++; +#endif + SetCriticalOutputPending(); + } + + WriteEventsToClient(client, count, pEvents); +#ifdef DEBUG_EVENTS + ErrorF( " delivered\n"); +#endif + return 1; + } + else + { +#ifdef DEBUG_EVENTS + ErrorF("\n"); +#endif + return 0; + } +} + +/** + * Deliver events to a window. At this point, we do not yet know if the event + * actually needs to be delivered. May activate a grab if the event is a + * button press. + * + * More than one event may be delivered at a time. This is the case with + * DeviceMotionNotifies which may be followed by DeviceValuator events. + * + * @param pWin The window that would get the event. + * @param pEvents The events to be delivered. + * @param count Number of elements in pEvents. + * @param filter Mask based on event type. + * @param grab Possible grab on the device that caused the event. + * @param mskidx Mask index, depending on device that caused event. + * + * @return Number of events delivered to various clients. + */ +int +DeliverEventsToWindow(WindowPtr pWin, xEvent *pEvents, int count, + Mask filter, GrabPtr grab, int mskidx) +{ + int deliveries = 0, nondeliveries = 0; + int attempt; + InputClients *other; + ClientPtr client = NullClient; + Mask deliveryMask = 0; /* If a grab occurs due to a button press, then + this mask is the mask of the grab. */ + int type = pEvents->u.u.type; + + /* CantBeFiltered means only window owner gets the event */ + if ((filter == CantBeFiltered) || !(type & EXTENSION_EVENT_BASE)) + { + /* if nobody ever wants to see this event, skip some work */ + if (filter != CantBeFiltered && + !((wOtherEventMasks(pWin)|pWin->eventMask) & filter)) + return 0; + if (XaceHook(XACE_RECEIVE_ACCESS, wClient(pWin), pWin, pEvents, count)) + /* do nothing */; + else if ( (attempt = TryClientEvents(wClient(pWin), pEvents, count, + pWin->eventMask, filter, grab)) ) + { + if (attempt > 0) + { + deliveries++; + client = wClient(pWin); + deliveryMask = pWin->eventMask; + } else + nondeliveries--; + } + } + if (filter != CantBeFiltered) + { + if (type & EXTENSION_EVENT_BASE) + { + OtherInputMasks *inputMasks; + + inputMasks = wOtherInputMasks(pWin); + if (!inputMasks || + !(inputMasks->inputEvents[mskidx] & filter)) + return 0; + other = inputMasks->inputClients; + } + else + other = (InputClients *)wOtherClients(pWin); + for (; other; other = other->next) + { + if (XaceHook(XACE_RECEIVE_ACCESS, rClient(other), pWin, pEvents, + count)) + /* do nothing */; + else if ( (attempt = TryClientEvents(rClient(other), pEvents, count, + other->mask[mskidx], filter, grab)) ) + { + if (attempt > 0) + { + deliveries++; + client = rClient(other); + deliveryMask = other->mask[mskidx]; + } else + nondeliveries--; + } + } + } + if ((type == ButtonPress) && deliveries && (!grab)) + { + GrabRec tempGrab; + + tempGrab.device = inputInfo.pointer; + tempGrab.resource = client->clientAsMask; + tempGrab.window = pWin; + tempGrab.ownerEvents = (deliveryMask & OwnerGrabButtonMask) ? TRUE : FALSE; + tempGrab.eventMask = deliveryMask; + tempGrab.keyboardMode = GrabModeAsync; + tempGrab.pointerMode = GrabModeAsync; + tempGrab.confineTo = NullWindow; + tempGrab.cursor = NullCursor; + (*inputInfo.pointer->ActivateGrab)(inputInfo.pointer, &tempGrab, + currentTime, TRUE); + } + else if ((type == MotionNotify) && deliveries) + inputInfo.pointer->valuator->motionHintWindow = pWin; +#ifdef XINPUT + else + { + if (((type == DeviceMotionNotify) +#ifdef XKB + || (type == DeviceButtonPress) +#endif + ) && deliveries) + CheckDeviceGrabAndHintWindow (pWin, type, + (deviceKeyButtonPointer*) pEvents, + grab, client, deliveryMask); + } +#endif + if (deliveries) + return deliveries; + return nondeliveries; +} + +/* If the event goes to dontClient, don't send it and return 0. if + send works, return 1 or if send didn't work, return 2. + Only works for core events. +*/ + +#ifdef PANORAMIX +static int +XineramaTryClientEventsResult( + ClientPtr client, + GrabPtr grab, + Mask mask, + Mask filter +){ + if ((client) && (client != serverClient) && (!client->clientGone) && + ((filter == CantBeFiltered) || (mask & filter))) + { + if (grab && !SameClient(grab, client)) return -1; + else return 1; + } + return 0; +} +#endif + +/** + * Try to deliver events to the interested parties. + * + * @param pWin The window that would get the event. + * @param pEvents The events to be delivered. + * @param count Number of elements in pEvents. + * @param filter Mask based on event type. + * @param dontClient Don't deliver to the dontClient. + */ +int +MaybeDeliverEventsToClient(WindowPtr pWin, xEvent *pEvents, + int count, Mask filter, ClientPtr dontClient) +{ + OtherClients *other; + + + if (pWin->eventMask & filter) + { + if (wClient(pWin) == dontClient) + return 0; +#ifdef PANORAMIX + if(!noPanoramiXExtension && pWin->drawable.pScreen->myNum) + return XineramaTryClientEventsResult( + wClient(pWin), NullGrab, pWin->eventMask, filter); +#endif + if (XaceHook(XACE_RECEIVE_ACCESS, wClient(pWin), pWin, pEvents, count)) + return 1; /* don't send, but pretend we did */ + return TryClientEvents(wClient(pWin), pEvents, count, + pWin->eventMask, filter, NullGrab); + } + for (other = wOtherClients(pWin); other; other = other->next) + { + if (other->mask & filter) + { + if (SameClient(other, dontClient)) + return 0; +#ifdef PANORAMIX + if(!noPanoramiXExtension && pWin->drawable.pScreen->myNum) + return XineramaTryClientEventsResult( + rClient(other), NullGrab, other->mask, filter); +#endif + if (XaceHook(XACE_RECEIVE_ACCESS, rClient(other), pWin, pEvents, + count)) + return 1; /* don't send, but pretend we did */ + return TryClientEvents(rClient(other), pEvents, count, + other->mask, filter, NullGrab); + } + } + return 2; +} + +/** + * Adjust event fields to comply with the window properties. + * + * @param xE Event to be modified in place + * @param pWin The window to get the information from. + * @param child Child window setting for event (if applicable) + * @param calcChild If True, calculate the child window. + */ +static void +FixUpEventFromWindow( + xEvent *xE, + WindowPtr pWin, + Window child, + Bool calcChild) +{ + if (calcChild) + { + WindowPtr w=spriteTrace[spriteTraceGood-1]; + /* If the search ends up past the root should the child field be + set to none or should the value in the argument be passed + through. It probably doesn't matter since everyone calls + this function with child == None anyway. */ + + while (w) + { + /* If the source window is same as event window, child should be + none. Don't bother going all all the way back to the root. */ + + if (w == pWin) + { + child = None; + break; + } + + if (w->parent == pWin) + { + child = w->drawable.id; + break; + } + w = w->parent; + } + } + XE_KBPTR.root = ROOT->drawable.id; + XE_KBPTR.event = pWin->drawable.id; + if (sprite.hot.pScreen == pWin->drawable.pScreen) + { + XE_KBPTR.sameScreen = xTrue; + XE_KBPTR.child = child; + XE_KBPTR.eventX = + XE_KBPTR.rootX - pWin->drawable.x; + XE_KBPTR.eventY = + XE_KBPTR.rootY - pWin->drawable.y; + } + else + { + XE_KBPTR.sameScreen = xFalse; + XE_KBPTR.child = None; + XE_KBPTR.eventX = 0; + XE_KBPTR.eventY = 0; + } +} + +/** + * Deliver events caused by input devices. Called for all core input events + * and XI events. No filtering of events happens before DeliverDeviceEvents(), + * it will be called for any event that comes out of the event queue. + * + * For all core events, dev is either inputInfo.pointer or inputInfo.keyboard. + * For all extension events, dev is the device that caused the event. + * + * @param pWin Window to deliver event to. + * @param xE Events to deliver. + * @param grab Possible grab on a device. + * @param stopAt Don't recurse up to the root window. + * @param dev The device that is responsible for the event. + * @param count number of events in xE. + * + */ +int +DeliverDeviceEvents(WindowPtr pWin, xEvent *xE, GrabPtr grab, + WindowPtr stopAt, DeviceIntPtr dev, int count) +{ + Window child = None; + int type = xE->u.u.type; + Mask filter = filters[type]; + int deliveries = 0; + + if (XaceHook(XACE_SEND_ACCESS, NULL, dev, pWin, xE, count)) + return 0; + + if (type & EXTENSION_EVENT_BASE) + { + OtherInputMasks *inputMasks; + int mskidx = dev->id; + + inputMasks = wOtherInputMasks(pWin); + if (inputMasks && !(filter & inputMasks->deliverableEvents[mskidx])) + return 0; + while (pWin) + { + if (inputMasks && (inputMasks->inputEvents[mskidx] & filter)) + { + FixUpEventFromWindow(xE, pWin, child, FALSE); + deliveries = DeliverEventsToWindow(pWin, xE, count, filter, + grab, mskidx); + if (deliveries > 0) + return deliveries; + } + if ((deliveries < 0) || + (pWin == stopAt) || + (inputMasks && + (filter & inputMasks->dontPropagateMask[mskidx]))) + return 0; + child = pWin->drawable.id; + pWin = pWin->parent; + if (pWin) + inputMasks = wOtherInputMasks(pWin); + } + } + else + { + if (!(filter & pWin->deliverableEvents)) + return 0; + while (pWin) + { + if ((wOtherEventMasks(pWin)|pWin->eventMask) & filter) + { + FixUpEventFromWindow(xE, pWin, child, FALSE); + deliveries = DeliverEventsToWindow(pWin, xE, count, filter, + grab, 0); + if (deliveries > 0) + return deliveries; + } + if ((deliveries < 0) || + (pWin == stopAt) || + (filter & wDontPropagateMask(pWin))) + return 0; + child = pWin->drawable.id; + pWin = pWin->parent; + } + } + return 0; +} + +/** + * Deliver event to a window and it's immediate parent. Used for most window + * events (CreateNotify, ConfigureNotify, etc.). Not useful for events that + * propagate up the tree or extension events + * + * In case of a ReparentNotify event, the event will be delivered to the + * otherParent as well. + * + * @param pWin Window to deliver events to. + * @param xE Events to deliver. + * @param count number of events in xE. + * @param otherParent Used for ReparentNotify events. + */ +_X_EXPORT int +DeliverEvents(WindowPtr pWin, xEvent *xE, int count, + WindowPtr otherParent) +{ + Mask filter; + int deliveries; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && pWin->drawable.pScreen->myNum) + return count; +#endif + + if (!count) + return 0; + filter = filters[xE->u.u.type]; + if ((filter & SubstructureNotifyMask) && (xE->u.u.type != CreateNotify)) + xE->u.destroyNotify.event = pWin->drawable.id; + if (filter != StructureAndSubMask) + return DeliverEventsToWindow(pWin, xE, count, filter, NullGrab, 0); + deliveries = DeliverEventsToWindow(pWin, xE, count, StructureNotifyMask, + NullGrab, 0); + if (pWin->parent) + { + xE->u.destroyNotify.event = pWin->parent->drawable.id; + deliveries += DeliverEventsToWindow(pWin->parent, xE, count, + SubstructureNotifyMask, NullGrab, + 0); + if (xE->u.u.type == ReparentNotify) + { + xE->u.destroyNotify.event = otherParent->drawable.id; + deliveries += DeliverEventsToWindow(otherParent, xE, count, + SubstructureNotifyMask, + NullGrab, 0); + } + } + return deliveries; +} + + +static Bool +PointInBorderSize(WindowPtr pWin, int x, int y) +{ + BoxRec box; + + if(POINT_IN_REGION(pWin->drawable.pScreen, &pWin->borderSize, x, y, &box)) + return TRUE; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && XineramaSetWindowPntrs(pWin)) { + int i; + + for(i = 1; i < PanoramiXNumScreens; i++) { + if(POINT_IN_REGION(sprite.screen, + &sprite.windows[i]->borderSize, + x + panoramiXdataPtr[0].x - panoramiXdataPtr[i].x, + y + panoramiXdataPtr[0].y - panoramiXdataPtr[i].y, + &box)) + return TRUE; + } + } +#endif + return FALSE; +} + +/** + * Traversed from the root window to the window at the position x/y. While + * traversing, it sets up the traversal history in the spriteTrace array. + * After completing, the spriteTrace history is set in the following way: + * spriteTrace[0] ... root window + * spriteTrace[1] ... top level window that encloses x/y + * ... + * spriteTrace[spriteTraceGood - 1] ... window at x/y + * + * @returns the window at the given coordinates. + */ +static WindowPtr +XYToWindow(int x, int y) +{ + WindowPtr pWin; + BoxRec box; + + spriteTraceGood = 1; /* root window still there */ + pWin = ROOT->firstChild; + while (pWin) + { + if ((pWin->mapped) && + (x >= pWin->drawable.x - wBorderWidth (pWin)) && + (x < pWin->drawable.x + (int)pWin->drawable.width + + wBorderWidth(pWin)) && + (y >= pWin->drawable.y - wBorderWidth (pWin)) && + (y < pWin->drawable.y + (int)pWin->drawable.height + + wBorderWidth (pWin)) +#ifdef SHAPE + /* When a window is shaped, a further check + * is made to see if the point is inside + * borderSize + */ + && (!wBoundingShape(pWin) || PointInBorderSize(pWin, x, y)) + && (!wInputShape(pWin) || + POINT_IN_REGION(pWin->drawable.pScreen, + wInputShape(pWin), + x - pWin->drawable.x, + y - pWin->drawable.y, &box)) +#endif + ) + { + if (spriteTraceGood >= spriteTraceSize) + { + spriteTraceSize += 10; + Must_have_memory = TRUE; /* XXX */ + spriteTrace = (WindowPtr *)xrealloc( + spriteTrace, spriteTraceSize*sizeof(WindowPtr)); + Must_have_memory = FALSE; /* XXX */ + } + spriteTrace[spriteTraceGood++] = pWin; + pWin = pWin->firstChild; + } + else + pWin = pWin->nextSib; + } + return spriteTrace[spriteTraceGood-1]; +} + +/** + * Update the sprite coordinates based on the event. Update the cursor + * position, then update the event with the new coordinates that may have been + * changed. If the window underneath the sprite has changed, change to new + * cursor and send enter/leave events. + */ +static Bool +CheckMotion(xEvent *xE) +{ + WindowPtr prevSpriteWin = sprite.win; + +#ifdef PANORAMIX + if(!noPanoramiXExtension) + return XineramaCheckMotion(xE); +#endif + + if (xE && !syncEvents.playingEvents) + { + if (sprite.hot.pScreen != sprite.hotPhys.pScreen) + { + sprite.hot.pScreen = sprite.hotPhys.pScreen; + ROOT = WindowTable[sprite.hot.pScreen->myNum]; + } + sprite.hot.x = XE_KBPTR.rootX; + sprite.hot.y = XE_KBPTR.rootY; + if (sprite.hot.x < sprite.physLimits.x1) + sprite.hot.x = sprite.physLimits.x1; + else if (sprite.hot.x >= sprite.physLimits.x2) + sprite.hot.x = sprite.physLimits.x2 - 1; + if (sprite.hot.y < sprite.physLimits.y1) + sprite.hot.y = sprite.physLimits.y1; + else if (sprite.hot.y >= sprite.physLimits.y2) + sprite.hot.y = sprite.physLimits.y2 - 1; +#ifdef SHAPE + if (sprite.hotShape) + ConfineToShape(sprite.hotShape, &sprite.hot.x, &sprite.hot.y); +#endif +#ifdef XEVIE + xeviehot.x = sprite.hot.x; + xeviehot.y = sprite.hot.y; +#endif + sprite.hotPhys = sprite.hot; + if ((sprite.hotPhys.x != XE_KBPTR.rootX) || + (sprite.hotPhys.y != XE_KBPTR.rootY)) + { + (*sprite.hotPhys.pScreen->SetCursorPosition)( + sprite.hotPhys.pScreen, + sprite.hotPhys.x, sprite.hotPhys.y, FALSE); + } + XE_KBPTR.rootX = sprite.hot.x; + XE_KBPTR.rootY = sprite.hot.y; + } + +#ifdef XEVIE + xeviewin = +#endif + sprite.win = XYToWindow(sprite.hot.x, sprite.hot.y); +#ifdef notyet + if (!(sprite.win->deliverableEvents & + Motion_Filter(inputInfo.pointer->button)) + !syncEvents.playingEvents) + { + /* XXX Do PointerNonInterestBox here */ + } +#endif + if (sprite.win != prevSpriteWin) + { + if (prevSpriteWin != NullWindow) { + if (!xE) + UpdateCurrentTimeIf(); + DoEnterLeaveEvents(prevSpriteWin, sprite.win, NotifyNormal); + } + PostNewCursor(); + return FALSE; + } + return TRUE; +} + +/** + * Windows have restructured, we need to update the sprite position and the + * sprite's cursor. + */ +_X_EXPORT void +WindowsRestructured(void) +{ + (void) CheckMotion((xEvent *)NULL); +} + +#ifdef PANORAMIX +/* This was added to support reconfiguration under Xdmx. The problem is + * that if the 0th screen (i.e., WindowTable[0]) is moved to an origin + * other than 0,0, the information in the private sprite structure must + * be updated accordingly, or XYToWindow (and other routines) will not + * compute correctly. */ +void ReinitializeRootWindow(WindowPtr win, int xoff, int yoff) +{ + GrabPtr grab; + + if (noPanoramiXExtension) return; + + sprite.hot.x -= xoff; + sprite.hot.y -= yoff; + + sprite.hotPhys.x -= xoff; + sprite.hotPhys.y -= yoff; + + sprite.hotLimits.x1 -= xoff; + sprite.hotLimits.y1 -= yoff; + sprite.hotLimits.x2 -= xoff; + sprite.hotLimits.y2 -= yoff; + + if (REGION_NOTEMPTY(sprite.screen, &sprite.Reg1)) + REGION_TRANSLATE(sprite.screen, &sprite.Reg1, xoff, yoff); + if (REGION_NOTEMPTY(sprite.screen, &sprite.Reg2)) + REGION_TRANSLATE(sprite.screen, &sprite.Reg2, xoff, yoff); + + /* FIXME: if we call ConfineCursorToWindow, must we do anything else? */ + if ((grab = inputInfo.pointer->grab) && grab->confineTo) { + if (grab->confineTo->drawable.pScreen != sprite.hotPhys.pScreen) + sprite.hotPhys.x = sprite.hotPhys.y = 0; + ConfineCursorToWindow(grab->confineTo, TRUE, TRUE); + } else + ConfineCursorToWindow(WindowTable[sprite.hotPhys.pScreen->myNum], + TRUE, FALSE); +} +#endif + +/** + * Set the given window to sane values, display the cursor in the center of + * the screen. Called from main() with the root window on the first screen. + */ +void +DefineInitialRootWindow(WindowPtr win) +{ + ScreenPtr pScreen = win->drawable.pScreen; + + sprite.hotPhys.pScreen = pScreen; + sprite.hotPhys.x = pScreen->width / 2; + sprite.hotPhys.y = pScreen->height / 2; + sprite.hot = sprite.hotPhys; + sprite.hotLimits.x2 = pScreen->width; + sprite.hotLimits.y2 = pScreen->height; +#ifdef XEVIE + xeviewin = +#endif + sprite.win = win; + sprite.current = wCursor (win); + sprite.current->refcnt++; + spriteTraceGood = 1; + ROOT = win; + (*pScreen->CursorLimits) ( + pScreen, sprite.current, &sprite.hotLimits, &sprite.physLimits); + sprite.confined = FALSE; + (*pScreen->ConstrainCursor) (pScreen, &sprite.physLimits); + (*pScreen->SetCursorPosition) (pScreen, sprite.hot.x, sprite.hot.y, FALSE); + (*pScreen->DisplayCursor) (pScreen, sprite.current); + +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + sprite.hotLimits.x1 = -panoramiXdataPtr[0].x; + sprite.hotLimits.y1 = -panoramiXdataPtr[0].y; + sprite.hotLimits.x2 = PanoramiXPixWidth - panoramiXdataPtr[0].x; + sprite.hotLimits.y2 = PanoramiXPixHeight - panoramiXdataPtr[0].y; + sprite.physLimits = sprite.hotLimits; + sprite.confineWin = NullWindow; +#ifdef SHAPE + sprite.hotShape = NullRegion; +#endif + sprite.screen = pScreen; + /* gotta UNINIT these someplace */ + REGION_NULL(pScreen, &sprite.Reg1); + REGION_NULL(pScreen, &sprite.Reg2); + } +#endif +} + +/** + * Update the mouse sprite info when the server switches from a pScreen to another. + * Otherwise, the pScreen of the mouse sprite is never updated when we switch + * from a pScreen to another. Never updating the pScreen of the mouse sprite + * implies that windows that are in pScreen whose pScreen->myNum >0 will never + * get pointer events. This is because in CheckMotion(), sprite.hotPhys.pScreen + * always points to the first pScreen it has been set by + * DefineInitialRootWindow(). + * + * Calling this function is useful for use cases where the server + * has more than one pScreen. + * This function is similar to DefineInitialRootWindow() but it does not + * reset the mouse pointer position. + * @param win must be the new pScreen we are switching to. + */ +void +UpdateSpriteForScreen(ScreenPtr pScreen) +{ + WindowPtr win = NULL; + if (!pScreen) + return ; + win = WindowTable[pScreen->myNum]; + + sprite.hotPhys.pScreen = pScreen; + sprite.hot = sprite.hotPhys; + sprite.hotLimits.x2 = pScreen->width; + sprite.hotLimits.y2 = pScreen->height; +#ifdef XEVIE + xeviewin = +#endif + sprite.win = win; + sprite.current = wCursor (win); + sprite.current->refcnt++; + spriteTraceGood = 1; + ROOT = win; + (*pScreen->CursorLimits) (pScreen, + sprite.current, + &sprite.hotLimits, + &sprite.physLimits); + sprite.confined = FALSE; + (*pScreen->ConstrainCursor) (pScreen, &sprite.physLimits); + (*pScreen->DisplayCursor) (pScreen, sprite.current); + +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + sprite.hotLimits.x1 = -panoramiXdataPtr[0].x; + sprite.hotLimits.y1 = -panoramiXdataPtr[0].y; + sprite.hotLimits.x2 = PanoramiXPixWidth - panoramiXdataPtr[0].x; + sprite.hotLimits.y2 = PanoramiXPixHeight - panoramiXdataPtr[0].y; + sprite.physLimits = sprite.hotLimits; + sprite.screen = pScreen; + } +#endif +} + +/* + * This does not take any shortcuts, and even ignores its argument, since + * it does not happen very often, and one has to walk up the tree since + * this might be a newly instantiated cursor for an intermediate window + * between the one the pointer is in and the one that the last cursor was + * instantiated from. + */ +void +WindowHasNewCursor(WindowPtr pWin) +{ + PostNewCursor(); +} + +_X_EXPORT void +NewCurrentScreen(ScreenPtr newScreen, int x, int y) +{ + sprite.hotPhys.x = x; + sprite.hotPhys.y = y; +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + sprite.hotPhys.x += panoramiXdataPtr[newScreen->myNum].x - + panoramiXdataPtr[0].x; + sprite.hotPhys.y += panoramiXdataPtr[newScreen->myNum].y - + panoramiXdataPtr[0].y; + if (newScreen != sprite.screen) { + sprite.screen = newScreen; + /* Make sure we tell the DDX to update its copy of the screen */ + if(sprite.confineWin) + XineramaConfineCursorToWindow(sprite.confineWin, TRUE); + else + XineramaConfineCursorToWindow(WindowTable[0], TRUE); + /* if the pointer wasn't confined, the DDX won't get + told of the pointer warp so we reposition it here */ + if(!syncEvents.playingEvents) + (*sprite.screen->SetCursorPosition)(sprite.screen, + sprite.hotPhys.x + panoramiXdataPtr[0].x - + panoramiXdataPtr[sprite.screen->myNum].x, + sprite.hotPhys.y + panoramiXdataPtr[0].y - + panoramiXdataPtr[sprite.screen->myNum].y, FALSE); + } + } else +#endif + if (newScreen != sprite.hotPhys.pScreen) + ConfineCursorToWindow(WindowTable[newScreen->myNum], TRUE, FALSE); +} + +#ifdef PANORAMIX + +static Bool +XineramaPointInWindowIsVisible( + WindowPtr pWin, + int x, + int y +) +{ + ScreenPtr pScreen = pWin->drawable.pScreen; + BoxRec box; + int i, xoff, yoff; + + if (!pWin->realized) return FALSE; + + if (POINT_IN_REGION(pScreen, &pWin->borderClip, x, y, &box)) + return TRUE; + + if(!XineramaSetWindowPntrs(pWin)) return FALSE; + + xoff = x + panoramiXdataPtr[0].x; + yoff = y + panoramiXdataPtr[0].y; + + for(i = 1; i < PanoramiXNumScreens; i++) { + pWin = sprite.windows[i]; + pScreen = pWin->drawable.pScreen; + x = xoff - panoramiXdataPtr[i].x; + y = yoff - panoramiXdataPtr[i].y; + + if(POINT_IN_REGION(pScreen, &pWin->borderClip, x, y, &box) + && (!wInputShape(pWin) || + POINT_IN_REGION(pWin->drawable.pScreen, + wInputShape(pWin), + x - pWin->drawable.x, + y - pWin->drawable.y, &box))) + return TRUE; + + } + + return FALSE; +} + +static int +XineramaWarpPointer(ClientPtr client) +{ + WindowPtr dest = NULL; + int x, y, rc; + + REQUEST(xWarpPointerReq); + + + if (stuff->dstWid != None) { + rc = dixLookupWindow(&dest, stuff->dstWid, client, DixReadAccess); + if (rc != Success) + return rc; + } + x = sprite.hotPhys.x; + y = sprite.hotPhys.y; + + if (stuff->srcWid != None) + { + int winX, winY; + XID winID = stuff->srcWid; + WindowPtr source; + + rc = dixLookupWindow(&source, winID, client, DixReadAccess); + if (rc != Success) + return rc; + + winX = source->drawable.x; + winY = source->drawable.y; + if(source == WindowTable[0]) { + winX -= panoramiXdataPtr[0].x; + winY -= panoramiXdataPtr[0].y; + } + if (x < winX + stuff->srcX || + y < winY + stuff->srcY || + (stuff->srcWidth != 0 && + winX + stuff->srcX + (int)stuff->srcWidth < x) || + (stuff->srcHeight != 0 && + winY + stuff->srcY + (int)stuff->srcHeight < y) || + !XineramaPointInWindowIsVisible(source, x, y)) + return Success; + } + if (dest) { + x = dest->drawable.x; + y = dest->drawable.y; + if(dest == WindowTable[0]) { + x -= panoramiXdataPtr[0].x; + y -= panoramiXdataPtr[0].y; + } + } + + x += stuff->dstX; + y += stuff->dstY; + + if (x < sprite.physLimits.x1) + x = sprite.physLimits.x1; + else if (x >= sprite.physLimits.x2) + x = sprite.physLimits.x2 - 1; + if (y < sprite.physLimits.y1) + y = sprite.physLimits.y1; + else if (y >= sprite.physLimits.y2) + y = sprite.physLimits.y2 - 1; + if (sprite.hotShape) + ConfineToShape(sprite.hotShape, &x, &y); + + XineramaSetCursorPosition(x, y, TRUE); + + return Success; +} + +#endif + + +/** + * Server-side protocol handling for WarpPointer request. + * Warps the cursor position to the coordinates given in the request. + */ +int +ProcWarpPointer(ClientPtr client) +{ + WindowPtr dest = NULL; + int x, y, rc; + ScreenPtr newScreen; + DeviceIntPtr dev; + REQUEST(xWarpPointerReq); + REQUEST_SIZE_MATCH(xWarpPointerReq); + + for (dev = inputInfo.devices; dev; dev = dev->next) { + if ((dev->coreEvents || dev == inputInfo.pointer) && dev->button) { + rc = XaceHook(XACE_DEVICE_ACCESS, client, dev, DixWriteAccess); + if (rc != Success) + return rc; + } + } +#ifdef PANORAMIX + if(!noPanoramiXExtension) + return XineramaWarpPointer(client); +#endif + + if (stuff->dstWid != None) { + rc = dixLookupWindow(&dest, stuff->dstWid, client, DixGetAttrAccess); + if (rc != Success) + return rc; + } + x = sprite.hotPhys.x; + y = sprite.hotPhys.y; + + if (stuff->srcWid != None) + { + int winX, winY; + XID winID = stuff->srcWid; + WindowPtr source; + + rc = dixLookupWindow(&source, winID, client, DixGetAttrAccess); + if (rc != Success) + return rc; + + winX = source->drawable.x; + winY = source->drawable.y; + if (source->drawable.pScreen != sprite.hotPhys.pScreen || + x < winX + stuff->srcX || + y < winY + stuff->srcY || + (stuff->srcWidth != 0 && + winX + stuff->srcX + (int)stuff->srcWidth < x) || + (stuff->srcHeight != 0 && + winY + stuff->srcY + (int)stuff->srcHeight < y) || + !PointInWindowIsVisible(source, x, y)) + return Success; + } + if (dest) + { + x = dest->drawable.x; + y = dest->drawable.y; + newScreen = dest->drawable.pScreen; + } else + newScreen = sprite.hotPhys.pScreen; + + x += stuff->dstX; + y += stuff->dstY; + + if (x < 0) + x = 0; + else if (x >= newScreen->width) + x = newScreen->width - 1; + if (y < 0) + y = 0; + else if (y >= newScreen->height) + y = newScreen->height - 1; + + if (newScreen == sprite.hotPhys.pScreen) + { + if (x < sprite.physLimits.x1) + x = sprite.physLimits.x1; + else if (x >= sprite.physLimits.x2) + x = sprite.physLimits.x2 - 1; + if (y < sprite.physLimits.y1) + y = sprite.physLimits.y1; + else if (y >= sprite.physLimits.y2) + y = sprite.physLimits.y2 - 1; +#if defined(SHAPE) + if (sprite.hotShape) + ConfineToShape(sprite.hotShape, &x, &y); +#endif + (*newScreen->SetCursorPosition)(newScreen, x, y, TRUE); + } + else if (!PointerConfinedToScreen()) + { + NewCurrentScreen(newScreen, x, y); + } + return Success; +} + +static Bool +BorderSizeNotEmpty(WindowPtr pWin) +{ + if(REGION_NOTEMPTY(sprite.hotPhys.pScreen, &pWin->borderSize)) + return TRUE; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && XineramaSetWindowPntrs(pWin)) { + int i; + + for(i = 1; i < PanoramiXNumScreens; i++) { + if(REGION_NOTEMPTY(sprite.screen, &sprite.windows[i]->borderSize)) + return TRUE; + } + } +#endif + return FALSE; +} + +/** + * "CheckPassiveGrabsOnWindow" checks to see if the event passed in causes a + * passive grab set on the window to be activated. + * If a passive grab is activated, the event will be delivered to the client. + * + * @param pWin The window that may be subject to a passive grab. + * @param device Device that caused the event. + * @param xE List of events (multiple ones for DeviceMotionNotify) + * @count number of elements in xE. + */ + +static Bool +CheckPassiveGrabsOnWindow( + WindowPtr pWin, + DeviceIntPtr device, + xEvent *xE, + int count) +{ + GrabPtr grab = wPassiveGrabs(pWin); + GrabRec tempGrab; + xEvent *dxE; + + if (!grab) + return FALSE; + tempGrab.window = pWin; + tempGrab.device = device; + tempGrab.type = xE->u.u.type; + tempGrab.detail.exact = xE->u.u.detail; + tempGrab.detail.pMask = NULL; + tempGrab.modifiersDetail.pMask = NULL; + for (; grab; grab = grab->next) + { +#ifdef XKB + DeviceIntPtr gdev; + XkbSrvInfoPtr xkbi; + + gdev= grab->modifierDevice; + xkbi= gdev->key->xkbInfo; +#endif + tempGrab.modifierDevice = grab->modifierDevice; + if ((device == grab->modifierDevice) && + ((xE->u.u.type == KeyPress) +#if defined(XINPUT) && defined(XKB) + || (xE->u.u.type == DeviceKeyPress) +#endif + )) + tempGrab.modifiersDetail.exact = +#ifdef XKB + (noXkbExtension?gdev->key->prev_state:xkbi->state.grab_mods); +#else + grab->modifierDevice->key->prev_state; +#endif + else + tempGrab.modifiersDetail.exact = +#ifdef XKB + (noXkbExtension ? gdev->key->state : xkbi->state.grab_mods); +#else + grab->modifierDevice->key->state; +#endif + if (GrabMatchesSecond(&tempGrab, grab) && + (!grab->confineTo || + (grab->confineTo->realized && + BorderSizeNotEmpty(grab->confineTo)))) + { +#ifdef XKB + if (!noXkbExtension) { + XE_KBPTR.state &= 0x1f00; + XE_KBPTR.state |= + tempGrab.modifiersDetail.exact&(~0x1f00); + } +#endif + (*device->ActivateGrab)(device, grab, currentTime, TRUE); + + FixUpEventFromWindow(xE, grab->window, None, TRUE); + + (void) TryClientEvents(rClient(grab), xE, count, + filters[xE->u.u.type], + filters[xE->u.u.type], grab); + + if (device->sync.state == FROZEN_NO_EVENT) + { + if (device->sync.evcount < count) + { + Must_have_memory = TRUE; /* XXX */ + device->sync.event = (xEvent *)xrealloc(device->sync.event, + count* + sizeof(xEvent)); + Must_have_memory = FALSE; /* XXX */ + } + device->sync.evcount = count; + for (dxE = device->sync.event; --count >= 0; dxE++, xE++) + *dxE = *xE; + device->sync.state = FROZEN_WITH_EVENT; + } + return TRUE; + } + } + return FALSE; +} + +/** + * CheckDeviceGrabs handles both keyboard and pointer events that may cause + * a passive grab to be activated. + * + * If the event is a keyboard event, the ancestors of the focus window are + * traced down and tried to see if they have any passive grabs to be + * activated. If the focus window itself is reached and it's descendants + * contain the pointer, the ancestors of the window that the pointer is in + * are then traced down starting at the focus window, otherwise no grabs are + * activated. + * If the event is a pointer event, the ancestors of the window that the + * pointer is in are traced down starting at the root until CheckPassiveGrabs + * causes a passive grab to activate or all the windows are + * tried. PRH + * + * If a grab is activated, the event has been sent to the client already! + * + * @param device The device that caused the event. + * @param xE The event to handle (most likely {Device}ButtonPress). + * @param count Number of events in list. + * @return TRUE if a grab has been activated or false otherwise. +*/ + +Bool +CheckDeviceGrabs(DeviceIntPtr device, xEvent *xE, + int checkFirst, int count) +{ + int i; + WindowPtr pWin = NULL; + FocusClassPtr focus = device->focus; + + if (((xE->u.u.type == ButtonPress) +#if defined(XINPUT) && defined(XKB) + || (xE->u.u.type == DeviceButtonPress) +#endif + ) && (device->button->buttonsDown != 1)) + return FALSE; + + i = checkFirst; + + if (focus) + { + for (; i < focus->traceGood; i++) + { + pWin = focus->trace[i]; + if (pWin->optional && + CheckPassiveGrabsOnWindow(pWin, device, xE, count)) + return TRUE; + } + + if ((focus->win == NoneWin) || + (i >= spriteTraceGood) || + ((i > checkFirst) && (pWin != spriteTrace[i-1]))) + return FALSE; + } + + for (; i < spriteTraceGood; i++) + { + pWin = spriteTrace[i]; + if (pWin->optional && + CheckPassiveGrabsOnWindow(pWin, device, xE, count)) + return TRUE; + } + + return FALSE; +} + +/** + * Called for keyboard events to deliver event to whatever client owns the + * focus. Event is delivered to the keyboard's focus window, the root window + * or to the window owning the input focus. + * + * @param keybd The keyboard originating the event. + * @param xE The event list. + * @param window Window underneath the sprite. + * @param count number of events in xE. + */ +void +DeliverFocusedEvent(DeviceIntPtr keybd, xEvent *xE, WindowPtr window, int count) +{ + WindowPtr focus = keybd->focus->win; + int mskidx = 0; + + if (focus == FollowKeyboardWin) + focus = inputInfo.keyboard->focus->win; + if (!focus) + return; + if (focus == PointerRootWin) + { + DeliverDeviceEvents(window, xE, NullGrab, NullWindow, keybd, count); + return; + } + if ((focus == window) || IsParent(focus, window)) + { + if (DeliverDeviceEvents(window, xE, NullGrab, focus, keybd, count)) + return; + } + if (XaceHook(XACE_SEND_ACCESS, NULL, keybd, focus, xE, count)) + return; + /* just deliver it to the focus window */ + FixUpEventFromWindow(xE, focus, None, FALSE); + if (xE->u.u.type & EXTENSION_EVENT_BASE) + mskidx = keybd->id; + (void)DeliverEventsToWindow(focus, xE, count, filters[xE->u.u.type], + NullGrab, mskidx); +} + +/** + * Deliver an event from a device that is currently grabbed. Uses + * DeliverDeviceEvents() for further delivery if a ownerEvents is set on the + * grab. If not, TryClientEvents() is used. + * + * @param deactivateGrab True if the device's grab should be deactivated. + */ +void +DeliverGrabbedEvent(xEvent *xE, DeviceIntPtr thisDev, + Bool deactivateGrab, int count) +{ + GrabPtr grab = thisDev->grab; + int deliveries = 0; + DeviceIntPtr dev; + xEvent *dxE; + + if (grab->ownerEvents) + { + WindowPtr focus; + + if (thisDev->focus) + { + focus = thisDev->focus->win; + if (focus == FollowKeyboardWin) + focus = inputInfo.keyboard->focus->win; + } + else + focus = PointerRootWin; + if (focus == PointerRootWin) + deliveries = DeliverDeviceEvents(sprite.win, xE, grab, NullWindow, + thisDev, count); + else if (focus && (focus == sprite.win || IsParent(focus, sprite.win))) + deliveries = DeliverDeviceEvents(sprite.win, xE, grab, focus, + thisDev, count); + else if (focus) + deliveries = DeliverDeviceEvents(focus, xE, grab, focus, + thisDev, count); + } + if (!deliveries) + { + FixUpEventFromWindow(xE, grab->window, None, TRUE); + if (XaceHook(XACE_SEND_ACCESS, 0, thisDev, grab->window, xE, count) || + XaceHook(XACE_RECEIVE_ACCESS, rClient(grab), grab->window, xE, + count)) + deliveries = 1; /* don't send, but pretend we did */ + else + deliveries = TryClientEvents(rClient(grab), xE, count, + (Mask)grab->eventMask, + filters[xE->u.u.type], grab); + if (deliveries && (xE->u.u.type == MotionNotify +#ifdef XINPUT + || xE->u.u.type == DeviceMotionNotify +#endif + )) + thisDev->valuator->motionHintWindow = grab->window; + } + if (deliveries && !deactivateGrab && (xE->u.u.type != MotionNotify +#ifdef XINPUT + && xE->u.u.type != DeviceMotionNotify +#endif + )) + switch (thisDev->sync.state) + { + case FREEZE_BOTH_NEXT_EVENT: + for (dev = inputInfo.devices; dev; dev = dev->next) + { + if (dev == thisDev) + continue; + FreezeThaw(dev, TRUE); + if ((dev->sync.state == FREEZE_BOTH_NEXT_EVENT) && + (CLIENT_BITS(dev->grab->resource) == + CLIENT_BITS(thisDev->grab->resource))) + dev->sync.state = FROZEN_NO_EVENT; + else + dev->sync.other = thisDev->grab; + } + /* fall through */ + case FREEZE_NEXT_EVENT: + thisDev->sync.state = FROZEN_WITH_EVENT; + FreezeThaw(thisDev, TRUE); + if (thisDev->sync.evcount < count) + { + Must_have_memory = TRUE; /* XXX */ + thisDev->sync.event = (xEvent *)xrealloc(thisDev->sync.event, + count*sizeof(xEvent)); + Must_have_memory = FALSE; /* XXX */ + } + thisDev->sync.evcount = count; + for (dxE = thisDev->sync.event; --count >= 0; dxE++, xE++) + *dxE = *xE; + break; + } +} + +/** + * Main keyboard event processing function for core keyboard events. + * Updates the events fields from the current pointer state and delivers the + * event. + * + * For key events, xE will always be a single event. + * + * @param xE Event list + * @param keybd The device that caused an event. + * @param count Number of elements in xE. + */ +void +#ifdef XKB +CoreProcessKeyboardEvent (xEvent *xE, DeviceIntPtr keybd, int count) +#else +ProcessKeyboardEvent (xEvent *xE, DeviceIntPtr keybd, int count) +#endif +{ + int key, bit; + BYTE *kptr; + int i; + CARD8 modifiers; + CARD16 mask; + GrabPtr grab = keybd->grab; + Bool deactivateGrab = FALSE; + KeyClassPtr keyc = keybd->key; +#ifdef XEVIE + static Window rootWin = 0; + + if(!xeviegrabState && xevieFlag && clients[xevieClientIndex] && + (xevieMask & xevieFilters[xE->u.u.type])) { + key = xE->u.u.detail; + kptr = &keyc->down[key >> 3]; + bit = 1 << (key & 7); + if((xE->u.u.type == KeyPress && (*kptr & bit)) || + (xE->u.u.type == KeyRelease && !(*kptr & bit))) + {} else { +#ifdef XKB + if(!noXkbExtension) + xevieKBEventSent = 1; +#endif + if(!xevieKBEventSent) + { + xeviekb = keybd; + if(!rootWin) { + rootWin = GetCurrentRootWindow()->drawable.id; + } + xE->u.keyButtonPointer.event = xeviewin->drawable.id; + xE->u.keyButtonPointer.root = rootWin; + xE->u.keyButtonPointer.child = (xeviewin->firstChild) ? xeviewin->firstChild-> +drawable.id:0; + xE->u.keyButtonPointer.rootX = xeviehot.x; + xE->u.keyButtonPointer.rootY = xeviehot.y; + xE->u.keyButtonPointer.state = keyc->state; + WriteToClient(clients[xevieClientIndex], sizeof(xEvent), (char *)xE); +#ifdef XKB + if(noXkbExtension) +#endif + return; + } else { + xevieKBEventSent = 0; + } + } + } +#endif + + if (!syncEvents.playingEvents) + { + NoticeTime(xE); + if (DeviceEventCallback) + { + DeviceEventInfoRec eventinfo; + eventinfo.events = xE; + eventinfo.count = count; + CallCallbacks(&DeviceEventCallback, (pointer)&eventinfo); + } + } +#ifdef XEVIE + /* fix for bug5094030: don't change the state bit if the event is from XEvIE client */ + if(!(!xeviegrabState && xevieFlag && clients[xevieClientIndex] && + (xevieMask & xevieFilters[xE->u.u.type] +#ifdef XKB + && !noXkbExtension +#endif + ))) +#endif + XE_KBPTR.state = (keyc->state | inputInfo.pointer->button->state); + XE_KBPTR.rootX = sprite.hot.x; + XE_KBPTR.rootY = sprite.hot.y; + key = xE->u.u.detail; + kptr = &keyc->down[key >> 3]; + bit = 1 << (key & 7); + modifiers = keyc->modifierMap[key]; +#if defined(XKB) && defined(XEVIE) + if(!noXkbExtension && !xeviegrabState && + xevieFlag && clients[xevieClientIndex] && + (xevieMask & xevieFilters[xE->u.u.type])) { + switch(xE->u.u.type) { + case KeyPress: *kptr &= ~bit; break; + case KeyRelease: *kptr |= bit; break; + } + } +#endif + + switch (xE->u.u.type) + { + case KeyPress: + if (*kptr & bit) /* allow ddx to generate multiple downs */ + { + if (!modifiers) + { + xE->u.u.type = KeyRelease; + (*keybd->public.processInputProc)(xE, keybd, count); + xE->u.u.type = KeyPress; + /* release can have side effects, don't fall through */ + (*keybd->public.processInputProc)(xE, keybd, count); + } + return; + } + inputInfo.pointer->valuator->motionHintWindow = NullWindow; + *kptr |= bit; + keyc->prev_state = keyc->state; + for (i = 0, mask = 1; modifiers; i++, mask <<= 1) + { + if (mask & modifiers) + { + /* This key affects modifier "i" */ + keyc->modifierKeyCount[i]++; + keyc->state |= mask; + modifiers &= ~mask; + } + } + if (!grab && CheckDeviceGrabs(keybd, xE, 0, count)) + { + keybd->activatingKey = key; + return; + } + break; + case KeyRelease: + if (!(*kptr & bit)) /* guard against duplicates */ + return; + inputInfo.pointer->valuator->motionHintWindow = NullWindow; + *kptr &= ~bit; + keyc->prev_state = keyc->state; + for (i = 0, mask = 1; modifiers; i++, mask <<= 1) + { + if (mask & modifiers) { + /* This key affects modifier "i" */ + if (--keyc->modifierKeyCount[i] <= 0) { + keyc->state &= ~mask; + keyc->modifierKeyCount[i] = 0; + } + modifiers &= ~mask; + } + } + if (keybd->fromPassiveGrab && (key == keybd->activatingKey)) + deactivateGrab = TRUE; + break; + default: + FatalError("Impossible keyboard event"); + } + if (grab) + DeliverGrabbedEvent(xE, keybd, deactivateGrab, count); + else + DeliverFocusedEvent(keybd, xE, sprite.win, count); + if (deactivateGrab) + (*keybd->DeactivateGrab)(keybd); + + XaceHook(XACE_KEY_AVAIL, xE, keybd, count); +} + +#ifdef XKB +/* This function is used to set the key pressed or key released state - + this is only used when the pressing of keys does not cause + the device's processInputProc to be called, as in for example Mouse Keys. +*/ +void +FixKeyState (xEvent *xE, DeviceIntPtr keybd) +{ + int key, bit; + BYTE *kptr; + KeyClassPtr keyc = keybd->key; + + key = xE->u.u.detail; + kptr = &keyc->down[key >> 3]; + bit = 1 << (key & 7); + + if (((xE->u.u.type==KeyPress)||(xE->u.u.type==KeyRelease)|| + (xE->u.u.type==DeviceKeyPress)||(xE->u.u.type==DeviceKeyRelease)) + ) { + DebugF("FixKeyState: Key %d %s\n",key, + (((xE->u.u.type==KeyPress)||(xE->u.u.type==DeviceKeyPress))?"down":"up")); + } + + if (xE->u.u.type == KeyPress || xE->u.u.type == DeviceKeyPress) + *kptr |= bit; + else if (xE->u.u.type == KeyRelease || xE->u.u.type == DeviceKeyRelease) + *kptr &= ~bit; + else + FatalError("Impossible keyboard event"); +} +#endif + +/** + * Main pointer event processing function for core pointer events. + * For motion events: update the sprite. + * For all other events: Update the event fields based on the current sprite + * state. + * + * For core pointer events, xE will always be a single event. + * + * @param xE Event list + * @param mouse The device that caused an event. + * @param count Number of elements in xE. + */ +void +#ifdef XKB +CoreProcessPointerEvent (xEvent *xE, DeviceIntPtr mouse, int count) +#else +ProcessPointerEvent (xEvent *xE, DeviceIntPtr mouse, int count) +#endif +{ + GrabPtr grab = mouse->grab; + Bool deactivateGrab = FALSE; + ButtonClassPtr butc = mouse->button; +#ifdef XKB + XkbSrvInfoPtr xkbi= inputInfo.keyboard->key->xkbInfo; +#endif +#ifdef XEVIE + if(xevieFlag && clients[xevieClientIndex] && !xeviegrabState && + (xevieMask & xevieFilters[xE->u.u.type])) { + if(xevieEventSent) + xevieEventSent = 0; + else { + xeviemouse = mouse; + WriteToClient(clients[xevieClientIndex], sizeof(xEvent), (char *)xE); + return; + } + } +#endif + + if (!syncEvents.playingEvents) + NoticeTime(xE) + XE_KBPTR.state = (butc->state | ( +#ifdef XKB + (noXkbExtension ? + inputInfo.keyboard->key->state : + xkbi->state.grab_mods) +#else + inputInfo.keyboard->key->state +#endif + )); + { + NoticeTime(xE); + if (DeviceEventCallback) + { + DeviceEventInfoRec eventinfo; + /* see comment in EnqueueEvents regarding the next three lines */ + if (xE->u.u.type == MotionNotify) + XE_KBPTR.root = + WindowTable[sprite.hotPhys.pScreen->myNum]->drawable.id; + eventinfo.events = xE; + eventinfo.count = count; + CallCallbacks(&DeviceEventCallback, (pointer)&eventinfo); + } + } + if (xE->u.u.type != MotionNotify) + { + int key; + BYTE *kptr; + int bit; + + XE_KBPTR.rootX = sprite.hot.x; + XE_KBPTR.rootY = sprite.hot.y; + + key = xE->u.u.detail; + kptr = &butc->down[key >> 3]; + bit = 1 << (key & 7); + switch (xE->u.u.type) + { + case ButtonPress: + mouse->valuator->motionHintWindow = NullWindow; + if (!(*kptr & bit)) + butc->buttonsDown++; + butc->motionMask = ButtonMotionMask; + *kptr |= bit; + if (xE->u.u.detail == 0) + return; + if (xE->u.u.detail <= 5) + butc->state |= (Button1Mask >> 1) << xE->u.u.detail; + filters[MotionNotify] = Motion_Filter(butc); + if (!grab) + if (CheckDeviceGrabs(mouse, xE, 0, count)) + return; + break; + case ButtonRelease: + mouse->valuator->motionHintWindow = NullWindow; + if (*kptr & bit) + --butc->buttonsDown; + if (!butc->buttonsDown) + butc->motionMask = 0; + *kptr &= ~bit; + if (xE->u.u.detail == 0) + return; + if (xE->u.u.detail <= 5) + butc->state &= ~((Button1Mask >> 1) << xE->u.u.detail); + filters[MotionNotify] = Motion_Filter(butc); + if (!butc->state && mouse->fromPassiveGrab) + deactivateGrab = TRUE; + break; + default: + FatalError("bogus pointer event from ddx: %d", xE->u.u.type); + } + } + else if (!CheckMotion(xE)) + return; + if (grab) + DeliverGrabbedEvent(xE, mouse, deactivateGrab, count); + else + DeliverDeviceEvents(sprite.win, xE, NullGrab, NullWindow, + mouse, count); + if (deactivateGrab) + (*mouse->DeactivateGrab)(mouse); +} + +#define AtMostOneClient \ + (SubstructureRedirectMask | ResizeRedirectMask | ButtonPressMask) +#define ManagerMask \ + (SubstructureRedirectMask | ResizeRedirectMask) + +/** + * Recalculate which events may be deliverable for the given window. + * Recalculated mask is used for quicker determination which events may be + * delivered to a window. + * + * The otherEventMasks on a WindowOptional is the combination of all event + * masks set by all clients on the window. + * deliverableEventMask is the combination of the eventMask and the + * otherEventMask. + * + * Traverses to siblings and parents of the window. + */ +void +RecalculateDeliverableEvents(pWin) + WindowPtr pWin; +{ + OtherClients *others; + WindowPtr pChild; + + pChild = pWin; + while (1) + { + if (pChild->optional) + { + pChild->optional->otherEventMasks = 0; + for (others = wOtherClients(pChild); others; others = others->next) + { + pChild->optional->otherEventMasks |= others->mask; + } + } + pChild->deliverableEvents = pChild->eventMask| + wOtherEventMasks(pChild); + if (pChild->parent) + pChild->deliverableEvents |= + (pChild->parent->deliverableEvents & + ~wDontPropagateMask(pChild) & PropagateMask); + if (pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + while (!pChild->nextSib && (pChild != pWin)) + pChild = pChild->parent; + if (pChild == pWin) + break; + pChild = pChild->nextSib; + } +} + +/** + * + * \param value must conform to DeleteType + */ +int +OtherClientGone(pointer value, XID id) +{ + OtherClientsPtr other, prev; + WindowPtr pWin = (WindowPtr)value; + + prev = 0; + for (other = wOtherClients(pWin); other; other = other->next) + { + if (other->resource == id) + { + if (prev) + prev->next = other->next; + else + { + if (!(pWin->optional->otherClients = other->next)) + CheckWindowOptionalNeed (pWin); + } + xfree(other); + RecalculateDeliverableEvents(pWin); + return(Success); + } + prev = other; + } + FatalError("client not on event list"); + /*NOTREACHED*/ + return -1; /* make compiler happy */ +} + +int +EventSelectForWindow(WindowPtr pWin, ClientPtr client, Mask mask) +{ + Mask check; + OtherClients * others; + int rc; + + if (mask & ~AllEventMasks) + { + client->errorValue = mask; + return BadValue; + } + check = (mask & ManagerMask); + if (check) { + rc = XaceHook(XACE_RESOURCE_ACCESS, client, pWin->drawable.id, + RT_WINDOW, pWin, RT_NONE, NULL, DixManageAccess); + if (rc != Success) + return rc; + } + check = (mask & AtMostOneClient); + if (check & (pWin->eventMask|wOtherEventMasks(pWin))) + { /* It is illegal for two different + clients to select on any of the + events for AtMostOneClient. However, + it is OK, for some client to + continue selecting on one of those + events. */ + if ((wClient(pWin) != client) && (check & pWin->eventMask)) + return BadAccess; + for (others = wOtherClients (pWin); others; others = others->next) + { + if (!SameClient(others, client) && (check & others->mask)) + return BadAccess; + } + } + if (wClient (pWin) == client) + { + check = pWin->eventMask; + pWin->eventMask = mask; + } + else + { + for (others = wOtherClients (pWin); others; others = others->next) + { + if (SameClient(others, client)) + { + check = others->mask; + if (mask == 0) + { + FreeResource(others->resource, RT_NONE); + return Success; + } + else + others->mask = mask; + goto maskSet; + } + } + check = 0; + if (!pWin->optional && !MakeWindowOptional (pWin)) + return BadAlloc; + others = (OtherClients *) xalloc(sizeof(OtherClients)); + if (!others) + return BadAlloc; + others->mask = mask; + others->resource = FakeClientID(client->index); + others->next = pWin->optional->otherClients; + pWin->optional->otherClients = others; + if (!AddResource(others->resource, RT_OTHERCLIENT, (pointer)pWin)) + return BadAlloc; + } +maskSet: + if ((inputInfo.pointer->valuator->motionHintWindow == pWin) && + (mask & PointerMotionHintMask) && + !(check & PointerMotionHintMask) && + !inputInfo.pointer->grab) + inputInfo.pointer->valuator->motionHintWindow = NullWindow; + RecalculateDeliverableEvents(pWin); + return Success; +} + +int +EventSuppressForWindow(WindowPtr pWin, ClientPtr client, + Mask mask, Bool *checkOptional) +{ + int i, free; + + if (mask & ~PropagateMask) + { + client->errorValue = mask; + return BadValue; + } + if (pWin->dontPropagate) + DontPropagateRefCnts[pWin->dontPropagate]--; + if (!mask) + i = 0; + else + { + for (i = DNPMCOUNT, free = 0; --i > 0; ) + { + if (!DontPropagateRefCnts[i]) + free = i; + else if (mask == DontPropagateMasks[i]) + break; + } + if (!i && free) + { + i = free; + DontPropagateMasks[i] = mask; + } + } + if (i || !mask) + { + pWin->dontPropagate = i; + if (i) + DontPropagateRefCnts[i]++; + if (pWin->optional) + { + pWin->optional->dontPropagateMask = mask; + *checkOptional = TRUE; + } + } + else + { + if (!pWin->optional && !MakeWindowOptional (pWin)) + { + if (pWin->dontPropagate) + DontPropagateRefCnts[pWin->dontPropagate]++; + return BadAlloc; + } + pWin->dontPropagate = 0; + pWin->optional->dontPropagateMask = mask; + } + RecalculateDeliverableEvents(pWin); + return Success; +} + +/** + * @return The window that is the first ancestor of both a and b. + */ +static WindowPtr +CommonAncestor( + WindowPtr a, + WindowPtr b) +{ + for (b = b->parent; b; b = b->parent) + if (IsParent(b, a)) return b; + return NullWindow; +} + +/** + * Assembles an EnterNotify or LeaveNotify and sends it event to the client. + * The core devices are used to fill in the event fields. + */ +static void +EnterLeaveEvent( + int type, + int mode, + int detail, + WindowPtr pWin, + Window child) +{ + xEvent event; + DeviceIntPtr keybd = inputInfo.keyboard; + WindowPtr focus; + DeviceIntPtr mouse = inputInfo.pointer; + GrabPtr grab = mouse->grab; + Mask mask; + + if ((pWin == mouse->valuator->motionHintWindow) && + (detail != NotifyInferior)) + mouse->valuator->motionHintWindow = NullWindow; + if (grab) + { + mask = (pWin == grab->window) ? grab->eventMask : 0; + if (grab->ownerEvents) + mask |= EventMaskForClient(pWin, rClient(grab)); + } + else + { + mask = pWin->eventMask | wOtherEventMasks(pWin); + } + if (mask & filters[type]) + { + event.u.u.type = type; + event.u.u.detail = detail; + event.u.enterLeave.time = currentTime.milliseconds; + event.u.enterLeave.rootX = sprite.hot.x; + event.u.enterLeave.rootY = sprite.hot.y; + /* Counts on the same initial structure of crossing & button events! */ + FixUpEventFromWindow(&event, pWin, None, FALSE); + /* Enter/Leave events always set child */ + event.u.enterLeave.child = child; + event.u.enterLeave.flags = event.u.keyButtonPointer.sameScreen ? + ELFlagSameScreen : 0; +#ifdef XKB + if (!noXkbExtension) { + event.u.enterLeave.state = mouse->button->state & 0x1f00; + event.u.enterLeave.state |= + XkbGrabStateFromRec(&keybd->key->xkbInfo->state); + } else +#endif + event.u.enterLeave.state = keybd->key->state | mouse->button->state; + event.u.enterLeave.mode = mode; + focus = keybd->focus->win; + if ((focus != NoneWin) && + ((pWin == focus) || (focus == PointerRootWin) || + IsParent(focus, pWin))) + event.u.enterLeave.flags |= ELFlagFocus; + if (grab) + (void)TryClientEvents(rClient(grab), &event, 1, mask, + filters[type], grab); + else + (void)DeliverEventsToWindow(pWin, &event, 1, filters[type], + NullGrab, 0); + } + if ((type == EnterNotify) && (mask & KeymapStateMask)) + { + xKeymapEvent ke; + ClientPtr client = grab ? rClient(grab) + : clients[CLIENT_ID(pWin->drawable.id)]; + if (XaceHook(XACE_DEVICE_ACCESS, client, keybd, DixReadAccess)) + bzero((char *)&ke.map[0], 31); + else + memmove((char *)&ke.map[0], (char *)&keybd->key->down[1], 31); + + ke.type = KeymapNotify; + if (grab) + (void)TryClientEvents(rClient(grab), (xEvent *)&ke, 1, mask, + KeymapStateMask, grab); + else + (void)DeliverEventsToWindow(pWin, (xEvent *)&ke, 1, + KeymapStateMask, NullGrab, 0); + } +} + +/** + * Send enter notifies to all parent windows up to ancestor. + * This function recurses. + */ +static void +EnterNotifies(WindowPtr ancestor, WindowPtr child, int mode, int detail) +{ + WindowPtr parent = child->parent; + + if (ancestor == parent) + return; + EnterNotifies(ancestor, parent, mode, detail); + EnterLeaveEvent(EnterNotify, mode, detail, parent, child->drawable.id); +} + + +/** + * Send leave notifies to all parent windows up to ancestor. + * This function recurses. + */ +static void +LeaveNotifies(WindowPtr child, WindowPtr ancestor, int mode, int detail) +{ + WindowPtr pWin; + + if (ancestor == child) + return; + for (pWin = child->parent; pWin != ancestor; pWin = pWin->parent) + { + EnterLeaveEvent(LeaveNotify, mode, detail, pWin, child->drawable.id); + child = pWin; + } +} + +/** + * Figure out if enter/leave events are necessary and send them to the + * appropriate windows. + * + * @param fromWin Window the sprite moved out of. + * @param toWin Window the sprite moved into. + */ +static void +DoEnterLeaveEvents(WindowPtr fromWin, WindowPtr toWin, int mode) +{ + if (fromWin == toWin) + return; + if (IsParent(fromWin, toWin)) + { + EnterLeaveEvent(LeaveNotify, mode, NotifyInferior, fromWin, None); + EnterNotifies(fromWin, toWin, mode, NotifyVirtual); + EnterLeaveEvent(EnterNotify, mode, NotifyAncestor, toWin, None); + } + else if (IsParent(toWin, fromWin)) + { + EnterLeaveEvent(LeaveNotify, mode, NotifyAncestor, fromWin, None); + LeaveNotifies(fromWin, toWin, mode, NotifyVirtual); + EnterLeaveEvent(EnterNotify, mode, NotifyInferior, toWin, None); + } + else + { /* neither fromWin nor toWin is descendent of the other */ + WindowPtr common = CommonAncestor(toWin, fromWin); + /* common == NullWindow ==> different screens */ + EnterLeaveEvent(LeaveNotify, mode, NotifyNonlinear, fromWin, None); + LeaveNotifies(fromWin, common, mode, NotifyNonlinearVirtual); + EnterNotifies(common, toWin, mode, NotifyNonlinearVirtual); + EnterLeaveEvent(EnterNotify, mode, NotifyNonlinear, toWin, None); + } +} + +static void +FocusEvent(DeviceIntPtr dev, int type, int mode, int detail, WindowPtr pWin) +{ + xEvent event; + +#ifdef XINPUT + if (dev != inputInfo.keyboard) + { + DeviceFocusEvent(dev, type, mode, detail, pWin); + return; + } +#endif + event.u.focus.mode = mode; + event.u.u.type = type; + event.u.u.detail = detail; + event.u.focus.window = pWin->drawable.id; + (void)DeliverEventsToWindow(pWin, &event, 1, filters[type], NullGrab, + 0); + if ((type == FocusIn) && + ((pWin->eventMask | wOtherEventMasks(pWin)) & KeymapStateMask)) + { + xKeymapEvent ke; + ClientPtr client = clients[CLIENT_ID(pWin->drawable.id)]; + if (XaceHook(XACE_DEVICE_ACCESS, client, dev, DixReadAccess)) + bzero((char *)&ke.map[0], 31); + else + memmove((char *)&ke.map[0], (char *)&dev->key->down[1], 31); + + ke.type = KeymapNotify; + (void)DeliverEventsToWindow(pWin, (xEvent *)&ke, 1, + KeymapStateMask, NullGrab, 0); + } +} + + /* + * recursive because it is easier + * no-op if child not descended from ancestor + */ +static Bool +FocusInEvents( + DeviceIntPtr dev, + WindowPtr ancestor, WindowPtr child, WindowPtr skipChild, + int mode, int detail, + Bool doAncestor) +{ + if (child == NullWindow) + return ancestor == NullWindow; + if (ancestor == child) + { + if (doAncestor) + FocusEvent(dev, FocusIn, mode, detail, child); + return TRUE; + } + if (FocusInEvents(dev, ancestor, child->parent, skipChild, mode, detail, + doAncestor)) + { + if (child != skipChild) + FocusEvent(dev, FocusIn, mode, detail, child); + return TRUE; + } + return FALSE; +} + +/* dies horribly if ancestor is not an ancestor of child */ +static void +FocusOutEvents( + DeviceIntPtr dev, + WindowPtr child, WindowPtr ancestor, + int mode, int detail, + Bool doAncestor) +{ + WindowPtr pWin; + + for (pWin = child; pWin != ancestor; pWin = pWin->parent) + FocusEvent(dev, FocusOut, mode, detail, pWin); + if (doAncestor) + FocusEvent(dev, FocusOut, mode, detail, ancestor); +} + +void +DoFocusEvents(DeviceIntPtr dev, WindowPtr fromWin, WindowPtr toWin, int mode) +{ + int out, in; /* for holding details for to/from + PointerRoot/None */ + int i; + + if (fromWin == toWin) + return; + out = (fromWin == NoneWin) ? NotifyDetailNone : NotifyPointerRoot; + in = (toWin == NoneWin) ? NotifyDetailNone : NotifyPointerRoot; + /* wrong values if neither, but then not referenced */ + + if ((toWin == NullWindow) || (toWin == PointerRootWin)) + { + if ((fromWin == NullWindow) || (fromWin == PointerRootWin)) + { + if (fromWin == PointerRootWin) + FocusOutEvents(dev, sprite.win, ROOT, mode, NotifyPointer, + TRUE); + /* Notify all the roots */ +#ifdef PANORAMIX + if ( !noPanoramiXExtension ) + FocusEvent(dev, FocusOut, mode, out, WindowTable[0]); + else +#endif + for (i=0; iparent, NullWindow, mode, + NotifyNonlinearVirtual, FALSE); + } + /* Notify all the roots */ +#ifdef PANORAMIX + if ( !noPanoramiXExtension ) + FocusEvent(dev, FocusIn, mode, in, WindowTable[0]); + else +#endif + for (i=0; iparent != NullWindow) + (void)FocusInEvents(dev, ROOT, toWin, toWin, mode, + NotifyNonlinearVirtual, TRUE); + FocusEvent(dev, FocusIn, mode, NotifyNonlinear, toWin); + if (IsParent(toWin, sprite.win)) + (void)FocusInEvents(dev, toWin, sprite.win, NullWindow, mode, + NotifyPointer, FALSE); + } + else + { + if (IsParent(toWin, fromWin)) + { + FocusEvent(dev, FocusOut, mode, NotifyAncestor, fromWin); + FocusOutEvents(dev, fromWin->parent, toWin, mode, + NotifyVirtual, FALSE); + FocusEvent(dev, FocusIn, mode, NotifyInferior, toWin); + if ((IsParent(toWin, sprite.win)) && + (sprite.win != fromWin) && + (!IsParent(fromWin, sprite.win)) && + (!IsParent(sprite.win, fromWin))) + (void)FocusInEvents(dev, toWin, sprite.win, NullWindow, + mode, NotifyPointer, FALSE); + } + else + if (IsParent(fromWin, toWin)) + { + if ((IsParent(fromWin, sprite.win)) && + (sprite.win != fromWin) && + (!IsParent(toWin, sprite.win)) && + (!IsParent(sprite.win, toWin))) + FocusOutEvents(dev, sprite.win, fromWin, mode, + NotifyPointer, FALSE); + FocusEvent(dev, FocusOut, mode, NotifyInferior, fromWin); + (void)FocusInEvents(dev, fromWin, toWin, toWin, mode, + NotifyVirtual, FALSE); + FocusEvent(dev, FocusIn, mode, NotifyAncestor, toWin); + } + else + { + /* neither fromWin or toWin is child of other */ + WindowPtr common = CommonAncestor(toWin, fromWin); + /* common == NullWindow ==> different screens */ + if (IsParent(fromWin, sprite.win)) + FocusOutEvents(dev, sprite.win, fromWin, mode, + NotifyPointer, FALSE); + FocusEvent(dev, FocusOut, mode, NotifyNonlinear, fromWin); + if (fromWin->parent != NullWindow) + FocusOutEvents(dev, fromWin->parent, common, mode, + NotifyNonlinearVirtual, FALSE); + if (toWin->parent != NullWindow) + (void)FocusInEvents(dev, common, toWin, toWin, mode, + NotifyNonlinearVirtual, FALSE); + FocusEvent(dev, FocusIn, mode, NotifyNonlinear, toWin); + if (IsParent(toWin, sprite.win)) + (void)FocusInEvents(dev, toWin, sprite.win, NullWindow, + mode, NotifyPointer, FALSE); + } + } + } +} + +/** + * Set the input focus to the given window. Subsequent keyboard events will be + * delivered to the given window. + * + * Usually called from ProcSetInputFocus as result of a client request. If so, + * the device is the inputInfo.keyboard. + * If called from ProcXSetInputFocus as result of a client xinput request, the + * device is set to the device specified by the client. + * + * @param client Client that requested input focus change. + * @param dev Focus device. + * @param focusID The window to obtain the focus. Can be PointerRoot or None. + * @param revertTo Specifies where the focus reverts to when window becomes + * unviewable. + * @param ctime Specifies the time. + * @param followOK True if pointer is allowed to follow the keyboard. + */ +int +SetInputFocus( + ClientPtr client, + DeviceIntPtr dev, + Window focusID, + CARD8 revertTo, + Time ctime, + Bool followOK) +{ + FocusClassPtr focus; + WindowPtr focusWin; + int mode, rc; + TimeStamp time; + + UpdateCurrentTime(); + if ((revertTo != RevertToParent) && + (revertTo != RevertToPointerRoot) && + (revertTo != RevertToNone) && + ((revertTo != RevertToFollowKeyboard) || !followOK)) + { + client->errorValue = revertTo; + return BadValue; + } + time = ClientTimeToServerTime(ctime); + if ((focusID == None) || (focusID == PointerRoot)) + focusWin = (WindowPtr)(long)focusID; + else if ((focusID == FollowKeyboard) && followOK) + focusWin = inputInfo.keyboard->focus->win; + else { + rc = dixLookupWindow(&focusWin, focusID, client, DixSetAttrAccess); + if (rc != Success) + return rc; + /* It is a match error to try to set the input focus to an + unviewable window. */ + if(!focusWin->realized) + return(BadMatch); + } + rc = XaceHook(XACE_DEVICE_ACCESS, client, dev, DixSetFocusAccess); + if (rc != Success) + return Success; + + focus = dev->focus; + if ((CompareTimeStamps(time, currentTime) == LATER) || + (CompareTimeStamps(time, focus->time) == EARLIER)) + return Success; + mode = (dev->grab) ? NotifyWhileGrabbed : NotifyNormal; + if (focus->win == FollowKeyboardWin) + DoFocusEvents(dev, inputInfo.keyboard->focus->win, focusWin, mode); + else + DoFocusEvents(dev, focus->win, focusWin, mode); + focus->time = time; + focus->revert = revertTo; + if (focusID == FollowKeyboard) + focus->win = FollowKeyboardWin; + else + focus->win = focusWin; + if ((focusWin == NoneWin) || (focusWin == PointerRootWin)) + focus->traceGood = 0; + else + { + int depth = 0; + WindowPtr pWin; + + for (pWin = focusWin; pWin; pWin = pWin->parent) depth++; + if (depth > focus->traceSize) + { + focus->traceSize = depth+1; + Must_have_memory = TRUE; /* XXX */ + focus->trace = (WindowPtr *)xrealloc(focus->trace, + focus->traceSize * + sizeof(WindowPtr)); + Must_have_memory = FALSE; /* XXX */ + } + focus->traceGood = depth; + for (pWin = focusWin, depth--; pWin; pWin = pWin->parent, depth--) + focus->trace[depth] = pWin; + } + return Success; +} + +/** + * Server-side protocol handling for SetInputFocus request. + * + * Sets the input focus for the virtual core keyboard. + */ +int +ProcSetInputFocus(client) + ClientPtr client; +{ + REQUEST(xSetInputFocusReq); + + REQUEST_SIZE_MATCH(xSetInputFocusReq); + + return SetInputFocus(client, inputInfo.keyboard, stuff->focus, + stuff->revertTo, stuff->time, FALSE); +} + +/** + * Server-side protocol handling for GetInputFocus request. + * + * Sends the current input focus for the virtual core keyboard back to the + * client. + */ +int +ProcGetInputFocus(ClientPtr client) +{ + xGetInputFocusReply rep; + FocusClassPtr focus = inputInfo.keyboard->focus; + int rc; + /* REQUEST(xReq); */ + REQUEST_SIZE_MATCH(xReq); + + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.keyboard, + DixGetFocusAccess); + if (rc != Success) + return rc; + + rep.type = X_Reply; + rep.length = 0; + rep.sequenceNumber = client->sequence; + if (focus->win == NoneWin) + rep.focus = None; + else if (focus->win == PointerRootWin) + rep.focus = PointerRoot; + else rep.focus = focus->win->drawable.id; + rep.revertTo = focus->revert; + WriteReplyToClient(client, sizeof(xGetInputFocusReply), &rep); + return Success; +} + +/** + * Server-side protocol handling for Grabpointer request. + * + * Sets an active grab on the inputInfo.pointer and returns success status to + * client. + */ +int +ProcGrabPointer(ClientPtr client) +{ + xGrabPointerReply rep; + DeviceIntPtr device = inputInfo.pointer; + GrabPtr grab; + WindowPtr pWin, confineTo; + CursorPtr cursor, oldCursor; + REQUEST(xGrabPointerReq); + TimeStamp time; + Mask access_mode = DixGrabAccess; + int rc; + + REQUEST_SIZE_MATCH(xGrabPointerReq); + UpdateCurrentTime(); + if ((stuff->pointerMode != GrabModeSync) && + (stuff->pointerMode != GrabModeAsync)) + { + client->errorValue = stuff->pointerMode; + return BadValue; + } + if ((stuff->keyboardMode != GrabModeSync) && + (stuff->keyboardMode != GrabModeAsync)) + { + client->errorValue = stuff->keyboardMode; + return BadValue; + } + if ((stuff->ownerEvents != xFalse) && (stuff->ownerEvents != xTrue)) + { + client->errorValue = stuff->ownerEvents; + return BadValue; + } + if (stuff->eventMask & ~PointerGrabMask) + { + client->errorValue = stuff->eventMask; + return BadValue; + } + rc = dixLookupWindow(&pWin, stuff->grabWindow, client, DixSetAttrAccess); + if (rc != Success) + return rc; + if (stuff->confineTo == None) + confineTo = NullWindow; + else + { + rc = dixLookupWindow(&confineTo, stuff->confineTo, client, + DixSetAttrAccess); + if (rc != Success) + return rc; + } + if (stuff->cursor == None) + cursor = NullCursor; + else + { + rc = dixLookupResource((pointer *)&cursor, stuff->cursor, RT_CURSOR, + client, DixUseAccess); + if (rc != Success) + { + client->errorValue = stuff->cursor; + return (rc == BadValue) ? BadCursor : rc; + } + access_mode |= DixForceAccess; + } + if (stuff->pointerMode == GrabModeSync || + stuff->keyboardMode == GrabModeSync) + access_mode |= DixFreezeAccess; + rc = XaceHook(XACE_DEVICE_ACCESS, client, device, access_mode); + if (rc != Success) + return rc; + + /* at this point, some sort of reply is guaranteed. */ + time = ClientTimeToServerTime(stuff->time); + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.length = 0; + grab = device->grab; + if ((grab) && !SameClient(grab, client)) + rep.status = AlreadyGrabbed; + else if ((!pWin->realized) || + (confineTo && + !(confineTo->realized && BorderSizeNotEmpty(confineTo)))) + rep.status = GrabNotViewable; + else if (device->sync.frozen && + device->sync.other && !SameClient(device->sync.other, client)) + rep.status = GrabFrozen; + else if ((CompareTimeStamps(time, currentTime) == LATER) || + (CompareTimeStamps(time, device->grabTime) == EARLIER)) + rep.status = GrabInvalidTime; + else + { + GrabRec tempGrab; + + oldCursor = NullCursor; + if (grab) + { + if (grab->confineTo && !confineTo) + ConfineCursorToWindow(ROOT, FALSE, FALSE); + oldCursor = grab->cursor; + } + tempGrab.cursor = cursor; + tempGrab.resource = client->clientAsMask; + tempGrab.ownerEvents = stuff->ownerEvents; + tempGrab.eventMask = stuff->eventMask; + tempGrab.confineTo = confineTo; + tempGrab.window = pWin; + tempGrab.keyboardMode = stuff->keyboardMode; + tempGrab.pointerMode = stuff->pointerMode; + tempGrab.device = device; + (*device->ActivateGrab)(device, &tempGrab, time, FALSE); + if (oldCursor) + FreeCursor (oldCursor, (Cursor)0); + rep.status = GrabSuccess; + } + WriteReplyToClient(client, sizeof(xGrabPointerReply), &rep); + return Success; +} + +/** + * Server-side protocol handling for ChangeActivePointerGrab request. + * + * Changes properties of the grab hold by the client. If the client does not + * hold an active grab on the device, nothing happens. + * + * Works on the core pointer only. + */ +int +ProcChangeActivePointerGrab(ClientPtr client) +{ + DeviceIntPtr device = inputInfo.pointer; + GrabPtr grab = device->grab; + CursorPtr newCursor, oldCursor; + REQUEST(xChangeActivePointerGrabReq); + TimeStamp time; + + REQUEST_SIZE_MATCH(xChangeActivePointerGrabReq); + if (stuff->eventMask & ~PointerGrabMask) + { + client->errorValue = stuff->eventMask; + return BadValue; + } + if (stuff->cursor == None) + newCursor = NullCursor; + else + { + int rc = dixLookupResource((pointer *)&newCursor, stuff->cursor, + RT_CURSOR, client, DixUseAccess); + if (rc != Success) + { + client->errorValue = stuff->cursor; + return (rc == BadValue) ? BadCursor : rc; + } + } + if (!grab) + return Success; + if (!SameClient(grab, client)) + return Success; + time = ClientTimeToServerTime(stuff->time); + if ((CompareTimeStamps(time, currentTime) == LATER) || + (CompareTimeStamps(time, device->grabTime) == EARLIER)) + return Success; + oldCursor = grab->cursor; + grab->cursor = newCursor; + if (newCursor) + newCursor->refcnt++; + PostNewCursor(); + if (oldCursor) + FreeCursor(oldCursor, (Cursor)0); + grab->eventMask = stuff->eventMask; + return Success; +} + +/** + * Server-side protocol handling for UngrabPointer request. + * + * Deletes the pointer grab on the core pointer device. + */ +int +ProcUngrabPointer(ClientPtr client) +{ + DeviceIntPtr device = inputInfo.pointer; + GrabPtr grab; + TimeStamp time; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + UpdateCurrentTime(); + grab = device->grab; + time = ClientTimeToServerTime(stuff->id); + if ((CompareTimeStamps(time, currentTime) != LATER) && + (CompareTimeStamps(time, device->grabTime) != EARLIER) && + (grab) && SameClient(grab, client)) + (*device->DeactivateGrab)(device); + return Success; +} + +/** + * Sets a grab on the given device. + * + * Called from ProcGrabKeyboard to work on the inputInfo.keyboard. + * Called from ProcXGrabDevice to work on the device specified by the client. + * + * The parameters this_mode and other_mode represent the keyboard_mode and + * pointer_mode parameters of XGrabKeyboard(). + * See man page for details on all the parameters + * + * @param client Client that owns the grab. + * @param dev The device to grab. + * @param this_mode GrabModeSync or GrabModeAsync + * @param other_mode GrabModeSync or GrabModeAsync + * @param status Return code to be returned to the caller. + * + * @returns Success or BadValue. + */ +int +GrabDevice(ClientPtr client, DeviceIntPtr dev, + unsigned this_mode, unsigned other_mode, Window grabWindow, + unsigned ownerEvents, Time ctime, Mask mask, CARD8 *status) +{ + WindowPtr pWin; + GrabPtr grab; + TimeStamp time; + Mask access_mode = DixGrabAccess; + int rc; + + UpdateCurrentTime(); + if ((this_mode != GrabModeSync) && (this_mode != GrabModeAsync)) + { + client->errorValue = this_mode; + return BadValue; + } + if ((other_mode != GrabModeSync) && (other_mode != GrabModeAsync)) + { + client->errorValue = other_mode; + return BadValue; + } + if ((ownerEvents != xFalse) && (ownerEvents != xTrue)) + { + client->errorValue = ownerEvents; + return BadValue; + } + + rc = dixLookupWindow(&pWin, grabWindow, client, DixSetAttrAccess); + if (rc != Success) + return rc; + if (this_mode == GrabModeSync || other_mode == GrabModeSync) + access_mode |= DixFreezeAccess; + rc = XaceHook(XACE_DEVICE_ACCESS, client, dev, access_mode); + if (rc != Success) + return rc; + + time = ClientTimeToServerTime(ctime); + grab = dev->grab; + if (grab && !SameClient(grab, client)) + *status = AlreadyGrabbed; + else if (!pWin->realized) + *status = GrabNotViewable; + else if ((CompareTimeStamps(time, currentTime) == LATER) || + (CompareTimeStamps(time, dev->grabTime) == EARLIER)) + *status = GrabInvalidTime; + else if (dev->sync.frozen && + dev->sync.other && !SameClient(dev->sync.other, client)) + *status = GrabFrozen; + else + { + GrabRec tempGrab; + + tempGrab.window = pWin; + tempGrab.resource = client->clientAsMask; + tempGrab.ownerEvents = ownerEvents; + tempGrab.keyboardMode = this_mode; + tempGrab.pointerMode = other_mode; + tempGrab.eventMask = mask; + tempGrab.device = dev; + (*dev->ActivateGrab)(dev, &tempGrab, time, FALSE); + *status = GrabSuccess; + } + return Success; +} + +/** + * Server-side protocol handling for GrabKeyboard request. + * + * Grabs the inputInfo.keyboad and returns success status to client. + */ +int +ProcGrabKeyboard(ClientPtr client) +{ + xGrabKeyboardReply rep; + REQUEST(xGrabKeyboardReq); + int result; + + REQUEST_SIZE_MATCH(xGrabKeyboardReq); + + result = GrabDevice(client, inputInfo.keyboard, stuff->keyboardMode, + stuff->pointerMode, stuff->grabWindow, + stuff->ownerEvents, stuff->time, + KeyPressMask | KeyReleaseMask, &rep.status); + + if (result != Success) + return result; + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.length = 0; + WriteReplyToClient(client, sizeof(xGrabKeyboardReply), &rep); + return Success; +} + +/** + * Server-side protocol handling for UngrabKeyboard request. + * + * Deletes a possible grab on the inputInfo.keyboard. + */ +int +ProcUngrabKeyboard(ClientPtr client) +{ + DeviceIntPtr device = inputInfo.keyboard; + GrabPtr grab; + TimeStamp time; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + UpdateCurrentTime(); + grab = device->grab; + time = ClientTimeToServerTime(stuff->id); + if ((CompareTimeStamps(time, currentTime) != LATER) && + (CompareTimeStamps(time, device->grabTime) != EARLIER) && + (grab) && SameClient(grab, client)) + (*device->DeactivateGrab)(device); + return Success; +} + +/** + * Server-side protocol handling for QueryPointer request. + * + * Returns the current state and position of the core pointer to the client. + */ +int +ProcQueryPointer(ClientPtr client) +{ + xQueryPointerReply rep; + WindowPtr pWin, t; + DeviceIntPtr mouse = inputInfo.pointer; + int rc; + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + rc = dixLookupWindow(&pWin, stuff->id, client, DixGetAttrAccess); + if (rc != Success) + return rc; + rc = XaceHook(XACE_DEVICE_ACCESS, client, mouse, DixReadAccess); + if (rc != Success) + return rc; + + if (mouse->valuator->motionHintWindow) + MaybeStopHint(mouse, client); + rep.type = X_Reply; + rep.sequenceNumber = client->sequence; + rep.mask = mouse->button->state | inputInfo.keyboard->key->state; + rep.length = 0; + rep.root = (ROOT)->drawable.id; + rep.rootX = sprite.hot.x; + rep.rootY = sprite.hot.y; + rep.child = None; + if (sprite.hot.pScreen == pWin->drawable.pScreen) + { + rep.sameScreen = xTrue; + rep.winX = sprite.hot.x - pWin->drawable.x; + rep.winY = sprite.hot.y - pWin->drawable.y; + for (t = sprite.win; t; t = t->parent) + if (t->parent == pWin) + { + rep.child = t->drawable.id; + break; + } + } + else + { + rep.sameScreen = xFalse; + rep.winX = 0; + rep.winY = 0; + } + +#ifdef PANORAMIX + if(!noPanoramiXExtension) { + rep.rootX += panoramiXdataPtr[0].x; + rep.rootY += panoramiXdataPtr[0].y; + if(stuff->id == rep.root) { + rep.winX += panoramiXdataPtr[0].x; + rep.winY += panoramiXdataPtr[0].y; + } + } +#endif + + WriteReplyToClient(client, sizeof(xQueryPointerReply), &rep); + + return(Success); +} + +/** + * Initializes the device list and the DIX sprite to sane values. Allocates + * trace memory used for quick window traversal. + */ +void +InitEvents(void) +{ + int i; + + sprite.hot.pScreen = sprite.hotPhys.pScreen = (ScreenPtr)NULL; + inputInfo.numDevices = 0; + inputInfo.devices = (DeviceIntPtr)NULL; + inputInfo.off_devices = (DeviceIntPtr)NULL; + inputInfo.keyboard = (DeviceIntPtr)NULL; + inputInfo.pointer = (DeviceIntPtr)NULL; + if (spriteTraceSize == 0) + { + spriteTraceSize = 32; + spriteTrace = (WindowPtr *)xalloc(32*sizeof(WindowPtr)); + if (!spriteTrace) + FatalError("failed to allocate spriteTrace"); + } + spriteTraceGood = 0; + lastEventMask = OwnerGrabButtonMask; + filters[MotionNotify] = PointerMotionMask; +#ifdef XEVIE + xeviewin = +#endif + sprite.win = NullWindow; + sprite.current = NullCursor; + sprite.hotLimits.x1 = 0; + sprite.hotLimits.y1 = 0; + sprite.hotLimits.x2 = 0; + sprite.hotLimits.y2 = 0; + sprite.confined = FALSE; + syncEvents.replayDev = (DeviceIntPtr)NULL; + syncEvents.replayWin = NullWindow; + while (syncEvents.pending) + { + QdEventPtr next = syncEvents.pending->next; + xfree(syncEvents.pending); + syncEvents.pending = next; + } + syncEvents.pendtail = &syncEvents.pending; + syncEvents.playingEvents = FALSE; + syncEvents.time.months = 0; + syncEvents.time.milliseconds = 0; /* hardly matters */ + currentTime.months = 0; + currentTime.milliseconds = GetTimeInMillis(); + lastDeviceEventTime = currentTime; + for (i = 0; i < DNPMCOUNT; i++) + { + DontPropagateMasks[i] = 0; + DontPropagateRefCnts[i] = 0; + } +} + +void +CloseDownEvents(void) +{ + xfree(spriteTrace); + spriteTrace = NULL; + spriteTraceSize = 0; +} + +/** + * Server-side protocol handling for SendEvent request. + * + * Locates the window to send the event to and forwards the event. + */ +int +ProcSendEvent(ClientPtr client) +{ + WindowPtr pWin; + WindowPtr effectiveFocus = NullWindow; /* only set if dest==InputFocus */ + REQUEST(xSendEventReq); + + REQUEST_SIZE_MATCH(xSendEventReq); + + /* The client's event type must be a core event type or one defined by an + extension. */ + + if ( ! ((stuff->event.u.u.type > X_Reply && + stuff->event.u.u.type < LASTEvent) || + (stuff->event.u.u.type >= EXTENSION_EVENT_BASE && + stuff->event.u.u.type < (unsigned)lastEvent))) + { + client->errorValue = stuff->event.u.u.type; + return BadValue; + } + if (stuff->event.u.u.type == ClientMessage && + stuff->event.u.u.detail != 8 && + stuff->event.u.u.detail != 16 && + stuff->event.u.u.detail != 32) + { + client->errorValue = stuff->event.u.u.detail; + return BadValue; + } + if (stuff->eventMask & ~AllEventMasks) + { + client->errorValue = stuff->eventMask; + return BadValue; + } + + if (stuff->destination == PointerWindow) + pWin = sprite.win; + else if (stuff->destination == InputFocus) + { + WindowPtr inputFocus = inputInfo.keyboard->focus->win; + + if (inputFocus == NoneWin) + return Success; + + /* If the input focus is PointerRootWin, send the event to where + the pointer is if possible, then perhaps propogate up to root. */ + if (inputFocus == PointerRootWin) + inputFocus = ROOT; + + if (IsParent(inputFocus, sprite.win)) + { + effectiveFocus = inputFocus; + pWin = sprite.win; + } + else + effectiveFocus = pWin = inputFocus; + } + else + dixLookupWindow(&pWin, stuff->destination, client, DixSendAccess); + + if (!pWin) + return BadWindow; + if ((stuff->propagate != xFalse) && (stuff->propagate != xTrue)) + { + client->errorValue = stuff->propagate; + return BadValue; + } + stuff->event.u.u.type |= 0x80; + if (stuff->propagate) + { + for (;pWin; pWin = pWin->parent) + { + if (XaceHook(XACE_SEND_ACCESS, client, NULL, pWin, + &stuff->event, 1)) + return Success; + if (DeliverEventsToWindow(pWin, &stuff->event, 1, stuff->eventMask, + NullGrab, 0)) + return Success; + if (pWin == effectiveFocus) + return Success; + stuff->eventMask &= ~wDontPropagateMask(pWin); + if (!stuff->eventMask) + break; + } + } + else if (!XaceHook(XACE_SEND_ACCESS, client, NULL, pWin, &stuff->event, 1)) + (void)DeliverEventsToWindow(pWin, &stuff->event, 1, stuff->eventMask, + NullGrab, 0); + return Success; +} + +/** + * Server-side protocol handling for UngrabKey request. + * + * Deletes a passive grab for the given key. Only works on the + * inputInfo.keyboard. + */ +int +ProcUngrabKey(ClientPtr client) +{ + REQUEST(xUngrabKeyReq); + WindowPtr pWin; + GrabRec tempGrab; + DeviceIntPtr keybd = inputInfo.keyboard; + int rc; + + REQUEST_SIZE_MATCH(xUngrabKeyReq); + rc = dixLookupWindow(&pWin, stuff->grabWindow, client, DixReadAccess); + if (rc != Success) + return rc; + + if (((stuff->key > keybd->key->curKeySyms.maxKeyCode) || + (stuff->key < keybd->key->curKeySyms.minKeyCode)) + && (stuff->key != AnyKey)) + { + client->errorValue = stuff->key; + return BadValue; + } + if ((stuff->modifiers != AnyModifier) && + (stuff->modifiers & ~AllModifiersMask)) + { + client->errorValue = stuff->modifiers; + return BadValue; + } + tempGrab.resource = client->clientAsMask; + tempGrab.device = keybd; + tempGrab.window = pWin; + tempGrab.modifiersDetail.exact = stuff->modifiers; + tempGrab.modifiersDetail.pMask = NULL; + tempGrab.modifierDevice = inputInfo.keyboard; + tempGrab.type = KeyPress; + tempGrab.detail.exact = stuff->key; + tempGrab.detail.pMask = NULL; + + if (!DeletePassiveGrabFromList(&tempGrab)) + return(BadAlloc); + return(Success); +} + +/** + * Server-side protocol handling for GrabKey request. + * + * Creates a grab for the inputInfo.keyboard and adds it to the list of + * passive grabs. + */ +int +ProcGrabKey(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xGrabKeyReq); + GrabPtr grab; + DeviceIntPtr keybd = inputInfo.keyboard; + int rc; + + REQUEST_SIZE_MATCH(xGrabKeyReq); + if ((stuff->ownerEvents != xTrue) && (stuff->ownerEvents != xFalse)) + { + client->errorValue = stuff->ownerEvents; + return(BadValue); + } + if ((stuff->pointerMode != GrabModeSync) && + (stuff->pointerMode != GrabModeAsync)) + { + client->errorValue = stuff->pointerMode; + return BadValue; + } + if ((stuff->keyboardMode != GrabModeSync) && + (stuff->keyboardMode != GrabModeAsync)) + { + client->errorValue = stuff->keyboardMode; + return BadValue; + } + if (((stuff->key > keybd->key->curKeySyms.maxKeyCode) || + (stuff->key < keybd->key->curKeySyms.minKeyCode)) + && (stuff->key != AnyKey)) + { + client->errorValue = stuff->key; + return BadValue; + } + if ((stuff->modifiers != AnyModifier) && + (stuff->modifiers & ~AllModifiersMask)) + { + client->errorValue = stuff->modifiers; + return BadValue; + } + rc = dixLookupWindow(&pWin, stuff->grabWindow, client, DixSetAttrAccess); + if (rc != Success) + return rc; + + grab = CreateGrab(client->index, keybd, pWin, + (Mask)(KeyPressMask | KeyReleaseMask), (Bool)stuff->ownerEvents, + (Bool)stuff->keyboardMode, (Bool)stuff->pointerMode, + keybd, stuff->modifiers, KeyPress, stuff->key, + NullWindow, NullCursor); + if (!grab) + return BadAlloc; + return AddPassiveGrabToList(client, grab); +} + + +/** + * Server-side protocol handling for GrabButton request. + * + * Creates a grab for the inputInfo.pointer and adds it as a passive grab to + * the list. + */ +int +ProcGrabButton(ClientPtr client) +{ + WindowPtr pWin, confineTo; + REQUEST(xGrabButtonReq); + CursorPtr cursor; + GrabPtr grab; + Mask access_mode = DixGrabAccess; + int rc; + + REQUEST_SIZE_MATCH(xGrabButtonReq); + if ((stuff->pointerMode != GrabModeSync) && + (stuff->pointerMode != GrabModeAsync)) + { + client->errorValue = stuff->pointerMode; + return BadValue; + } + if ((stuff->keyboardMode != GrabModeSync) && + (stuff->keyboardMode != GrabModeAsync)) + { + client->errorValue = stuff->keyboardMode; + return BadValue; + } + if ((stuff->modifiers != AnyModifier) && + (stuff->modifiers & ~AllModifiersMask)) + { + client->errorValue = stuff->modifiers; + return BadValue; + } + if ((stuff->ownerEvents != xFalse) && (stuff->ownerEvents != xTrue)) + { + client->errorValue = stuff->ownerEvents; + return BadValue; + } + if (stuff->eventMask & ~PointerGrabMask) + { + client->errorValue = stuff->eventMask; + return BadValue; + } + rc = dixLookupWindow(&pWin, stuff->grabWindow, client, DixSetAttrAccess); + if (rc != Success) + return rc; + if (stuff->confineTo == None) + confineTo = NullWindow; + else { + rc = dixLookupWindow(&confineTo, stuff->confineTo, client, + DixSetAttrAccess); + if (rc != Success) + return rc; + } + if (stuff->cursor == None) + cursor = NullCursor; + else + { + rc = dixLookupResource((pointer *)&cursor, stuff->cursor, RT_CURSOR, + client, DixUseAccess); + if (rc != Success) + if (!cursor) + { + client->errorValue = stuff->cursor; + return (rc == BadValue) ? BadCursor : rc; + } + access_mode |= DixForceAccess; + } + if (stuff->pointerMode == GrabModeSync || + stuff->keyboardMode == GrabModeSync) + access_mode |= DixFreezeAccess; + rc = XaceHook(XACE_DEVICE_ACCESS, client, inputInfo.pointer, access_mode); + if (rc != Success) + return rc; + + grab = CreateGrab(client->index, inputInfo.pointer, pWin, + (Mask)stuff->eventMask, (Bool)stuff->ownerEvents, + (Bool) stuff->keyboardMode, (Bool)stuff->pointerMode, + inputInfo.keyboard, stuff->modifiers, ButtonPress, + stuff->button, confineTo, cursor); + if (!grab) + return BadAlloc; + return AddPassiveGrabToList(client, grab); +} + +/** + * Server-side protocol handling for UngrabButton request. + * + * Deletes a passive grab on the inputInfo.pointer from the list. + */ +int +ProcUngrabButton(ClientPtr client) +{ + REQUEST(xUngrabButtonReq); + WindowPtr pWin; + GrabRec tempGrab; + int rc; + + REQUEST_SIZE_MATCH(xUngrabButtonReq); + if ((stuff->modifiers != AnyModifier) && + (stuff->modifiers & ~AllModifiersMask)) + { + client->errorValue = stuff->modifiers; + return BadValue; + } + rc = dixLookupWindow(&pWin, stuff->grabWindow, client, DixReadAccess); + if (rc != Success) + return rc; + tempGrab.resource = client->clientAsMask; + tempGrab.device = inputInfo.pointer; + tempGrab.window = pWin; + tempGrab.modifiersDetail.exact = stuff->modifiers; + tempGrab.modifiersDetail.pMask = NULL; + tempGrab.modifierDevice = inputInfo.keyboard; + tempGrab.type = ButtonPress; + tempGrab.detail.exact = stuff->button; + tempGrab.detail.pMask = NULL; + + if (!DeletePassiveGrabFromList(&tempGrab)) + return(BadAlloc); + return(Success); +} + +/** + * Deactivate any grab that may be on the window, remove the focus. + * Delete any XInput extension events from the window too. Does not change the + * window mask. Use just before the window is deleted. + * + * If freeResources is set, passive grabs on the window are deleted. + * + * @param pWin The window to delete events from. + * @param freeResources True if resources associated with the window should be + * deleted. + */ +void +DeleteWindowFromAnyEvents(WindowPtr pWin, Bool freeResources) +{ + WindowPtr parent; + DeviceIntPtr mouse = inputInfo.pointer; + DeviceIntPtr keybd = inputInfo.keyboard; + FocusClassPtr focus = keybd->focus; + OtherClientsPtr oc; + GrabPtr passive; + + + /* Deactivate any grabs performed on this window, before making any + input focus changes. */ + + if (mouse->grab && + ((mouse->grab->window == pWin) || (mouse->grab->confineTo == pWin))) + (*mouse->DeactivateGrab)(mouse); + + /* Deactivating a keyboard grab should cause focus events. */ + + if (keybd->grab && (keybd->grab->window == pWin)) + (*keybd->DeactivateGrab)(keybd); + + /* If the focus window is a root window (ie. has no parent) then don't + delete the focus from it. */ + + if ((pWin == focus->win) && (pWin->parent != NullWindow)) + { + int focusEventMode = NotifyNormal; + + /* If a grab is in progress, then alter the mode of focus events. */ + + if (keybd->grab) + focusEventMode = NotifyWhileGrabbed; + + switch (focus->revert) + { + case RevertToNone: + DoFocusEvents(keybd, pWin, NoneWin, focusEventMode); + focus->win = NoneWin; + focus->traceGood = 0; + break; + case RevertToParent: + parent = pWin; + do + { + parent = parent->parent; + focus->traceGood--; + } while (!parent->realized +/* This would be a good protocol change -- windows being reparented + during SaveSet processing would cause the focus to revert to the + nearest enclosing window which will survive the death of the exiting + client, instead of ending up reverting to a dying window and thence + to None + */ +#ifdef NOTDEF + || clients[CLIENT_ID(parent->drawable.id)]->clientGone +#endif + ); + DoFocusEvents(keybd, pWin, parent, focusEventMode); + focus->win = parent; + focus->revert = RevertToNone; + break; + case RevertToPointerRoot: + DoFocusEvents(keybd, pWin, PointerRootWin, focusEventMode); + focus->win = PointerRootWin; + focus->traceGood = 0; + break; + } + } + + if (mouse->valuator->motionHintWindow == pWin) + mouse->valuator->motionHintWindow = NullWindow; + + if (freeResources) + { + if (pWin->dontPropagate) + DontPropagateRefCnts[pWin->dontPropagate]--; + while ( (oc = wOtherClients(pWin)) ) + FreeResource(oc->resource, RT_NONE); + while ( (passive = wPassiveGrabs(pWin)) ) + FreeResource(passive->resource, RT_NONE); + } +#ifdef XINPUT + DeleteWindowFromAnyExtEvents(pWin, freeResources); +#endif +} + +/** + * Call this whenever some window at or below pWin has changed geometry. If + * there is a grab on the window, the cursor will be re-confined into the + * window. + */ +_X_EXPORT void +CheckCursorConfinement(WindowPtr pWin) +{ + GrabPtr grab = inputInfo.pointer->grab; + WindowPtr confineTo; + +#ifdef PANORAMIX + if(!noPanoramiXExtension && pWin->drawable.pScreen->myNum) return; +#endif + + if (grab && (confineTo = grab->confineTo)) + { + if (!BorderSizeNotEmpty(confineTo)) + (*inputInfo.pointer->DeactivateGrab)(inputInfo.pointer); + else if ((pWin == confineTo) || IsParent(pWin, confineTo)) + ConfineCursorToWindow(confineTo, TRUE, TRUE); + } +} + +Mask +EventMaskForClient(WindowPtr pWin, ClientPtr client) +{ + OtherClientsPtr other; + + if (wClient (pWin) == client) + return pWin->eventMask; + for (other = wOtherClients(pWin); other; other = other->next) + { + if (SameClient(other, client)) + return other->mask; + } + return 0; +} + +/** + * Server-side protocol handling for RecolorCursor request. + */ +int +ProcRecolorCursor(ClientPtr client) +{ + CursorPtr pCursor; + int rc, nscr; + ScreenPtr pscr; + Bool displayed; + REQUEST(xRecolorCursorReq); + + REQUEST_SIZE_MATCH(xRecolorCursorReq); + rc = dixLookupResource((pointer *)&pCursor, stuff->cursor, RT_CURSOR, + client, DixWriteAccess); + if (rc != Success) + { + client->errorValue = stuff->cursor; + return (rc == BadValue) ? BadCursor : rc; + } + + pCursor->foreRed = stuff->foreRed; + pCursor->foreGreen = stuff->foreGreen; + pCursor->foreBlue = stuff->foreBlue; + + pCursor->backRed = stuff->backRed; + pCursor->backGreen = stuff->backGreen; + pCursor->backBlue = stuff->backBlue; + + for (nscr = 0; nscr < screenInfo.numScreens; nscr++) + { + pscr = screenInfo.screens[nscr]; +#ifdef PANORAMIX + if(!noPanoramiXExtension) + displayed = (pscr == sprite.screen); + else +#endif + displayed = (pscr == sprite.hotPhys.pScreen); + ( *pscr->RecolorCursor)(pscr, pCursor, + (pCursor == sprite.current) && displayed); + } + return (Success); +} + +/** + * Write the given events to a client, swapping the byte order if necessary. + * To swap the byte ordering, a callback is called that has to be set up for + * the given event type. + * + * In the case of DeviceMotionNotify trailed by DeviceValuators, the events + * can be more than one. Usually it's just one event. + * + * Do not modify the event structure passed in. See comment below. + * + * @param pClient Client to send events to. + * @param count Number of events. + * @param events The event list. + */ +_X_EXPORT void +WriteEventsToClient(ClientPtr pClient, int count, xEvent *events) +{ +#ifdef PANORAMIX + xEvent eventCopy; +#endif + xEvent eventTo, *eventFrom; + int i; + +#ifdef XKB + if ((!noXkbExtension)&&(!XkbFilterEvents(pClient, count, events))) + return; +#endif + +#ifdef PANORAMIX + if(!noPanoramiXExtension && + (panoramiXdataPtr[0].x || panoramiXdataPtr[0].y)) + { + switch(events->u.u.type) { + case MotionNotify: + case ButtonPress: + case ButtonRelease: + case KeyPress: + case KeyRelease: + case EnterNotify: + case LeaveNotify: + /* + When multiple clients want the same event DeliverEventsToWindow + passes the same event structure multiple times so we can't + modify the one passed to us + */ + count = 1; /* should always be 1 */ + memcpy(&eventCopy, events, sizeof(xEvent)); + eventCopy.u.keyButtonPointer.rootX += panoramiXdataPtr[0].x; + eventCopy.u.keyButtonPointer.rootY += panoramiXdataPtr[0].y; + if(eventCopy.u.keyButtonPointer.event == + eventCopy.u.keyButtonPointer.root) + { + eventCopy.u.keyButtonPointer.eventX += panoramiXdataPtr[0].x; + eventCopy.u.keyButtonPointer.eventY += panoramiXdataPtr[0].y; + } + events = &eventCopy; + break; + default: break; + } + } +#endif + + if (EventCallback) + { + EventInfoRec eventinfo; + eventinfo.client = pClient; + eventinfo.events = events; + eventinfo.count = count; + CallCallbacks(&EventCallback, (pointer)&eventinfo); + } +#ifdef XSERVER_DTRACE + if (XSERVER_SEND_EVENT_ENABLED()) { + for (i = 0; i < count; i++) + { + XSERVER_SEND_EVENT(pClient->index, events[i].u.u.type, &events[i]); + } + } +#endif + if(pClient->swapped) + { + for(i = 0; i < count; i++) + { + eventFrom = &events[i]; + /* Remember to strip off the leading bit of type in case + this event was sent with "SendEvent." */ + (*EventSwapVector[eventFrom->u.u.type & 0177]) + (eventFrom, &eventTo); + (void)WriteToClient(pClient, sizeof(xEvent), (char *)&eventTo); + } + } + else + { + (void)WriteToClient(pClient, count * sizeof(xEvent), (char *) events); + } +} diff --git a/xorg-server/dix/extension.c b/xorg-server/dix/extension.c new file mode 100644 index 000000000..9740c1b50 --- /dev/null +++ b/xorg-server/dix/extension.c @@ -0,0 +1,356 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_EVENTS +#define NEED_REPLIES +#include +#include "misc.h" +#include "dixstruct.h" +#include "extnsionst.h" +#include "gcstruct.h" +#include "scrnintstr.h" +#include "dispatch.h" +#include "privates.h" +#include "registry.h" +#include "xace.h" + +#define EXTENSION_BASE 128 +#define EXTENSION_EVENT_BASE 64 +#define LAST_EVENT 128 +#define LAST_ERROR 255 + +static ExtensionEntry **extensions = (ExtensionEntry **)NULL; + +int lastEvent = EXTENSION_EVENT_BASE; +static int lastError = FirstExtensionError; +static unsigned int NumExtensions = 0; + +_X_EXPORT ExtensionEntry * +AddExtension(char *name, int NumEvents, int NumErrors, + int (*MainProc)(ClientPtr c1), + int (*SwappedMainProc)(ClientPtr c2), + void (*CloseDownProc)(ExtensionEntry *e), + unsigned short (*MinorOpcodeProc)(ClientPtr c3)) +{ + int i; + ExtensionEntry *ext, **newexts; + + if (!MainProc || !SwappedMainProc || !CloseDownProc || !MinorOpcodeProc) + return((ExtensionEntry *) NULL); + if ((lastEvent + NumEvents > LAST_EVENT) || + (unsigned)(lastError + NumErrors > LAST_ERROR)) + return((ExtensionEntry *) NULL); + + ext = (ExtensionEntry *) xalloc(sizeof(ExtensionEntry)); + if (!ext) + return((ExtensionEntry *) NULL); + ext->name = (char *)xalloc(strlen(name) + 1); + ext->num_aliases = 0; + ext->aliases = (char **)NULL; + ext->devPrivates = NULL; + if (!ext->name) + { + xfree(ext); + return((ExtensionEntry *) NULL); + } + strcpy(ext->name, name); + i = NumExtensions; + newexts = (ExtensionEntry **) xrealloc(extensions, + (i + 1) * sizeof(ExtensionEntry *)); + if (!newexts) + { + xfree(ext->name); + xfree(ext); + return((ExtensionEntry *) NULL); + } + NumExtensions++; + extensions = newexts; + extensions[i] = ext; + ext->index = i; + ext->base = i + EXTENSION_BASE; + ext->CloseDown = CloseDownProc; + ext->MinorOpcode = MinorOpcodeProc; + ProcVector[i + EXTENSION_BASE] = MainProc; + SwappedProcVector[i + EXTENSION_BASE] = SwappedMainProc; + if (NumEvents) + { + ext->eventBase = lastEvent; + ext->eventLast = lastEvent + NumEvents; + lastEvent += NumEvents; + } + else + { + ext->eventBase = 0; + ext->eventLast = 0; + } + if (NumErrors) + { + ext->errorBase = lastError; + ext->errorLast = lastError + NumErrors; + lastError += NumErrors; + } + else + { + ext->errorBase = 0; + ext->errorLast = 0; + } + + RegisterExtensionNames(ext); + return(ext); +} + +_X_EXPORT Bool AddExtensionAlias(char *alias, ExtensionEntry *ext) +{ + char *name; + char **aliases; + + if (!ext) + return FALSE ; + aliases = (char **)xrealloc(ext->aliases, + (ext->num_aliases + 1) * sizeof(char *)); + if (!aliases) + return FALSE; + ext->aliases = aliases; + name = (char *)xalloc(strlen(alias) + 1); + if (!name) + return FALSE; + strcpy(name, alias); + ext->aliases[ext->num_aliases] = name; + ext->num_aliases++; + return TRUE; +} + +static int +FindExtension(char *extname, int len) +{ + int i, j; + + for (i=0; iname) == len) && + !strncmp(extname, extensions[i]->name, len)) + break; + for (j = extensions[i]->num_aliases; --j >= 0;) + { + if ((strlen(extensions[i]->aliases[j]) == len) && + !strncmp(extname, extensions[i]->aliases[j], len)) + break; + } + if (j >= 0) break; + } + return ((i == NumExtensions) ? -1 : i); +} + +/* + * CheckExtension returns the extensions[] entry for the requested + * extension name. Maybe this could just return a Bool instead? + */ +_X_EXPORT ExtensionEntry * +CheckExtension(const char *extname) +{ + int n; + + n = FindExtension((char*)extname, strlen(extname)); + if (n != -1) + return extensions[n]; + else + return NULL; +} + +/* + * Added as part of Xace. + */ +ExtensionEntry * +GetExtensionEntry(int major) +{ + if (major < EXTENSION_BASE) + return NULL; + major -= EXTENSION_BASE; + if (major >= NumExtensions) + return NULL; + return extensions[major]; +} + +_X_EXPORT unsigned short +StandardMinorOpcode(ClientPtr client) +{ + return ((xReq *)client->requestBuffer)->data; +} + +_X_EXPORT unsigned short +MinorOpcodeOfRequest(ClientPtr client) +{ + unsigned char major; + + major = ((xReq *)client->requestBuffer)->reqType; + if (major < EXTENSION_BASE) + return 0; + major -= EXTENSION_BASE; + if (major >= NumExtensions) + return 0; + return (*extensions[major]->MinorOpcode)(client); +} + +void +CloseDownExtensions(void) +{ + int i,j; + + for (i = NumExtensions - 1; i >= 0; i--) + { + (* extensions[i]->CloseDown)(extensions[i]); + NumExtensions = i; + xfree(extensions[i]->name); + for (j = extensions[i]->num_aliases; --j >= 0;) + xfree(extensions[i]->aliases[j]); + xfree(extensions[i]->aliases); + dixFreePrivates(extensions[i]->devPrivates); + xfree(extensions[i]); + } + xfree(extensions); + extensions = (ExtensionEntry **)NULL; + lastEvent = EXTENSION_EVENT_BASE; + lastError = FirstExtensionError; +} + +int +ProcQueryExtension(ClientPtr client) +{ + xQueryExtensionReply reply; + int i; + REQUEST(xQueryExtensionReq); + + REQUEST_FIXED_SIZE(xQueryExtensionReq, stuff->nbytes); + + reply.type = X_Reply; + reply.length = 0; + reply.major_opcode = 0; + reply.sequenceNumber = client->sequence; + + if ( ! NumExtensions ) + reply.present = xFalse; + else + { + i = FindExtension((char *)&stuff[1], stuff->nbytes); + if (i < 0 || XaceHook(XACE_EXT_ACCESS, client, extensions[i])) + reply.present = xFalse; + else + { + reply.present = xTrue; + reply.major_opcode = extensions[i]->base; + reply.first_event = extensions[i]->eventBase; + reply.first_error = extensions[i]->errorBase; + } + } + WriteReplyToClient(client, sizeof(xQueryExtensionReply), &reply); + return(client->noClientException); +} + +int +ProcListExtensions(ClientPtr client) +{ + xListExtensionsReply reply; + char *bufptr, *buffer; + int total_length = 0; + + REQUEST_SIZE_MATCH(xReq); + + reply.type = X_Reply; + reply.nExtensions = 0; + reply.length = 0; + reply.sequenceNumber = client->sequence; + buffer = NULL; + + if ( NumExtensions ) + { + int i, j; + + for (i=0; iname) + 1; + reply.nExtensions += 1 + extensions[i]->num_aliases; + for (j = extensions[i]->num_aliases; --j >= 0;) + total_length += strlen(extensions[i]->aliases[j]) + 1; + } + reply.length = (total_length + 3) >> 2; + buffer = bufptr = (char *)xalloc(total_length); + if (!buffer) + return(BadAlloc); + for (i=0; iname); + memmove(bufptr, extensions[i]->name, len); + bufptr += len; + for (j = extensions[i]->num_aliases; --j >= 0;) + { + *bufptr++ = len = strlen(extensions[i]->aliases[j]); + memmove(bufptr, extensions[i]->aliases[j], len); + bufptr += len; + } + } + } + WriteReplyToClient(client, sizeof(xListExtensionsReply), &reply); + if (reply.length) + { + WriteToClient(client, total_length, buffer); + xfree(buffer); + } + return(client->noClientException); +} diff --git a/xorg-server/dix/ffs.c b/xorg-server/dix/ffs.c new file mode 100644 index 000000000..b75657d29 --- /dev/null +++ b/xorg-server/dix/ffs.c @@ -0,0 +1,44 @@ +/* + +Copyright 1996, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABIL- +ITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT +SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABIL- +ITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization from +The Open Group. + +*/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "dix.h" + +int +ffs(int i) +{ + int j; + if (i == 0) + return 0; + for (j = 1; (i & 1) == 0; j++) + i >>= 1; + return j; +} diff --git a/xorg-server/dix/gc.c b/xorg-server/dix/gc.c new file mode 100644 index 000000000..83f48d4e3 --- /dev/null +++ b/xorg-server/dix/gc.c @@ -0,0 +1,1259 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include +#include "misc.h" +#include "resource.h" +#include "gcstruct.h" +#include "pixmapstr.h" +#include "dixfontstr.h" +#include "scrnintstr.h" +#include "region.h" + +#include "privates.h" +#include "dix.h" +#include "xace.h" +#include + +extern XID clientErrorValue; +extern FontPtr defaultFont; + +static Bool CreateDefaultTile(GCPtr pGC); + +static unsigned char DefaultDash[2] = {4, 4}; + +_X_EXPORT void +ValidateGC(DrawablePtr pDraw, GC *pGC) +{ + (*pGC->funcs->ValidateGC) (pGC, pGC->stateChanges, pDraw); + pGC->stateChanges = 0; + pGC->serialNumber = pDraw->serialNumber; +} + + +/* dixChangeGC(client, pGC, mask, pC32, pUnion) + * + * This function was created as part of the Security extension + * implementation. The client performing the gc change must be passed so + * that access checks can be performed on any tiles, stipples, or fonts + * that are specified. ddxen can call this too; they should normally + * pass NullClient for the client since any access checking should have + * already been done at a higher level. + * + * Since we had to create a new function anyway, we decided to change the + * way the list of gc values is passed to eliminate the compiler warnings + * caused by the DoChangeGC interface. You can pass the values via pC32 + * or pUnion, but not both; one of them must be NULL. If you don't need + * to pass any pointers, you can use either one: + * + * example calling dixChangeGC using pC32 parameter + * + * CARD32 v[2]; + * v[0] = foreground; + * v[1] = background; + * dixChangeGC(client, pGC, GCForeground|GCBackground, v, NULL); + * + * example calling dixChangeGC using pUnion parameter; + * same effect as above + * + * ChangeGCVal v[2]; + * v[0].val = foreground; + * v[1].val = background; + * dixChangeGC(client, pGC, GCForeground|GCBackground, NULL, v); + * + * However, if you need to pass a pointer to a pixmap or font, you MUST + * use the pUnion parameter. + * + * example calling dixChangeGC passing pointers in the value list + * v[1].ptr is a pointer to a pixmap + * + * ChangeGCVal v[2]; + * v[0].val = FillTiled; + * v[1].ptr = pPixmap; + * dixChangeGC(client, pGC, GCFillStyle|GCTile, NULL, v); + * + * Note: we could have gotten by with just the pUnion parameter, but on + * 64 bit machines that would have forced us to copy the value list that + * comes in the ChangeGC request. + * + * Ideally, we'd change all the DoChangeGC calls to dixChangeGC, but this + * is far too many changes to consider at this time, so we've only + * changed the ones that caused compiler warnings. New code should use + * dixChangeGC. + * + * dpw + */ + +#define NEXTVAL(_type, _var) { \ + if (pC32) _var = (_type)*pC32++; \ + else { \ + _var = (_type)(pUnion->val); pUnion++; \ + } \ + } + +#define NEXT_PTR(_type, _var) { \ + assert(pUnion); _var = (_type)pUnion->ptr; pUnion++; } + +_X_EXPORT int +dixChangeGC(ClientPtr client, GC *pGC, BITS32 mask, CARD32 *pC32, ChangeGCValPtr pUnion) +{ + BITS32 index2; + int rc, error = 0; + PixmapPtr pPixmap; + BITS32 maskQ; + + assert( (pC32 && !pUnion) || (!pC32 && pUnion) ); + pGC->serialNumber |= GC_CHANGE_SERIAL_BIT; + + maskQ = mask; /* save these for when we walk the GCque */ + while (mask && !error) + { + index2 = (BITS32) lowbit (mask); + mask &= ~index2; + pGC->stateChanges |= index2; + switch (index2) + { + case GCFunction: + { + CARD8 newalu; + NEXTVAL(CARD8, newalu); + if (newalu <= GXset) + pGC->alu = newalu; + else + { + clientErrorValue = newalu; + error = BadValue; + } + break; + } + case GCPlaneMask: + NEXTVAL(unsigned long, pGC->planemask); + break; + case GCForeground: + NEXTVAL(unsigned long, pGC->fgPixel); + /* + * this is for CreateGC + */ + if (!pGC->tileIsPixel && !pGC->tile.pixmap) + { + pGC->tileIsPixel = TRUE; + pGC->tile.pixel = pGC->fgPixel; + } + break; + case GCBackground: + NEXTVAL(unsigned long, pGC->bgPixel); + break; + case GCLineWidth: /* ??? line width is a CARD16 */ + NEXTVAL(CARD16, pGC->lineWidth); + break; + case GCLineStyle: + { + unsigned int newlinestyle; + NEXTVAL(unsigned int, newlinestyle); + if (newlinestyle <= LineDoubleDash) + pGC->lineStyle = newlinestyle; + else + { + clientErrorValue = newlinestyle; + error = BadValue; + } + break; + } + case GCCapStyle: + { + unsigned int newcapstyle; + NEXTVAL(unsigned int, newcapstyle); + if (newcapstyle <= CapProjecting) + pGC->capStyle = newcapstyle; + else + { + clientErrorValue = newcapstyle; + error = BadValue; + } + break; + } + case GCJoinStyle: + { + unsigned int newjoinstyle; + NEXTVAL(unsigned int, newjoinstyle); + if (newjoinstyle <= JoinBevel) + pGC->joinStyle = newjoinstyle; + else + { + clientErrorValue = newjoinstyle; + error = BadValue; + } + break; + } + case GCFillStyle: + { + unsigned int newfillstyle; + NEXTVAL(unsigned int, newfillstyle); + if (newfillstyle <= FillOpaqueStippled) + pGC->fillStyle = newfillstyle; + else + { + clientErrorValue = newfillstyle; + error = BadValue; + } + break; + } + case GCFillRule: + { + unsigned int newfillrule; + NEXTVAL(unsigned int, newfillrule); + if (newfillrule <= WindingRule) + pGC->fillRule = newfillrule; + else + { + clientErrorValue = newfillrule; + error = BadValue; + } + break; + } + case GCTile: + { + XID newpix = 0; + if (pUnion) + { + NEXT_PTR(PixmapPtr, pPixmap); + rc = Success; + } + else + { + NEXTVAL(XID, newpix); + rc = dixLookupResource((pointer *)&pPixmap, newpix, + RT_PIXMAP, client, DixReadAccess); + } + if (rc == Success) + { + if ((pPixmap->drawable.depth != pGC->depth) || + (pPixmap->drawable.pScreen != pGC->pScreen)) + { + error = BadMatch; + } + else + { + pPixmap->refcnt++; + if (!pGC->tileIsPixel) + (* pGC->pScreen->DestroyPixmap)(pGC->tile.pixmap); + pGC->tileIsPixel = FALSE; + pGC->tile.pixmap = pPixmap; + } + } + else + { + clientErrorValue = newpix; + error = (rc == BadValue) ? BadPixmap : rc; + } + break; + } + case GCStipple: + { + XID newstipple = 0; + if (pUnion) + { + NEXT_PTR(PixmapPtr, pPixmap); + rc = Success; + } + else + { + NEXTVAL(XID, newstipple) + rc = dixLookupResource((pointer *)&pPixmap, newstipple, + RT_PIXMAP, client, DixReadAccess); + } + if (rc == Success) + { + if ((pPixmap->drawable.depth != 1) || + (pPixmap->drawable.pScreen != pGC->pScreen)) + { + error = BadMatch; + } + else + { + pPixmap->refcnt++; + if (pGC->stipple) + (* pGC->pScreen->DestroyPixmap)(pGC->stipple); + pGC->stipple = pPixmap; + } + } + else + { + clientErrorValue = newstipple; + error = (rc == BadValue) ? BadPixmap : rc; + } + break; + } + case GCTileStipXOrigin: + NEXTVAL(INT16, pGC->patOrg.x); + break; + case GCTileStipYOrigin: + NEXTVAL(INT16, pGC->patOrg.y); + break; + case GCFont: + { + FontPtr pFont; + XID newfont = 0; + if (pUnion) + { + NEXT_PTR(FontPtr, pFont); + rc = Success; + } + else + { + NEXTVAL(XID, newfont) + rc = dixLookupResource((pointer *)&pFont, newfont, + RT_FONT, client, DixUseAccess); + } + if (rc == Success) + { + pFont->refcnt++; + if (pGC->font) + CloseFont(pGC->font, (Font)0); + pGC->font = pFont; + } + else + { + clientErrorValue = newfont; + error = (rc == BadValue) ? BadFont : rc; + } + break; + } + case GCSubwindowMode: + { + unsigned int newclipmode; + NEXTVAL(unsigned int, newclipmode); + if (newclipmode <= IncludeInferiors) + pGC->subWindowMode = newclipmode; + else + { + clientErrorValue = newclipmode; + error = BadValue; + } + break; + } + case GCGraphicsExposures: + { + unsigned int newge; + NEXTVAL(unsigned int, newge); + if (newge <= xTrue) + pGC->graphicsExposures = newge; + else + { + clientErrorValue = newge; + error = BadValue; + } + break; + } + case GCClipXOrigin: + NEXTVAL(INT16, pGC->clipOrg.x); + break; + case GCClipYOrigin: + NEXTVAL(INT16, pGC->clipOrg.y); + break; + case GCClipMask: + { + Pixmap pid = 0; + int clipType = 0; + + if (pUnion) + { + NEXT_PTR(PixmapPtr, pPixmap); + } + else + { + NEXTVAL(Pixmap, pid) + if (pid == None) + { + clipType = CT_NONE; + pPixmap = NullPixmap; + } + else { + rc = dixLookupResource((pointer *)&pPixmap, pid, + RT_PIXMAP, client, + DixReadAccess); + if (rc != Success) { + clientErrorValue = pid; + error = (rc == BadValue) ? BadPixmap : rc; + } + } + } + + if (pPixmap) + { + if ((pPixmap->drawable.depth != 1) || + (pPixmap->drawable.pScreen != pGC->pScreen)) + { + error = BadMatch; + } + else + { + clipType = CT_PIXMAP; + pPixmap->refcnt++; + } + } + if(error == Success) + { + (*pGC->funcs->ChangeClip)(pGC, clipType, + (pointer)pPixmap, 0); + } + break; + } + case GCDashOffset: + NEXTVAL(INT16, pGC->dashOffset); + break; + case GCDashList: + { + CARD8 newdash; + NEXTVAL(CARD8, newdash); + if (newdash == 4) + { + if (pGC->dash != DefaultDash) + { + xfree(pGC->dash); + pGC->numInDashList = 2; + pGC->dash = DefaultDash; + } + } + else if (newdash != 0) + { + unsigned char *dash; + + dash = (unsigned char *)xalloc(2 * sizeof(unsigned char)); + if (dash) + { + if (pGC->dash != DefaultDash) + xfree(pGC->dash); + pGC->numInDashList = 2; + pGC->dash = dash; + dash[0] = newdash; + dash[1] = newdash; + } + else + error = BadAlloc; + } + else + { + clientErrorValue = newdash; + error = BadValue; + } + break; + } + case GCArcMode: + { + unsigned int newarcmode; + NEXTVAL(unsigned int, newarcmode); + if (newarcmode <= ArcPieSlice) + pGC->arcMode = newarcmode; + else + { + clientErrorValue = newarcmode; + error = BadValue; + } + break; + } + default: + clientErrorValue = maskQ; + error = BadValue; + break; + } + } /* end while mask && !error */ + + if (pGC->fillStyle == FillTiled && pGC->tileIsPixel) + { + if (!CreateDefaultTile (pGC)) + { + pGC->fillStyle = FillSolid; + error = BadAlloc; + } + } + (*pGC->funcs->ChangeGC)(pGC, maskQ); + return error; +} + +#undef NEXTVAL +#undef NEXT_PTR + +/* Publically defined entry to ChangeGC. Just calls dixChangeGC and tells + * it that all of the entries are constants or IDs */ +_X_EXPORT int +ChangeGC(GC *pGC, BITS32 mask, XID *pval) +{ + return (dixChangeGC(NullClient, pGC, mask, pval, NULL)); +} + +/* DoChangeGC(pGC, mask, pval, fPointer) + mask is a set of bits indicating which values to change. + pval contains an appropriate value for each mask. + fPointer is true if the values for tiles, stipples, fonts or clipmasks + are pointers instead of IDs. Note: if you are passing pointers you + MUST declare the array of values as type pointer! Other data types + may not be large enough to hold pointers on some machines. Yes, + this means you have to cast to (XID *) when you pass the array to + DoChangeGC. Similarly, if you are not passing pointers (fPointer = 0) you + MUST declare the array as type XID (not unsigned long!), or again the wrong + size data type may be used. To avoid this cruftiness, use dixChangeGC + above. + + if there is an error, the value is marked as changed + anyway, which is probably wrong, but infrequent. + +NOTE: + all values sent over the protocol for ChangeGC requests are +32 bits long +*/ +_X_EXPORT int +DoChangeGC(GC *pGC, BITS32 mask, XID *pval, int fPointer) +{ + if (fPointer) + /* XXX might be a problem on 64 bit big-endian servers */ + return dixChangeGC(NullClient, pGC, mask, NULL, (ChangeGCValPtr)pval); + else + return dixChangeGC(NullClient, pGC, mask, pval, NULL); +} + + +/* CreateGC(pDrawable, mask, pval, pStatus) + creates a default GC for the given drawable, using mask to fill + in any non-default values. + Returns a pointer to the new GC on success, NULL otherwise. + returns status of non-default fields in pStatus +BUG: + should check for failure to create default tile + +*/ +_X_EXPORT GCPtr +CreateGC(DrawablePtr pDrawable, BITS32 mask, XID *pval, int *pStatus, + XID gcid, ClientPtr client) +{ + GCPtr pGC; + + pGC = (GCPtr)xalloc(sizeof(GC)); + if (!pGC) + { + *pStatus = BadAlloc; + return (GCPtr)NULL; + } + + pGC->pScreen = pDrawable->pScreen; + pGC->depth = pDrawable->depth; + pGC->alu = GXcopy; /* dst <- src */ + pGC->planemask = ~0; + pGC->serialNumber = GC_CHANGE_SERIAL_BIT; + pGC->funcs = 0; + pGC->devPrivates = NULL; + pGC->fgPixel = 0; + pGC->bgPixel = 1; + pGC->lineWidth = 0; + pGC->lineStyle = LineSolid; + pGC->capStyle = CapButt; + pGC->joinStyle = JoinMiter; + pGC->fillStyle = FillSolid; + pGC->fillRule = EvenOddRule; + pGC->arcMode = ArcPieSlice; + if (mask & GCForeground) + { + /* + * magic special case -- ChangeGC checks for this condition + * and snags the Foreground value to create a pseudo default-tile + */ + pGC->tileIsPixel = FALSE; + pGC->tile.pixmap = NullPixmap; + } + else + { + pGC->tileIsPixel = TRUE; + pGC->tile.pixel = 0; + } + + pGC->patOrg.x = 0; + pGC->patOrg.y = 0; + pGC->subWindowMode = ClipByChildren; + pGC->graphicsExposures = TRUE; + pGC->clipOrg.x = 0; + pGC->clipOrg.y = 0; + pGC->clientClipType = CT_NONE; + pGC->clientClip = (pointer)NULL; + pGC->numInDashList = 2; + pGC->dash = DefaultDash; + pGC->dashOffset = 0; + pGC->lastWinOrg.x = 0; + pGC->lastWinOrg.y = 0; + + /* use the default font and stipple */ + pGC->font = defaultFont; + defaultFont->refcnt++; + pGC->stipple = pGC->pScreen->PixmapPerDepth[0]; + pGC->stipple->refcnt++; + + /* security creation/labeling check */ + *pStatus = XaceHook(XACE_RESOURCE_ACCESS, client, gcid, RT_GC, pGC, + RT_NONE, NULL, DixCreateAccess|DixSetAttrAccess); + if (*pStatus != Success) + goto out; + + pGC->stateChanges = (1 << (GCLastBit+1)) - 1; + if (!(*pGC->pScreen->CreateGC)(pGC)) + *pStatus = BadAlloc; + else if (mask) + *pStatus = ChangeGC(pGC, mask, pval); + else + *pStatus = Success; + +out: + if (*pStatus != Success) + { + if (!pGC->tileIsPixel && !pGC->tile.pixmap) + pGC->tileIsPixel = TRUE; /* undo special case */ + FreeGC(pGC, (XID)0); + pGC = (GCPtr)NULL; + } + + return (pGC); +} + +static Bool +CreateDefaultTile (GCPtr pGC) +{ + XID tmpval[3]; + PixmapPtr pTile; + GCPtr pgcScratch; + xRectangle rect; + CARD16 w, h; + + w = 1; + h = 1; + (*pGC->pScreen->QueryBestSize)(TileShape, &w, &h, pGC->pScreen); + pTile = (PixmapPtr) + (*pGC->pScreen->CreatePixmap)(pGC->pScreen, + w, h, pGC->depth, 0); + pgcScratch = GetScratchGC(pGC->depth, pGC->pScreen); + if (!pTile || !pgcScratch) + { + if (pTile) + (*pTile->drawable.pScreen->DestroyPixmap)(pTile); + if (pgcScratch) + FreeScratchGC(pgcScratch); + return FALSE; + } + tmpval[0] = GXcopy; + tmpval[1] = pGC->tile.pixel; + tmpval[2] = FillSolid; + (void)ChangeGC(pgcScratch, GCFunction | GCForeground | GCFillStyle, + tmpval); + ValidateGC((DrawablePtr)pTile, pgcScratch); + rect.x = 0; + rect.y = 0; + rect.width = w; + rect.height = h; + (*pgcScratch->ops->PolyFillRect)((DrawablePtr)pTile, pgcScratch, 1, &rect); + /* Always remember to free the scratch graphics context after use. */ + FreeScratchGC(pgcScratch); + + pGC->tileIsPixel = FALSE; + pGC->tile.pixmap = pTile; + return TRUE; +} + +_X_EXPORT int +CopyGC(GC *pgcSrc, GC *pgcDst, BITS32 mask) +{ + BITS32 index2; + BITS32 maskQ; + int error = 0; + + if (pgcSrc == pgcDst) + return Success; + pgcDst->serialNumber |= GC_CHANGE_SERIAL_BIT; + pgcDst->stateChanges |= mask; + maskQ = mask; + while (mask) + { + index2 = (BITS32) lowbit (mask); + mask &= ~index2; + switch (index2) + { + case GCFunction: + pgcDst->alu = pgcSrc->alu; + break; + case GCPlaneMask: + pgcDst->planemask = pgcSrc->planemask; + break; + case GCForeground: + pgcDst->fgPixel = pgcSrc->fgPixel; + break; + case GCBackground: + pgcDst->bgPixel = pgcSrc->bgPixel; + break; + case GCLineWidth: + pgcDst->lineWidth = pgcSrc->lineWidth; + break; + case GCLineStyle: + pgcDst->lineStyle = pgcSrc->lineStyle; + break; + case GCCapStyle: + pgcDst->capStyle = pgcSrc->capStyle; + break; + case GCJoinStyle: + pgcDst->joinStyle = pgcSrc->joinStyle; + break; + case GCFillStyle: + pgcDst->fillStyle = pgcSrc->fillStyle; + break; + case GCFillRule: + pgcDst->fillRule = pgcSrc->fillRule; + break; + case GCTile: + { + if (EqualPixUnion(pgcDst->tileIsPixel, + pgcDst->tile, + pgcSrc->tileIsPixel, + pgcSrc->tile)) + { + break; + } + if (!pgcDst->tileIsPixel) + (* pgcDst->pScreen->DestroyPixmap)(pgcDst->tile.pixmap); + pgcDst->tileIsPixel = pgcSrc->tileIsPixel; + pgcDst->tile = pgcSrc->tile; + if (!pgcDst->tileIsPixel) + pgcDst->tile.pixmap->refcnt++; + break; + } + case GCStipple: + { + if (pgcDst->stipple == pgcSrc->stipple) + break; + if (pgcDst->stipple) + (* pgcDst->pScreen->DestroyPixmap)(pgcDst->stipple); + pgcDst->stipple = pgcSrc->stipple; + if (pgcDst->stipple) + pgcDst->stipple->refcnt ++; + break; + } + case GCTileStipXOrigin: + pgcDst->patOrg.x = pgcSrc->patOrg.x; + break; + case GCTileStipYOrigin: + pgcDst->patOrg.y = pgcSrc->patOrg.y; + break; + case GCFont: + if (pgcDst->font == pgcSrc->font) + break; + if (pgcDst->font) + CloseFont(pgcDst->font, (Font)0); + if ((pgcDst->font = pgcSrc->font) != NullFont) + (pgcDst->font)->refcnt++; + break; + case GCSubwindowMode: + pgcDst->subWindowMode = pgcSrc->subWindowMode; + break; + case GCGraphicsExposures: + pgcDst->graphicsExposures = pgcSrc->graphicsExposures; + break; + case GCClipXOrigin: + pgcDst->clipOrg.x = pgcSrc->clipOrg.x; + break; + case GCClipYOrigin: + pgcDst->clipOrg.y = pgcSrc->clipOrg.y; + break; + case GCClipMask: + (* pgcDst->funcs->CopyClip)(pgcDst, pgcSrc); + break; + case GCDashOffset: + pgcDst->dashOffset = pgcSrc->dashOffset; + break; + case GCDashList: + if (pgcSrc->dash == DefaultDash) + { + if (pgcDst->dash != DefaultDash) + { + xfree(pgcDst->dash); + pgcDst->numInDashList = pgcSrc->numInDashList; + pgcDst->dash = pgcSrc->dash; + } + } + else + { + unsigned char *dash; + unsigned int i; + + dash = (unsigned char *)xalloc(pgcSrc->numInDashList * + sizeof(unsigned char)); + if (dash) + { + if (pgcDst->dash != DefaultDash) + xfree(pgcDst->dash); + pgcDst->numInDashList = pgcSrc->numInDashList; + pgcDst->dash = dash; + for (i=0; inumInDashList; i++) + dash[i] = pgcSrc->dash[i]; + } + else + error = BadAlloc; + } + break; + case GCArcMode: + pgcDst->arcMode = pgcSrc->arcMode; + break; + default: + clientErrorValue = maskQ; + error = BadValue; + break; + } + } + if (pgcDst->fillStyle == FillTiled && pgcDst->tileIsPixel) + { + if (!CreateDefaultTile (pgcDst)) + { + pgcDst->fillStyle = FillSolid; + error = BadAlloc; + } + } + (*pgcDst->funcs->CopyGC) (pgcSrc, maskQ, pgcDst); + return error; +} + +/** + * does the diX part of freeing the characteristics in the GC. + * + * \param value must conform to DeleteType + */ +_X_EXPORT int +FreeGC(pointer value, XID gid) +{ + GCPtr pGC = (GCPtr)value; + + CloseFont(pGC->font, (Font)0); + (* pGC->funcs->DestroyClip)(pGC); + + if (!pGC->tileIsPixel) + (* pGC->pScreen->DestroyPixmap)(pGC->tile.pixmap); + if (pGC->stipple) + (* pGC->pScreen->DestroyPixmap)(pGC->stipple); + + (*pGC->funcs->DestroyGC) (pGC); + if (pGC->dash != DefaultDash) + xfree(pGC->dash); + dixFreePrivates(pGC->devPrivates); + xfree(pGC); + return(Success); +} + +/* CreateScratchGC(pScreen, depth) + like CreateGC, but doesn't do the default tile or stipple, +since we can't create them without already having a GC. any code +using the tile or stipple has to set them explicitly anyway, +since the state of the scratch gc is unknown. This is OK +because ChangeGC() has to be able to deal with NULL tiles and +stipples anyway (in case the CreateGC() call has provided a +value for them -- we can't set the default tile until the +client-supplied attributes are installed, since the fgPixel +is what fills the default tile. (maybe this comment should +go with CreateGC() or ChangeGC().) +*/ + +_X_EXPORT GCPtr +CreateScratchGC(ScreenPtr pScreen, unsigned depth) +{ + GCPtr pGC; + + pGC = (GCPtr)xalloc(sizeof(GC)); + if (!pGC) + return (GCPtr)NULL; + + pGC->pScreen = pScreen; + pGC->depth = depth; + pGC->alu = GXcopy; /* dst <- src */ + pGC->planemask = ~0; + pGC->serialNumber = 0; + pGC->devPrivates = NULL; + pGC->fgPixel = 0; + pGC->bgPixel = 1; + pGC->lineWidth = 0; + pGC->lineStyle = LineSolid; + pGC->capStyle = CapButt; + pGC->joinStyle = JoinMiter; + pGC->fillStyle = FillSolid; + pGC->fillRule = EvenOddRule; + pGC->arcMode = ArcPieSlice; + pGC->font = defaultFont; + if ( pGC->font) /* necessary, because open of default font could fail */ + pGC->font->refcnt++; + pGC->tileIsPixel = TRUE; + pGC->tile.pixel = 0; + pGC->stipple = NullPixmap; + pGC->patOrg.x = 0; + pGC->patOrg.y = 0; + pGC->subWindowMode = ClipByChildren; + pGC->graphicsExposures = TRUE; + pGC->clipOrg.x = 0; + pGC->clipOrg.y = 0; + pGC->clientClipType = CT_NONE; + pGC->dashOffset = 0; + pGC->numInDashList = 2; + pGC->dash = DefaultDash; + pGC->lastWinOrg.x = 0; + pGC->lastWinOrg.y = 0; + + pGC->stateChanges = (1 << (GCLastBit+1)) - 1; + if (!(*pScreen->CreateGC)(pGC)) + { + FreeGC(pGC, (XID)0); + pGC = (GCPtr)NULL; + } + return pGC; +} + +void +FreeGCperDepth(int screenNum) +{ + int i; + ScreenPtr pScreen; + GCPtr *ppGC; + + pScreen = screenInfo.screens[screenNum]; + ppGC = pScreen->GCperDepth; + + for (i = 0; i <= pScreen->numDepths; i++) + (void)FreeGC(ppGC[i], (XID)0); + pScreen->rgf = ~0L; +} + + +Bool +CreateGCperDepth(int screenNum) +{ + int i; + ScreenPtr pScreen; + DepthPtr pDepth; + GCPtr *ppGC; + + pScreen = screenInfo.screens[screenNum]; + pScreen->rgf = 0; + ppGC = pScreen->GCperDepth; + /* do depth 1 separately because it's not included in list */ + if (!(ppGC[0] = CreateScratchGC(pScreen, 1))) + return FALSE; + ppGC[0]->graphicsExposures = FALSE; + /* Make sure we don't overflow GCperDepth[] */ + if( pScreen->numDepths > MAXFORMATS ) + return FALSE; + + pDepth = pScreen->allowedDepths; + for (i=0; inumDepths; i++, pDepth++) + { + if (!(ppGC[i+1] = CreateScratchGC(pScreen, pDepth->depth))) + { + for (; i >= 0; i--) + (void)FreeGC(ppGC[i], (XID)0); + return FALSE; + } + ppGC[i+1]->graphicsExposures = FALSE; + } + return TRUE; +} + +Bool +CreateDefaultStipple(int screenNum) +{ + ScreenPtr pScreen; + XID tmpval[3]; + xRectangle rect; + CARD16 w, h; + GCPtr pgcScratch; + + pScreen = screenInfo.screens[screenNum]; + + w = 16; + h = 16; + (* pScreen->QueryBestSize)(StippleShape, &w, &h, pScreen); + if (!(pScreen->PixmapPerDepth[0] = + (*pScreen->CreatePixmap)(pScreen, w, h, 1, 0))) + return FALSE; + /* fill stipple with 1 */ + tmpval[0] = GXcopy; tmpval[1] = 1; tmpval[2] = FillSolid; + pgcScratch = GetScratchGC(1, pScreen); + if (!pgcScratch) + { + (*pScreen->DestroyPixmap)(pScreen->PixmapPerDepth[0]); + return FALSE; + } + (void)ChangeGC(pgcScratch, GCFunction|GCForeground|GCFillStyle, tmpval); + ValidateGC((DrawablePtr)pScreen->PixmapPerDepth[0], pgcScratch); + rect.x = 0; + rect.y = 0; + rect.width = w; + rect.height = h; + (*pgcScratch->ops->PolyFillRect)((DrawablePtr)pScreen->PixmapPerDepth[0], + pgcScratch, 1, &rect); + FreeScratchGC(pgcScratch); + return TRUE; +} + +void +FreeDefaultStipple(int screenNum) +{ + ScreenPtr pScreen = screenInfo.screens[screenNum]; + (*pScreen->DestroyPixmap)(pScreen->PixmapPerDepth[0]); +} + +_X_EXPORT int +SetDashes(GCPtr pGC, unsigned offset, unsigned ndash, unsigned char *pdash) +{ + long i; + unsigned char *p, *indash; + BITS32 maskQ = 0; + + i = ndash; + p = pdash; + while (i--) + { + if (!*p++) + { + /* dash segment must be > 0 */ + clientErrorValue = 0; + return BadValue; + } + } + + if (ndash & 1) + p = (unsigned char *)xalloc(2 * ndash * sizeof(unsigned char)); + else + p = (unsigned char *)xalloc(ndash * sizeof(unsigned char)); + if (!p) + return BadAlloc; + + pGC->serialNumber |= GC_CHANGE_SERIAL_BIT; + if (offset != pGC->dashOffset) + { + pGC->dashOffset = offset; + pGC->stateChanges |= GCDashOffset; + maskQ |= GCDashOffset; + } + + if (pGC->dash != DefaultDash) + xfree(pGC->dash); + pGC->numInDashList = ndash; + pGC->dash = p; + if (ndash & 1) + { + pGC->numInDashList += ndash; + indash = pdash; + i = ndash; + while (i--) + *p++ = *indash++; + } + while(ndash--) + *p++ = *pdash++; + pGC->stateChanges |= GCDashList; + maskQ |= GCDashList; + + if (pGC->funcs->ChangeGC) + (*pGC->funcs->ChangeGC) (pGC, maskQ); + return Success; +} + +_X_EXPORT int +VerifyRectOrder(int nrects, xRectangle *prects, int ordering) +{ + xRectangle *prectP, *prectN; + int i; + + switch(ordering) + { + case Unsorted: + return CT_UNSORTED; + case YSorted: + if(nrects > 1) + { + for(i = 1, prectP = prects, prectN = prects + 1; + i < nrects; + i++, prectP++, prectN++) + if(prectN->y < prectP->y) + return -1; + } + return CT_YSORTED; + case YXSorted: + if(nrects > 1) + { + for(i = 1, prectP = prects, prectN = prects + 1; + i < nrects; + i++, prectP++, prectN++) + if((prectN->y < prectP->y) || + ( (prectN->y == prectP->y) && + (prectN->x < prectP->x) ) ) + return -1; + } + return CT_YXSORTED; + case YXBanded: + if(nrects > 1) + { + for(i = 1, prectP = prects, prectN = prects + 1; + i < nrects; + i++, prectP++, prectN++) + if((prectN->y != prectP->y && + prectN->y < prectP->y + (int) prectP->height) || + ((prectN->y == prectP->y) && + (prectN->height != prectP->height || + prectN->x < prectP->x + (int) prectP->width))) + return -1; + } + return CT_YXBANDED; + } + return -1; +} + +_X_EXPORT int +SetClipRects(GCPtr pGC, int xOrigin, int yOrigin, int nrects, + xRectangle *prects, int ordering) +{ + int newct, size; + xRectangle *prectsNew; + + newct = VerifyRectOrder(nrects, prects, ordering); + if (newct < 0) + return(BadMatch); + size = nrects * sizeof(xRectangle); + prectsNew = (xRectangle *) xalloc(size); + if (!prectsNew && size) + return BadAlloc; + + pGC->serialNumber |= GC_CHANGE_SERIAL_BIT; + pGC->clipOrg.x = xOrigin; + pGC->stateChanges |= GCClipXOrigin; + + pGC->clipOrg.y = yOrigin; + pGC->stateChanges |= GCClipYOrigin; + + if (size) + memmove((char *)prectsNew, (char *)prects, size); + (*pGC->funcs->ChangeClip)(pGC, newct, (pointer)prectsNew, nrects); + if (pGC->funcs->ChangeGC) + (*pGC->funcs->ChangeGC) (pGC, GCClipXOrigin|GCClipYOrigin|GCClipMask); + return Success; +} + + +/* + sets reasonable defaults + if we can get a pre-allocated one, use it and mark it as used. + if we can't, create one out of whole cloth (The Velveteen GC -- if + you use it often enough it will become real.) +*/ +_X_EXPORT GCPtr +GetScratchGC(unsigned depth, ScreenPtr pScreen) +{ + int i; + GCPtr pGC; + + for (i=0; i<=pScreen->numDepths; i++) + if ( pScreen->GCperDepth[i]->depth == depth && + !(pScreen->rgf & (1L << (i+1))) + ) + { + pScreen->rgf |= (1L << (i+1)); + pGC = (pScreen->GCperDepth[i]); + + pGC->alu = GXcopy; + pGC->planemask = ~0; + pGC->serialNumber = 0; + pGC->fgPixel = 0; + pGC->bgPixel = 1; + pGC->lineWidth = 0; + pGC->lineStyle = LineSolid; + pGC->capStyle = CapButt; + pGC->joinStyle = JoinMiter; + pGC->fillStyle = FillSolid; + pGC->fillRule = EvenOddRule; + pGC->arcMode = ArcChord; + pGC->patOrg.x = 0; + pGC->patOrg.y = 0; + pGC->subWindowMode = ClipByChildren; + pGC->graphicsExposures = FALSE; + pGC->clipOrg.x = 0; + pGC->clipOrg.y = 0; + if (pGC->clientClipType != CT_NONE) + (*pGC->funcs->ChangeClip) (pGC, CT_NONE, NULL, 0); + pGC->stateChanges = (1 << (GCLastBit+1)) - 1; + return pGC; + } + /* if we make it this far, need to roll our own */ + pGC = CreateScratchGC(pScreen, depth); + if (pGC) + pGC->graphicsExposures = FALSE; + return pGC; +} + +/* + if the gc to free is in the table of pre-existing ones, +mark it as available. + if not, free it for real +*/ +_X_EXPORT void +FreeScratchGC(GCPtr pGC) +{ + ScreenPtr pScreen = pGC->pScreen; + int i; + + for (i=0; i<=pScreen->numDepths; i++) + { + if ( pScreen->GCperDepth[i] == pGC) + { + pScreen->rgf &= ~(1L << (i+1)); + return; + } + } + (void)FreeGC(pGC, (GContext)0); +} diff --git a/xorg-server/dix/getevents.c b/xorg-server/dix/getevents.c new file mode 100644 index 000000000..1e0edbf00 --- /dev/null +++ b/xorg-server/dix/getevents.c @@ -0,0 +1,940 @@ +/* + * Copyright © 2006 Nokia Corporation + * Copyright © 2006-2007 Daniel Stone + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation + * the rights to use, copy, modify, merge, publish, distribute, sublicense, + * and/or sell copies of the Software, and to permit persons to whom the + * Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice (including the next + * paragraph) shall be included in all copies or substantial portions of the + * Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR + * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL + * THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER + * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING + * FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER + * DEALINGS IN THE SOFTWARE. + * + * Author: Daniel Stone + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#define NEED_EVENTS +#define NEED_REPLIES +#include + +#include "misc.h" +#include "resource.h" +#include "inputstr.h" +#include "scrnintstr.h" +#include "cursorstr.h" +#include "dixstruct.h" +#include "globals.h" +#include "dixevents.h" +#include "mipointer.h" + +#ifdef XKB +#include +#include +extern Bool XkbCopyKeymap(XkbDescPtr src, XkbDescPtr dst, Bool sendNotifies); +#endif + +#ifdef PANORAMIX +#include "panoramiX.h" +#include "panoramiXsrv.h" +#endif + +#include +#include +#include "exglobals.h" +#include "exevents.h" +#include "exglobals.h" +#include "extnsionst.h" + + +/* Maximum number of valuators, divided by six, rounded up, to get number + * of events. */ +#define MAX_VALUATOR_EVENTS 6 + +/* Number of motion history events to store. */ +#define MOTION_HISTORY_SIZE 256 + + +/** + * Pick some arbitrary size for Xi motion history. + */ +_X_EXPORT int +GetMotionHistorySize(void) +{ + return MOTION_HISTORY_SIZE; +} + +static void +set_key_down(DeviceIntPtr pDev, int key_code) +{ + pDev->key->postdown[key_code >> 3] |= (1 << (key_code & 7)); +} + +static void +set_key_up(DeviceIntPtr pDev, int key_code) +{ + pDev->key->postdown[key_code >> 3] &= ~(1 << (key_code & 7)); +} + +static Bool +key_is_down(DeviceIntPtr pDev, int key_code) +{ + return !!(pDev->key->postdown[key_code >> 3] & (1 << (key_code & 7))); +} + +static Bool +key_autorepeats(DeviceIntPtr pDev, int key_code) +{ + return !!(pDev->kbdfeed->ctrl.autoRepeats[key_code >> 3] & + (1 << (key_code & 7))); +} + +/** + * Allocate the motion history buffer. + */ +_X_EXPORT void +AllocateMotionHistory(DeviceIntPtr pDev) +{ + if (pDev->valuator->motion) + xfree(pDev->valuator->motion); + + if (pDev->valuator->numMotionEvents < 1) + return; + + pDev->valuator->motion = xalloc(((sizeof(INT32) * pDev->valuator->numAxes) + + sizeof(Time)) * + pDev->valuator->numMotionEvents); + pDev->valuator->first_motion = 0; + pDev->valuator->last_motion = 0; +} + + +/** + * Dump the motion history between start and stop into the supplied buffer. + * Only records the event for a given screen in theory, but in practice, we + * sort of ignore this. + */ +_X_EXPORT int +GetMotionHistory(DeviceIntPtr pDev, xTimecoord *buff, unsigned long start, + unsigned long stop, ScreenPtr pScreen) +{ + char *ibuff = NULL, *obuff = (char *) buff; + int i = 0, ret = 0; + Time current; + /* The size of a single motion event. */ + int size = (sizeof(INT32) * pDev->valuator->numAxes) + sizeof(Time); + + if (!pDev->valuator || !pDev->valuator->numMotionEvents) + return 0; + + for (i = pDev->valuator->first_motion; + i != pDev->valuator->last_motion; + i = (i + 1) % pDev->valuator->numMotionEvents) { + /* We index the input buffer by which element we're accessing, which + * is not monotonic, and the output buffer by how many events we've + * written so far. */ + ibuff = (char *) pDev->valuator->motion + (i * size); + memcpy(¤t, ibuff, sizeof(Time)); + + if (current > stop) { + return ret; + } + else if (current >= start) { + memcpy(obuff, ibuff, size); + obuff += size; + ret++; + } + } + + return ret; +} + + +/** + * Update the motion history for a specific device, with the list of + * valuators. + */ +static void +updateMotionHistory(DeviceIntPtr pDev, CARD32 ms, int first_valuator, + int num_valuators, int *valuators) +{ + char *buff = (char *) pDev->valuator->motion; + + if (!pDev->valuator->numMotionEvents) + return; + + buff += ((sizeof(INT32) * pDev->valuator->numAxes) + sizeof(CARD32)) * + pDev->valuator->last_motion; + memcpy(buff, &ms, sizeof(Time)); + + buff += sizeof(Time); + bzero(buff, sizeof(INT32) * pDev->valuator->numAxes); + + buff += sizeof(INT32) * first_valuator; + memcpy(buff, valuators, sizeof(INT32) * num_valuators); + + pDev->valuator->last_motion = (pDev->valuator->last_motion + 1) % + pDev->valuator->numMotionEvents; + + /* If we're wrapping around, just keep the circular buffer going. */ + if (pDev->valuator->first_motion == pDev->valuator->last_motion) + pDev->valuator->first_motion = (pDev->valuator->first_motion + 1) % + pDev->valuator->numMotionEvents; + + return; +} + + +/** + * Returns the maximum number of events GetKeyboardEvents, + * GetKeyboardValuatorEvents, and GetPointerEvents will ever return. + * + * Should be used in DIX as: + * xEvent *events = xcalloc(sizeof(xEvent), GetMaximumEventsNum()); + * + * This MUST be absolutely constant, from init until exit. + */ +_X_EXPORT int +GetMaximumEventsNum(void) { + /* Two base events -- core and device, plus valuator events. Multiply + * by two if we're doing non-XKB key repeats. */ + int ret = 2 + MAX_VALUATOR_EVENTS; + +#ifdef XKB + if (noXkbExtension) +#endif + ret *= 2; + + return ret; +} + + +/* Originally a part of xf86PostMotionEvent; modifies valuators + * in-place. */ +static void +acceleratePointer(DeviceIntPtr pDev, int first_valuator, int num_valuators, + int *valuators) +{ + float mult = 0.0; + int dx = 0, dy = 0; + int *px = NULL, *py = NULL; + + if (!num_valuators || !valuators) + return; + + if (first_valuator == 0) { + dx = valuators[0]; + px = &valuators[0]; + } + if (first_valuator <= 1 && num_valuators >= (2 - first_valuator)) { + dy = valuators[1 - first_valuator]; + py = &valuators[1 - first_valuator]; + } + + if (!dx && !dy) + return; + + if (pDev->ptrfeed && pDev->ptrfeed->ctrl.num) { + /* modeled from xf86Events.c */ + if (pDev->ptrfeed->ctrl.threshold) { + if ((abs(dx) + abs(dy)) >= pDev->ptrfeed->ctrl.threshold) { + pDev->valuator->dxremaind = ((float)dx * + (float)(pDev->ptrfeed->ctrl.num)) / + (float)(pDev->ptrfeed->ctrl.den) + + pDev->valuator->dxremaind; + if (px) { + *px = (int)pDev->valuator->dxremaind; + pDev->valuator->dxremaind = pDev->valuator->dxremaind - + (float)(*px); + } + + pDev->valuator->dyremaind = ((float)dy * + (float)(pDev->ptrfeed->ctrl.num)) / + (float)(pDev->ptrfeed->ctrl.den) + + pDev->valuator->dyremaind; + if (py) { + *py = (int)pDev->valuator->dyremaind; + pDev->valuator->dyremaind = pDev->valuator->dyremaind - + (float)(*py); + } + } + } + else { + mult = pow((float)dx * (float)dx + (float)dy * (float)dy, + ((float)(pDev->ptrfeed->ctrl.num) / + (float)(pDev->ptrfeed->ctrl.den) - 1.0) / + 2.0) / 2.0; + if (dx) { + pDev->valuator->dxremaind = mult * (float)dx + + pDev->valuator->dxremaind; + *px = (int)pDev->valuator->dxremaind; + pDev->valuator->dxremaind = pDev->valuator->dxremaind - + (float)(*px); + } + if (dy) { + pDev->valuator->dyremaind = mult * (float)dy + + pDev->valuator->dyremaind; + *py = (int)pDev->valuator->dyremaind; + pDev->valuator->dyremaind = pDev->valuator->dyremaind - + (float)(*py); + } + } + } +} + + +/** + * Clip an axis to its bounds, which are declared in the call to + * InitValuatorAxisClassStruct. + */ +static void +clipAxis(DeviceIntPtr pDev, int axisNum, int *val) +{ + AxisInfoPtr axes = pDev->valuator->axes + axisNum; + + /* No clipping if the value-range <= 0 */ + if(axes->min_value < axes->min_value) { + if (*val < axes->min_value) + *val = axes->min_value; + if (*val > axes->max_value) + *val = axes->max_value; + } +} + +/** + * Clip every axis in the list of valuators to its bounds. + */ +static void +clipValuators(DeviceIntPtr pDev, int first_valuator, int num_valuators, + int *valuators) +{ + AxisInfoPtr axes = pDev->valuator->axes + first_valuator; + int i; + + for (i = 0; i < num_valuators; i++, axes++) + clipAxis(pDev, i + first_valuator, &(valuators[i])); +} + + +/** + * Fills events with valuator events for pDev, as given by the other + * parameters. + * + * FIXME: Need to fix ValuatorClassRec to store all the valuators as + * last posted, not just x and y; otherwise relative non-x/y + * valuators, though a very narrow use case, will be broken. + */ +static xEvent * +getValuatorEvents(xEvent *events, DeviceIntPtr pDev, int first_valuator, + int num_valuators, int *valuators) { + deviceValuator *xv = (deviceValuator *) events; + int i = 0, final_valuator = first_valuator + num_valuators; + + for (i = first_valuator; i < final_valuator; i += 6, xv++, events++) { + xv->type = DeviceValuator; + xv->first_valuator = i; + xv->num_valuators = ((final_valuator - i) > 6) ? 6 : (final_valuator - i); + xv->deviceid = pDev->id; + switch (final_valuator - i) { + case 6: + xv->valuator5 = valuators[i + 5]; + case 5: + xv->valuator4 = valuators[i + 4]; + case 4: + xv->valuator3 = valuators[i + 3]; + case 3: + xv->valuator2 = valuators[i + 2]; + case 2: + xv->valuator1 = valuators[i + 1]; + case 1: + xv->valuator0 = valuators[i]; + } + + if (i + 6 < final_valuator) + xv->deviceid |= MORE_EVENTS; + } + + return events; +} + + +/** + * Convenience wrapper around GetKeyboardValuatorEvents, that takes no + * valuators. + */ +_X_EXPORT int +GetKeyboardEvents(xEvent *events, DeviceIntPtr pDev, int type, int key_code) { + return GetKeyboardValuatorEvents(events, pDev, type, key_code, 0, 0, NULL); +} + + +/** + * Returns a set of keyboard events for KeyPress/KeyRelease, optionally + * also with valuator events. Handles Xi and XKB. + * + * events is not NULL-terminated; the return value is the number of events. + * The DDX is responsible for allocating the event structure in the first + * place via GetMaximumEventsNum(), and for freeing it. + * + * This function does not change the core keymap to that of the device; + * that is done by SwitchCoreKeyboard, which is called from + * mieqProcessInputEvents. If replacing that function, take care to call + * SetCoreKeyboard before processInputProc, so keymaps are altered to suit. + * + * Note that this function recurses! If called for non-XKB, a repeating + * key press will trigger a matching KeyRelease, as well as the + * KeyPresses. + */ +_X_EXPORT int +GetKeyboardValuatorEvents(xEvent *events, DeviceIntPtr pDev, int type, + int key_code, int first_valuator, + int num_valuators, int *valuators) { + int numEvents = 0; + CARD32 ms = 0; + KeySym *map = pDev->key->curKeySyms.map; + KeySym sym; + deviceKeyButtonPointer *kbp = NULL; + + if (!events) + return 0; + + /* DO NOT WANT */ + if (type != KeyPress && type != KeyRelease) + return 0; + + if (!pDev->key || !pDev->focus || !pDev->kbdfeed || + (pDev->coreEvents && !inputInfo.keyboard->key)) + return 0; + + if (key_code < 8 || key_code > 255) + return 0; + + sym = map[(key_code - pDev->key->curKeySyms.minKeyCode) + * pDev->key->curKeySyms.mapWidth]; + + if (pDev->coreEvents) + numEvents = 2; + else + numEvents = 1; + + if (num_valuators) { + if ((num_valuators / 6) + 1 > MAX_VALUATOR_EVENTS) + num_valuators = MAX_VALUATOR_EVENTS; + numEvents += (num_valuators / 6) + 1; + } + +#ifdef XKB + if (noXkbExtension) +#endif + { + switch (sym) { + case XK_Num_Lock: + case XK_Caps_Lock: + case XK_Scroll_Lock: + case XK_Shift_Lock: + if (type == KeyRelease) + return 0; + else if (type == KeyPress && key_is_down(pDev, key_code)) + type = KeyRelease; + } + } + + /* Handle core repeating, via press/release/press/release. + * FIXME: In theory, if you're repeating with two keyboards in non-XKB, + * you could get unbalanced events here. */ + if (type == KeyPress && key_is_down(pDev, key_code)) { + /* If autorepeating is disabled either globally or just for that key, + * or we have a modifier, don't generate a repeat event. */ + if (!pDev->kbdfeed->ctrl.autoRepeat || + !key_autorepeats(pDev, key_code) || + pDev->key->modifierMap[key_code]) + return 0; + +#ifdef XKB + if (noXkbExtension) +#endif + { + numEvents += GetKeyboardValuatorEvents(events, pDev, + KeyRelease, key_code, + first_valuator, num_valuators, + valuators); + events += numEvents; + } + } + + ms = GetTimeInMillis(); + + if (pDev->coreEvents) { + events->u.keyButtonPointer.time = ms; + events->u.u.type = type; + events->u.u.detail = key_code; + if (type == KeyPress) + set_key_down(inputInfo.keyboard, key_code); + else if (type == KeyRelease) + set_key_up(inputInfo.keyboard, key_code); + events++; + } + + kbp = (deviceKeyButtonPointer *) events; + kbp->time = ms; + kbp->deviceid = pDev->id; + kbp->detail = key_code; + if (type == KeyPress) { + kbp->type = DeviceKeyPress; + set_key_down(pDev, key_code); + } + else if (type == KeyRelease) { + kbp->type = DeviceKeyRelease; + set_key_up(pDev, key_code); + } + + events++; + if (num_valuators) { + kbp->deviceid |= MORE_EVENTS; + clipValuators(pDev, first_valuator, num_valuators, valuators); + events = getValuatorEvents(events, pDev, first_valuator, + num_valuators, valuators); + } + + return numEvents; +} + + +/** + * Generate a series of xEvents (returned in xE) representing pointer + * motion, or button presses. Xi and XKB-aware. + * + * events is not NULL-terminated; the return value is the number of events. + * The DDX is responsible for allocating the event structure in the first + * place via GetMaximumEventsNum(), and for freeing it. + */ +_X_EXPORT int +GetPointerEvents(xEvent *events, DeviceIntPtr pDev, int type, int buttons, + int flags, int first_valuator, int num_valuators, + int *valuators) { + int num_events = 0, final_valuator = 0; + CARD32 ms = 0; + deviceKeyButtonPointer *kbp = NULL; + DeviceIntPtr cp = inputInfo.pointer; + int x = 0, y = 0; + Bool coreOnly = (pDev == inputInfo.pointer); + ScreenPtr scr = miPointerGetScreen(pDev); + + /* Sanity checks. */ + if (type != MotionNotify && type != ButtonPress && type != ButtonRelease) + return 0; + + if ((type == ButtonPress || type == ButtonRelease) && !pDev->button) + return 0; + + /* FIXME: I guess it should, in theory, be possible to post button events + * from devices without valuators. */ + if (!pDev->valuator) + return 0; + + if (!coreOnly && pDev->coreEvents) + num_events = 2; + else + num_events = 1; + + if (type == MotionNotify && num_valuators <= 0) + return 0; + + /* Do we need to send a DeviceValuator event? */ + if (!coreOnly && num_valuators) { + if ((((num_valuators - 1) / 6) + 1) > MAX_VALUATOR_EVENTS) + num_valuators = MAX_VALUATOR_EVENTS * 6; + num_events += ((num_valuators - 1) / 6) + 1; + } + + final_valuator = num_valuators + first_valuator; + + /* You fail. */ + if (first_valuator < 0 || final_valuator > pDev->valuator->numAxes) + return 0; + + ms = GetTimeInMillis(); + + /* Set x and y based on whether this is absolute or relative, and + * accelerate if we need to. */ + if (flags & POINTER_ABSOLUTE) { + if (num_valuators >= 1 && first_valuator == 0) { + x = valuators[0]; + } + else { + /* If we're sending core events but didn't provide a value, + * translate the core value (but use the device coord if + * it translates to the same coord to preserve sub-pixel + * coord information). If we're not sending core events use + * whatever value we have */ + x = pDev->valuator->lastx; + if(pDev->coreEvents) { + int min = pDev->valuator->axes[0].min_value; + int max = pDev->valuator->axes[0].max_value; + if(min < max) { + if((int)((float)(x-min)*scr->width/(max-min+1)) != cp->valuator->lastx) + x = (int)((float)(cp->valuator->lastx)*(max-min+1)/scr->width)+min; + } + else + x = cp->valuator->lastx; + } + } + + if (first_valuator <= 1 && num_valuators >= (2 - first_valuator)) { + y = valuators[1 - first_valuator]; + } + else { + y = pDev->valuator->lasty; + if(pDev->coreEvents) { + int min = pDev->valuator->axes[1].min_value; + int max = pDev->valuator->axes[1].max_value; + if(min < max) { + if((int)((float)(y-min)*scr->height/(max-min+1)) != cp->valuator->lasty) + y = (int)((float)(cp->valuator->lasty)*(max-min+1)/scr->height)+min; + } + else + y = cp->valuator->lasty; + } + } + + /* Clip both x and y to the defined limits (usually co-ord space limit). */ + clipAxis(pDev, 0, &x); + clipAxis(pDev, 1, &y); + } + else { + if (flags & POINTER_ACCELERATE) + acceleratePointer(pDev, first_valuator, num_valuators, + valuators); + + if (pDev->coreEvents) { + /* Get and convert the core pointer coordinate space into + * device coordinates. Use the device coords if it translates + * into the same position as the core to preserve relative sub- + * pixel movements from the device. */ + int min = pDev->valuator->axes[0].min_value; + int max = pDev->valuator->axes[0].max_value; + if(min < max) { + x = pDev->valuator->lastx; + if((int)((float)(x-min)*scr->width/(max-min+1)) != cp->valuator->lastx) + x = (int)((float)(cp->valuator->lastx)*(max-min+1)/scr->width)+min; + } + else + x = cp->valuator->lastx; + + min = pDev->valuator->axes[1].min_value; + max = pDev->valuator->axes[1].max_value; + if(min < max) { + y = pDev->valuator->lasty; + if((int)((float)(y-min)*scr->height/(max-min+1)) != cp->valuator->lasty) + y = (int)((float)(cp->valuator->lasty)*(max-min+1)/scr->height)+min; + } + else + y = cp->valuator->lasty; + + /* Add relative movement */ + if (first_valuator == 0 && num_valuators >= 1) + x += valuators[0]; + if (first_valuator <= 1 && num_valuators >= (2 - first_valuator)) + y += valuators[1 - first_valuator]; + } + else { + x = pDev->valuator->lastx; + y = pDev->valuator->lasty; + if (first_valuator == 0 && num_valuators >= 1) + x += valuators[0]; + if (first_valuator <= 1 && num_valuators >= (2 - first_valuator)) + y += valuators[1 - first_valuator]; + + if(!coreOnly) { + /* Since we're not sending core-events we must clip both x and y + * to the defined limits so we don't run outside the box. */ + clipAxis(pDev, 0, &x); + clipAxis(pDev, 1, &y); + } + } + } + + pDev->valuator->lastx = x; + pDev->valuator->lasty = y; + /* Convert the dev coord back to screen coord if we're + * sending core events */ + if (pDev->coreEvents) { + int min = pDev->valuator->axes[0].min_value; + int max = pDev->valuator->axes[0].max_value; + if(min < max) + x = (int)((float)(x-min)*scr->width/(max-min+1)); + cp->valuator->lastx = x; + min = pDev->valuator->axes[1].min_value; + max = pDev->valuator->axes[1].max_value; + if(min < max) + y = (int)((float)(y-min)*scr->height/(max-min+1)); + cp->valuator->lasty = y; + } + + /* This takes care of crossing screens for us, as well as clipping + * to the current screen. Right now, we only have one history buffer, + * so we don't set this for both the device and core.*/ + miPointerSetPosition(pDev, &x, &y, ms); + + if (pDev->coreEvents) { + /* miPointerSetPosition may have changed screen */ + scr = miPointerGetScreen(pDev); + if(x != cp->valuator->lastx) { + int min = pDev->valuator->axes[0].min_value; + int max = pDev->valuator->axes[0].max_value; + cp->valuator->lastx = pDev->valuator->lastx = x; + if(min < max) + pDev->valuator->lastx = (int)((float)(x)*(max-min+1)/scr->width)+min; + } + if(y != cp->valuator->lasty) { + int min = pDev->valuator->axes[1].min_value; + int max = pDev->valuator->axes[1].max_value; + cp->valuator->lasty = pDev->valuator->lasty = y; + if(min < max) + pDev->valuator->lasty = (int)((float)(y)*(max-min+1)/scr->height)+min; + } + } + else if (coreOnly) { + cp->valuator->lastx = x; + cp->valuator->lasty = y; + } + + /* Drop x and y back into the valuators list, if they were originally + * present. */ + if (first_valuator == 0 && num_valuators >= 1) + valuators[0] = pDev->valuator->lastx; + if (first_valuator <= 1 && num_valuators >= (2 - first_valuator)) + valuators[1 - first_valuator] = pDev->valuator->lasty; + + updateMotionHistory(pDev, ms, first_valuator, num_valuators, valuators); + + /* for some reason inputInfo.pointer does not have coreEvents set */ + if (coreOnly || pDev->coreEvents) { + events->u.u.type = type; + events->u.keyButtonPointer.time = ms; + events->u.keyButtonPointer.rootX = x; + events->u.keyButtonPointer.rootY = y; + + if (type == ButtonPress || type == ButtonRelease) { + /* We hijack SetPointerMapping to work on all core-sending + * devices, so we use the device-specific map here instead of + * the core one. */ + events->u.u.detail = pDev->button->map[buttons]; + } + else { + events->u.u.detail = 0; + } + + events++; + } + + if (!coreOnly) { + kbp = (deviceKeyButtonPointer *) events; + kbp->time = ms; + kbp->deviceid = pDev->id; + + if (type == MotionNotify) { + kbp->type = DeviceMotionNotify; + } + else { + if (type == ButtonPress) + kbp->type = DeviceButtonPress; + else if (type == ButtonRelease) + kbp->type = DeviceButtonRelease; + kbp->detail = pDev->button->map[buttons]; + } + + kbp->root_x = pDev->valuator->lastx; + kbp->root_y = pDev->valuator->lasty; + + events++; + if (num_valuators) { + kbp->deviceid |= MORE_EVENTS; + clipValuators(pDev, first_valuator, num_valuators, valuators); + events = getValuatorEvents(events, pDev, first_valuator, + num_valuators, valuators); + } + } + + return num_events; +} + + +/** + * Post ProximityIn/ProximityOut events, accompanied by valuators. + * + * events is not NULL-terminated; the return value is the number of events. + * The DDX is responsible for allocating the event structure in the first + * place via GetMaximumEventsNum(), and for freeing it. + */ +_X_EXPORT int +GetProximityEvents(xEvent *events, DeviceIntPtr pDev, int type, + int first_valuator, int num_valuators, int *valuators) +{ + int num_events = 1; + deviceKeyButtonPointer *kbp = (deviceKeyButtonPointer *) events; + + /* Sanity checks. */ + if (type != ProximityIn && type != ProximityOut) + return 0; + + if (!pDev->valuator) + return 0; + + /* Do we need to send a DeviceValuator event? */ + if ((pDev->valuator->mode & 1) == Relative) + num_valuators = 0; + + if (num_valuators) { + if ((((num_valuators - 1) / 6) + 1) > MAX_VALUATOR_EVENTS) + num_valuators = MAX_VALUATOR_EVENTS * 6; + num_events += ((num_valuators - 1) / 6) + 1; + } + + /* You fail. */ + if (first_valuator < 0 || + (num_valuators + first_valuator) > pDev->valuator->numAxes) + return 0; + + kbp->type = type; + kbp->deviceid = pDev->id; + kbp->detail = 0; + kbp->time = GetTimeInMillis(); + + if (num_valuators) { + kbp->deviceid |= MORE_EVENTS; + events++; + clipValuators(pDev, first_valuator, num_valuators, valuators); + events = getValuatorEvents(events, pDev, first_valuator, + num_valuators, valuators); + } + + return num_events; +} + + +/** + * Note that pDev was the last device to send a core event. This function + * copies the complete keymap from the originating device to the core + * device, and makes sure the appropriate notifications are generated. + * + * Call this just before processInputProc. + */ +_X_EXPORT void +SwitchCoreKeyboard(DeviceIntPtr pDev) +{ + KeyClassPtr ckeyc = inputInfo.keyboard->key; + int i = 0; + + if (pDev != dixLookupPrivate(&inputInfo.keyboard->devPrivates, + CoreDevicePrivateKey)) { + memcpy(ckeyc->modifierMap, pDev->key->modifierMap, MAP_LENGTH); + if (ckeyc->modifierKeyMap) + xfree(ckeyc->modifierKeyMap); + ckeyc->modifierKeyMap = xalloc(8 * pDev->key->maxKeysPerModifier); + memcpy(ckeyc->modifierKeyMap, pDev->key->modifierKeyMap, + (8 * pDev->key->maxKeysPerModifier)); + + ckeyc->maxKeysPerModifier = pDev->key->maxKeysPerModifier; + ckeyc->curKeySyms.minKeyCode = pDev->key->curKeySyms.minKeyCode; + ckeyc->curKeySyms.maxKeyCode = pDev->key->curKeySyms.maxKeyCode; + SetKeySymsMap(&ckeyc->curKeySyms, &pDev->key->curKeySyms); + + /* + * Copy state from the extended keyboard to core. If you omit this, + * holding Ctrl on keyboard one, and pressing Q on keyboard two, will + * cause your app to quit. This feels wrong to me, hence the below + * code. + * + * XXX: If you synthesise core modifier events, the state will get + * clobbered here. You'll have to work out something sensible + * to fix that. Good luck. + */ + +#define KEYBOARD_MASK (ShiftMask | LockMask | ControlMask | Mod1Mask | \ + Mod2Mask | Mod3Mask | Mod4Mask | Mod5Mask) + ckeyc->state &= ~(KEYBOARD_MASK); + ckeyc->state |= (pDev->key->state & KEYBOARD_MASK); +#undef KEYBOARD_MASK + for (i = 0; i < 8; i++) + ckeyc->modifierKeyCount[i] = pDev->key->modifierKeyCount[i]; + +#ifdef XKB + if (!noXkbExtension && pDev->key->xkbInfo && pDev->key->xkbInfo->desc) { + if (!XkbCopyKeymap(pDev->key->xkbInfo->desc, ckeyc->xkbInfo->desc, + True)) + FatalError("Couldn't pivot keymap from device to core!\n"); + } +#endif + + SendMappingNotify(MappingKeyboard, ckeyc->curKeySyms.minKeyCode, + (ckeyc->curKeySyms.maxKeyCode - + ckeyc->curKeySyms.minKeyCode), + serverClient); + dixSetPrivate(&inputInfo.keyboard->devPrivates, CoreDevicePrivateKey, + pDev); + } +} + + +/** + * Note that pDev was the last function to send a core pointer event. + * Currently a no-op. + * + * Call this just before processInputProc. + */ +_X_EXPORT void +SwitchCorePointer(DeviceIntPtr pDev) +{ + if (pDev != dixLookupPrivate(&inputInfo.pointer->devPrivates, + CoreDevicePrivateKey)) + dixSetPrivate(&inputInfo.pointer->devPrivates, + CoreDevicePrivateKey, pDev); +} + + +/** + * Synthesize a single motion event for the core pointer. + * + * Used in cursor functions, e.g. when cursor confinement changes, and we need + * to shift the pointer to get it inside the new bounds. + */ +void +PostSyntheticMotion(int x, int y, int screen, unsigned long time) +{ + xEvent xE; + +#ifdef PANORAMIX + /* Translate back to the sprite screen since processInputProc + will translate from sprite screen to screen 0 upon reentry + to the DIX layer. */ + if (!noPanoramiXExtension) { + x += panoramiXdataPtr[0].x - panoramiXdataPtr[screen].x; + y += panoramiXdataPtr[0].y - panoramiXdataPtr[screen].y; + } +#endif + + memset(&xE, 0, sizeof(xEvent)); + xE.u.u.type = MotionNotify; + xE.u.keyButtonPointer.rootX = x; + xE.u.keyButtonPointer.rootY = y; + xE.u.keyButtonPointer.time = time; + + (*inputInfo.pointer->public.processInputProc)(&xE, inputInfo.pointer, 1); +} diff --git a/xorg-server/dix/globals.c b/xorg-server/dix/globals.c new file mode 100644 index 000000000..7f95eabd5 --- /dev/null +++ b/xorg-server/dix/globals.c @@ -0,0 +1,162 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "misc.h" +#include "windowstr.h" +#include "scrnintstr.h" +#include "input.h" +#include "dixfont.h" +#include "site.h" +#include "dixstruct.h" +#include "os.h" + +_X_EXPORT ScreenInfo screenInfo; +KeybdCtrl defaultKeyboardControl = { + DEFAULT_KEYBOARD_CLICK, + DEFAULT_BELL, + DEFAULT_BELL_PITCH, + DEFAULT_BELL_DURATION, + DEFAULT_AUTOREPEAT, + DEFAULT_AUTOREPEATS, + DEFAULT_LEDS, + 0}; + +PtrCtrl defaultPointerControl = { + DEFAULT_PTR_NUMERATOR, + DEFAULT_PTR_DENOMINATOR, + DEFAULT_PTR_THRESHOLD, + 0}; + +_X_EXPORT ClientPtr *clients; +_X_EXPORT ClientPtr serverClient; +_X_EXPORT int currentMaxClients; /* current size of clients array */ +_X_EXPORT long maxBigRequestSize = MAX_BIG_REQUEST_SIZE; + +_X_EXPORT WindowPtr *WindowTable; + +_X_EXPORT unsigned long globalSerialNumber = 0; +_X_EXPORT unsigned long serverGeneration = 0; + +/* these next four are initialized in main.c */ +_X_EXPORT CARD32 ScreenSaverTime; +CARD32 ScreenSaverInterval; +_X_EXPORT int ScreenSaverBlanking; +int ScreenSaverAllowExposures; + +#ifdef DPMSExtension +# ifndef DEFAULT_STANDBY_TIME +# define DEFAULT_STANDBY_TIME DEFAULT_SCREEN_SAVER_TIME * 2 +# endif +# ifndef DEFAULT_SUSPEND_TIME +# define DEFAULT_SUSPEND_TIME DEFAULT_SCREEN_SAVER_TIME * 3 +# endif +# ifndef DEFAULT_OFF_TIME +# define DEFAULT_OFF_TIME DEFAULT_SCREEN_SAVER_TIME * 4 +# endif +# ifndef DEFAULT_DPMS_ENABLED +# define DEFAULT_DPMS_ENABLED TRUE +# endif +CARD32 defaultDPMSStandbyTime = DEFAULT_STANDBY_TIME; +CARD32 defaultDPMSSuspendTime = DEFAULT_SUSPEND_TIME; +CARD32 defaultDPMSOffTime = DEFAULT_OFF_TIME; +_X_EXPORT CARD16 DPMSPowerLevel = 0; +_X_EXPORT Bool defaultDPMSEnabled = DEFAULT_DPMS_ENABLED; +_X_EXPORT Bool DPMSEnabledSwitch = FALSE; /* these denote the DPMS command */ +_X_EXPORT Bool DPMSDisabledSwitch = FALSE; /* lind switch states */ +_X_EXPORT Bool DPMSCapableFlag = FALSE; +_X_EXPORT CARD32 DPMSStandbyTime; +_X_EXPORT CARD32 DPMSSuspendTime; +_X_EXPORT CARD32 DPMSOffTime; +_X_EXPORT Bool DPMSEnabled; +#endif + +CARD32 defaultScreenSaverTime = DEFAULT_SCREEN_SAVER_TIME; +CARD32 defaultScreenSaverInterval = DEFAULT_SCREEN_SAVER_INTERVAL; +int defaultScreenSaverBlanking = DEFAULT_SCREEN_SAVER_BLANKING; +int defaultScreenSaverAllowExposures = DEFAULT_SCREEN_SAVER_EXPOSURES; +#ifndef NOLOGOHACK +int logoScreenSaver = DEFAULT_LOGO_SCREEN_SAVER; +#endif + +#ifdef SCREENSAVER +Bool screenSaverSuspended = FALSE; +#endif + +char *defaultFontPath = COMPILEDDEFAULTFONTPATH; +char *defaultTextFont = COMPILEDDEFAULTFONT; +char *defaultCursorFont = COMPILEDCURSORFONT; +char *defaultDisplayClass = COMPILEDDISPLAYCLASS; +FontPtr defaultFont; /* not declared in dix.h to avoid including font.h in + every compilation of dix code */ +Bool loadableFonts = FALSE; +CursorPtr rootCursor; +Bool blackRoot=FALSE; +Bool whiteRoot=FALSE; +#ifdef XPRINT +ClientPtr requestingClient; /* XXX this should be obsolete now, remove? */ +#endif + +_X_EXPORT TimeStamp currentTime; +_X_EXPORT TimeStamp lastDeviceEventTime; + +_X_EXPORT int defaultColorVisualClass = -1; +_X_EXPORT int monitorResolution = 0; + +_X_EXPORT char *display; + +CARD32 TimeOutValue = DEFAULT_TIMEOUT * MILLI_PER_SECOND; +int argcGlobal; +char **argvGlobal; + +DDXPointRec dixScreenOrigins[MAXSCREENS]; diff --git a/xorg-server/dix/glyphcurs.c b/xorg-server/dix/glyphcurs.c new file mode 100644 index 000000000..905b5fb13 --- /dev/null +++ b/xorg-server/dix/glyphcurs.c @@ -0,0 +1,194 @@ +/************************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +************************************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "misc.h" +#include +#include "dixfontstr.h" +#include "scrnintstr.h" +#include "gcstruct.h" +#include "resource.h" +#include "dix.h" +#include "cursorstr.h" +#include "opaque.h" +#include "servermd.h" + + +/* + get the bits out of the font in a portable way. to avoid +dealing with padding and such-like, we draw the glyph into +a bitmap, then read the bits out with GetImage, which +uses server-natural format. + since all screens return the same bitmap format, we'll just use +the first one we find. + the character origin lines up with the hotspot in the +cursor metrics. +*/ + +int +ServerBitsFromGlyph(FontPtr pfont, unsigned ch, CursorMetricPtr cm, unsigned char **ppbits) +{ + ScreenPtr pScreen; + GCPtr pGC; + xRectangle rect; + PixmapPtr ppix; + long nby; + char *pbits; + ChangeGCVal gcval[3]; + unsigned char char2b[2]; + + /* turn glyph index into a protocol-format char2b */ + char2b[0] = (unsigned char)(ch >> 8); + char2b[1] = (unsigned char)(ch & 0xff); + + pScreen = screenInfo.screens[0]; + nby = BitmapBytePad(cm->width) * (long)cm->height; + pbits = (char *)xalloc(nby); + if (!pbits) + return BadAlloc; + /* zeroing the (pad) bits seems to help some ddx cursor handling */ + bzero(pbits, nby); + + ppix = (PixmapPtr)(*pScreen->CreatePixmap)(pScreen, cm->width, + cm->height, 1, + CREATE_PIXMAP_USAGE_SCRATCH); + pGC = GetScratchGC(1, pScreen); + if (!ppix || !pGC) + { + if (ppix) + (*pScreen->DestroyPixmap)(ppix); + if (pGC) + FreeScratchGC(pGC); + xfree(pbits); + return BadAlloc; + } + + rect.x = 0; + rect.y = 0; + rect.width = cm->width; + rect.height = cm->height; + + /* fill the pixmap with 0 */ + gcval[0].val = GXcopy; + gcval[1].val = 0; + gcval[2].ptr = (pointer)pfont; + dixChangeGC(NullClient, pGC, GCFunction | GCForeground | GCFont, + NULL, gcval); + ValidateGC((DrawablePtr)ppix, pGC); + (*pGC->ops->PolyFillRect)((DrawablePtr)ppix, pGC, 1, &rect); + + /* draw the glyph */ + gcval[0].val = 1; + dixChangeGC(NullClient, pGC, GCForeground, NULL, gcval); + ValidateGC((DrawablePtr)ppix, pGC); + (*pGC->ops->PolyText16)((DrawablePtr)ppix, pGC, cm->xhot, cm->yhot, + 1, (unsigned short *)char2b); + (*pScreen->GetImage)((DrawablePtr)ppix, 0, 0, cm->width, cm->height, + XYPixmap, 1, pbits); + *ppbits = (unsigned char *)pbits; + FreeScratchGC(pGC); + (*pScreen->DestroyPixmap)(ppix); + return Success; +} + + +Bool +CursorMetricsFromGlyph(FontPtr pfont, unsigned ch, CursorMetricPtr cm) +{ + CharInfoPtr pci; + unsigned long nglyphs; + CARD8 chs[2]; + FontEncoding encoding; + + chs[0] = ch >> 8; + chs[1] = ch; + encoding = (FONTLASTROW(pfont) == 0) ? Linear16Bit : TwoD16Bit; + if (encoding == Linear16Bit) + { + if (ch < pfont->info.firstCol || pfont->info.lastCol < ch) + return FALSE; + } + else + { + if (chs[0] < pfont->info.firstRow || pfont->info.lastRow < chs[0]) + return FALSE; + if (chs[1] < pfont->info.firstCol || pfont->info.lastCol < chs[1]) + return FALSE; + } + (*pfont->get_glyphs) (pfont, 1, chs, encoding, &nglyphs, &pci); + if (nglyphs == 0) + return FALSE; + cm->width = pci->metrics.rightSideBearing - pci->metrics.leftSideBearing; + cm->height = pci->metrics.descent + pci->metrics.ascent; + if (pci->metrics.leftSideBearing > 0) + { + cm->width += pci->metrics.leftSideBearing; + cm->xhot = 0; + } + else + { + cm->xhot = -pci->metrics.leftSideBearing; + if (pci->metrics.rightSideBearing < 0) + cm->width -= pci->metrics.rightSideBearing; + } + if (pci->metrics.ascent < 0) + { + cm->height -= pci->metrics.ascent; + cm->yhot = 0; + } + else + { + cm->yhot = pci->metrics.ascent; + if (pci->metrics.descent < 0) + cm->height -= pci->metrics.descent; + } + return TRUE; +} diff --git a/xorg-server/dix/grabs.c b/xorg-server/dix/grabs.c new file mode 100644 index 000000000..85e101c6a --- /dev/null +++ b/xorg-server/dix/grabs.c @@ -0,0 +1,492 @@ +/* + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts, + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN action OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +*/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "misc.h" +#define NEED_EVENTS +#include +#include "windowstr.h" +#include "inputstr.h" +#include "cursorstr.h" +#include "dixgrabs.h" +#include "xace.h" + +#define BITMASK(i) (((Mask)1) << ((i) & 31)) +#define MASKIDX(i) ((i) >> 5) +#define MASKWORD(buf, i) buf[MASKIDX(i)] +#define BITSET(buf, i) MASKWORD(buf, i) |= BITMASK(i) +#define BITCLEAR(buf, i) MASKWORD(buf, i) &= ~BITMASK(i) +#define GETBIT(buf, i) (MASKWORD(buf, i) & BITMASK(i)) + +GrabPtr +CreateGrab( + int client, + DeviceIntPtr device, + WindowPtr window, + Mask eventMask, + Bool ownerEvents, Bool keyboardMode, Bool pointerMode, + DeviceIntPtr modDevice, + unsigned short modifiers, + int type, + KeyCode keybut, /* key or button */ + WindowPtr confineTo, + CursorPtr cursor) +{ + GrabPtr grab; + + grab = (GrabPtr)xalloc(sizeof(GrabRec)); + if (!grab) + return (GrabPtr)NULL; + grab->resource = FakeClientID(client); + grab->device = device; + grab->coreGrab = ((device == inputInfo.keyboard) || + (device == inputInfo.pointer)); + grab->window = window; + grab->eventMask = eventMask; + grab->ownerEvents = ownerEvents; + grab->keyboardMode = keyboardMode; + grab->pointerMode = pointerMode; + grab->modifiersDetail.exact = modifiers; + grab->modifiersDetail.pMask = NULL; + grab->modifierDevice = modDevice; + grab->coreMods = ((modDevice == inputInfo.keyboard) || + (modDevice == inputInfo.pointer)); + grab->type = type; + grab->detail.exact = keybut; + grab->detail.pMask = NULL; + grab->confineTo = confineTo; + grab->cursor = cursor; + if (cursor) + cursor->refcnt++; + return grab; + +} + +static void +FreeGrab(GrabPtr pGrab) +{ + if (pGrab->modifiersDetail.pMask != NULL) + xfree(pGrab->modifiersDetail.pMask); + + if (pGrab->detail.pMask != NULL) + xfree(pGrab->detail.pMask); + + if (pGrab->cursor) + FreeCursor(pGrab->cursor, (Cursor)0); + + xfree(pGrab); +} + +int +DeletePassiveGrab(pointer value, XID id) +{ + GrabPtr g, prev; + GrabPtr pGrab = (GrabPtr)value; + + /* it is OK if the grab isn't found */ + prev = 0; + for (g = (wPassiveGrabs (pGrab->window)); g; g = g->next) + { + if (pGrab == g) + { + if (prev) + prev->next = g->next; + else + if (!(pGrab->window->optional->passiveGrabs = g->next)) + CheckWindowOptionalNeed (pGrab->window); + break; + } + prev = g; + } + FreeGrab(pGrab); + return Success; +} + +static Mask * +DeleteDetailFromMask(Mask *pDetailMask, unsigned short detail) +{ + Mask *mask; + int i; + + mask = (Mask *)xalloc(sizeof(Mask) * MasksPerDetailMask); + if (mask) + { + if (pDetailMask) + for (i = 0; i < MasksPerDetailMask; i++) + mask[i]= pDetailMask[i]; + else + for (i = 0; i < MasksPerDetailMask; i++) + mask[i]= ~0L; + BITCLEAR(mask, detail); + } + return mask; +} + +static Bool +IsInGrabMask( + DetailRec firstDetail, + DetailRec secondDetail, + unsigned short exception) +{ + if (firstDetail.exact == exception) + { + if (firstDetail.pMask == NULL) + return TRUE; + + /* (at present) never called with two non-null pMasks */ + if (secondDetail.exact == exception) + return FALSE; + + if (GETBIT(firstDetail.pMask, secondDetail.exact)) + return TRUE; + } + + return FALSE; +} + +static Bool +IdenticalExactDetails( + unsigned short firstExact, + unsigned short secondExact, + unsigned short exception) +{ + if ((firstExact == exception) || (secondExact == exception)) + return FALSE; + + if (firstExact == secondExact) + return TRUE; + + return FALSE; +} + +static Bool +DetailSupersedesSecond( + DetailRec firstDetail, + DetailRec secondDetail, + unsigned short exception) +{ + if (IsInGrabMask(firstDetail, secondDetail, exception)) + return TRUE; + + if (IdenticalExactDetails(firstDetail.exact, secondDetail.exact, + exception)) + return TRUE; + + return FALSE; +} + +static Bool +GrabSupersedesSecond(GrabPtr pFirstGrab, GrabPtr pSecondGrab) +{ + if (!DetailSupersedesSecond(pFirstGrab->modifiersDetail, + pSecondGrab->modifiersDetail, + (unsigned short)AnyModifier)) + return FALSE; + + if (DetailSupersedesSecond(pFirstGrab->detail, + pSecondGrab->detail, (unsigned short)AnyKey)) + return TRUE; + + return FALSE; +} + +Bool +GrabMatchesSecond(GrabPtr pFirstGrab, GrabPtr pSecondGrab) +{ + if ((pFirstGrab->device != pSecondGrab->device) || + (pFirstGrab->modifierDevice != pSecondGrab->modifierDevice) || + (pFirstGrab->type != pSecondGrab->type)) + return FALSE; + + if (GrabSupersedesSecond(pFirstGrab, pSecondGrab) || + GrabSupersedesSecond(pSecondGrab, pFirstGrab)) + return TRUE; + + if (DetailSupersedesSecond(pSecondGrab->detail, pFirstGrab->detail, + (unsigned short)AnyKey) + && + DetailSupersedesSecond(pFirstGrab->modifiersDetail, + pSecondGrab->modifiersDetail, + (unsigned short)AnyModifier)) + return TRUE; + + if (DetailSupersedesSecond(pFirstGrab->detail, pSecondGrab->detail, + (unsigned short)AnyKey) + && + DetailSupersedesSecond(pSecondGrab->modifiersDetail, + pFirstGrab->modifiersDetail, + (unsigned short)AnyModifier)) + return TRUE; + + return FALSE; +} + +static Bool +GrabsAreIdentical(GrabPtr pFirstGrab, GrabPtr pSecondGrab) +{ + if (pFirstGrab->device != pSecondGrab->device || + (pFirstGrab->modifierDevice != pSecondGrab->modifierDevice) || + (pFirstGrab->type != pSecondGrab->type)) + return FALSE; + + if (!(DetailSupersedesSecond(pFirstGrab->detail, + pSecondGrab->detail, + (unsigned short)AnyKey) && + DetailSupersedesSecond(pSecondGrab->detail, + pFirstGrab->detail, + (unsigned short)AnyKey))) + return FALSE; + + if (!(DetailSupersedesSecond(pFirstGrab->modifiersDetail, + pSecondGrab->modifiersDetail, + (unsigned short)AnyModifier) && + DetailSupersedesSecond(pSecondGrab->modifiersDetail, + pFirstGrab->modifiersDetail, + (unsigned short)AnyModifier))) + return FALSE; + + return TRUE; +} + + +/** + * Prepend the new grab to the list of passive grabs on the window. + * Any previously existing grab that matches the new grab will be removed. + * Adding a new grab that would override another client's grab will result in + * a BadAccess. + * + * @return Success or X error code on failure. + */ +int +AddPassiveGrabToList(ClientPtr client, GrabPtr pGrab) +{ + GrabPtr grab; + Mask access_mode = DixGrabAccess; + int rc; + + for (grab = wPassiveGrabs(pGrab->window); grab; grab = grab->next) + { + if (GrabMatchesSecond(pGrab, grab)) + { + if (CLIENT_BITS(pGrab->resource) != CLIENT_BITS(grab->resource)) + { + FreeGrab(pGrab); + return BadAccess; + } + } + } + + if (pGrab->keyboardMode == GrabModeSync||pGrab->pointerMode == GrabModeSync) + access_mode |= DixFreezeAccess; + rc = XaceHook(XACE_DEVICE_ACCESS, client, pGrab->device, access_mode); + if (rc != Success) + return rc; + + /* Remove all grabs that match the new one exactly */ + for (grab = wPassiveGrabs(pGrab->window); grab; grab = grab->next) + { + if (GrabsAreIdentical(pGrab, grab)) + { + DeletePassiveGrabFromList(grab); + break; + } + } + + if (!pGrab->window->optional && !MakeWindowOptional (pGrab->window)) + { + FreeGrab(pGrab); + return BadAlloc; + } + + pGrab->next = pGrab->window->optional->passiveGrabs; + pGrab->window->optional->passiveGrabs = pGrab; + if (AddResource(pGrab->resource, RT_PASSIVEGRAB, (pointer)pGrab)) + return Success; + return BadAlloc; +} + +/* the following is kinda complicated, because we need to be able to back out + * if any allocation fails + */ + +Bool +DeletePassiveGrabFromList(GrabPtr pMinuendGrab) +{ + GrabPtr grab; + GrabPtr *deletes, *adds; + Mask ***updates, **details; + int i, ndels, nadds, nups; + Bool ok; + +#define UPDATE(mask,exact) \ + if (!(details[nups] = DeleteDetailFromMask(mask, exact))) \ + ok = FALSE; \ + else \ + updates[nups++] = &(mask) + + i = 0; + for (grab = wPassiveGrabs(pMinuendGrab->window); grab; grab = grab->next) + i++; + if (!i) + return TRUE; + deletes = (GrabPtr *)xalloc(i * sizeof(GrabPtr)); + adds = (GrabPtr *)xalloc(i * sizeof(GrabPtr)); + updates = (Mask ***)xalloc(i * sizeof(Mask **)); + details = (Mask **)xalloc(i * sizeof(Mask *)); + if (!deletes || !adds || !updates || !details) + { + if (details) xfree(details); + if (updates) xfree(updates); + if (adds) xfree(adds); + if (deletes) xfree(deletes); + return FALSE; + } + ndels = nadds = nups = 0; + ok = TRUE; + for (grab = wPassiveGrabs(pMinuendGrab->window); + grab && ok; + grab = grab->next) + { + if ((CLIENT_BITS(grab->resource) != CLIENT_BITS(pMinuendGrab->resource)) || + !GrabMatchesSecond(grab, pMinuendGrab)) + continue; + if (GrabSupersedesSecond(pMinuendGrab, grab)) + { + deletes[ndels++] = grab; + } + else if ((grab->detail.exact == AnyKey) + && (grab->modifiersDetail.exact != AnyModifier)) + { + UPDATE(grab->detail.pMask, pMinuendGrab->detail.exact); + } + else if ((grab->modifiersDetail.exact == AnyModifier) + && (grab->detail.exact != AnyKey)) + { + UPDATE(grab->modifiersDetail.pMask, + pMinuendGrab->modifiersDetail.exact); + } + else if ((pMinuendGrab->detail.exact != AnyKey) + && (pMinuendGrab->modifiersDetail.exact != AnyModifier)) + { + GrabPtr pNewGrab; + + UPDATE(grab->detail.pMask, pMinuendGrab->detail.exact); + + pNewGrab = CreateGrab(CLIENT_ID(grab->resource), grab->device, + grab->window, (Mask)grab->eventMask, + (Bool)grab->ownerEvents, + (Bool)grab->keyboardMode, + (Bool)grab->pointerMode, + grab->modifierDevice, + AnyModifier, (int)grab->type, + pMinuendGrab->detail.exact, + grab->confineTo, grab->cursor); + if (!pNewGrab) + ok = FALSE; + else if (!(pNewGrab->modifiersDetail.pMask = + DeleteDetailFromMask(grab->modifiersDetail.pMask, + pMinuendGrab->modifiersDetail.exact)) + || + (!pNewGrab->window->optional && + !MakeWindowOptional(pNewGrab->window))) + { + FreeGrab(pNewGrab); + ok = FALSE; + } + else if (!AddResource(pNewGrab->resource, RT_PASSIVEGRAB, + (pointer)pNewGrab)) + ok = FALSE; + else + adds[nadds++] = pNewGrab; + } + else if (pMinuendGrab->detail.exact == AnyKey) + { + UPDATE(grab->modifiersDetail.pMask, + pMinuendGrab->modifiersDetail.exact); + } + else + { + UPDATE(grab->detail.pMask, pMinuendGrab->detail.exact); + } + } + + if (!ok) + { + for (i = 0; i < nadds; i++) + FreeResource(adds[i]->resource, RT_NONE); + for (i = 0; i < nups; i++) + xfree(details[i]); + } + else + { + for (i = 0; i < ndels; i++) + FreeResource(deletes[i]->resource, RT_NONE); + for (i = 0; i < nadds; i++) + { + grab = adds[i]; + grab->next = grab->window->optional->passiveGrabs; + grab->window->optional->passiveGrabs = grab; + } + for (i = 0; i < nups; i++) + { + xfree(*updates[i]); + *updates[i] = details[i]; + } + } + xfree(details); + xfree(updates); + xfree(adds); + xfree(deletes); + return ok; + +#undef UPDATE +} diff --git a/xorg-server/dix/initatoms.c b/xorg-server/dix/initatoms.c new file mode 100644 index 000000000..de101bd0f --- /dev/null +++ b/xorg-server/dix/initatoms.c @@ -0,0 +1,84 @@ +/* THIS IS A GENERATED FILE + * + * Do not change! Changing this file implies a protocol change! + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "misc.h" +#include "dix.h" +void MakePredeclaredAtoms(void) +{ + if (MakeAtom("PRIMARY", 7, 1) != XA_PRIMARY) AtomError(); + if (MakeAtom("SECONDARY", 9, 1) != XA_SECONDARY) AtomError(); + if (MakeAtom("ARC", 3, 1) != XA_ARC) AtomError(); + if (MakeAtom("ATOM", 4, 1) != XA_ATOM) AtomError(); + if (MakeAtom("BITMAP", 6, 1) != XA_BITMAP) AtomError(); + if (MakeAtom("CARDINAL", 8, 1) != XA_CARDINAL) AtomError(); + if (MakeAtom("COLORMAP", 8, 1) != XA_COLORMAP) AtomError(); + if (MakeAtom("CURSOR", 6, 1) != XA_CURSOR) AtomError(); + if (MakeAtom("CUT_BUFFER0", 11, 1) != XA_CUT_BUFFER0) AtomError(); + if (MakeAtom("CUT_BUFFER1", 11, 1) != XA_CUT_BUFFER1) AtomError(); + if (MakeAtom("CUT_BUFFER2", 11, 1) != XA_CUT_BUFFER2) AtomError(); + if (MakeAtom("CUT_BUFFER3", 11, 1) != XA_CUT_BUFFER3) AtomError(); + if (MakeAtom("CUT_BUFFER4", 11, 1) != XA_CUT_BUFFER4) AtomError(); + if (MakeAtom("CUT_BUFFER5", 11, 1) != XA_CUT_BUFFER5) AtomError(); + if (MakeAtom("CUT_BUFFER6", 11, 1) != XA_CUT_BUFFER6) AtomError(); + if (MakeAtom("CUT_BUFFER7", 11, 1) != XA_CUT_BUFFER7) AtomError(); + if (MakeAtom("DRAWABLE", 8, 1) != XA_DRAWABLE) AtomError(); + if (MakeAtom("FONT", 4, 1) != XA_FONT) AtomError(); + if (MakeAtom("INTEGER", 7, 1) != XA_INTEGER) AtomError(); + if (MakeAtom("PIXMAP", 6, 1) != XA_PIXMAP) AtomError(); + if (MakeAtom("POINT", 5, 1) != XA_POINT) AtomError(); + if (MakeAtom("RECTANGLE", 9, 1) != XA_RECTANGLE) AtomError(); + if (MakeAtom("RESOURCE_MANAGER", 16, 1) != XA_RESOURCE_MANAGER) AtomError(); + if (MakeAtom("RGB_COLOR_MAP", 13, 1) != XA_RGB_COLOR_MAP) AtomError(); + if (MakeAtom("RGB_BEST_MAP", 12, 1) != XA_RGB_BEST_MAP) AtomError(); + if (MakeAtom("RGB_BLUE_MAP", 12, 1) != XA_RGB_BLUE_MAP) AtomError(); + if (MakeAtom("RGB_DEFAULT_MAP", 15, 1) != XA_RGB_DEFAULT_MAP) AtomError(); + if (MakeAtom("RGB_GRAY_MAP", 12, 1) != XA_RGB_GRAY_MAP) AtomError(); + if (MakeAtom("RGB_GREEN_MAP", 13, 1) != XA_RGB_GREEN_MAP) AtomError(); + if (MakeAtom("RGB_RED_MAP", 11, 1) != XA_RGB_RED_MAP) AtomError(); + if (MakeAtom("STRING", 6, 1) != XA_STRING) AtomError(); + if (MakeAtom("VISUALID", 8, 1) != XA_VISUALID) AtomError(); + if (MakeAtom("WINDOW", 6, 1) != XA_WINDOW) AtomError(); + if (MakeAtom("WM_COMMAND", 10, 1) != XA_WM_COMMAND) AtomError(); + if (MakeAtom("WM_HINTS", 8, 1) != XA_WM_HINTS) AtomError(); + if (MakeAtom("WM_CLIENT_MACHINE", 17, 1) != XA_WM_CLIENT_MACHINE) AtomError(); + if (MakeAtom("WM_ICON_NAME", 12, 1) != XA_WM_ICON_NAME) AtomError(); + if (MakeAtom("WM_ICON_SIZE", 12, 1) != XA_WM_ICON_SIZE) AtomError(); + if (MakeAtom("WM_NAME", 7, 1) != XA_WM_NAME) AtomError(); + if (MakeAtom("WM_NORMAL_HINTS", 15, 1) != XA_WM_NORMAL_HINTS) AtomError(); + if (MakeAtom("WM_SIZE_HINTS", 13, 1) != XA_WM_SIZE_HINTS) AtomError(); + if (MakeAtom("WM_ZOOM_HINTS", 13, 1) != XA_WM_ZOOM_HINTS) AtomError(); + if (MakeAtom("MIN_SPACE", 9, 1) != XA_MIN_SPACE) AtomError(); + if (MakeAtom("NORM_SPACE", 10, 1) != XA_NORM_SPACE) AtomError(); + if (MakeAtom("MAX_SPACE", 9, 1) != XA_MAX_SPACE) AtomError(); + if (MakeAtom("END_SPACE", 9, 1) != XA_END_SPACE) AtomError(); + if (MakeAtom("SUPERSCRIPT_X", 13, 1) != XA_SUPERSCRIPT_X) AtomError(); + if (MakeAtom("SUPERSCRIPT_Y", 13, 1) != XA_SUPERSCRIPT_Y) AtomError(); + if (MakeAtom("SUBSCRIPT_X", 11, 1) != XA_SUBSCRIPT_X) AtomError(); + if (MakeAtom("SUBSCRIPT_Y", 11, 1) != XA_SUBSCRIPT_Y) AtomError(); + if (MakeAtom("UNDERLINE_POSITION", 18, 1) != XA_UNDERLINE_POSITION) AtomError(); + if (MakeAtom("UNDERLINE_THICKNESS", 19, 1) != XA_UNDERLINE_THICKNESS) AtomError(); + if (MakeAtom("STRIKEOUT_ASCENT", 16, 1) != XA_STRIKEOUT_ASCENT) AtomError(); + if (MakeAtom("STRIKEOUT_DESCENT", 17, 1) != XA_STRIKEOUT_DESCENT) AtomError(); + if (MakeAtom("ITALIC_ANGLE", 12, 1) != XA_ITALIC_ANGLE) AtomError(); + if (MakeAtom("X_HEIGHT", 8, 1) != XA_X_HEIGHT) AtomError(); + if (MakeAtom("QUAD_WIDTH", 10, 1) != XA_QUAD_WIDTH) AtomError(); + if (MakeAtom("WEIGHT", 6, 1) != XA_WEIGHT) AtomError(); + if (MakeAtom("POINT_SIZE", 10, 1) != XA_POINT_SIZE) AtomError(); + if (MakeAtom("RESOLUTION", 10, 1) != XA_RESOLUTION) AtomError(); + if (MakeAtom("COPYRIGHT", 9, 1) != XA_COPYRIGHT) AtomError(); + if (MakeAtom("NOTICE", 6, 1) != XA_NOTICE) AtomError(); + if (MakeAtom("FONT_NAME", 9, 1) != XA_FONT_NAME) AtomError(); + if (MakeAtom("FAMILY_NAME", 11, 1) != XA_FAMILY_NAME) AtomError(); + if (MakeAtom("FULL_NAME", 9, 1) != XA_FULL_NAME) AtomError(); + if (MakeAtom("CAP_HEIGHT", 10, 1) != XA_CAP_HEIGHT) AtomError(); + if (MakeAtom("WM_CLASS", 8, 1) != XA_WM_CLASS) AtomError(); + if (MakeAtom("WM_TRANSIENT_FOR", 16, 1) != XA_WM_TRANSIENT_FOR) AtomError(); +} diff --git a/xorg-server/dix/main.c b/xorg-server/dix/main.c new file mode 100644 index 000000000..6d9dd3332 --- /dev/null +++ b/xorg-server/dix/main.c @@ -0,0 +1,754 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +/* The panoramix components contained the following notice */ +/***************************************************************** + +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ + +#define NEED_EVENTS +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include /* for unistd.h */ +#include +#include "scrnintstr.h" +#include "misc.h" +#include "os.h" +#include "windowstr.h" +#include "resource.h" +#include "dixstruct.h" +#include "gcstruct.h" +#include "extension.h" +#include "colormap.h" +#include "colormapst.h" +#include "cursorstr.h" +#include "selection.h" +#include +#include "opaque.h" +#include "servermd.h" +#include "hotplug.h" +#include "site.h" +#include "dixfont.h" +#include "extnsionst.h" +#include "privates.h" +#include "registry.h" +#ifdef XPRINT +#include "DiPrint.h" +#endif +#ifdef PANORAMIX +#include "panoramiXsrv.h" +#else +#include "dixevents.h" /* InitEvents() */ +#include "dispatch.h" /* InitProcVectors() */ +#endif + +#ifdef DPMSExtension +#define DPMS_SERVER +#include +#include "dpmsproc.h" +#endif + +extern void Dispatch(void); + +char *ConnectionInfo; +xConnSetupPrefix connSetupPrefix; + +extern FontPtr defaultFont; + +extern void InitProcVectors(void); +extern Bool CreateGCperDepthArray(void); + +#ifndef PANORAMIX +static +#endif +Bool CreateConnectionBlock(void); + +_X_EXPORT PaddingInfo PixmapWidthPaddingInfo[33]; + +int connBlockScreenStart; + +_X_EXPORT void +NotImplemented(xEvent *from, xEvent *to) +{ + FatalError("Not implemented"); +} + +/* + * Dummy entry for ReplySwapVector[] + */ + +void +ReplyNotSwappd( + ClientPtr pClient , + int size , + void * pbuf + ) +{ + FatalError("Not implemented"); +} + +/* + * This array encodes the answer to the question "what is the log base 2 + * of the number of pixels that fit in a scanline pad unit?" + * Note that ~0 is an invalid entry (mostly for the benefit of the reader). + */ +static int answer[6][4] = { + /* pad pad pad pad*/ + /* 8 16 32 64 */ + + { 3, 4, 5 , 6 }, /* 1 bit per pixel */ + { 1, 2, 3 , 4 }, /* 4 bits per pixel */ + { 0, 1, 2 , 3 }, /* 8 bits per pixel */ + { ~0, 0, 1 , 2 }, /* 16 bits per pixel */ + { ~0, ~0, 0 , 1 }, /* 24 bits per pixel */ + { ~0, ~0, 0 , 1 } /* 32 bits per pixel */ +}; + +/* + * This array gives the answer to the question "what is the first index for + * the answer array above given the number of bits per pixel?" + * Note that ~0 is an invalid entry (mostly for the benefit of the reader). + */ +static int indexForBitsPerPixel[ 33 ] = { + ~0, 0, ~0, ~0, /* 1 bit per pixel */ + 1, ~0, ~0, ~0, /* 4 bits per pixel */ + 2, ~0, ~0, ~0, /* 8 bits per pixel */ + ~0,~0, ~0, ~0, + 3, ~0, ~0, ~0, /* 16 bits per pixel */ + ~0,~0, ~0, ~0, + 4, ~0, ~0, ~0, /* 24 bits per pixel */ + ~0,~0, ~0, ~0, + 5 /* 32 bits per pixel */ +}; + +/* + * This array gives the bytesperPixel value for cases where the number + * of bits per pixel is a multiple of 8 but not a power of 2. + */ +static int answerBytesPerPixel[ 33 ] = { + ~0, 0, ~0, ~0, /* 1 bit per pixel */ + 0, ~0, ~0, ~0, /* 4 bits per pixel */ + 0, ~0, ~0, ~0, /* 8 bits per pixel */ + ~0,~0, ~0, ~0, + 0, ~0, ~0, ~0, /* 16 bits per pixel */ + ~0,~0, ~0, ~0, + 3, ~0, ~0, ~0, /* 24 bits per pixel */ + ~0,~0, ~0, ~0, + 0 /* 32 bits per pixel */ +}; + +/* + * This array gives the answer to the question "what is the second index for + * the answer array above given the number of bits per scanline pad unit?" + * Note that ~0 is an invalid entry (mostly for the benefit of the reader). + */ +static int indexForScanlinePad[ 65 ] = { + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + 0, ~0, ~0, ~0, /* 8 bits per scanline pad unit */ + ~0, ~0, ~0, ~0, + 1, ~0, ~0, ~0, /* 16 bits per scanline pad unit */ + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + 2, ~0, ~0, ~0, /* 32 bits per scanline pad unit */ + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + ~0, ~0, ~0, ~0, + 3 /* 64 bits per scanline pad unit */ +}; + +#ifndef MIN +#define MIN(a,b) (((a) < (b)) ? (a) : (b)) +#endif + +#ifdef __APPLE__ +void DarwinHandleGUI(int argc, char **argv, char **envp); +#endif + +int +main(int argc, char *argv[], char *envp[]) +{ + int i, j, k, error; + char *xauthfile; + HWEventQueueType alwaysCheckForInput[2]; + + display = "0"; + + InitGlobals(); + InitRegions(); +#ifdef XPRINT + PrinterInitGlobals(); +#endif + +#ifdef XQUARTZ + /* Quartz support on Mac OS X requires that the Cocoa event loop be in + * the main thread. This allows the X server main to be called again + * from another thread. */ + DarwinHandleGUI(argc, argv, envp); +#endif + + CheckUserParameters(argc, argv, envp); + + CheckUserAuthorization(); + +#ifdef COMMANDLINE_CHALLENGED_OPERATING_SYSTEMS + ExpandCommandLine(&argc, &argv); +#endif + + InitConnectionLimits(); + + /* These are needed by some routines which are called from interrupt + * handlers, thus have no direct calling path back to main and thus + * can't be passed argc, argv as parameters */ + argcGlobal = argc; + argvGlobal = argv; + /* prep X authority file from environment; this can be overriden by a + * command line option */ + xauthfile = getenv("XAUTHORITY"); + if (xauthfile) InitAuthorization (xauthfile); + ProcessCommandLine(argc, argv); + + alwaysCheckForInput[0] = 0; + alwaysCheckForInput[1] = 1; + while(1) + { + serverGeneration++; + ScreenSaverTime = defaultScreenSaverTime; + ScreenSaverInterval = defaultScreenSaverInterval; + ScreenSaverBlanking = defaultScreenSaverBlanking; + ScreenSaverAllowExposures = defaultScreenSaverAllowExposures; +#ifdef DPMSExtension + DPMSStandbyTime = defaultDPMSStandbyTime; + DPMSSuspendTime = defaultDPMSSuspendTime; + DPMSOffTime = defaultDPMSOffTime; + DPMSEnabled = defaultDPMSEnabled; + DPMSPowerLevel = 0; +#endif + InitBlockAndWakeupHandlers(); + /* Perform any operating system dependent initializations you'd like */ + OsInit(); + config_init(); + if(serverGeneration == 1) + { + CreateWellKnownSockets(); + InitProcVectors(); + clients = (ClientPtr *)xalloc(MAXCLIENTS * sizeof(ClientPtr)); + if (!clients) + FatalError("couldn't create client array"); + for (i=1; iCreateScreenResources && + !(*pScreen->CreateScreenResources)(pScreen)) + FatalError("failed to create screen resources"); + if (!CreateGCperDepth(i)) + FatalError("failed to create scratch GCs"); + if (!CreateDefaultStipple(i)) + FatalError("failed to create default stipple"); + if (!CreateRootWindow(pScreen)) + FatalError("failed to create root window"); + } + InitCoreDevices(); + InitInput(argc, argv); + if (InitAndStartDevices() != Success) + FatalError("failed to initialize core devices"); + + InitFonts(); + if (loadableFonts) + SetFontPath(serverClient, 0, (unsigned char *)defaultFontPath, + &error); + else { + if (SetDefaultFontPath(defaultFontPath) != Success) + ErrorF("failed to set default font path '%s'", + defaultFontPath); + } + if (!SetDefaultFont(defaultTextFont)) { + FatalError("could not open default font '%s'", defaultTextFont); + } + + if (!(rootCursor = CreateRootCursor(NULL, 0))) { + FatalError("could not open default cursor font '%s'", + defaultCursorFont); + } + +#ifdef DPMSExtension + /* check all screens, looking for DPMS Capabilities */ + DPMSCapableFlag = DPMSSupported(); + if (!DPMSCapableFlag) + DPMSEnabled = FALSE; +#endif + +#ifdef PANORAMIX + /* + * Consolidate window and colourmap information for each screen + */ + if (!noPanoramiXExtension) + PanoramiXConsolidate(); +#endif + + for (i = 0; i < screenInfo.numScreens; i++) + InitRootWindow(WindowTable[i]); + DefineInitialRootWindow(WindowTable[0]); + dixSaveScreens(serverClient, SCREEN_SAVER_FORCER, ScreenSaverReset); + +#ifdef PANORAMIX + if (!noPanoramiXExtension) { + if (!PanoramiXCreateConnectionBlock()) { + FatalError("could not create connection block info"); + } + } else +#endif + { + if (!CreateConnectionBlock()) { + FatalError("could not create connection block info"); + } + } + + NotifyParentProcess(); + + Dispatch(); + + /* Now free up whatever must be freed */ + if (screenIsSaved == SCREEN_SAVER_ON) + dixSaveScreens(serverClient, SCREEN_SAVER_OFF, ScreenSaverReset); + FreeScreenSaverTimer(); + CloseDownExtensions(); + +#ifdef PANORAMIX + { + Bool remember_it = noPanoramiXExtension; + noPanoramiXExtension = TRUE; + FreeAllResources(); + noPanoramiXExtension = remember_it; + } +#else + FreeAllResources(); +#endif + + config_fini(); + + memset(WindowTable, 0, MAXSCREENS * sizeof(WindowPtr)); + CloseDownDevices(); + + for (i = screenInfo.numScreens - 1; i >= 0; i--) + { + FreeScratchPixmapsForScreen(i); + FreeGCperDepth(i); + FreeDefaultStipple(i); + (* screenInfo.screens[i]->CloseScreen)(i, screenInfo.screens[i]); + dixFreePrivates(screenInfo.screens[i]->devPrivates); + xfree(screenInfo.screens[i]); + screenInfo.numScreens = i; + } + CloseDownEvents(); + xfree(WindowTable); + WindowTable = NULL; + FreeFonts(); + + FreeAuditTimer(); + + dixFreePrivates(serverClient->devPrivates); + serverClient->devPrivates = NULL; + + if (dispatchException & DE_TERMINATE) + { + CloseWellKnownConnections(); + } + + OsCleanup((dispatchException & DE_TERMINATE) != 0); + + if (dispatchException & DE_TERMINATE) + { + ddxGiveUp(); + break; + } + + xfree(ConnectionInfo); + ConnectionInfo = NULL; + } + return(0); +} + +static int VendorRelease = VENDOR_RELEASE; +static char *VendorString = VENDOR_NAME; + +void +SetVendorRelease(int release) +{ + VendorRelease = release; +} + +void +SetVendorString(char *string) +{ + VendorString = string; +} + +static int padlength[4] = {0, 3, 2, 1}; + +#ifndef PANORAMIX +static +#endif +Bool +CreateConnectionBlock(void) +{ + xConnSetup setup; + xWindowRoot root; + xDepth depth; + xVisualType visual; + xPixmapFormat format; + unsigned long vid; + int i, j, k, + lenofblock, + sizesofar = 0; + char *pBuf; + + + /* Leave off the ridBase and ridMask, these must be sent with + connection */ + + setup.release = VendorRelease; + /* + * per-server image and bitmap parameters are defined in Xmd.h + */ + setup.imageByteOrder = screenInfo.imageByteOrder; + + setup.bitmapScanlineUnit = screenInfo.bitmapScanlineUnit; + setup.bitmapScanlinePad = screenInfo.bitmapScanlinePad; + + setup.bitmapBitOrder = screenInfo.bitmapBitOrder; + setup.motionBufferSize = NumMotionEvents(); + setup.numRoots = screenInfo.numScreens; + setup.nbytesVendor = strlen(VendorString); + setup.numFormats = screenInfo.numPixmapFormats; + setup.maxRequestSize = MAX_REQUEST_SIZE; + QueryMinMaxKeyCodes(&setup.minKeyCode, &setup.maxKeyCode); + + lenofblock = sizeof(xConnSetup) + + ((setup.nbytesVendor + 3) & ~3) + + (setup.numFormats * sizeof(xPixmapFormat)) + + (setup.numRoots * sizeof(xWindowRoot)); + ConnectionInfo = (char *) xalloc(lenofblock); + if (!ConnectionInfo) + return FALSE; + + memmove(ConnectionInfo, (char *)&setup, sizeof(xConnSetup)); + sizesofar = sizeof(xConnSetup); + pBuf = ConnectionInfo + sizeof(xConnSetup); + + memmove(pBuf, VendorString, (int)setup.nbytesVendor); + sizesofar += setup.nbytesVendor; + pBuf += setup.nbytesVendor; + i = padlength[setup.nbytesVendor & 3]; + sizesofar += i; + while (--i >= 0) + *pBuf++ = 0; + + for (i=0; idrawable.id; + root.defaultColormap = pScreen->defColormap; + root.whitePixel = pScreen->whitePixel; + root.blackPixel = pScreen->blackPixel; + root.currentInputMask = 0; /* filled in when sent */ + root.pixWidth = pScreen->width; + root.pixHeight = pScreen->height; + root.mmWidth = pScreen->mmWidth; + root.mmHeight = pScreen->mmHeight; + root.minInstalledMaps = pScreen->minInstalledCmaps; + root.maxInstalledMaps = pScreen->maxInstalledCmaps; + root.rootVisualID = pScreen->rootVisual; + root.backingStore = pScreen->backingStoreSupport; + root.saveUnders = pScreen->saveUnderSupport != NotUseful; + root.rootDepth = pScreen->rootDepth; + root.nDepths = pScreen->numDepths; + memmove(pBuf, (char *)&root, sizeof(xWindowRoot)); + sizesofar += sizeof(xWindowRoot); + pBuf += sizeof(xWindowRoot); + + pDepth = pScreen->allowedDepths; + for(j = 0; j < pScreen->numDepths; j++, pDepth++) + { + lenofblock += sizeof(xDepth) + + (pDepth->numVids * sizeof(xVisualType)); + pBuf = (char *)xrealloc(ConnectionInfo, lenofblock); + if (!pBuf) + { + xfree(ConnectionInfo); + return FALSE; + } + ConnectionInfo = pBuf; + pBuf += sizesofar; + depth.depth = pDepth->depth; + depth.nVisuals = pDepth->numVids; + memmove(pBuf, (char *)&depth, sizeof(xDepth)); + pBuf += sizeof(xDepth); + sizesofar += sizeof(xDepth); + for(k = 0; k < pDepth->numVids; k++) + { + vid = pDepth->vids[k]; + for (pVisual = pScreen->visuals; + pVisual->vid != vid; + pVisual++) + ; + visual.visualID = vid; + visual.class = pVisual->class; + visual.bitsPerRGB = pVisual->bitsPerRGBValue; + visual.colormapEntries = pVisual->ColormapEntries; + visual.redMask = pVisual->redMask; + visual.greenMask = pVisual->greenMask; + visual.blueMask = pVisual->blueMask; + memmove(pBuf, (char *)&visual, sizeof(xVisualType)); + pBuf += sizeof(xVisualType); + sizesofar += sizeof(xVisualType); + } + } + } + connSetupPrefix.success = xTrue; + connSetupPrefix.length = lenofblock/4; + connSetupPrefix.majorVersion = X_PROTOCOL; + connSetupPrefix.minorVersion = X_PROTOCOL_REVISION; + return TRUE; +} + +/* + grow the array of screenRecs if necessary. + call the device-supplied initialization procedure +with its screen number, a pointer to its ScreenRec, argc, and argv. + return the number of successfully installed screens. + +*/ + +int +AddScreen( + Bool (* pfnInit)( + int /*index*/, + ScreenPtr /*pScreen*/, + int /*argc*/, + char ** /*argv*/ + ), + int argc, + char **argv) +{ + + int i; + int scanlinepad, format, depth, bitsPerPixel, j, k; + ScreenPtr pScreen; + + i = screenInfo.numScreens; + if (i == MAXSCREENS) + return -1; + + pScreen = (ScreenPtr) xcalloc(1, sizeof(ScreenRec)); + if (!pScreen) + return -1; + + pScreen->devPrivates = NULL; + pScreen->myNum = i; + pScreen->totalPixmapSize = BitmapBytePad(sizeof(PixmapRec)*8); + pScreen->ClipNotify = 0; /* for R4 ddx compatibility */ + pScreen->CreateScreenResources = 0; + + /* + * This loop gets run once for every Screen that gets added, + * but thats ok. If the ddx layer initializes the formats + * one at a time calling AddScreen() after each, then each + * iteration will make it a little more accurate. Worst case + * we do this loop N * numPixmapFormats where N is # of screens. + * Anyway, this must be called after InitOutput and before the + * screen init routine is called. + */ + for (format=0; formatrgf = ~0L; /* there are no scratch GCs yet*/ + WindowTable[i] = NullWindow; + screenInfo.screens[i] = pScreen; + screenInfo.numScreens++; + if (!(*pfnInit)(i, pScreen, argc, argv)) + { + dixFreePrivates(pScreen->devPrivates); + xfree(pScreen); + screenInfo.numScreens--; + return -1; + } + return i; +} diff --git a/xorg-server/dix/pixmap.c b/xorg-server/dix/pixmap.c new file mode 100644 index 000000000..82e388cf3 --- /dev/null +++ b/xorg-server/dix/pixmap.c @@ -0,0 +1,122 @@ +/* + +Copyright 1993, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + +*/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "scrnintstr.h" +#include "misc.h" +#include "os.h" +#include "windowstr.h" +#include "resource.h" +#include "dixstruct.h" +#include "gcstruct.h" +#include "servermd.h" +#include "site.h" + + +/* + * Scratch pixmap management and device independent pixmap allocation + * function. + */ + + +/* callable by ddx */ +_X_EXPORT PixmapPtr +GetScratchPixmapHeader(ScreenPtr pScreen, int width, int height, int depth, + int bitsPerPixel, int devKind, pointer pPixData) +{ + PixmapPtr pPixmap = pScreen->pScratchPixmap; + + if (pPixmap) + pScreen->pScratchPixmap = NULL; + else + /* width and height of 0 means don't allocate any pixmap data */ + pPixmap = (*pScreen->CreatePixmap)(pScreen, 0, 0, depth, 0); + + if (pPixmap) { + if ((*pScreen->ModifyPixmapHeader)(pPixmap, width, height, depth, + bitsPerPixel, devKind, pPixData)) + return pPixmap; + (*pScreen->DestroyPixmap)(pPixmap); + } + return NullPixmap; +} + + +/* callable by ddx */ +_X_EXPORT void +FreeScratchPixmapHeader(PixmapPtr pPixmap) +{ + if (pPixmap) + { + ScreenPtr pScreen = pPixmap->drawable.pScreen; + + pPixmap->devPrivate.ptr = NULL; /* lest ddx chases bad ptr */ + if (pScreen->pScratchPixmap) + (*pScreen->DestroyPixmap)(pPixmap); + else + pScreen->pScratchPixmap = pPixmap; + } +} + + +Bool +CreateScratchPixmapsForScreen(int scrnum) +{ + /* let it be created on first use */ + screenInfo.screens[scrnum]->pScratchPixmap = NULL; + return TRUE; +} + + +void +FreeScratchPixmapsForScreen(int scrnum) +{ + FreeScratchPixmapHeader(screenInfo.screens[scrnum]->pScratchPixmap); +} + + +/* callable by ddx */ +_X_EXPORT PixmapPtr +AllocatePixmap(ScreenPtr pScreen, int pixDataSize) +{ + PixmapPtr pPixmap; + + if (pScreen->totalPixmapSize > ((size_t)-1) - pixDataSize) + return NullPixmap; + + pPixmap = (PixmapPtr)xalloc(pScreen->totalPixmapSize + pixDataSize); + if (!pPixmap) + return NullPixmap; + + pPixmap->devPrivates = NULL; + return pPixmap; +} diff --git a/xorg-server/dix/privates.c b/xorg-server/dix/privates.c new file mode 100644 index 000000000..efb320463 --- /dev/null +++ b/xorg-server/dix/privates.c @@ -0,0 +1,314 @@ +/* + +Copyright 1993, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + +*/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "windowstr.h" +#include "resource.h" +#include "privates.h" +#include "gcstruct.h" +#include "cursorstr.h" +#include "colormapst.h" +#include "inputstr.h" + +struct _Private { + DevPrivateKey key; + pointer value; + struct _Private *next; +}; + +typedef struct _PrivateDesc { + DevPrivateKey key; + unsigned size; + CallbackListPtr initfuncs; + CallbackListPtr deletefuncs; + struct _PrivateDesc *next; +} PrivateDescRec; + +/* list of all allocated privates */ +static PrivateDescRec *items = NULL; + +static _X_INLINE PrivateDescRec * +findItem(const DevPrivateKey key) +{ + PrivateDescRec *item = items; + while (item) { + if (item->key == key) + return item; + item = item->next; + } + return NULL; +} + +/* + * Request pre-allocated space. + */ +_X_EXPORT int +dixRequestPrivate(const DevPrivateKey key, unsigned size) +{ + PrivateDescRec *item = findItem(key); + if (item) { + if (size > item->size) + item->size = size; + } else { + item = (PrivateDescRec *)xalloc(sizeof(PrivateDescRec)); + if (!item) + return FALSE; + memset(item, 0, sizeof(PrivateDescRec)); + + /* add privates descriptor */ + item->key = key; + item->size = size; + item->next = items; + items = item; + } + return TRUE; +} + +/* + * Allocate a private and attach it to an existing object. + */ +_X_EXPORT pointer * +dixAllocatePrivate(PrivateRec **privates, const DevPrivateKey key) +{ + PrivateDescRec *item = findItem(key); + PrivateRec *ptr; + unsigned size = sizeof(PrivateRec); + + if (item) + size += item->size; + + ptr = (PrivateRec *)xcalloc(size, 1); + if (!ptr) + return NULL; + ptr->key = key; + ptr->value = (size > sizeof(PrivateRec)) ? (ptr + 1) : NULL; + ptr->next = *privates; + *privates = ptr; + + /* call any init funcs and return */ + if (item) { + PrivateCallbackRec calldata = { key, &ptr->value }; + CallCallbacks(&item->initfuncs, &calldata); + } + return &ptr->value; +} + +/* + * Look up a private pointer. + */ +_X_EXPORT pointer +dixLookupPrivate(PrivateRec **privates, const DevPrivateKey key) +{ + PrivateRec *rec = *privates; + pointer *ptr; + + while (rec) { + if (rec->key == key) + return rec->value; + rec = rec->next; + } + + ptr = dixAllocatePrivate(privates, key); + return ptr ? *ptr : NULL; +} + +/* + * Look up the address of a private pointer. + */ +_X_EXPORT pointer * +dixLookupPrivateAddr(PrivateRec **privates, const DevPrivateKey key) +{ + PrivateRec *rec = *privates; + + while (rec) { + if (rec->key == key) + return &rec->value; + rec = rec->next; + } + + return dixAllocatePrivate(privates, key); +} + +/* + * Set a private pointer. + */ +_X_EXPORT int +dixSetPrivate(PrivateRec **privates, const DevPrivateKey key, pointer val) +{ + PrivateRec *rec; + + top: + rec = *privates; + while (rec) { + if (rec->key == key) { + rec->value = val; + return TRUE; + } + rec = rec->next; + } + + if (!dixAllocatePrivate(privates, key)) + return FALSE; + goto top; +} + +/* + * Called to free privates at object deletion time. + */ +_X_EXPORT void +dixFreePrivates(PrivateRec *privates) +{ + PrivateRec *ptr, *next; + PrivateDescRec *item; + PrivateCallbackRec calldata; + + /* first pass calls the delete callbacks */ + for (ptr = privates; ptr; ptr = ptr->next) { + item = findItem(ptr->key); + if (item) { + calldata.key = ptr->key; + calldata.value = &ptr->value; + CallCallbacks(&item->deletefuncs, &calldata); + } + } + + /* second pass frees the memory */ + ptr = privates; + while (ptr) { + next = ptr->next; + xfree(ptr); + ptr = next; + } +} + +/* + * Callback registration + */ +_X_EXPORT int +dixRegisterPrivateInitFunc(const DevPrivateKey key, + CallbackProcPtr callback, pointer data) +{ + PrivateDescRec *item = findItem(key); + if (!item) { + if (!dixRequestPrivate(key, 0)) + return FALSE; + item = findItem(key); + } + return AddCallback(&item->initfuncs, callback, data); +} + +_X_EXPORT int +dixRegisterPrivateDeleteFunc(const DevPrivateKey key, + CallbackProcPtr callback, pointer data) +{ + PrivateDescRec *item = findItem(key); + if (!item) { + if (!dixRequestPrivate(key, 0)) + return FALSE; + item = findItem(key); + } + return AddCallback(&item->deletefuncs, callback, data); +} + +/* Table of devPrivates offsets */ +static const int offsetDefaults[] = { + -1, /* RT_NONE */ + offsetof(WindowRec, devPrivates), /* RT_WINDOW */ + offsetof(PixmapRec, devPrivates), /* RT_PIXMAP */ + offsetof(GC, devPrivates), /* RT_GC */ + -1, /* RT_FONT */ + offsetof(CursorRec, devPrivates), /* RT_CURSOR */ + offsetof(ColormapRec, devPrivates), /* RT_COLORMAP */ + -1, /* RT_CMAPENTRY */ + -1, /* RT_OTHERCLIENT */ + -1 /* RT_PASSIVEGRAB */ +}; + +static int *offsets = NULL; +static int offsetsSize = 0; + +/* + * Specify where the devPrivates field is located in a structure type + */ +_X_EXPORT int +dixRegisterPrivateOffset(RESTYPE type, int offset) +{ + type = type & TypeMask; + + /* resize offsets table if necessary */ + while (type >= offsetsSize) { + unsigned i = offsetsSize * 2 * sizeof(int); + offsets = (int *)xrealloc(offsets, i); + if (!offsets) { + offsetsSize = 0; + return FALSE; + } + for (i=offsetsSize; i < 2*offsetsSize; i++) + offsets[i] = -1; + offsetsSize *= 2; + } + + offsets[type] = offset; + return TRUE; +} + +_X_EXPORT int +dixLookupPrivateOffset(RESTYPE type) +{ + type = type & TypeMask; + assert(type < offsetsSize); + return offsets[type]; +} + +int +dixResetPrivates(void) +{ + PrivateDescRec *next; + + /* reset internal structures */ + while (items) { + next = items->next; + DeleteCallbackList(&items->initfuncs); + DeleteCallbackList(&items->deletefuncs); + xfree(items); + items = next; + } + if (offsets) + xfree(offsets); + offsetsSize = sizeof(offsetDefaults); + offsets = (int *)xalloc(offsetsSize); + offsetsSize /= sizeof(int); + if (!offsets) + return FALSE; + memcpy(offsets, offsetDefaults, sizeof(offsetDefaults)); + return TRUE; +} diff --git a/xorg-server/dix/property.c b/xorg-server/dix/property.c new file mode 100644 index 000000000..8b66ad6a2 --- /dev/null +++ b/xorg-server/dix/property.c @@ -0,0 +1,637 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_REPLIES +#define NEED_EVENTS +#include +#include "windowstr.h" +#include "propertyst.h" +#include "dixstruct.h" +#include "dispatch.h" +#include "swaprep.h" +#include "xace.h" + +/***************************************************************** + * Property Stuff + * + * dixLookupProperty, dixChangeProperty, DeleteProperty + * + * Properties belong to windows. The list of properties should not be + * traversed directly. Instead, use the three functions listed above. + * + *****************************************************************/ + +#ifdef notdef +static void +PrintPropertys(WindowPtr pWin) +{ + PropertyPtr pProp; + int j; + + pProp = pWin->userProps; + while (pProp) + { + ErrorF( "%x %x\n", pProp->propertyName, pProp->type); + ErrorF("property format: %d\n", pProp->format); + ErrorF("property data: \n"); + for (j=0; j<(pProp->format/8)*pProp->size; j++) + ErrorF("%c\n", pProp->data[j]); + pProp = pProp->next; + } +} +#endif + +_X_EXPORT int +dixLookupProperty(PropertyPtr *result, WindowPtr pWin, Atom propertyName, + ClientPtr client, Mask access_mode) +{ + PropertyPtr pProp; + int rc = BadMatch; + client->errorValue = propertyName; + + for (pProp = wUserProps(pWin); pProp; pProp = pProp->next) + if (pProp->propertyName == propertyName) + break; + + if (pProp) + rc = XaceHookPropertyAccess(client, pWin, &pProp, access_mode); + *result = pProp; + return rc; +} + +static void +deliverPropertyNotifyEvent(WindowPtr pWin, int state, Atom atom) +{ + xEvent event; + + event.u.u.type = PropertyNotify; + event.u.property.window = pWin->drawable.id; + event.u.property.state = state; + event.u.property.atom = atom; + event.u.property.time = currentTime.milliseconds; + DeliverEvents(pWin, &event, 1, (WindowPtr)NULL); +} + +int +ProcRotateProperties(ClientPtr client) +{ + int i, j, delta, rc; + REQUEST(xRotatePropertiesReq); + WindowPtr pWin; + Atom * atoms; + PropertyPtr * props; /* array of pointer */ + PropertyPtr pProp, saved; + + REQUEST_FIXED_SIZE(xRotatePropertiesReq, stuff->nAtoms << 2); + UpdateCurrentTime(); + rc = dixLookupWindow(&pWin, stuff->window, client, DixSetPropAccess); + if (rc != Success || stuff->nAtoms <= 0) + return rc; + + atoms = (Atom *) & stuff[1]; + props = (PropertyPtr *)xalloc(stuff->nAtoms * sizeof(PropertyPtr)); + saved = (PropertyPtr)xalloc(stuff->nAtoms * sizeof(PropertyRec)); + if (!props || !saved) { + rc = BadAlloc; + goto out; + } + + for (i = 0; i < stuff->nAtoms; i++) + { + if (!ValidAtom(atoms[i])) { + rc = BadAtom; + client->errorValue = atoms[i]; + goto out; + } + for (j = i + 1; j < stuff->nAtoms; j++) + if (atoms[j] == atoms[i]) + { + rc = BadMatch; + goto out; + } + + rc = dixLookupProperty(&pProp, pWin, atoms[i], client, + DixReadAccess|DixWriteAccess); + if (rc != Success) + goto out; + + props[i] = pProp; + saved[i] = *pProp; + } + delta = stuff->nPositions; + + /* If the rotation is a complete 360 degrees, then moving the properties + around and generating PropertyNotify events should be skipped. */ + + if (abs(delta) % stuff->nAtoms) + { + while (delta < 0) /* faster if abs value is small */ + delta += stuff->nAtoms; + for (i = 0; i < stuff->nAtoms; i++) + { + j = (i + delta) % stuff->nAtoms; + deliverPropertyNotifyEvent(pWin, PropertyNewValue, atoms[i]); + + /* Preserve name and devPrivates */ + props[j]->type = saved[i].type; + props[j]->format = saved[i].format; + props[j]->size = saved[i].size; + props[j]->data = saved[i].data; + } + } +out: + xfree(saved); + xfree(props); + return rc; +} + +int +ProcChangeProperty(ClientPtr client) +{ + WindowPtr pWin; + char format, mode; + unsigned long len; + int sizeInBytes, totalSize, err; + REQUEST(xChangePropertyReq); + + REQUEST_AT_LEAST_SIZE(xChangePropertyReq); + UpdateCurrentTime(); + format = stuff->format; + mode = stuff->mode; + if ((mode != PropModeReplace) && (mode != PropModeAppend) && + (mode != PropModePrepend)) + { + client->errorValue = mode; + return BadValue; + } + if ((format != 8) && (format != 16) && (format != 32)) + { + client->errorValue = format; + return BadValue; + } + len = stuff->nUnits; + if (len > ((0xffffffff - sizeof(xChangePropertyReq)) >> 2)) + return BadLength; + sizeInBytes = format>>3; + totalSize = len * sizeInBytes; + REQUEST_FIXED_SIZE(xChangePropertyReq, totalSize); + + err = dixLookupWindow(&pWin, stuff->window, client, DixSetPropAccess); + if (err != Success) + return err; + if (!ValidAtom(stuff->property)) + { + client->errorValue = stuff->property; + return(BadAtom); + } + if (!ValidAtom(stuff->type)) + { + client->errorValue = stuff->type; + return(BadAtom); + } + + err = dixChangeWindowProperty(client, pWin, stuff->property, stuff->type, + (int)format, (int)mode, len, &stuff[1], + TRUE); + if (err != Success) + return err; + else + return client->noClientException; +} + +_X_EXPORT int +dixChangeWindowProperty(ClientPtr pClient, WindowPtr pWin, Atom property, + Atom type, int format, int mode, unsigned long len, + pointer value, Bool sendevent) +{ + PropertyPtr pProp; + int sizeInBytes, totalSize, rc; + pointer data; + Mask access_mode; + + sizeInBytes = format>>3; + totalSize = len * sizeInBytes; + access_mode = (mode == PropModeReplace) ? DixWriteAccess : DixBlendAccess; + + /* first see if property already exists */ + rc = dixLookupProperty(&pProp, pWin, property, pClient, access_mode); + + if (rc == BadMatch) /* just add to list */ + { + if (!pWin->optional && !MakeWindowOptional (pWin)) + return(BadAlloc); + pProp = (PropertyPtr)xalloc(sizeof(PropertyRec)); + if (!pProp) + return(BadAlloc); + data = (pointer)xalloc(totalSize); + if (!data && len) + { + xfree(pProp); + return(BadAlloc); + } + pProp->propertyName = property; + pProp->type = type; + pProp->format = format; + pProp->data = data; + if (len) + memmove((char *)data, (char *)value, totalSize); + pProp->size = len; + pProp->devPrivates = NULL; + rc = XaceHookPropertyAccess(pClient, pWin, &pProp, + DixCreateAccess|DixWriteAccess); + if (rc != Success) { + xfree(data); + xfree(pProp); + pClient->errorValue = property; + return rc; + } + pProp->next = pWin->optional->userProps; + pWin->optional->userProps = pProp; + } + else if (rc == Success) + { + /* To append or prepend to a property the request format and type + must match those of the already defined property. The + existing format and type are irrelevant when using the mode + "PropModeReplace" since they will be written over. */ + + if ((format != pProp->format) && (mode != PropModeReplace)) + return(BadMatch); + if ((pProp->type != type) && (mode != PropModeReplace)) + return(BadMatch); + if (mode == PropModeReplace) + { + if (totalSize != pProp->size * (pProp->format >> 3)) + { + data = (pointer)xrealloc(pProp->data, totalSize); + if (!data && len) + return(BadAlloc); + pProp->data = data; + } + if (len) + memmove((char *)pProp->data, (char *)value, totalSize); + pProp->size = len; + pProp->type = type; + pProp->format = format; + } + else if (len == 0) + { + /* do nothing */ + } + else if (mode == PropModeAppend) + { + data = (pointer)xrealloc(pProp->data, + sizeInBytes * (len + pProp->size)); + if (!data) + return(BadAlloc); + pProp->data = data; + memmove(&((char *)data)[pProp->size * sizeInBytes], + (char *)value, + totalSize); + pProp->size += len; + } + else if (mode == PropModePrepend) + { + data = (pointer)xalloc(sizeInBytes * (len + pProp->size)); + if (!data) + return(BadAlloc); + memmove(&((char *)data)[totalSize], (char *)pProp->data, + (int)(pProp->size * sizeInBytes)); + memmove((char *)data, (char *)value, totalSize); + xfree(pProp->data); + pProp->data = data; + pProp->size += len; + } + } + else + return rc; + + if (sendevent) + deliverPropertyNotifyEvent(pWin, PropertyNewValue, pProp->propertyName); + + return(Success); +} + +_X_EXPORT int +ChangeWindowProperty(WindowPtr pWin, Atom property, Atom type, int format, + int mode, unsigned long len, pointer value, + Bool sendevent) +{ + return dixChangeWindowProperty(serverClient, pWin, property, type, format, + mode, len, value, sendevent); +} + +int +DeleteProperty(ClientPtr client, WindowPtr pWin, Atom propName) +{ + PropertyPtr pProp, prevProp; + int rc; + + rc = dixLookupProperty(&pProp, pWin, propName, client, DixDestroyAccess); + if (rc == BadMatch) + return Success; /* Succeed if property does not exist */ + + if (rc == Success) { + if (pWin->optional->userProps == pProp) { + /* Takes care of head */ + if (!(pWin->optional->userProps = pProp->next)) + CheckWindowOptionalNeed (pWin); + } else { + /* Need to traverse to find the previous element */ + prevProp = pWin->optional->userProps; + while (prevProp->next != pProp) + prevProp = prevProp->next; + prevProp->next = pProp->next; + } + + deliverPropertyNotifyEvent(pWin, PropertyDelete, pProp->propertyName); + dixFreePrivates(pProp->devPrivates); + xfree(pProp->data); + xfree(pProp); + } + return rc; +} + +void +DeleteAllWindowProperties(WindowPtr pWin) +{ + PropertyPtr pProp, pNextProp; + + pProp = wUserProps (pWin); + while (pProp) + { + deliverPropertyNotifyEvent(pWin, PropertyDelete, pProp->propertyName); + pNextProp = pProp->next; + dixFreePrivates(pProp->devPrivates); + xfree(pProp->data); + xfree(pProp); + pProp = pNextProp; + } +} + +static int +NullPropertyReply( + ClientPtr client, + ATOM propertyType, + int format, + xGetPropertyReply *reply) +{ + reply->nItems = 0; + reply->length = 0; + reply->bytesAfter = 0; + reply->propertyType = propertyType; + reply->format = format; + WriteReplyToClient(client, sizeof(xGenericReply), reply); + return(client->noClientException); +} + +/***************** + * GetProperty + * If type Any is specified, returns the property from the specified + * window regardless of its type. If a type is specified, returns the + * property only if its type equals the specified type. + * If delete is True and a property is returned, the property is also + * deleted from the window and a PropertyNotify event is generated on the + * window. + *****************/ + +int +ProcGetProperty(ClientPtr client) +{ + PropertyPtr pProp, prevProp; + unsigned long n, len, ind; + int rc; + WindowPtr pWin; + xGetPropertyReply reply; + Mask win_mode = DixGetPropAccess, prop_mode = DixReadAccess; + REQUEST(xGetPropertyReq); + + REQUEST_SIZE_MATCH(xGetPropertyReq); + if (stuff->delete) { + UpdateCurrentTime(); + win_mode |= DixSetPropAccess; + prop_mode |= DixDestroyAccess; + } + rc = dixLookupWindow(&pWin, stuff->window, client, win_mode); + if (rc != Success) + return rc; + + if (!ValidAtom(stuff->property)) + { + client->errorValue = stuff->property; + return(BadAtom); + } + if ((stuff->delete != xTrue) && (stuff->delete != xFalse)) + { + client->errorValue = stuff->delete; + return(BadValue); + } + if ((stuff->type != AnyPropertyType) && !ValidAtom(stuff->type)) + { + client->errorValue = stuff->type; + return(BadAtom); + } + + reply.type = X_Reply; + reply.sequenceNumber = client->sequence; + + rc = dixLookupProperty(&pProp, pWin, stuff->property, client, prop_mode); + if (rc == BadMatch) + return NullPropertyReply(client, None, 0, &reply); + else if (rc != Success) + return rc; + + /* If the request type and actual type don't match. Return the + property information, but not the data. */ + + if (((stuff->type != pProp->type) && + (stuff->type != AnyPropertyType)) + ) + { + reply.bytesAfter = pProp->size; + reply.format = pProp->format; + reply.length = 0; + reply.nItems = 0; + reply.propertyType = pProp->type; + WriteReplyToClient(client, sizeof(xGenericReply), &reply); + return(Success); + } + +/* + * Return type, format, value to client + */ + n = (pProp->format/8) * pProp->size; /* size (bytes) of prop */ + ind = stuff->longOffset << 2; + + /* If longOffset is invalid such that it causes "len" to + be negative, it's a value error. */ + + if (n < ind) + { + client->errorValue = stuff->longOffset; + return BadValue; + } + + len = min(n - ind, 4 * stuff->longLength); + + reply.bytesAfter = n - (ind + len); + reply.format = pProp->format; + reply.length = (len + 3) >> 2; + reply.nItems = len / (pProp->format / 8 ); + reply.propertyType = pProp->type; + + if (stuff->delete && (reply.bytesAfter == 0)) + deliverPropertyNotifyEvent(pWin, PropertyDelete, pProp->propertyName); + + WriteReplyToClient(client, sizeof(xGenericReply), &reply); + if (len) + { + switch (reply.format) { + case 32: client->pSwapReplyFunc = (ReplySwapPtr)CopySwap32Write; break; + case 16: client->pSwapReplyFunc = (ReplySwapPtr)CopySwap16Write; break; + default: client->pSwapReplyFunc = (ReplySwapPtr)WriteToClient; break; + } + WriteSwappedDataToClient(client, len, + (char *)pProp->data + ind); + } + + if (stuff->delete && (reply.bytesAfter == 0)) { + /* Delete the Property */ + if (pWin->optional->userProps == pProp) { + /* Takes care of head */ + if (!(pWin->optional->userProps = pProp->next)) + CheckWindowOptionalNeed (pWin); + } else { + /* Need to traverse to find the previous element */ + prevProp = pWin->optional->userProps; + while (prevProp->next != pProp) + prevProp = prevProp->next; + prevProp->next = pProp->next; + } + + dixFreePrivates(pProp->devPrivates); + xfree(pProp->data); + xfree(pProp); + } + return(client->noClientException); +} + +int +ProcListProperties(ClientPtr client) +{ + Atom *pAtoms = NULL, *temppAtoms; + xListPropertiesReply xlpr; + int rc, numProps = 0; + WindowPtr pWin; + PropertyPtr pProp, realProp; + REQUEST(xResourceReq); + + REQUEST_SIZE_MATCH(xResourceReq); + rc = dixLookupWindow(&pWin, stuff->id, client, DixListPropAccess); + if (rc != Success) + return rc; + + for (pProp = wUserProps(pWin); pProp; pProp = pProp->next) + numProps++; + + if (numProps && !(pAtoms = (Atom *)xalloc(numProps * sizeof(Atom)))) + return BadAlloc; + + numProps = 0; + temppAtoms = pAtoms; + for (pProp = wUserProps(pWin); pProp; pProp = pProp->next) { + realProp = pProp; + rc = XaceHookPropertyAccess(client, pWin, &realProp, DixGetAttrAccess); + if (rc == Success && realProp == pProp) { + *temppAtoms++ = pProp->propertyName; + numProps++; + } + } + + xlpr.type = X_Reply; + xlpr.nProperties = numProps; + xlpr.length = (numProps * sizeof(Atom)) >> 2; + xlpr.sequenceNumber = client->sequence; + WriteReplyToClient(client, sizeof(xGenericReply), &xlpr); + if (numProps) + { + client->pSwapReplyFunc = (ReplySwapPtr)Swap32Write; + WriteSwappedDataToClient(client, numProps * sizeof(Atom), pAtoms); + } + xfree(pAtoms); + return(client->noClientException); +} + +int +ProcDeleteProperty(ClientPtr client) +{ + WindowPtr pWin; + REQUEST(xDeletePropertyReq); + int result; + + REQUEST_SIZE_MATCH(xDeletePropertyReq); + UpdateCurrentTime(); + result = dixLookupWindow(&pWin, stuff->window, client, DixSetPropAccess); + if (result != Success) + return result; + if (!ValidAtom(stuff->property)) + { + client->errorValue = stuff->property; + return (BadAtom); + } + + result = DeleteProperty(client, pWin, stuff->property); + if (client->noClientException != Success) + return(client->noClientException); + else + return(result); +} diff --git a/xorg-server/dix/protocol.txt b/xorg-server/dix/protocol.txt new file mode 100644 index 000000000..0a85ca872 --- /dev/null +++ b/xorg-server/dix/protocol.txt @@ -0,0 +1,1066 @@ +# Registry of protocol names used by X Server +# This will eventually be replaced by server-side XCB +# +# Format is Xnnn : +# R=Request, V=Event, E=Error +# +# This is a security-sensitive file, please set permissions as appropriate. +# +R001 Adobe-DPS-Extension:Init +R002 Adobe-DPS-Extension:CreateContext +R003 Adobe-DPS-Extension:CreateSpace +R004 Adobe-DPS-Extension:GiveInput +R005 Adobe-DPS-Extension:GetStatus +R006 Adobe-DPS-Extension:DestroySpace +R007 Adobe-DPS-Extension:Reset +R008 Adobe-DPS-Extension:NotifyContext +R009 Adobe-DPS-Extension:CreateContextFromID +R010 Adobe-DPS-Extension:XIDFromContext +R011 Adobe-DPS-Extension:ContextFromXID +R012 Adobe-DPS-Extension:SetStatusMask +R013 Adobe-DPS-Extension:CreateSecureContext +R014 Adobe-DPS-Extension:NotifyWhenReady +R000 Apple-DRI:QueryVersion +R001 Apple-DRI:QueryDirectRenderingCapable +R002 Apple-DRI:CreateSurface +R003 Apple-DRI:DestroySurface +R004 Apple-DRI:AuthConnection +V000 Apple-DRI:ObsoleteEvent1 +V001 Apple-DRI:ObsoleteEvent2 +V002 Apple-DRI:ObsoleteEvent3 +V003 Apple-DRI:SurfaceNotify +E000 Apple-DRI:ClientNotLocal +E001 Apple-DRI:OperationNotSupported +R000 Apple-WM:QueryVersion +R001 Apple-WM:FrameGetRect +R002 Apple-WM:FrameHitTest +R003 Apple-WM:FrameDraw +R004 Apple-WM:DisableUpdate +R005 Apple-WM:ReenableUpdate +R006 Apple-WM:SelectInput +R007 Apple-WM:SetWindowMenuCheck +R008 Apple-WM:SetFrontProcess +R009 Apple-WM:SetWindowLevel +R010 Apple-WM:SetCanQuit +R011 Apple-WM:SetWindowMenu +V000 Apple-WM:ControllerNotify +V001 Apple-WM:ActivationNotify +V002 Apple-WM:PasteboardNotify +E000 Apple-WM:ClientNotLocal +E001 Apple-WM:OperationNotSupported +R000 BIG-REQUESTS:Enable +R000 Composite:CompositeQueryVersion +R001 Composite:CompositeRedirectWindow +R002 Composite:CompositeRedirectSubwindows +R003 Composite:CompositeUnredirectWindow +R004 Composite:CompositeUnredirectSubwindows +R005 Composite:CompositeCreateRegionFromBorderClip +R006 Composite:CompositeNameWindowPixmap +R007 Composite:CompositeGetOverlayWindow +R008 Composite:CompositeReleaseOverlayWindow +R000 DAMAGE:QueryVersion +R001 DAMAGE:Create +R002 DAMAGE:Destroy +R003 DAMAGE:Subtract +R004 DAMAGE:Add +V000 DAMAGE:Notify +E000 DAMAGE:BadDamage +R000 DEC-XTRAP:Reset +R001 DEC-XTRAP:GetAvailable +R002 DEC-XTRAP:Config +R003 DEC-XTRAP:StartTrap +R004 DEC-XTRAP:StopTrap +R005 DEC-XTRAP:GetCurrent +R006 DEC-XTRAP:GetStatistics +R007 DEC-XTRAP:SimulateXEvent +R008 DEC-XTRAP:GetVersion +R009 DEC-XTRAP:GetLastInpTime +V000 DEC-XTRAP:Event +E002 DEC-XTRAP:BadIO +E004 DEC-XTRAP:BadStatistics +E005 DEC-XTRAP:BadDevices +E007 DEC-XTRAP:BadScreen +E008 DEC-XTRAP:BadSwapReq +R000 DMX:DMXQueryVersion +R001 DMX:DMXGetScreenCount +R002 DMX:DMXGetScreenInfoDEPRECATED +R003 DMX:DMXGetWindowAttributes +R004 DMX:DMXGetInputCount +R005 DMX:DMXGetInputAttributes +R006 DMX:DMXForceWindowCreationDEPRECATED +R007 DMX:DMXReconfigureScreenDEPRECATED +R008 DMX:DMXSync +R009 DMX:DMXForceWindowCreation +R010 DMX:DMXGetScreenAttributes +R011 DMX:DMXChangeScreensAttributes +R012 DMX:DMXAddScreen +R013 DMX:DMXRemoveScreen +R014 DMX:DMXGetDesktopAttributes +R015 DMX:DMXChangeDesktopAttributes +R016 DMX:DMXAddInput +R017 DMX:DMXRemoveInput +R000 DOUBLE-BUFFER:GetVersion +R001 DOUBLE-BUFFER:AllocateBackBufferName +R002 DOUBLE-BUFFER:DeallocateBackBufferName +R003 DOUBLE-BUFFER:SwapBuffers +R004 DOUBLE-BUFFER:BeginIdiom +R005 DOUBLE-BUFFER:EndIdiom +R006 DOUBLE-BUFFER:GetVisualInfo +R007 DOUBLE-BUFFER:GetBackBufferAttributes +E000 DOUBLE-BUFFER:BadBuffer +R000 DPMS:GetVersion +R001 DPMS:Capable +R002 DPMS:GetTimeouts +R003 DPMS:SetTimeouts +R004 DPMS:Enable +R005 DPMS:Disable +R006 DPMS:ForceLevel +R007 DPMS:Info +R000 Extended-Visual-Information:QueryVersion +R001 Extended-Visual-Information:GetVisualInfo +R000 FontCache:QueryVersion +R001 FontCache:GetCacheSettings +R002 FontCache:ChangeCacheSettings +R003 FontCache:GetCacheStatistics +E000 FontCache:BadProtocol +E001 FontCache:CannotAllocMemory +R001 GLX: +R002 GLX:Large +R003 GLX:CreateContext +R004 GLX:DestroyContext +R005 GLX:MakeCurrent +R006 GLX:IsDirect +R007 GLX:QueryVersion +R008 GLX:WaitGL +R009 GLX:WaitX +R010 GLX:CopyContext +R011 GLX:SwapBuffers +R012 GLX:UseXFont +R013 GLX:CreateGLXPixmap +R014 GLX:GetVisualConfigs +R015 GLX:DestroyGLXPixmap +R016 GLX:VendorPrivate +R017 GLX:VendorPrivateWithReply +R018 GLX:QueryExtensionsString +R019 GLX:QueryServerString +R020 GLX:ClientInfo +R101 GLX:NewList +R102 GLX:EndList +R103 GLX:DeleteLists +R104 GLX:GenLists +R105 GLX:FeedbackBuffer +R106 GLX:SelectBuffer +R107 GLX:Mode +R108 GLX:Finish +R109 GLX:PixelStoref +R110 GLX:PixelStorei +R111 GLX:ReadPixels +R112 GLX:GetBooleanv +R113 GLX:GetClipPlane +R114 GLX:GetDoublev +R115 GLX:GetError +R116 GLX:GetFloatv +R117 GLX:GetIntegerv +R118 GLX:GetLightfv +R119 GLX:GetLightiv +R120 GLX:GetMapdv +R121 GLX:GetMapfv +R122 GLX:GetMapiv +R123 GLX:GetMaterialfv +R124 GLX:GetMaterialiv +R125 GLX:GetPixelfv +R126 GLX:GetPixelMapuiv +R127 GLX:GetPixelMapusv +R128 GLX:GetPolygonStipple +R129 GLX:GetString +R130 GLX:GetTexEnvfv +R131 GLX:GetTexEnviv +R132 GLX:GetTexGendv +R133 GLX:GetTexGenfv +R134 GLX:GetTexGeniv +R135 GLX:GetTexImage +R136 GLX:GetTexParameterfv +R137 GLX:GetTexParameteriv +R138 GLX:GetTexLevelParameterfv +R139 GLX:GetTexLevelParameteriv +R140 GLX:IsEnabled +R141 GLX:IsList +R142 GLX:Flush +E000 GLX:BadContext +E001 GLX:BadContextState +E002 GLX:BadDrawable +E003 GLX:BadPixmap +E004 GLX:BadContextTag +E005 GLX:BadCurrentWindow +E006 GLX:BadRenderRequest +E007 GLX:BadLargeRequest +E008 GLX:UnsupportedPrivateRequest +R000 LBX:QueryVersion +R001 LBX:StartProxy +R002 LBX:StopProxy +R003 LBX:Switch +R004 LBX:NewClient +R005 LBX:CloseClient +R006 LBX:ModifySequence +R007 LBX:AllowMotion +R008 LBX:IncrementPixel +R009 LBX:Delta +R010 LBX:GetModifierMapping +R011 LBX:QueryTag +R012 LBX:InvalidateTag +R013 LBX:PolyPoint +R014 LBX:PolyLine +R015 LBX:PolySegment +R016 LBX:PolyRectangle +R017 LBX:PolyArc +R018 LBX:FillPoly +R019 LBX:PolyFillRectangle +R020 LBX:PolyFillArc +R021 LBX:GetKeyboardMapping +R022 LBX:QueryFont +R023 LBX:ChangeProperty +R024 LBX:GetProperty +R025 LBX:TagData +R026 LBX:CopyArea +R027 LBX:CopyPlane +R028 LBX:PolyText8 +R029 LBX:PolyText16 +R030 LBX:ImageText8 +R031 LBX:ImageText16 +R032 LBX:QueryExtension +R033 LBX:PutImage +R034 LBX:GetImage +R035 LBX:BeginLargeRequest +R036 LBX:LargeRequestData +R037 LBX:EndLargeRequest +R038 LBX:InternAtoms +R039 LBX:GetWinAttrAndGeom +R040 LBX:GrabCmap +R041 LBX:ReleaseCmap +R042 LBX:AllocColor +R043 LBX:Sync +E000 LBX:BadLbxClient +R000 MIT-SCREEN-SAVER:QueryVersion +R001 MIT-SCREEN-SAVER:QueryInfo +R002 MIT-SCREEN-SAVER:SelectInput +R003 MIT-SCREEN-SAVER:SetAttributes +R004 MIT-SCREEN-SAVER:UnsetAttributes +R005 MIT-SCREEN-SAVER:Suspend +V000 MIT-SCREEN-SAVER:Notify +R000 MIT-SHM:QueryVersion +R001 MIT-SHM:Attach +R002 MIT-SHM:Detach +R003 MIT-SHM:PutImage +R004 MIT-SHM:GetImage +R005 MIT-SHM:CreatePixmap +V000 MIT-SHM:Completion +E000 MIT-SHM:BadShmSeg +R000 MIT-SUNDRY-NONSTANDARD:SetBugMode +R001 MIT-SUNDRY-NONSTANDARD:GetBugMode +R000 Multi-Buffering:GetBufferVersion +R001 Multi-Buffering:CreateImageBuffers +R002 Multi-Buffering:DestroyImageBuffers +R003 Multi-Buffering:DisplayImageBuffers +R004 Multi-Buffering:SetMBufferAttributes +R005 Multi-Buffering:GetMBufferAttributes +R006 Multi-Buffering:SetBufferAttributes +R007 Multi-Buffering:GetBufferAttributes +R008 Multi-Buffering:GetBufferInfo +R009 Multi-Buffering:CreateStereoWindow +R010 Multi-Buffering:ClearImageBufferArea +V000 Multi-Buffering:ClobberNotify +V001 Multi-Buffering:UpdateNotify +E000 Multi-Buffering:BadBuffer +R000 RANDR:QueryVersion +R001 RANDR:OldGetScreenInfo +R002 RANDR:SetScreenConfig +R003 RANDR:OldScreenChangeSelectInput +R004 RANDR:SelectInput +R005 RANDR:GetScreenInfo +R006 RANDR:GetScreenSizeRange +R007 RANDR:SetScreenSize +R008 RANDR:GetScreenResources +R009 RANDR:GetOutputInfo +R010 RANDR:ListOutputProperties +R011 RANDR:QueryOutputProperty +R012 RANDR:ConfigureOutputProperty +R013 RANDR:ChangeOutputProperty +R014 RANDR:DeleteOutputProperty +R015 RANDR:GetOutputProperty +R016 RANDR:CreateMode +R017 RANDR:DestroyMode +R018 RANDR:AddOutputMode +R019 RANDR:DeleteOutputMode +R020 RANDR:GetCrtcInfo +R021 RANDR:SetCrtcConfig +R022 RANDR:GetCrtcGammaSize +R023 RANDR:GetCrtcGamma +R024 RANDR:SetCrtcGamma +V000 RANDR:ScreenChangeNotify +V001 RANDR:Notify +E000 RANDR:BadRROutput +E001 RANDR:BadRRCrtc +E002 RANDR:BadRRMode +R000 RECORD:QueryVersion +R001 RECORD:CreateContext +R002 RECORD:RegisterClients +R003 RECORD:UnregisterClients +R004 RECORD:GetContext +R005 RECORD:EnableContext +R006 RECORD:DisableContext +R007 RECORD:FreeContext +E000 RECORD:BadContext +R000 RENDER:QueryVersion +R001 RENDER:QueryPictFormats +R002 RENDER:QueryPictIndexValues +R003 RENDER:QueryDithers +R004 RENDER:CreatePicture +R005 RENDER:ChangePicture +R006 RENDER:SetPictureClipRectangles +R007 RENDER:FreePicture +R008 RENDER:Composite +R009 RENDER:Scale +R010 RENDER:Trapezoids +R011 RENDER:Triangles +R012 RENDER:TriStrip +R013 RENDER:TriFan +R014 RENDER:ColorTrapezoids +R015 RENDER:ColorTriangles +R016 RENDER:Transform +R017 RENDER:CreateGlyphSet +R018 RENDER:ReferenceGlyphSet +R019 RENDER:FreeGlyphSet +R020 RENDER:AddGlyphs +R021 RENDER:AddGlyphsFromPicture +R022 RENDER:FreeGlyphs +R023 RENDER:CompositeGlyphs8 +R024 RENDER:CompositeGlyphs16 +R025 RENDER:CompositeGlyphs32 +R026 RENDER:FillRectangles +R027 RENDER:CreateCursor +R028 RENDER:SetPictureTransform +R029 RENDER:QueryFilters +R030 RENDER:SetPictureFilter +R031 RENDER:CreateAnimCursor +R032 RENDER:AddTraps +R033 RENDER:CreateSolidFill +R034 RENDER:CreateLinearGradient +R035 RENDER:CreateRadialGradient +R036 RENDER:CreateConicalGradient +E000 RENDER:BadPictFormat +E001 RENDER:BadPicture +E002 RENDER:BadPictOp +E003 RENDER:BadGlyphSet +E004 RENDER:BadGlyph +R000 SECURITY:QueryVersion +R001 SECURITY:GenerateAuthorization +R002 SECURITY:RevokeAuthorization +V000 SECURITY:AuthorizationRevoked +E000 SECURITY:BadAuthorization +E001 SECURITY:BadAuthorizationProtocol +R000 SELinux:SELinuxQueryVersion +R001 SELinux:SELinuxSetDeviceCreateContext +R002 SELinux:SELinuxGetDeviceCreateContext +R003 SELinux:SELinuxSetDeviceContext +R004 SELinux:SELinuxGetDeviceContext +R005 SELinux:SELinuxSetWindowCreateContext +R006 SELinux:SELinuxGetWindowCreateContext +R007 SELinux:SELinuxGetWindowContext +R008 SELinux:SELinuxSetPropertyCreateContext +R009 SELinux:SELinuxGetPropertyCreateContext +R010 SELinux:SELinuxSetPropertyUseContext +R011 SELinux:SELinuxGetPropertyUseContext +R012 SELinux:SELinuxGetPropertyContext +R013 SELinux:SELinuxGetPropertyDataContext +R014 SELinux:SELinuxListProperties +R015 SELinux:SELinuxSetSelectionCreateContext +R016 SELinux:SELinuxGetSelectionCreateContext +R017 SELinux:SELinuxSetSelectionUseContext +R018 SELinux:SELinuxGetSelectionUseContext +R019 SELinux:SELinuxGetSelectionContext +R020 SELinux:SELinuxGetSelectionDataContext +R021 SELinux:SELinuxListSelections +R022 SELinux:SELinuxGetClientContext +R000 SHAPE:QueryVersion +R001 SHAPE:Rectangles +R002 SHAPE:Mask +R003 SHAPE:Combine +R004 SHAPE:Offset +R005 SHAPE:QueryExtents +R006 SHAPE:SelectInput +R007 SHAPE:InputSelected +R008 SHAPE:GetRectangles +V000 SHAPE:Notify +R000 SYNC:Initialize +R001 SYNC:ListSystemCounters +R002 SYNC:CreateCounter +R003 SYNC:SetCounter +R004 SYNC:ChangeCounter +R005 SYNC:QueryCounter +R006 SYNC:DestroyCounter +R007 SYNC:Await +R008 SYNC:CreateAlarm +R009 SYNC:ChangeAlarm +R010 SYNC:QueryAlarm +R011 SYNC:DestroyAlarm +R012 SYNC:SetPriority +R013 SYNC:GetPriority +V000 SYNC:CounterNotify +V001 SYNC:AlarmNotify +E000 SYNC:BadCounter +E001 SYNC:BadAlarm +R000 TOG-CUP:QueryVersion +R001 TOG-CUP:GetReservedColormapEntries +R002 TOG-CUP:StoreColors +R000 Windows-WM:QueryVersion +R001 Windows-WM:FrameGetRect +R002 Windows-WM:FrameDraw +R003 Windows-WM:FrameSetTitle +R004 Windows-WM:DisableUpdate +R005 Windows-WM:ReenableUpdate +R006 Windows-WM:SelectInput +R007 Windows-WM:SetFrontProcess +V000 Windows-WM:ControllerNotify +V001 Windows-WM:ActivationNotify +E000 Windows-WM:ClientNotLocal +E001 Windows-WM:OperationNotSupported +R000 X-Resource:QueryVersion +R001 X-Resource:QueryClients +R002 X-Resource:QueryClientResources +R003 X-Resource:QueryClientPixmapBytes +R001 X11:CreateWindow +R002 X11:ChangeWindowAttributes +R003 X11:GetWindowAttributes +R004 X11:DestroyWindow +R005 X11:DestroySubwindows +R006 X11:ChangeSaveSet +R007 X11:ReparentWindow +R008 X11:MapWindow +R009 X11:MapSubwindows +R010 X11:UnmapWindow +R011 X11:UnmapSubwindows +R012 X11:ConfigureWindow +R013 X11:CirculateWindow +R014 X11:GetGeometry +R015 X11:QueryTree +R016 X11:InternAtom +R017 X11:GetAtomName +R018 X11:ChangeProperty +R019 X11:DeleteProperty +R020 X11:GetProperty +R021 X11:ListProperties +R022 X11:SetSelectionOwner +R023 X11:GetSelectionOwner +R024 X11:ConvertSelection +R025 X11:SendEvent +R026 X11:GrabPointer +R027 X11:UngrabPointer +R028 X11:GrabButton +R029 X11:UngrabButton +R030 X11:ChangeActivePointerGrab +R031 X11:GrabKeyboard +R032 X11:UngrabKeyboard +R033 X11:GrabKey +R034 X11:UngrabKey +R035 X11:AllowEvents +R036 X11:GrabServer +R037 X11:UngrabServer +R038 X11:QueryPointer +R039 X11:GetMotionEvents +R040 X11:TranslateCoords +R041 X11:WarpPointer +R042 X11:SetInputFocus +R043 X11:GetInputFocus +R044 X11:QueryKeymap +R045 X11:OpenFont +R046 X11:CloseFont +R047 X11:QueryFont +R048 X11:QueryTextExtents +R049 X11:ListFonts +R050 X11:ListFontsWithInfo +R051 X11:SetFontPath +R052 X11:GetFontPath +R053 X11:CreatePixmap +R054 X11:FreePixmap +R055 X11:CreateGC +R056 X11:ChangeGC +R057 X11:CopyGC +R058 X11:SetDashes +R059 X11:SetClipRectangles +R060 X11:FreeGC +R061 X11:ClearArea +R062 X11:CopyArea +R063 X11:CopyPlane +R064 X11:PolyPoint +R065 X11:PolyLine +R066 X11:PolySegment +R067 X11:PolyRectangle +R068 X11:PolyArc +R069 X11:FillPoly +R070 X11:PolyFillRectangle +R071 X11:PolyFillArc +R072 X11:PutImage +R073 X11:GetImage +R074 X11:PolyText8 +R075 X11:PolyText16 +R076 X11:ImageText8 +R077 X11:ImageText16 +R078 X11:CreateColormap +R079 X11:FreeColormap +R080 X11:CopyColormapAndFree +R081 X11:InstallColormap +R082 X11:UninstallColormap +R083 X11:ListInstalledColormaps +R084 X11:AllocColor +R085 X11:AllocNamedColor +R086 X11:AllocColorCells +R087 X11:AllocColorPlanes +R088 X11:FreeColors +R089 X11:StoreColors +R090 X11:StoreNamedColor +R091 X11:QueryColors +R092 X11:LookupColor +R093 X11:CreateCursor +R094 X11:CreateGlyphCursor +R095 X11:FreeCursor +R096 X11:RecolorCursor +R097 X11:QueryBestSize +R098 X11:QueryExtension +R099 X11:ListExtensions +R100 X11:ChangeKeyboardMapping +R101 X11:GetKeyboardMapping +R102 X11:ChangeKeyboardControl +R103 X11:GetKeyboardControl +R104 X11:Bell +R105 X11:ChangePointerControl +R106 X11:GetPointerControl +R107 X11:SetScreenSaver +R108 X11:GetScreenSaver +R109 X11:ChangeHosts +R110 X11:ListHosts +R111 X11:SetAccessControl +R112 X11:SetCloseDownMode +R113 X11:KillClient +R114 X11:RotateProperties +R115 X11:ForceScreenSaver +R116 X11:SetPointerMapping +R117 X11:GetPointerMapping +R118 X11:SetModifierMapping +R119 X11:GetModifierMapping +R127 X11:NoOperation +V000 X11:X_Error +V001 X11:X_Reply +V002 X11:KeyPress +V003 X11:KeyRelease +V004 X11:ButtonPress +V005 X11:ButtonRelease +V006 X11:MotionNotify +V007 X11:EnterNotify +V008 X11:LeaveNotify +V009 X11:FocusIn +V010 X11:FocusOut +V011 X11:KeymapNotify +V012 X11:Expose +V013 X11:GraphicsExpose +V014 X11:NoExpose +V015 X11:VisibilityNotify +V016 X11:CreateNotify +V017 X11:DestroyNotify +V018 X11:UnmapNotify +V019 X11:MapNotify +V020 X11:MapRequest +V021 X11:ReparentNotify +V022 X11:ConfigureNotify +V023 X11:ConfigureRequest +V024 X11:GravityNotify +V025 X11:ResizeRequest +V026 X11:CirculateNotify +V027 X11:CirculateRequest +V028 X11:PropertyNotify +V029 X11:SelectionClear +V030 X11:SelectionRequest +V031 X11:SelectionNotify +V032 X11:ColormapNotify +V033 X11:ClientMessage +V034 X11:MappingNotify +E000 X11:Success +E001 X11:BadRequest +E002 X11:BadValue +E003 X11:BadWindow +E004 X11:BadPixmap +E005 X11:BadAtom +E006 X11:BadCursor +E007 X11:BadFont +E008 X11:BadMatch +E009 X11:BadDrawable +E010 X11:BadAccess +E011 X11:BadAlloc +E012 X11:BadColor +E013 X11:BadGC +E014 X11:BadIDChoice +E015 X11:BadName +E016 X11:BadLength +E017 X11:BadImplementation +R001 X3D-PEX:GetExtensionInfo +R002 X3D-PEX:GetEnumeratedTypeInfo +R003 X3D-PEX:GetImpDepConstants +R004 X3D-PEX:CreateLookupTable +R005 X3D-PEX:CopyLookupTable +R006 X3D-PEX:FreeLookupTable +R007 X3D-PEX:GetTableInfo +R008 X3D-PEX:GetPredefinedEntries +R009 X3D-PEX:GetDefinedIndices +R010 X3D-PEX:GetTableEntry +R011 X3D-PEX:GetTableEntries +R012 X3D-PEX:SetTableEntries +R013 X3D-PEX:DeleteTableEntries +R014 X3D-PEX:CreatePipelineContext +R015 X3D-PEX:CopyPipelineContext +R016 X3D-PEX:FreePipelineContext +R017 X3D-PEX:GetPipelineContext +R018 X3D-PEX:ChangePipelineContext +R019 X3D-PEX:CreateRenderer +R020 X3D-PEX:FreeRenderer +R021 X3D-PEX:ChangeRenderer +R022 X3D-PEX:GetRendererAttributes +R023 X3D-PEX:GetRendererDynamics +R024 X3D-PEX:BeginRendering +R025 X3D-PEX:EndRendering +R026 X3D-PEX:BeginStructure +R027 X3D-PEX:EndStructure +R028 X3D-PEX:OutputCommands +R029 X3D-PEX:Network +R030 X3D-PEX:CreateStructure +R031 X3D-PEX:CopyStructure +R032 X3D-PEX:DestroyStructures +R033 X3D-PEX:GetStructureInfo +R034 X3D-PEX:GetElementInfo +R035 X3D-PEX:GetStructuresInNetwork +R036 X3D-PEX:GetAncestors +R037 X3D-PEX:GetDescendants +R038 X3D-PEX:FetchElements +R039 X3D-PEX:SetEditingMode +R040 X3D-PEX:SetElementPointer +R041 X3D-PEX:SetElementPointerAtLabel +R042 X3D-PEX:ElementSearch +R043 X3D-PEX:StoreElements +R044 X3D-PEX:DeleteElements +R045 X3D-PEX:DeleteElementsToLabel +R046 X3D-PEX:DeleteBetweenLabels +R047 X3D-PEX:CopyElements +R048 X3D-PEX:ChangeStructureRefs +R049 X3D-PEX:CreateNameSet +R050 X3D-PEX:CopyNameSet +R051 X3D-PEX:FreeNameSet +R052 X3D-PEX:GetNameSet +R053 X3D-PEX:ChangeNameSet +R054 X3D-PEX:CreateSearchContext +R055 X3D-PEX:CopySearchContext +R056 X3D-PEX:FreeSearchContext +R057 X3D-PEX:GetSearchContext +R058 X3D-PEX:ChangeSearchContext +R059 X3D-PEX:SearchNetwork +R060 X3D-PEX:CreatePhigsWks +R061 X3D-PEX:FreePhigsWks +R062 X3D-PEX:GetWksInfo +R063 X3D-PEX:GetDynamics +R064 X3D-PEX:GetViewRep +R065 X3D-PEX:RedrawAllStructures +R066 X3D-PEX:UpdateWorkstation +R067 X3D-PEX:RedrawClipRegion +R068 X3D-PEX:ExecuteDeferredActions +R069 X3D-PEX:SetViewPriority +R070 X3D-PEX:SetDisplayUpdateMode +R071 X3D-PEX:MapDCtoWC +R072 X3D-PEX:MapWCtoDC +R073 X3D-PEX:SetViewRep +R074 X3D-PEX:SetWksWindow +R075 X3D-PEX:SetWksViewport +R076 X3D-PEX:SetHlhsrMode +R077 X3D-PEX:SetWksBufferMode +R078 X3D-PEX:PostStructure +R079 X3D-PEX:UnpostStructure +R080 X3D-PEX:UnpostAllStructures +R081 X3D-PEX:GetWksPostings +R082 X3D-PEX:GetPickDevice +R083 X3D-PEX:ChangePickDevice +R084 X3D-PEX:CreatePickMeasure +R085 X3D-PEX:FreePickMeasure +R086 X3D-PEX:GetPickMeasure +R087 X3D-PEX:UpdatePickMeasure +R088 X3D-PEX:OpenFont +R089 X3D-PEX:CloseFont +R090 X3D-PEX:QueryFont +R091 X3D-PEX:ListFonts +R092 X3D-PEX:ListFontsWithInfo +R093 X3D-PEX:QueryTextExtents +R094 X3D-PEX:MatchRenderingTargets +R095 X3D-PEX:Escape +R096 X3D-PEX:EscapeWithReply +R097 X3D-PEX:Elements +R098 X3D-PEX:AccumulateState +R099 X3D-PEX:BeginPickOne +R100 X3D-PEX:EndPickOne +R101 X3D-PEX:PickOne +R102 X3D-PEX:BeginPickAll +R103 X3D-PEX:EndPickAll +R104 X3D-PEX:PickAll +E000 X3D-PEX:ColorTypeError +E001 X3D-PEX:erStateError +E002 X3D-PEX:FloatingPointFormatError +E003 X3D-PEX:LabelError +E004 X3D-PEX:LookupTableError +E005 X3D-PEX:NameSetError +E006 X3D-PEX:PathError +E007 X3D-PEX:FontError +E008 X3D-PEX:PhigsWksError +E009 X3D-PEX:PickMeasureError +E010 X3D-PEX:PipelineContextError +E011 X3D-PEX:erError +E012 X3D-PEX:SearchContextError +E013 X3D-PEX:StructureError +E014 X3D-PEX:OutputCommandError +R000 XC-APPGROUP:QueryVersion +R001 XC-APPGROUP:Create +R002 XC-APPGROUP:Destroy +R003 XC-APPGROUP:GetAttr +R004 XC-APPGROUP:Query +R005 XC-APPGROUP:CreateAssoc +R006 XC-APPGROUP:DestroyAssoc +E000 XC-APPGROUP:BadAppGroup +R000 XC-MISC:GetVersion +R001 XC-MISC:GetXIDRange +R002 XC-MISC:GetXIDList +R000 XEVIE:QueryVersion +R001 XEVIE:Start +R002 XEVIE:End +R003 XEVIE:Send +R004 XEVIE:SelectInput +R000 XFIXES:QueryVersion +R001 XFIXES:ChangeSaveSet +R002 XFIXES:SelectSelectionInput +R003 XFIXES:SelectCursorInput +R004 XFIXES:GetCursorImage +R005 XFIXES:CreateRegion +R006 XFIXES:CreateRegionFromBitmap +R007 XFIXES:CreateRegionFromWindow +R008 XFIXES:CreateRegionFromGC +R009 XFIXES:CreateRegionFromPicture +R010 XFIXES:DestroyRegion +R011 XFIXES:SetRegion +R012 XFIXES:CopyRegion +R013 XFIXES:UnionRegion +R014 XFIXES:IntersectRegion +R015 XFIXES:SubtractRegion +R016 XFIXES:InvertRegion +R017 XFIXES:TranslateRegion +R018 XFIXES:RegionExtents +R019 XFIXES:FetchRegion +R020 XFIXES:SetGCClipRegion +R021 XFIXES:SetWindowShapeRegion +R022 XFIXES:SetPictureClipRegion +R023 XFIXES:SetCursorName +R024 XFIXES:GetCursorName +R025 XFIXES:GetCursorImageAndName +R026 XFIXES:ChangeCursor +R027 XFIXES:ChangeCursorByName +R028 XFIXES:ExpandRegion +R029 XFIXES:HideCursor +R030 XFIXES:ShowCursor +V000 XFIXES:SelectionNotify +V001 XFIXES:CursorNotify +E000 XFIXES:BadRegion +R000 XFree86-Bigfont:QueryVersion +R001 XFree86-Bigfont:QueryFont +R000 XFree86-DGA:QueryVersion +R001 XFree86-DGA:GetVideoLL +R002 XFree86-DGA:DirectVideo +R003 XFree86-DGA:GetViewPortSize +R004 XFree86-DGA:SetViewPort +R005 XFree86-DGA:GetVidPage +R006 XFree86-DGA:SetVidPage +R007 XFree86-DGA:InstallColormap +R008 XFree86-DGA:QueryDirectVideo +R009 XFree86-DGA:ViewPortChanged +R010 XFree86-DGA:Obsolete1 +R011 XFree86-DGA:Obsolete2 +R012 XFree86-DGA:QueryModes +R013 XFree86-DGA:SetMode +R014 XFree86-DGA:SetViewport +R015 XFree86-DGA:InstallColormap +R016 XFree86-DGA:SelectInput +R017 XFree86-DGA:FillRectangle +R018 XFree86-DGA:CopyArea +R019 XFree86-DGA:CopyTransparentArea +R020 XFree86-DGA:GetViewportStatus +R021 XFree86-DGA:Sync +R022 XFree86-DGA:OpenFramebuffer +R023 XFree86-DGA:CloseFramebuffer +R024 XFree86-DGA:SetClientVersion +R025 XFree86-DGA:ChangePixmapMode +R026 XFree86-DGA:CreateColormap +E000 XFree86-DGA:ClientNotLocal +E001 XFree86-DGA:NoDirectVideoMode +E002 XFree86-DGA:ScreenNotActive +E003 XFree86-DGA:DirectNotActivated +E004 XFree86-DGA:OperationNotSupported +R000 XFree86-DRI:QueryVersion +R001 XFree86-DRI:QueryDirectRenderingCapable +R002 XFree86-DRI:OpenConnection +R003 XFree86-DRI:CloseConnection +R004 XFree86-DRI:GetClientDriverName +R005 XFree86-DRI:CreateContext +R006 XFree86-DRI:DestroyContext +R007 XFree86-DRI:CreateDrawable +R008 XFree86-DRI:DestroyDrawable +R009 XFree86-DRI:GetDrawableInfo +R010 XFree86-DRI:GetDeviceInfo +R011 XFree86-DRI:AuthConnection +R012 XFree86-DRI:OpenFullScreen +R013 XFree86-DRI:CloseFullScreen +E000 XFree86-DRI:ClientNotLocal +E001 XFree86-DRI:OperationNotSupported +R000 XFree86-Misc:QueryVersion +R001 XFree86-Misc:GetSaver +R002 XFree86-Misc:SetSaver +R003 XFree86-Misc:GetMouseSettings +R004 XFree86-Misc:GetKbdSettings +R005 XFree86-Misc:SetMouseSettings +R006 XFree86-Misc:SetKbdSettings +R007 XFree86-Misc:SetGrabKeysState +R008 XFree86-Misc:SetClientVersion +R009 XFree86-Misc:GetFilePaths +R010 XFree86-Misc:PassMessage +E000 XFree86-Misc:BadMouseProtocol +E001 XFree86-Misc:BadMouseBaudRate +E002 XFree86-Misc:BadMouseFlags +E003 XFree86-Misc:BadMouseCombo +E004 XFree86-Misc:BadKbdType +E005 XFree86-Misc:ModInDevDisabled +E006 XFree86-Misc:ModInDevClientNotLocal +E007 XFree86-Misc:NoModule +R000 XFree86-VidModeExtension:QueryVersion +R001 XFree86-VidModeExtension:GetModeLine +R002 XFree86-VidModeExtension:ModModeLine +R003 XFree86-VidModeExtension:SwitchMode +R004 XFree86-VidModeExtension:GetMonitor +R005 XFree86-VidModeExtension:LockModeSwitch +R006 XFree86-VidModeExtension:GetAllModeLines +R007 XFree86-VidModeExtension:AddModeLine +R008 XFree86-VidModeExtension:DeleteModeLine +R009 XFree86-VidModeExtension:ValidateModeLine +R010 XFree86-VidModeExtension:SwitchToMode +R011 XFree86-VidModeExtension:GetViewPort +R012 XFree86-VidModeExtension:SetViewPort +R013 XFree86-VidModeExtension:GetDotClocks +R014 XFree86-VidModeExtension:SetClientVersion +R015 XFree86-VidModeExtension:SetGamma +R016 XFree86-VidModeExtension:GetGamma +R017 XFree86-VidModeExtension:GetGammaRamp +R018 XFree86-VidModeExtension:SetGammaRamp +R019 XFree86-VidModeExtension:GetGammaRampSize +R020 XFree86-VidModeExtension:GetPermissions +V000 XFree86-VidModeExtension:Notify +E000 XFree86-VidModeExtension:BadClock +E001 XFree86-VidModeExtension:BadHTimings +E002 XFree86-VidModeExtension:BadVTimings +E003 XFree86-VidModeExtension:ModeUnsuitable +E004 XFree86-VidModeExtension:ExtensionDisabled +E005 XFree86-VidModeExtension:ClientNotLocal +E006 XFree86-VidModeExtension:ZoomLocked +R001 XIE:QueryImageExtension +R002 XIE:QueryTechniques +R003 XIE:CreateColorList +R004 XIE:DestroyColorList +R005 XIE:PurgeColorList +R006 XIE:QueryColorList +R007 XIE:CreateLUT +R008 XIE:DestroyLUT +R009 XIE:CreatePhotomap +R010 XIE:DestroyPhotomap +R011 XIE:QueryPhotomap +R012 XIE:CreateROI +R013 XIE:DestroyROI +R014 XIE:CreatePhotospace +R015 XIE:DestroyPhotospace +R016 XIE:ExecuteImmediate +R017 XIE:CreatePhotoflo +R018 XIE:DestroyPhotoflo +R019 XIE:ExecutePhotoflo +R020 XIE:ModifyPhotoflo +R021 XIE:RedefinePhotoflo +R022 XIE:PutClientData +R023 XIE:GetClientData +R024 XIE:QueryPhotoflo +R025 XIE:Await +R026 XIE:Abort +E000 XIE:ColorListError +E001 XIE:LUTError +E002 XIE:PhotofloError +E003 XIE:PhotomapError +E004 XIE:PhotospaceError +E005 XIE:ROIError +E006 XIE:FloError +R000 XINERAMA:QueryVersion +R001 XINERAMA:GetState +R002 XINERAMA:GetScreenCount +R003 XINERAMA:GetScreenSize +R004 XINERAMA:IsActive +R005 XINERAMA:QueryScreens +R001 XInputExtension:GetExtensionVersion +R002 XInputExtension:ListInputDevices +R003 XInputExtension:OpenDevice +R004 XInputExtension:CloseDevice +R005 XInputExtension:SetDeviceMode +R006 XInputExtension:SelectExtensionEvent +R007 XInputExtension:GetSelectedExtensionEvents +R008 XInputExtension:ChangeDeviceDontPropagateList +R009 XInputExtension:GetDeviceDontPropagageList +R010 XInputExtension:GetDeviceMotionEvents +R011 XInputExtension:ChangeKeyboardDevice +R012 XInputExtension:ChangePointerDevice +R013 XInputExtension:GrabDevice +R014 XInputExtension:UngrabDevice +R015 XInputExtension:GrabDeviceKey +R016 XInputExtension:UngrabDeviceKey +R017 XInputExtension:GrabDeviceButton +R018 XInputExtension:UngrabDeviceButton +R019 XInputExtension:AllowDeviceEvents +R020 XInputExtension:GetDeviceFocus +R021 XInputExtension:SetDeviceFocus +R022 XInputExtension:GetFeedbackControl +R023 XInputExtension:ChangeFeedbackControl +R024 XInputExtension:GetDeviceKeyMapping +R025 XInputExtension:ChangeDeviceKeyMapping +R026 XInputExtension:GetDeviceModifierMapping +R027 XInputExtension:SetDeviceModifierMapping +R028 XInputExtension:GetDeviceButtonMapping +R029 XInputExtension:SetDeviceButtonMapping +R030 XInputExtension:QueryDeviceState +R031 XInputExtension:SendExtensionEvent +R032 XInputExtension:DeviceBell +R033 XInputExtension:SetDeviceValuators +R034 XInputExtension:GetDeviceControl +R035 XInputExtension:ChangeDeviceControl +V000 XInputExtension:DeviceValuator +V001 XInputExtension:DeviceKeyPress +V002 XInputExtension:DeviceKeyRelease +V003 XInputExtension:DeviceButtonPress +V004 XInputExtension:DeviceButtonRelease +V005 XInputExtension:DeviceMotionNotify +V006 XInputExtension:DeviceFocusIn +V007 XInputExtension:DeviceFocusOut +V008 XInputExtension:ProximityIn +V009 XInputExtension:ProximityOut +V010 XInputExtension:DeviceStateNotify +V011 XInputExtension:DeviceMappingNotify +V012 XInputExtension:ChangeDeviceNotify +V013 XInputExtension:DeviceKeystateNotify +V014 XInputExtension:DeviceButtonstateNotify +V015 XInputExtension:DevicePresenceNotify +E000 XInputExtension:BadDevice +E001 XInputExtension:BadEvent +E002 XInputExtension:BadMode +E003 XInputExtension:DeviceBusy +E004 XInputExtension:BadClass +R000 XKEYBOARD:UseExtension +R001 XKEYBOARD:SelectEvents +R002 XKEYBOARD:Obsolete +R003 XKEYBOARD:Bell +R004 XKEYBOARD:GetState +R005 XKEYBOARD:LatchLockState +R006 XKEYBOARD:GetControls +R007 XKEYBOARD:SetControls +R008 XKEYBOARD:GetMap +R009 XKEYBOARD:SetMap +R010 XKEYBOARD:GetCompatMap +R011 XKEYBOARD:SetCompatMap +R012 XKEYBOARD:GetIndicatorState +R013 XKEYBOARD:GetIndicatorMap +R014 XKEYBOARD:SetIndicatorMap +R015 XKEYBOARD:GetNamedIndicator +R016 XKEYBOARD:SetNamedIndicator +R017 XKEYBOARD:GetNames +R018 XKEYBOARD:SetNames +R019 XKEYBOARD:GetGeometry +R020 XKEYBOARD:SetGeometry +R021 XKEYBOARD:PerClientFlags +R022 XKEYBOARD:ListComponents +R023 XKEYBOARD:GetKbdByName +R024 XKEYBOARD:GetDeviceInfo +R025 XKEYBOARD:SetDeviceInfo +R101 XKEYBOARD:SetDebuggingFlags +V000 XKEYBOARD:EventCode +E000 XKEYBOARD:BadKeyboard +R000 XTEST:GetVersion +R001 XTEST:CompareCursor +R002 XTEST:FakeInput +R003 XTEST:GrabControl +R000 XVideo:QueryExtension +R001 XVideo:QueryAdaptors +R002 XVideo:QueryEncodings +R003 XVideo:GrabPort +R004 XVideo:UngrabPort +R005 XVideo:PutVideo +R006 XVideo:PutStill +R007 XVideo:GetVideo +R008 XVideo:GetStill +R009 XVideo:StopVideo +R010 XVideo:SelectVideoNotify +R011 XVideo:SelectPortNotify +R012 XVideo:QueryBestSize +R013 XVideo:SetPortAttribute +R014 XVideo:GetPortAttribute +R015 XVideo:QueryPortAttributes +R016 XVideo:ListImageFormats +R017 XVideo:QueryImageAttributes +R018 XVideo:PutImage +R019 XVideo:ShmPutImage +V000 XVideo:VideoNotify +V001 XVideo:PortNotify +E000 XVideo:BadPort +E001 XVideo:BadEncoding +E002 XVideo:BadControl +R000 XVideo-MotionCompensation:QueryVersion +R001 XVideo-MotionCompensation:ListSurfaceTypes +R002 XVideo-MotionCompensation:CreateContext +R003 XVideo-MotionCompensation:DestroyContext +R004 XVideo-MotionCompensation:CreateSurface +R005 XVideo-MotionCompensation:DestroySurface +R006 XVideo-MotionCompensation:CreateSubpicture +R007 XVideo-MotionCompensation:DestroySubpicture +R008 XVideo-MotionCompensation:ListSubpictureTypes +R009 XVideo-MotionCompensation:GetDRInfo +E000 XVideo-MotionCompensation:BadContext +E001 XVideo-MotionCompensation:BadSurface +E002 XVideo-MotionCompensation:BadSubpicture +R000 XpExtension:QueryVersion +R001 XpExtension:GetPrinterList +R002 XpExtension:CreateContext +R003 XpExtension:SetContext +R004 XpExtension:GetContext +R005 XpExtension:DestroyContext +R006 XpExtension:GetContextScreen +R007 XpExtension:StartJob +R008 XpExtension:EndJob +R009 XpExtension:StartDoc +R010 XpExtension:EndDoc +R011 XpExtension:PutDocumentData +R012 XpExtension:GetDocumentData +R013 XpExtension:StartPage +R014 XpExtension:EndPage +R015 XpExtension:SelectInput +R016 XpExtension:InputSelected +R017 XpExtension:GetAttributes +R018 XpExtension:SetAttributes +R019 XpExtension:GetOneAttribute +R020 XpExtension:RehashPrinterList +R021 XpExtension:GetPageDimensions +R022 XpExtension:QueryScreens +R023 XpExtension:SetImageResolution +R024 XpExtension:GetImageResolution +V000 XpExtension:PrintNotify +V001 XpExtension:AttributeNotify +E000 XpExtension:BadContext +E001 XpExtension:BadSequence +E002 XpExtension:BadResourceID diff --git a/xorg-server/dix/registry.c b/xorg-server/dix/registry.c new file mode 100644 index 000000000..a519cff6b --- /dev/null +++ b/xorg-server/dix/registry.c @@ -0,0 +1,336 @@ +/************************************************************ + +Author: Eamon Walsh + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +this permission notice appear in supporting documentation. This permission +notice shall be included in all copies or substantial portions of the +Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +********************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#ifdef XREGISTRY + +#include +#include +#include +#include +#include "resource.h" +#include "registry.h" + +#define BASE_SIZE 16 +#define CORE "X11" +#define FILENAME SERVER_MISC_CONFIG_PATH "/protocol.txt" + +#define PROT_COMMENT '#' +#define PROT_REQUEST 'R' +#define PROT_EVENT 'V' +#define PROT_ERROR 'E' + +static FILE *fh; + +static char ***requests, **events, **errors, **resources; +static unsigned nmajor, *nminor, nevent, nerror, nresource; + +/* + * File parsing routines + */ +static int double_size(void *p, unsigned n, unsigned size) +{ + char **ptr = (char **)p; + unsigned s, f; + + if (n) { + s = n * size; + n *= 2 * size; + f = n; + } else { + s = 0; + n = f = BASE_SIZE * size; + } + + *ptr = xrealloc(*ptr, n); + if (!*ptr) { + dixResetRegistry(); + return FALSE; + } + memset(*ptr + s, 0, f - s); + return TRUE; +} + +static void +RegisterRequestName(unsigned major, unsigned minor, char *name) +{ + while (major >= nmajor) { + if (!double_size(&requests, nmajor, sizeof(char **))) + return; + if (!double_size(&nminor, nmajor, sizeof(unsigned))) + return; + nmajor = nmajor ? nmajor * 2 : BASE_SIZE; + } + while (minor >= nminor[major]) { + if (!double_size(requests+major, nminor[major], sizeof(char *))) + return; + nminor[major] = nminor[major] ? nminor[major] * 2 : BASE_SIZE; + } + + free(requests[major][minor]); + requests[major][minor] = name; +} + +static void +RegisterEventName(unsigned event, char *name) { + while (event >= nevent) { + if (!double_size(&events, nevent, sizeof(char *))) + return; + nevent = nevent ? nevent * 2 : BASE_SIZE; + } + + free(events[event]); + events[event] = name; +} + +static void +RegisterErrorName(unsigned error, char *name) { + while (error >= nerror) { + if (!double_size(&errors, nerror, sizeof(char *))) + return; + nerror = nerror ? nerror * 2 : BASE_SIZE; + } + + free(errors[error]); + errors[error] = name; +} + +void +RegisterExtensionNames(ExtensionEntry *extEntry) +{ + char buf[256], *lineobj, *ptr; + unsigned offset; + + if (fh == NULL) + return; + + rewind(fh); + + while (fgets(buf, sizeof(buf), fh)) { + lineobj = NULL; + ptr = strchr(buf, '\n'); + if (ptr) + *ptr = 0; + + /* Check for comments or empty lines */ + switch (buf[0]) { + case PROT_REQUEST: + case PROT_EVENT: + case PROT_ERROR: + break; + case PROT_COMMENT: + case '\0': + continue; + default: + goto invalid; + } + + /* Check for space character in the fifth position */ + ptr = strchr(buf, ' '); + if (!ptr || ptr != buf + 4) + goto invalid; + + /* Duplicate the string after the space */ + lineobj = strdup(ptr + 1); + if (!lineobj) + continue; + + /* Check for a colon somewhere on the line */ + ptr = strchr(buf, ':'); + if (!ptr) + goto invalid; + + /* Compare the part before colon with the target extension name */ + *ptr = 0; + if (strcmp(buf + 5, extEntry->name)) + goto skip; + + /* Get the opcode for the request, event, or error */ + offset = strtol(buf + 1, &ptr, 10); + if (offset == 0 && ptr == buf + 1) + goto invalid; + + /* Save the strdup result in the registry */ + switch(buf[0]) { + case PROT_REQUEST: + if (extEntry->base) + RegisterRequestName(extEntry->base, offset, lineobj); + else + RegisterRequestName(offset, 0, lineobj); + continue; + case PROT_EVENT: + RegisterEventName(extEntry->eventBase + offset, lineobj); + continue; + case PROT_ERROR: + RegisterErrorName(extEntry->errorBase + offset, lineobj); + continue; + } + + invalid: + LogMessage(X_WARNING, "Invalid line in " FILENAME ", skipping\n"); + skip: + free(lineobj); + } +} + +/* + * Registration functions + */ + +void +RegisterResourceName(RESTYPE resource, char *name) +{ + resource &= TypeMask; + + while (resource >= nresource) { + if (!double_size(&resources, nresource, sizeof(char *))) + return; + nresource = nresource ? nresource * 2 : BASE_SIZE; + } + + resources[resource] = name; +} + +/* + * Lookup functions + */ + +const char * +LookupRequestName(int major, int minor) +{ + if (major >= nmajor) + return XREGISTRY_UNKNOWN; + if (minor >= nminor[major]) + return XREGISTRY_UNKNOWN; + + return requests[major][minor] ? requests[major][minor] : XREGISTRY_UNKNOWN; +} + +const char * +LookupMajorName(int major) +{ + if (major < 128) { + const char *retval; + + if (major >= nmajor) + return XREGISTRY_UNKNOWN; + if (0 >= nminor[major]) + return XREGISTRY_UNKNOWN; + + retval = requests[major][0]; + return retval ? retval + sizeof(CORE) : XREGISTRY_UNKNOWN; + } else { + ExtensionEntry *extEntry = GetExtensionEntry(major); + return extEntry ? extEntry->name : XREGISTRY_UNKNOWN; + } +} + +const char * +LookupEventName(int event) +{ + event &= 127; + if (event >= nevent) + return XREGISTRY_UNKNOWN; + + return events[event] ? events[event] : XREGISTRY_UNKNOWN; +} + +const char * +LookupErrorName(int error) +{ + if (error >= nerror) + return XREGISTRY_UNKNOWN; + + return errors[error] ? errors[error] : XREGISTRY_UNKNOWN; +} + +const char * +LookupResourceName(RESTYPE resource) +{ + resource &= TypeMask; + if (resource >= nresource) + return XREGISTRY_UNKNOWN; + + return resources[resource] ? resources[resource] : XREGISTRY_UNKNOWN; +} + +/* + * Setup and teardown + */ +void +dixResetRegistry(void) +{ + ExtensionEntry extEntry; + + /* Free all memory */ + while (nmajor--) { + while (nminor[nmajor]) + free(requests[nmajor][--nminor[nmajor]]); + xfree(requests[nmajor]); + } + xfree(requests); + xfree(nminor); + + while (nevent--) + free(events[nevent]); + xfree(events); + + while (nerror--) + free(errors[nerror]); + xfree(errors); + + xfree(resources); + + requests = NULL; + nminor = NULL; + events = NULL; + errors = NULL; + resources = NULL; + + nmajor = nevent = nerror = nresource = 0; + + /* Open the protocol file */ + if (fh) + fclose(fh); + fh = fopen(FILENAME, "r"); + if (!fh) + LogMessage(X_WARNING, "Failed to open protocol names file " FILENAME); + + /* Add built-in resources */ + RegisterResourceName(RT_NONE, "NONE"); + RegisterResourceName(RT_WINDOW, "WINDOW"); + RegisterResourceName(RT_PIXMAP, "PIXMAP"); + RegisterResourceName(RT_GC, "GC"); + RegisterResourceName(RT_FONT, "FONT"); + RegisterResourceName(RT_CURSOR, "CURSOR"); + RegisterResourceName(RT_COLORMAP, "COLORMAP"); + RegisterResourceName(RT_CMAPENTRY, "COLORMAP ENTRY"); + RegisterResourceName(RT_OTHERCLIENT, "OTHER CLIENT"); + RegisterResourceName(RT_PASSIVEGRAB, "PASSIVE GRAB"); + + /* Add the core protocol */ + memset(&extEntry, 0, sizeof(extEntry)); + extEntry.name = CORE; + RegisterExtensionNames(&extEntry); +} + +#endif /* XREGISTRY */ diff --git a/xorg-server/dix/resource.c b/xorg-server/dix/resource.c new file mode 100644 index 000000000..f318de3c0 --- /dev/null +++ b/xorg-server/dix/resource.c @@ -0,0 +1,879 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ +/* The panoramix components contained the following notice */ +/***************************************************************** + +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ +/* XSERVER_DTRACE additions: + * Copyright 2005-2006 Sun Microsystems, Inc. All rights reserved. + * + * Permission is hereby granted, free of charge, to any person obtaining a + * copy of this software and associated documentation files (the + * "Software"), to deal in the Software without restriction, including + * without limitation the rights to use, copy, modify, merge, publish, + * distribute, and/or sell copies of the Software, and to permit persons + * to whom the Software is furnished to do so, provided that the above + * copyright notice(s) and this permission notice appear in all copies of + * the Software and that both the above copyright notice(s) and this + * permission notice appear in supporting documentation. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS + * OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF + * MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT + * OF THIRD PARTY RIGHTS. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR + * HOLDERS INCLUDED IN THIS NOTICE BE LIABLE FOR ANY CLAIM, OR ANY SPECIAL + * INDIRECT OR CONSEQUENTIAL DAMAGES, OR ANY DAMAGES WHATSOEVER RESULTING + * FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, + * NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION + * WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. + * + * Except as contained in this notice, the name of a copyright holder + * shall not be used in advertising or otherwise to promote the sale, use + * or other dealings in this Software without prior written authorization + * of the copyright holder. + */ + +/* Routines to manage various kinds of resources: + * + * CreateNewResourceType, CreateNewResourceClass, InitClientResources, + * FakeClientID, AddResource, FreeResource, FreeClientResources, + * FreeAllResources, LookupIDByType, LookupIDByClass, GetXIDRange + */ + +/* + * A resource ID is a 32 bit quantity, the upper 2 bits of which are + * off-limits for client-visible resources. The next 8 bits are + * used as client ID, and the low 22 bits come from the client. + * A resource ID is "hashed" by extracting and xoring subfields + * (varying with the size of the hash table). + * + * It is sometimes necessary for the server to create an ID that looks + * like it belongs to a client. This ID, however, must not be one + * the client actually can create, or we have the potential for conflict. + * The 31st bit of the ID is reserved for the server's use for this + * purpose. By setting CLIENT_ID(id) to the client, the SERVER_BIT to + * 1, and an otherwise arbitrary ID in the low 22 bits, we can create a + * resource "owned" by the client. + */ + +#define NEED_EVENTS +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "misc.h" +#include "os.h" +#include "resource.h" +#include "dixstruct.h" +#include "opaque.h" +#include "windowstr.h" +#include "dixfont.h" +#include "colormap.h" +#include "inputstr.h" +#include "dixevents.h" +#include "dixgrabs.h" +#include "cursor.h" +#ifdef PANORAMIX +#include "panoramiX.h" +#include "panoramiXsrv.h" +#endif +#include "xace.h" +#include + +#ifdef XSERVER_DTRACE +#include +#include "registry.h" +typedef const char *string; +#include "Xserver-dtrace.h" + +#define TypeNameString(t) LookupResourceName(t) +#endif + +static void RebuildTable( + int /*client*/ +); + +#define SERVER_MINID 32 + +#define INITBUCKETS 64 +#define INITHASHSIZE 6 +#define MAXHASHSIZE 11 + +typedef struct _Resource { + struct _Resource *next; + XID id; + RESTYPE type; + pointer value; +} ResourceRec, *ResourcePtr; +#define NullResource ((ResourcePtr)NULL) + +typedef struct _ClientResource { + ResourcePtr *resources; + int elements; + int buckets; + int hashsize; /* log(2)(buckets) */ + XID fakeID; + XID endFakeID; + XID expectID; +} ClientResourceRec; + +_X_EXPORT RESTYPE lastResourceType; +static RESTYPE lastResourceClass; +_X_EXPORT RESTYPE TypeMask; + +static DeleteType *DeleteFuncs = (DeleteType *)NULL; + +_X_EXPORT CallbackListPtr ResourceStateCallback; + +static _X_INLINE void +CallResourceStateCallback(ResourceState state, ResourceRec *res) +{ + if (ResourceStateCallback) { + ResourceStateInfoRec rsi = { state, res->id, res->type, res->value }; + CallCallbacks(&ResourceStateCallback, &rsi); + } +} + +_X_EXPORT RESTYPE +CreateNewResourceType(DeleteType deleteFunc) +{ + RESTYPE next = lastResourceType + 1; + DeleteType *funcs; + + if (next & lastResourceClass) + return 0; + funcs = (DeleteType *)xrealloc(DeleteFuncs, + (next + 1) * sizeof(DeleteType)); + if (!funcs) + return 0; + if (!dixRegisterPrivateOffset(next, -1)) + return 0; + + lastResourceType = next; + DeleteFuncs = funcs; + DeleteFuncs[next] = deleteFunc; + return next; +} + +_X_EXPORT RESTYPE +CreateNewResourceClass(void) +{ + RESTYPE next = lastResourceClass >> 1; + + if (next & lastResourceType) + return 0; + lastResourceClass = next; + TypeMask = next - 1; + return next; +} + +static ClientResourceRec clientTable[MAXCLIENTS]; + +/***************** + * InitClientResources + * When a new client is created, call this to allocate space + * in resource table + *****************/ + +Bool +InitClientResources(ClientPtr client) +{ + int i, j; + + if (client == serverClient) + { + lastResourceType = RT_LASTPREDEF; + lastResourceClass = RC_LASTPREDEF; + TypeMask = RC_LASTPREDEF - 1; + if (DeleteFuncs) + xfree(DeleteFuncs); + DeleteFuncs = (DeleteType *)xalloc((lastResourceType + 1) * + sizeof(DeleteType)); + if (!DeleteFuncs) + return FALSE; + DeleteFuncs[RT_NONE & TypeMask] = (DeleteType)NoopDDA; + DeleteFuncs[RT_WINDOW & TypeMask] = DeleteWindow; + DeleteFuncs[RT_PIXMAP & TypeMask] = dixDestroyPixmap; + DeleteFuncs[RT_GC & TypeMask] = FreeGC; + DeleteFuncs[RT_FONT & TypeMask] = CloseFont; + DeleteFuncs[RT_CURSOR & TypeMask] = FreeCursor; + DeleteFuncs[RT_COLORMAP & TypeMask] = FreeColormap; + DeleteFuncs[RT_CMAPENTRY & TypeMask] = FreeClientPixels; + DeleteFuncs[RT_OTHERCLIENT & TypeMask] = OtherClientGone; + DeleteFuncs[RT_PASSIVEGRAB & TypeMask] = DeletePassiveGrab; + } + clientTable[i = client->index].resources = + (ResourcePtr *)xalloc(INITBUCKETS*sizeof(ResourcePtr)); + if (!clientTable[i].resources) + return FALSE; + clientTable[i].buckets = INITBUCKETS; + clientTable[i].elements = 0; + clientTable[i].hashsize = INITHASHSIZE; + /* Many IDs allocated from the server client are visible to clients, + * so we don't use the SERVER_BIT for them, but we have to start + * past the magic value constants used in the protocol. For normal + * clients, we can start from zero, with SERVER_BIT set. + */ + clientTable[i].fakeID = client->clientAsMask | + (client->index ? SERVER_BIT : SERVER_MINID); + clientTable[i].endFakeID = (clientTable[i].fakeID | RESOURCE_ID_MASK) + 1; + clientTable[i].expectID = client->clientAsMask; + for (j=0; j>6) ^ (id>>12)))); + case 7: + return ((int)(0x07F & (id ^ (id>>7) ^ (id>>13)))); + case 8: + return ((int)(0x0FF & (id ^ (id>>8) ^ (id>>16)))); + case 9: + return ((int)(0x1FF & (id ^ (id>>9)))); + case 10: + return ((int)(0x3FF & (id ^ (id>>10)))); + case 11: + return ((int)(0x7FF & (id ^ (id>>11)))); + } + return -1; +} + +static XID +AvailableID( + int client, + XID id, + XID maxid, + XID goodid) +{ + ResourcePtr res; + + if ((goodid >= id) && (goodid <= maxid)) + return goodid; + for (; id <= maxid; id++) + { + res = clientTable[client].resources[Hash(client, id)]; + while (res && (res->id != id)) + res = res->next; + if (!res) + return id; + } + return 0; +} + +_X_EXPORT void +GetXIDRange(int client, Bool server, XID *minp, XID *maxp) +{ + XID id, maxid; + ResourcePtr *resp; + ResourcePtr res; + int i; + XID goodid; + + id = (Mask)client << CLIENTOFFSET; + if (server) + id |= client ? SERVER_BIT : SERVER_MINID; + maxid = id | RESOURCE_ID_MASK; + goodid = 0; + for (resp = clientTable[client].resources, i = clientTable[client].buckets; + --i >= 0;) + { + for (res = *resp++; res; res = res->next) + { + if ((res->id < id) || (res->id > maxid)) + continue; + if (((res->id - id) >= (maxid - res->id)) ? + (goodid = AvailableID(client, id, res->id - 1, goodid)) : + !(goodid = AvailableID(client, res->id + 1, maxid, goodid))) + maxid = res->id - 1; + else + id = res->id + 1; + } + } + if (id > maxid) + id = maxid = 0; + *minp = id; + *maxp = maxid; +} + +/** + * GetXIDList is called by the XC-MISC extension's MiscGetXIDList function. + * This function tries to find count unused XIDs for the given client. It + * puts the IDs in the array pids and returns the number found, which should + * almost always be the number requested. + * + * The circumstances that lead to a call to this function are very rare. + * Xlib must run out of IDs while trying to generate a request that wants + * multiple ID's, like the Multi-buffering CreateImageBuffers request. + * + * No rocket science in the implementation; just iterate over all + * possible IDs for the given client and pick the first count IDs + * that aren't in use. A more efficient algorithm could probably be + * invented, but this will be used so rarely that this should suffice. + */ + +_X_EXPORT unsigned int +GetXIDList(ClientPtr pClient, unsigned count, XID *pids) +{ + unsigned int found = 0; + XID id = pClient->clientAsMask; + XID maxid; + + maxid = id | RESOURCE_ID_MASK; + while ( (found < count) && (id <= maxid) ) + { + if (!LookupIDByClass(id, RC_ANY)) + { + pids[found++] = id; + } + id++; + } + return found; +} + +/* + * Return the next usable fake client ID. + * + * Normally this is just the next one in line, but if we've used the last + * in the range, we need to find a new range of safe IDs to avoid + * over-running another client. + */ + +_X_EXPORT XID +FakeClientID(int client) +{ + XID id, maxid; + + id = clientTable[client].fakeID++; + if (id != clientTable[client].endFakeID) + return id; + GetXIDRange(client, TRUE, &id, &maxid); + if (!id) { + if (!client) + FatalError("FakeClientID: server internal ids exhausted\n"); + MarkClientException(clients[client]); + id = ((Mask)client << CLIENTOFFSET) | (SERVER_BIT * 3); + maxid = id | RESOURCE_ID_MASK; + } + clientTable[client].fakeID = id + 1; + clientTable[client].endFakeID = maxid + 1; + return id; +} + +_X_EXPORT Bool +AddResource(XID id, RESTYPE type, pointer value) +{ + int client; + ClientResourceRec *rrec; + ResourcePtr res, *head; + +#ifdef XSERVER_DTRACE + XSERVER_RESOURCE_ALLOC(id, type, value, TypeNameString(type)); +#endif + client = CLIENT_ID(id); + rrec = &clientTable[client]; + if (!rrec->buckets) + { + ErrorF("AddResource(%lx, %lx, %lx), client=%d \n", + (unsigned long)id, type, (unsigned long)value, client); + FatalError("client not in use\n"); + } + if ((rrec->elements >= 4*rrec->buckets) && + (rrec->hashsize < MAXHASHSIZE)) + RebuildTable(client); + head = &rrec->resources[Hash(client, id)]; + res = (ResourcePtr)xalloc(sizeof(ResourceRec)); + if (!res) + { + (*DeleteFuncs[type & TypeMask])(value, id); + return FALSE; + } + res->next = *head; + res->id = id; + res->type = type; + res->value = value; + *head = res; + rrec->elements++; + if (!(id & SERVER_BIT) && (id >= rrec->expectID)) + rrec->expectID = id + 1; + CallResourceStateCallback(ResourceStateAdding, res); + return TRUE; +} + +static void +RebuildTable(int client) +{ + int j; + ResourcePtr res, next; + ResourcePtr **tails, *resources; + ResourcePtr **tptr, *rptr; + + /* + * For now, preserve insertion order, since some ddx layers depend + * on resources being free in the opposite order they are added. + */ + + j = 2 * clientTable[client].buckets; + tails = (ResourcePtr **)xalloc(j * sizeof(ResourcePtr *)); + if (!tails) + return; + resources = (ResourcePtr *)xalloc(j * sizeof(ResourcePtr)); + if (!resources) + { + xfree(tails); + return; + } + for (rptr = resources, tptr = tails; --j >= 0; rptr++, tptr++) + { + *rptr = NullResource; + *tptr = rptr; + } + clientTable[client].hashsize++; + for (j = clientTable[client].buckets, + rptr = clientTable[client].resources; + --j >= 0; + rptr++) + { + for (res = *rptr; res; res = next) + { + next = res->next; + res->next = NullResource; + tptr = &tails[Hash(client, res->id)]; + **tptr = res; + *tptr = &res->next; + } + } + xfree(tails); + clientTable[client].buckets *= 2; + xfree(clientTable[client].resources); + clientTable[client].resources = resources; +} + +_X_EXPORT void +FreeResource(XID id, RESTYPE skipDeleteFuncType) +{ + int cid; + ResourcePtr res; + ResourcePtr *prev, *head; + int *eltptr; + int elements; + + if (((cid = CLIENT_ID(id)) < MAXCLIENTS) && clientTable[cid].buckets) + { + head = &clientTable[cid].resources[Hash(cid, id)]; + eltptr = &clientTable[cid].elements; + + prev = head; + while ( (res = *prev) ) + { + if (res->id == id) + { + RESTYPE rtype = res->type; + +#ifdef XSERVER_DTRACE + XSERVER_RESOURCE_FREE(res->id, res->type, + res->value, TypeNameString(res->type)); +#endif + *prev = res->next; + elements = --*eltptr; + + CallResourceStateCallback(ResourceStateFreeing, res); + + if (rtype != skipDeleteFuncType) + (*DeleteFuncs[rtype & TypeMask])(res->value, res->id); + xfree(res); + if (*eltptr != elements) + prev = head; /* prev may no longer be valid */ + } + else + prev = &res->next; + } + } +} + + +_X_EXPORT void +FreeResourceByType(XID id, RESTYPE type, Bool skipFree) +{ + int cid; + ResourcePtr res; + ResourcePtr *prev, *head; + if (((cid = CLIENT_ID(id)) < MAXCLIENTS) && clientTable[cid].buckets) + { + head = &clientTable[cid].resources[Hash(cid, id)]; + + prev = head; + while ( (res = *prev) ) + { + if (res->id == id && res->type == type) + { +#ifdef XSERVER_DTRACE + XSERVER_RESOURCE_FREE(res->id, res->type, + res->value, TypeNameString(res->type)); +#endif + *prev = res->next; + + CallResourceStateCallback(ResourceStateFreeing, res); + + if (!skipFree) + (*DeleteFuncs[type & TypeMask])(res->value, res->id); + xfree(res); + break; + } + else + prev = &res->next; + } + } +} + +/* + * Change the value associated with a resource id. Caller + * is responsible for "doing the right thing" with the old + * data + */ + +_X_EXPORT Bool +ChangeResourceValue (XID id, RESTYPE rtype, pointer value) +{ + int cid; + ResourcePtr res; + + if (((cid = CLIENT_ID(id)) < MAXCLIENTS) && clientTable[cid].buckets) + { + res = clientTable[cid].resources[Hash(cid, id)]; + + for (; res; res = res->next) + if ((res->id == id) && (res->type == rtype)) + { + res->value = value; + return TRUE; + } + } + return FALSE; +} + +/* Note: if func adds or deletes resources, then func can get called + * more than once for some resources. If func adds new resources, + * func might or might not get called for them. func cannot both + * add and delete an equal number of resources! + */ + +_X_EXPORT void +FindClientResourcesByType( + ClientPtr client, + RESTYPE type, + FindResType func, + pointer cdata +){ + ResourcePtr *resources; + ResourcePtr this, next; + int i, elements; + int *eltptr; + + if (!client) + client = serverClient; + + resources = clientTable[client->index].resources; + eltptr = &clientTable[client->index].elements; + for (i = 0; i < clientTable[client->index].buckets; i++) + { + for (this = resources[i]; this; this = next) + { + next = this->next; + if (!type || this->type == type) { + elements = *eltptr; + (*func)(this->value, this->id, cdata); + if (*eltptr != elements) + next = resources[i]; /* start over */ + } + } + } +} + +_X_EXPORT void +FindAllClientResources( + ClientPtr client, + FindAllRes func, + pointer cdata +){ + ResourcePtr *resources; + ResourcePtr this, next; + int i, elements; + int *eltptr; + + if (!client) + client = serverClient; + + resources = clientTable[client->index].resources; + eltptr = &clientTable[client->index].elements; + for (i = 0; i < clientTable[client->index].buckets; i++) + { + for (this = resources[i]; this; this = next) + { + next = this->next; + elements = *eltptr; + (*func)(this->value, this->id, this->type, cdata); + if (*eltptr != elements) + next = resources[i]; /* start over */ + } + } +} + + +pointer +LookupClientResourceComplex( + ClientPtr client, + RESTYPE type, + FindComplexResType func, + pointer cdata +){ + ResourcePtr *resources; + ResourcePtr this; + int i; + + if (!client) + client = serverClient; + + resources = clientTable[client->index].resources; + for (i = 0; i < clientTable[client->index].buckets; i++) { + for (this = resources[i]; this; this = this->next) { + if (!type || this->type == type) { + if((*func)(this->value, this->id, cdata)) + return this->value; + } + } + } + return NULL; +} + + +void +FreeClientNeverRetainResources(ClientPtr client) +{ + ResourcePtr *resources; + ResourcePtr this; + ResourcePtr *prev; + int j; + + if (!client) + return; + + resources = clientTable[client->index].resources; + for (j=0; j < clientTable[client->index].buckets; j++) + { + prev = &resources[j]; + while ( (this = *prev) ) + { + RESTYPE rtype = this->type; + if (rtype & RC_NEVERRETAIN) + { +#ifdef XSERVER_DTRACE + XSERVER_RESOURCE_FREE(this->id, this->type, + this->value, TypeNameString(this->type)); +#endif + *prev = this->next; + + CallResourceStateCallback(ResourceStateFreeing, this); + + (*DeleteFuncs[rtype & TypeMask])(this->value, this->id); + xfree(this); + } + else + prev = &this->next; + } + } +} + +void +FreeClientResources(ClientPtr client) +{ + ResourcePtr *resources; + ResourcePtr this; + int j; + + /* This routine shouldn't be called with a null client, but just in + case ... */ + + if (!client) + return; + + HandleSaveSet(client); + + resources = clientTable[client->index].resources; + for (j=0; j < clientTable[client->index].buckets; j++) + { + /* It may seem silly to update the head of this resource list as + we delete the members, since the entire list will be deleted any way, + but there are some resource deletion functions "FreeClientPixels" for + one which do a LookupID on another resource id (a Colormap id in this + case), so the resource list must be kept valid up to the point that + it is deleted, so every time we delete a resource, we must update the + head, just like in FreeResource. I hope that this doesn't slow down + mass deletion appreciably. PRH */ + + ResourcePtr *head; + + head = &resources[j]; + + for (this = *head; this; this = *head) + { + RESTYPE rtype = this->type; +#ifdef XSERVER_DTRACE + XSERVER_RESOURCE_FREE(this->id, this->type, + this->value, TypeNameString(this->type)); +#endif + *head = this->next; + + CallResourceStateCallback(ResourceStateFreeing, this); + + (*DeleteFuncs[rtype & TypeMask])(this->value, this->id); + xfree(this); + } + } + xfree(clientTable[client->index].resources); + clientTable[client->index].resources = NULL; + clientTable[client->index].buckets = 0; +} + +void +FreeAllResources(void) +{ + int i; + + for (i = currentMaxClients; --i >= 0; ) + { + if (clientTable[i].buckets) + FreeClientResources(clients[i]); + } +} + +_X_EXPORT Bool +LegalNewID(XID id, ClientPtr client) +{ + +#ifdef PANORAMIX + XID minid, maxid; + + if (!noPanoramiXExtension) { + minid = client->clientAsMask | (client->index ? + SERVER_BIT : SERVER_MINID); + maxid = (clientTable[client->index].fakeID | RESOURCE_ID_MASK) + 1; + if ((id >= minid) && (id <= maxid)) + return TRUE; + } +#endif /* PANORAMIX */ + return ((client->clientAsMask == (id & ~RESOURCE_ID_MASK)) && + ((clientTable[client->index].expectID <= id) || + !LookupIDByClass(id, RC_ANY))); +} + +_X_EXPORT int +dixLookupResource(pointer *result, XID id, RESTYPE rtype, + ClientPtr client, Mask mode) +{ + int cid = CLIENT_ID(id); + int istype = (rtype & TypeMask) && (rtype != RC_ANY); + ResourcePtr res = NULL; + + *result = NULL; + + if ((cid < MAXCLIENTS) && clientTable[cid].buckets) { + res = clientTable[cid].resources[Hash(cid, id)]; + + for (; res; res = res->next) + if ((res->id == id) && ((istype && res->type == rtype) || + (!istype && res->type & rtype))) + break; + } + if (!res) + return BadValue; + + if (client) { + client->errorValue = id; + cid = XaceHook(XACE_RESOURCE_ACCESS, client, id, res->type, + res->value, RT_NONE, NULL, mode); + if (cid != Success) + return cid; + } + + *result = res->value; + return Success; +} diff --git a/xorg-server/dix/selection.c b/xorg-server/dix/selection.c new file mode 100644 index 000000000..6a9198e96 --- /dev/null +++ b/xorg-server/dix/selection.c @@ -0,0 +1,311 @@ +/************************************************************ + +Copyright 1987, 1989, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987, 1989 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "windowstr.h" +#include "dixstruct.h" +#include "dispatch.h" +#include "selection.h" +#include "xace.h" + +/***************************************************************** + * Selection Stuff + * + * dixLookupSelection + * + * Selections are global to the server. The list of selections should + * not be traversed directly. Instead, use the functions listed above. + * + *****************************************************************/ + +_X_EXPORT Selection *CurrentSelections; +CallbackListPtr SelectionCallback; + +_X_EXPORT int +dixLookupSelection(Selection **result, Atom selectionName, + ClientPtr client, Mask access_mode) +{ + Selection *pSel; + int rc = BadMatch; + client->errorValue = selectionName; + + for (pSel = CurrentSelections; pSel; pSel = pSel->next) + if (pSel->selection == selectionName) + break; + + if (pSel) + rc = XaceHookSelectionAccess(client, &pSel, access_mode); + *result = pSel; + return rc; +} + +void +InitSelections(void) +{ + Selection *pSel, *pNextSel; + + pSel = CurrentSelections; + while (pSel) { + pNextSel = pSel->next; + dixFreePrivates(pSel->devPrivates); + xfree(pSel); + pSel = pNextSel; + } + + CurrentSelections = NULL; +} + +static _X_INLINE void +CallSelectionCallback(Selection *pSel, ClientPtr client, + SelectionCallbackKind kind) +{ + SelectionInfoRec info = { pSel, client, kind }; + CallCallbacks(&SelectionCallback, &info); +} + +void +DeleteWindowFromAnySelections(WindowPtr pWin) +{ + Selection *pSel; + + for (pSel = CurrentSelections; pSel; pSel = pSel->next) + if (pSel->pWin == pWin) { + CallSelectionCallback(pSel, NULL, SelectionWindowDestroy); + + pSel->pWin = (WindowPtr)NULL; + pSel->window = None; + pSel->client = NullClient; + } +} + +void +DeleteClientFromAnySelections(ClientPtr client) +{ + Selection *pSel; + + for (pSel = CurrentSelections; pSel; pSel = pSel->next) + if (pSel->client == client) { + CallSelectionCallback(pSel, NULL, SelectionClientClose); + + pSel->pWin = (WindowPtr)NULL; + pSel->window = None; + pSel->client = NullClient; + } +} + +int +ProcSetSelectionOwner(ClientPtr client) +{ + WindowPtr pWin = NULL; + TimeStamp time; + Selection *pSel; + int rc; + + REQUEST(xSetSelectionOwnerReq); + REQUEST_SIZE_MATCH(xSetSelectionOwnerReq); + + UpdateCurrentTime(); + time = ClientTimeToServerTime(stuff->time); + + /* If the client's time stamp is in the future relative to the server's + time stamp, do not set the selection, just return success. */ + if (CompareTimeStamps(time, currentTime) == LATER) + return Success; + + if (stuff->window != None) { + rc = dixLookupWindow(&pWin, stuff->window, client, DixSetAttrAccess); + if (rc != Success) + return rc; + } + if (!ValidAtom(stuff->selection)) { + client->errorValue = stuff->selection; + return BadAtom; + } + + /* + * First, see if the selection is already set... + */ + rc = dixLookupSelection(&pSel, stuff->selection, client, DixSetAttrAccess); + + if (rc == Success) { + xEvent event; + + /* If the timestamp in client's request is in the past relative + to the time stamp indicating the last time the owner of the + selection was set, do not set the selection, just return + success. */ + if (CompareTimeStamps(time, pSel->lastTimeChanged) == EARLIER) + return Success; + if (pSel->client && (!pWin || (pSel->client != client))) + { + event.u.u.type = SelectionClear; + event.u.selectionClear.time = time.milliseconds; + event.u.selectionClear.window = pSel->window; + event.u.selectionClear.atom = pSel->selection; + TryClientEvents(pSel->client, &event, 1, NoEventMask, + NoEventMask /* CantBeFiltered */, NullGrab); + } + } + else if (rc == BadMatch) + { + /* + * It doesn't exist, so add it... + */ + pSel = xalloc(sizeof(Selection)); + if (!pSel) + return BadAlloc; + + pSel->selection = stuff->selection; + pSel->devPrivates = NULL; + + /* security creation/labeling check */ + rc = XaceHookSelectionAccess(client, &pSel, + DixCreateAccess|DixSetAttrAccess); + if (rc != Success) { + xfree(pSel); + return rc; + } + + pSel->next = CurrentSelections; + CurrentSelections = pSel; + } + else + return rc; + + pSel->lastTimeChanged = time; + pSel->window = stuff->window; + pSel->pWin = pWin; + pSel->client = (pWin ? client : NullClient); + + CallSelectionCallback(pSel, client, SelectionSetOwner); + return client->noClientException; +} + +int +ProcGetSelectionOwner(ClientPtr client) +{ + int rc; + Selection *pSel; + xGetSelectionOwnerReply reply; + + REQUEST(xResourceReq); + REQUEST_SIZE_MATCH(xResourceReq); + + if (!ValidAtom(stuff->id)) { + client->errorValue = stuff->id; + return BadAtom; + } + + reply.type = X_Reply; + reply.length = 0; + reply.sequenceNumber = client->sequence; + + rc = dixLookupSelection(&pSel, stuff->id, client, DixGetAttrAccess); + if (rc == Success) + reply.owner = pSel->window; + else if (rc == BadMatch) + reply.owner = None; + else + return rc; + + WriteReplyToClient(client, sizeof(xGetSelectionOwnerReply), &reply); + return client->noClientException; +} + +int +ProcConvertSelection(ClientPtr client) +{ + Bool paramsOkay; + xEvent event; + WindowPtr pWin; + Selection *pSel; + int rc; + + REQUEST(xConvertSelectionReq); + REQUEST_SIZE_MATCH(xConvertSelectionReq); + + rc = dixLookupWindow(&pWin, stuff->requestor, client, DixSetAttrAccess); + if (rc != Success) + return rc; + + paramsOkay = ValidAtom(stuff->selection) && ValidAtom(stuff->target); + paramsOkay &= (stuff->property == None) || ValidAtom(stuff->property); + if (!paramsOkay) { + client->errorValue = stuff->property; + return BadAtom; + } + + rc = dixLookupSelection(&pSel, stuff->selection, client, DixReadAccess); + + if (rc != Success && rc != BadMatch) + return rc; + else if (rc == Success && pSel->window != None) { + event.u.u.type = SelectionRequest; + event.u.selectionRequest.owner = pSel->window; + event.u.selectionRequest.time = stuff->time; + event.u.selectionRequest.requestor = stuff->requestor; + event.u.selectionRequest.selection = stuff->selection; + event.u.selectionRequest.target = stuff->target; + event.u.selectionRequest.property = stuff->property; + if (TryClientEvents(pSel->client, &event, 1, NoEventMask, + NoEventMask /* CantBeFiltered */, NullGrab)) + return client->noClientException; + } + + event.u.u.type = SelectionNotify; + event.u.selectionNotify.time = stuff->time; + event.u.selectionNotify.requestor = stuff->requestor; + event.u.selectionNotify.selection = stuff->selection; + event.u.selectionNotify.target = stuff->target; + event.u.selectionNotify.property = None; + TryClientEvents(client, &event, 1, NoEventMask, + NoEventMask /* CantBeFiltered */, NullGrab); + return client->noClientException; +} diff --git a/xorg-server/dix/strcasecmp.c b/xorg-server/dix/strcasecmp.c new file mode 100644 index 000000000..ca1051dc1 --- /dev/null +++ b/xorg-server/dix/strcasecmp.c @@ -0,0 +1,70 @@ +/* + * Copyright (c) 1987, 1993 + * The Regents of the University of California. All rights reserved. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 4. Neither the name of the University nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE REGENTS AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include "dix.h" + +#ifdef NEED_STRCASECMP +int +xstrcasecmp(const char *str1, const char *str2) +{ + const u_char *us1 = (const u_char *)str1, *us2 = (const u_char *)str2; + + while (tolower(*us1) == tolower(*us2)) { + if (*us1++ == '\0') + return (0); + us2++; + } + + return (tolower(*us1) - tolower(*us2)); +} +#endif + +#ifdef NEED_STRNCASECMP +int +xstrncasecmp(const char *s1, const char *s2, size_t n) +{ + if (n != 0) { + const u_char *us1 = (const u_char *)s1, *us2 = (const u_char *)s2; + + do { + if (tolower(*us1) != tolower(*us2++)) + return (tolower(*us1) - tolower(*--us2)); + if (*us1++ == '\0') + break; + } while (--n != 0); + } + + return 0; +} +#endif diff --git a/xorg-server/dix/strcasestr.c b/xorg-server/dix/strcasestr.c new file mode 100644 index 000000000..b3d45495c --- /dev/null +++ b/xorg-server/dix/strcasestr.c @@ -0,0 +1,64 @@ +/*- + * Copyright (c) 1990, 1993 + * The Regents of the University of California. All rights reserved. + * + * This code is derived from software contributed to Berkeley by + * Chris Torek. + * + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions + * are met: + * 1. Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * 2. Redistributions in binary form must reproduce the above copyright + * notice, this list of conditions and the following disclaimer in the + * documentation and/or other materials provided with the distribution. + * 4. Neither the name of the University nor the names of its contributors + * may be used to endorse or promote products derived from this software + * without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE REGENTS AND CONTRIBUTORS ``AS IS'' AND + * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE + * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE + * ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE + * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL + * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS + * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) + * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT + * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY + * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF + * SUCH DAMAGE. + */ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#include +#include "dix.h" + +/* + * Find the first occurrence of find in s, ignore case. + */ +#ifdef NEED_STRCASESTR +char * +xstrcasestr(const char *s, const char *find) +{ + char c, sc; + size_t len; + + if ((c = *find++) != 0) { + c = tolower((unsigned char)c); + len = strlen(find); + do { + do { + if ((sc = *s++) == 0) + return (NULL); + } while ((char)tolower((unsigned char)sc) != c); + } while (strncasecmp(s, find, len) != 0); + s--; + } + return ((char *)s); +} +#endif diff --git a/xorg-server/dix/swaprep.c b/xorg-server/dix/swaprep.c new file mode 100644 index 000000000..91469e17b --- /dev/null +++ b/xorg-server/dix/swaprep.c @@ -0,0 +1,1298 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_REPLIES +#define NEED_EVENTS +#include +#include "misc.h" +#include "dixstruct.h" +#include +#include "scrnintstr.h" +#include "swaprep.h" +#include "globals.h" + +static void SwapFontInfo(xQueryFontReply *pr); + +static void SwapCharInfo(xCharInfo *pInfo); + +static void SwapFont(xQueryFontReply *pr, Bool hasGlyphs); + +/** + * Thanks to Jack Palevich for testing and subsequently rewriting all this + * + * \param size size in bytes + */ +_X_EXPORT void +Swap32Write(ClientPtr pClient, int size, CARD32 *pbuf) +{ + int i; + char n; + + size >>= 2; + for(i = 0; i < size; i++) + /* brackets are mandatory here, because "swapl" macro expands + to several statements */ + { + swapl(&pbuf[i], n); + } + (void)WriteToClient(pClient, size << 2, (char *) pbuf); +} + +/** + * + * \param size size in bytes + */ +_X_EXPORT void +CopySwap32Write(ClientPtr pClient, int size, CARD32 *pbuf) +{ + int bufsize = size; + CARD32 *pbufT; + CARD32 *from, *to, *fromLast, *toLast; + CARD32 tmpbuf[1]; + + /* Allocate as big a buffer as we can... */ + while (!(pbufT = (CARD32 *) xalloc(bufsize))) + { + bufsize >>= 1; + if (bufsize == 4) + { + pbufT = tmpbuf; + break; + } + } + + /* convert lengths from # of bytes to # of longs */ + size >>= 2; + bufsize >>= 2; + + from = pbuf; + fromLast = from + size; + while (from < fromLast) { + int nbytes; + to = pbufT; + toLast = to + min (bufsize, fromLast - from); + nbytes = (toLast - to) << 2; + while (to < toLast) { + /* can't write "cpswapl(*from++, *to++)" because cpswapl is a macro + that evaulates its args more than once */ + cpswapl(*from, *to); + from++; + to++; + } + (void)WriteToClient (pClient, nbytes, (char *) pbufT); + } + + if (pbufT != tmpbuf) + xfree ((char *) pbufT); +} + +/** + * + * \param size size in bytes + */ +void +CopySwap16Write(ClientPtr pClient, int size, short *pbuf) +{ + int bufsize = size; + short *pbufT; + short *from, *to, *fromLast, *toLast; + short tmpbuf[2]; + + /* Allocate as big a buffer as we can... */ + while (!(pbufT = (short *) xalloc(bufsize))) + { + bufsize >>= 1; + if (bufsize == 4) + { + pbufT = tmpbuf; + break; + } + } + + /* convert lengths from # of bytes to # of shorts */ + size >>= 1; + bufsize >>= 1; + + from = pbuf; + fromLast = from + size; + while (from < fromLast) { + int nbytes; + to = pbufT; + toLast = to + min (bufsize, fromLast - from); + nbytes = (toLast - to) << 1; + while (to < toLast) { + /* can't write "cpswaps(*from++, *to++)" because cpswaps is a macro + that evaulates its args more than once */ + cpswaps(*from, *to); + from++; + to++; + } + (void)WriteToClient (pClient, nbytes, (char *) pbufT); + } + + if (pbufT != tmpbuf) + xfree ((char *) pbufT); +} + + +/* Extra-small reply */ +void +SGenericReply(ClientPtr pClient, int size, xGenericReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +/* Extra-large reply */ +void +SGetWindowAttributesReply(ClientPtr pClient, int size, + xGetWindowAttributesReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->visualID, n); + swaps(&pRep->class, n); + swapl(&pRep->backingBitPlanes, n); + swapl(&pRep->backingPixel, n); + swapl(&pRep->colormap, n); + swapl(&pRep->allEventMasks, n); + swapl(&pRep->yourEventMask, n); + swaps(&pRep->doNotPropagateMask, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetGeometryReply(ClientPtr pClient, int size, xGetGeometryReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->root, n); + swaps(&pRep->x, n); + swaps(&pRep->y, n); + swaps(&pRep->width, n); + swaps(&pRep->height, n); + swaps(&pRep->borderWidth, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SQueryTreeReply(ClientPtr pClient, int size, xQueryTreeReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->root, n); + swapl(&pRep->parent, n); + swaps(&pRep->nChildren, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SInternAtomReply(ClientPtr pClient, int size, xInternAtomReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->atom, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetAtomNameReply(ClientPtr pClient, int size, xGetAtomNameReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nameLength, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + + +void +SGetPropertyReply(ClientPtr pClient, int size, xGetPropertyReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->propertyType, n); + swapl(&pRep->bytesAfter, n); + swapl(&pRep->nItems, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SListPropertiesReply(ClientPtr pClient, int size, xListPropertiesReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nProperties, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetSelectionOwnerReply(ClientPtr pClient, int size, + xGetSelectionOwnerReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->owner, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + + +void +SQueryPointerReply(ClientPtr pClient, int size, xQueryPointerReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->root, n); + swapl(&pRep->child, n); + swaps(&pRep->rootX, n); + swaps(&pRep->rootY, n); + swaps(&pRep->winX, n); + swaps(&pRep->winY, n); + swaps(&pRep->mask, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +static void +SwapTimecoord(xTimecoord* pCoord) +{ + char n; + + swapl(&pCoord->time, n); + swaps(&pCoord->x, n); + swaps(&pCoord->y, n); +} + +void +SwapTimeCoordWrite(ClientPtr pClient, int size, xTimecoord *pRep) +{ + int i, n; + xTimecoord *pRepT; + + n = size / sizeof(xTimecoord); + pRepT = pRep; + for(i = 0; i < n; i++) + { + SwapTimecoord(pRepT); + pRepT++; + } + (void)WriteToClient(pClient, size, (char *) pRep); + +} +void +SGetMotionEventsReply(ClientPtr pClient, int size, xGetMotionEventsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->nEvents, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +STranslateCoordsReply(ClientPtr pClient, int size, xTranslateCoordsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->child, n); + swaps(&pRep->dstX, n); + swaps(&pRep->dstY, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetInputFocusReply(ClientPtr pClient, int size, xGetInputFocusReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->focus, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +/* extra long reply */ +void +SQueryKeymapReply(ClientPtr pClient, int size, xQueryKeymapReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +static void +SwapCharInfo(xCharInfo *pInfo) +{ + char n; + + swaps(&pInfo->leftSideBearing, n); + swaps(&pInfo->rightSideBearing, n); + swaps(&pInfo->characterWidth, n); + swaps(&pInfo->ascent, n); + swaps(&pInfo->descent, n); + swaps(&pInfo->attributes, n); +} + +static void +SwapFontInfo(xQueryFontReply *pr) +{ + char n; + + swaps(&pr->minCharOrByte2, n); + swaps(&pr->maxCharOrByte2, n); + swaps(&pr->defaultChar, n); + swaps(&pr->nFontProps, n); + swaps(&pr->fontAscent, n); + swaps(&pr->fontDescent, n); + SwapCharInfo( &pr->minBounds); + SwapCharInfo( &pr->maxBounds); + swapl(&pr->nCharInfos, n); +} + +static void +SwapFont(xQueryFontReply *pr, Bool hasGlyphs) +{ + unsigned i; + xCharInfo * pxci; + unsigned nchars, nprops; + char *pby; + char n; + + swaps(&pr->sequenceNumber, n); + swapl(&pr->length, n); + nchars = pr->nCharInfos; + nprops = pr->nFontProps; + SwapFontInfo(pr); + pby = (char *) &pr[1]; + /* Font properties are an atom and either an int32 or a CARD32, so + * they are always 2 4 byte values */ + for(i = 0; i < nprops; i++) + { + swapl(pby, n); + pby += 4; + swapl(pby, n); + pby += 4; + } + if (hasGlyphs) + { + pxci = (xCharInfo *)pby; + for(i = 0; i< nchars; i++, pxci++) + SwapCharInfo(pxci); + } +} + +void +SQueryFontReply(ClientPtr pClient, int size, xQueryFontReply *pRep) +{ + SwapFont(pRep, TRUE); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SQueryTextExtentsReply(ClientPtr pClient, int size, xQueryTextExtentsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->fontAscent, n); + swaps(&pRep->fontDescent, n); + swaps(&pRep->overallAscent, n); + swaps(&pRep->overallDescent, n); + swapl(&pRep->overallWidth, n); + swapl(&pRep->overallLeft, n); + swapl(&pRep->overallRight, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SListFontsReply(ClientPtr pClient, int size, xListFontsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nFonts, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SListFontsWithInfoReply(ClientPtr pClient, int size, + xListFontsWithInfoReply *pRep) +{ + SwapFont((xQueryFontReply *)pRep, FALSE); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetFontPathReply(ClientPtr pClient, int size, xGetFontPathReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nPaths, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetImageReply(ClientPtr pClient, int size, xGetImageReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->visual, n); + (void)WriteToClient(pClient, size, (char *) pRep); + /* Fortunately, image doesn't need swapping */ +} + +void +SListInstalledColormapsReply(ClientPtr pClient, int size, + xListInstalledColormapsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nColormaps, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SAllocColorReply(pClient, size, pRep) + ClientPtr pClient; + int size; + xAllocColorReply *pRep; +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->red, n); + swaps(&pRep->green, n); + swaps(&pRep->blue, n); + swapl(&pRep->pixel, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SAllocNamedColorReply(ClientPtr pClient, int size, xAllocNamedColorReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->pixel, n); + swaps(&pRep->exactRed, n); + swaps(&pRep->exactGreen, n); + swaps(&pRep->exactBlue, n); + swaps(&pRep->screenRed, n); + swaps(&pRep->screenGreen, n); + swaps(&pRep->screenBlue, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SAllocColorCellsReply(ClientPtr pClient, int size, xAllocColorCellsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nPixels, n); + swaps(&pRep->nMasks, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + + +void +SAllocColorPlanesReply(ClientPtr pClient, int size, xAllocColorPlanesReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nPixels, n); + swapl(&pRep->redMask, n); + swapl(&pRep->greenMask, n); + swapl(&pRep->blueMask, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +static void +SwapRGB(xrgb *prgb) +{ + char n; + + swaps(&prgb->red, n); + swaps(&prgb->green, n); + swaps(&prgb->blue, n); +} + +void +SQColorsExtend(ClientPtr pClient, int size, xrgb *prgb) +{ + int i, n; + xrgb *prgbT; + + n = size / sizeof(xrgb); + prgbT = prgb; + for(i = 0; i < n; i++) + { + SwapRGB(prgbT); + prgbT++; + } + (void)WriteToClient(pClient, size, (char *) prgb); +} + +void +SQueryColorsReply(ClientPtr pClient, int size, xQueryColorsReply* pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nColors, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SLookupColorReply(ClientPtr pClient, int size, xLookupColorReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->exactRed, n); + swaps(&pRep->exactGreen, n); + swaps(&pRep->exactBlue, n); + swaps(&pRep->screenRed, n); + swaps(&pRep->screenGreen, n); + swaps(&pRep->screenBlue, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SQueryBestSizeReply(ClientPtr pClient, int size, xQueryBestSizeReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->width, n); + swaps(&pRep->height, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SListExtensionsReply(ClientPtr pClient, int size, xListExtensionsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetKeyboardMappingReply(ClientPtr pClient, int size, + xGetKeyboardMappingReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetPointerMappingReply(ClientPtr pClient, int size, + xGetPointerMappingReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetModifierMappingReply(ClientPtr pClient, int size, + xGetModifierMappingReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetKeyboardControlReply(ClientPtr pClient, int size, xGetKeyboardControlReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swapl(&pRep->ledMask, n); + swaps(&pRep->bellPitch, n); + swaps(&pRep->bellDuration, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetPointerControlReply(ClientPtr pClient, int size, xGetPointerControlReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->accelNumerator, n); + swaps(&pRep->accelDenominator, n); + swaps(&pRep->threshold, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SGetScreenSaverReply(ClientPtr pClient, int size, xGetScreenSaverReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swaps(&pRep->timeout, n); + swaps(&pRep->interval, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + +void +SLHostsExtend(ClientPtr pClient, int size, char *buf) +{ + char *bufT = buf; + char *endbuf = buf + size; + while (bufT < endbuf) { + xHostEntry *host = (xHostEntry *) bufT; + int len = host->length; + char n; + swaps (&host->length, n); + bufT += sizeof (xHostEntry) + (((len + 3) >> 2) << 2); + } + (void)WriteToClient (pClient, size, buf); +} + +void +SListHostsReply(ClientPtr pClient, int size, xListHostsReply *pRep) +{ + char n; + + swaps(&pRep->sequenceNumber, n); + swapl(&pRep->length, n); + swaps(&pRep->nHosts, n); + (void)WriteToClient(pClient, size, (char *) pRep); +} + + + +void +SErrorEvent(xError *from, xError *to) +{ + to->type = X_Error; + to->errorCode = from->errorCode; + cpswaps(from->sequenceNumber, to->sequenceNumber); + cpswapl(from->resourceID, to->resourceID); + cpswaps(from->minorCode, to->minorCode); + to->majorCode = from->majorCode; +} + +void +SKeyButtonPtrEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.keyButtonPointer.time, + to->u.keyButtonPointer.time); + cpswapl(from->u.keyButtonPointer.root, + to->u.keyButtonPointer.root); + cpswapl(from->u.keyButtonPointer.event, + to->u.keyButtonPointer.event); + cpswapl(from->u.keyButtonPointer.child, + to->u.keyButtonPointer.child); + cpswaps(from->u.keyButtonPointer.rootX, + to->u.keyButtonPointer.rootX); + cpswaps(from->u.keyButtonPointer.rootY, + to->u.keyButtonPointer.rootY); + cpswaps(from->u.keyButtonPointer.eventX, + to->u.keyButtonPointer.eventX); + cpswaps(from->u.keyButtonPointer.eventY, + to->u.keyButtonPointer.eventY); + cpswaps(from->u.keyButtonPointer.state, + to->u.keyButtonPointer.state); + to->u.keyButtonPointer.sameScreen = + from->u.keyButtonPointer.sameScreen; +} + +void +SEnterLeaveEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.enterLeave.time, to->u.enterLeave.time); + cpswapl(from->u.enterLeave.root, to->u.enterLeave.root); + cpswapl(from->u.enterLeave.event, to->u.enterLeave.event); + cpswapl(from->u.enterLeave.child, to->u.enterLeave.child); + cpswaps(from->u.enterLeave.rootX, to->u.enterLeave.rootX); + cpswaps(from->u.enterLeave.rootY, to->u.enterLeave.rootY); + cpswaps(from->u.enterLeave.eventX, to->u.enterLeave.eventX); + cpswaps(from->u.enterLeave.eventY, to->u.enterLeave.eventY); + cpswaps(from->u.enterLeave.state, to->u.enterLeave.state); + to->u.enterLeave.mode = from->u.enterLeave.mode; + to->u.enterLeave.flags = from->u.enterLeave.flags; +} + +void +SFocusEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.focus.window, to->u.focus.window); + to->u.focus.mode = from->u.focus.mode; +} + +void +SExposeEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.expose.window, to->u.expose.window); + cpswaps(from->u.expose.x, to->u.expose.x); + cpswaps(from->u.expose.y, to->u.expose.y); + cpswaps(from->u.expose.width, to->u.expose.width); + cpswaps(from->u.expose.height, to->u.expose.height); + cpswaps(from->u.expose.count, to->u.expose.count); +} + +void +SGraphicsExposureEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.graphicsExposure.drawable, + to->u.graphicsExposure.drawable); + cpswaps(from->u.graphicsExposure.x, + to->u.graphicsExposure.x); + cpswaps(from->u.graphicsExposure.y, + to->u.graphicsExposure.y); + cpswaps(from->u.graphicsExposure.width, + to->u.graphicsExposure.width); + cpswaps(from->u.graphicsExposure.height, + to->u.graphicsExposure.height); + cpswaps(from->u.graphicsExposure.minorEvent, + to->u.graphicsExposure.minorEvent); + cpswaps(from->u.graphicsExposure.count, + to->u.graphicsExposure.count); + to->u.graphicsExposure.majorEvent = + from->u.graphicsExposure.majorEvent; +} + +void +SNoExposureEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.noExposure.drawable, to->u.noExposure.drawable); + cpswaps(from->u.noExposure.minorEvent, to->u.noExposure.minorEvent); + to->u.noExposure.majorEvent = from->u.noExposure.majorEvent; +} + +void +SVisibilityEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.visibility.window, to->u.visibility.window); + to->u.visibility.state = from->u.visibility.state; +} + +void +SCreateNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.createNotify.window, to->u.createNotify.window); + cpswapl(from->u.createNotify.parent, to->u.createNotify.parent); + cpswaps(from->u.createNotify.x, to->u.createNotify.x); + cpswaps(from->u.createNotify.y, to->u.createNotify.y); + cpswaps(from->u.createNotify.width, to->u.createNotify.width); + cpswaps(from->u.createNotify.height, to->u.createNotify.height); + cpswaps(from->u.createNotify.borderWidth, + to->u.createNotify.borderWidth); + to->u.createNotify.override = from->u.createNotify.override; +} + +void +SDestroyNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.destroyNotify.event, to->u.destroyNotify.event); + cpswapl(from->u.destroyNotify.window, to->u.destroyNotify.window); +} + +void +SUnmapNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.unmapNotify.event, to->u.unmapNotify.event); + cpswapl(from->u.unmapNotify.window, to->u.unmapNotify.window); + to->u.unmapNotify.fromConfigure = from->u.unmapNotify.fromConfigure; +} + +void +SMapNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.mapNotify.event, to->u.mapNotify.event); + cpswapl(from->u.mapNotify.window, to->u.mapNotify.window); + to->u.mapNotify.override = from->u.mapNotify.override; +} + +void +SMapRequestEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.mapRequest.parent, to->u.mapRequest.parent); + cpswapl(from->u.mapRequest.window, to->u.mapRequest.window); +} + +void +SReparentEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.reparent.event, to->u.reparent.event); + cpswapl(from->u.reparent.window, to->u.reparent.window); + cpswapl(from->u.reparent.parent, to->u.reparent.parent); + cpswaps(from->u.reparent.x, to->u.reparent.x); + cpswaps(from->u.reparent.y, to->u.reparent.y); + to->u.reparent.override = from->u.reparent.override; +} + +void +SConfigureNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.configureNotify.event, + to->u.configureNotify.event); + cpswapl(from->u.configureNotify.window, + to->u.configureNotify.window); + cpswapl(from->u.configureNotify.aboveSibling, + to->u.configureNotify.aboveSibling); + cpswaps(from->u.configureNotify.x, to->u.configureNotify.x); + cpswaps(from->u.configureNotify.y, to->u.configureNotify.y); + cpswaps(from->u.configureNotify.width, to->u.configureNotify.width); + cpswaps(from->u.configureNotify.height, + to->u.configureNotify.height); + cpswaps(from->u.configureNotify.borderWidth, + to->u.configureNotify.borderWidth); + to->u.configureNotify.override = from->u.configureNotify.override; +} + +void +SConfigureRequestEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; /* actually stack-mode */ + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.configureRequest.parent, + to->u.configureRequest.parent); + cpswapl(from->u.configureRequest.window, + to->u.configureRequest.window); + cpswapl(from->u.configureRequest.sibling, + to->u.configureRequest.sibling); + cpswaps(from->u.configureRequest.x, to->u.configureRequest.x); + cpswaps(from->u.configureRequest.y, to->u.configureRequest.y); + cpswaps(from->u.configureRequest.width, + to->u.configureRequest.width); + cpswaps(from->u.configureRequest.height, + to->u.configureRequest.height); + cpswaps(from->u.configureRequest.borderWidth, + to->u.configureRequest.borderWidth); + cpswaps(from->u.configureRequest.valueMask, + to->u.configureRequest.valueMask); +} + + +void +SGravityEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.gravity.event, to->u.gravity.event); + cpswapl(from->u.gravity.window, to->u.gravity.window); + cpswaps(from->u.gravity.x, to->u.gravity.x); + cpswaps(from->u.gravity.y, to->u.gravity.y); +} + +void +SResizeRequestEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.resizeRequest.window, to->u.resizeRequest.window); + cpswaps(from->u.resizeRequest.width, to->u.resizeRequest.width); + cpswaps(from->u.resizeRequest.height, to->u.resizeRequest.height); +} + +void +SCirculateEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.circulate.event, to->u.circulate.event); + cpswapl(from->u.circulate.window, to->u.circulate.window); + cpswapl(from->u.circulate.parent, to->u.circulate.parent); + to->u.circulate.place = from->u.circulate.place; +} + +void +SPropertyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.property.window, to->u.property.window); + cpswapl(from->u.property.atom, to->u.property.atom); + cpswapl(from->u.property.time, to->u.property.time); + to->u.property.state = from->u.property.state; +} + +void +SSelectionClearEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.selectionClear.time, to->u.selectionClear.time); + cpswapl(from->u.selectionClear.window, to->u.selectionClear.window); + cpswapl(from->u.selectionClear.atom, to->u.selectionClear.atom); +} + +void +SSelectionRequestEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.selectionRequest.time, to->u.selectionRequest.time); + cpswapl(from->u.selectionRequest.owner, + to->u.selectionRequest.owner); + cpswapl(from->u.selectionRequest.requestor, + to->u.selectionRequest.requestor); + cpswapl(from->u.selectionRequest.selection, + to->u.selectionRequest.selection); + cpswapl(from->u.selectionRequest.target, + to->u.selectionRequest.target); + cpswapl(from->u.selectionRequest.property, + to->u.selectionRequest.property); +} + +void +SSelectionNotifyEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.selectionNotify.time, to->u.selectionNotify.time); + cpswapl(from->u.selectionNotify.requestor, + to->u.selectionNotify.requestor); + cpswapl(from->u.selectionNotify.selection, + to->u.selectionNotify.selection); + cpswapl(from->u.selectionNotify.target, + to->u.selectionNotify.target); + cpswapl(from->u.selectionNotify.property, + to->u.selectionNotify.property); +} + +void +SColormapEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.colormap.window, to->u.colormap.window); + cpswapl(from->u.colormap.colormap, to->u.colormap.colormap); + to->u.colormap.new = from->u.colormap.new; + to->u.colormap.state = from->u.colormap.state; +} + +void +SMappingEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + to->u.mappingNotify.request = from->u.mappingNotify.request; + to->u.mappingNotify.firstKeyCode = + from->u.mappingNotify.firstKeyCode; + to->u.mappingNotify.count = from->u.mappingNotify.count; +} + +void +SClientMessageEvent(xEvent *from, xEvent *to) +{ + to->u.u.type = from->u.u.type; + to->u.u.detail = from->u.u.detail; /* actually format */ + cpswaps(from->u.u.sequenceNumber, to->u.u.sequenceNumber); + cpswapl(from->u.clientMessage.window, to->u.clientMessage.window); + cpswapl(from->u.clientMessage.u.l.type, + to->u.clientMessage.u.l.type); + switch (from->u.u.detail) { + case 8: + memmove(to->u.clientMessage.u.b.bytes, + from->u.clientMessage.u.b.bytes,20); + break; + case 16: + cpswaps(from->u.clientMessage.u.s.shorts0, + to->u.clientMessage.u.s.shorts0); + cpswaps(from->u.clientMessage.u.s.shorts1, + to->u.clientMessage.u.s.shorts1); + cpswaps(from->u.clientMessage.u.s.shorts2, + to->u.clientMessage.u.s.shorts2); + cpswaps(from->u.clientMessage.u.s.shorts3, + to->u.clientMessage.u.s.shorts3); + cpswaps(from->u.clientMessage.u.s.shorts4, + to->u.clientMessage.u.s.shorts4); + cpswaps(from->u.clientMessage.u.s.shorts5, + to->u.clientMessage.u.s.shorts5); + cpswaps(from->u.clientMessage.u.s.shorts6, + to->u.clientMessage.u.s.shorts6); + cpswaps(from->u.clientMessage.u.s.shorts7, + to->u.clientMessage.u.s.shorts7); + cpswaps(from->u.clientMessage.u.s.shorts8, + to->u.clientMessage.u.s.shorts8); + cpswaps(from->u.clientMessage.u.s.shorts9, + to->u.clientMessage.u.s.shorts9); + break; + case 32: + cpswapl(from->u.clientMessage.u.l.longs0, + to->u.clientMessage.u.l.longs0); + cpswapl(from->u.clientMessage.u.l.longs1, + to->u.clientMessage.u.l.longs1); + cpswapl(from->u.clientMessage.u.l.longs2, + to->u.clientMessage.u.l.longs2); + cpswapl(from->u.clientMessage.u.l.longs3, + to->u.clientMessage.u.l.longs3); + cpswapl(from->u.clientMessage.u.l.longs4, + to->u.clientMessage.u.l.longs4); + break; + } +} + +void +SKeymapNotifyEvent(xEvent *from, xEvent *to) +{ + /* Keymap notify events are special; they have no + sequence number field, and contain entirely 8-bit data */ + *to = *from; +} + +static void +SwapConnSetup(xConnSetup *pConnSetup, xConnSetup *pConnSetupT) +{ + cpswapl(pConnSetup->release, pConnSetupT->release); + cpswapl(pConnSetup->ridBase, pConnSetupT->ridBase); + cpswapl(pConnSetup->ridMask, pConnSetupT->ridMask); + cpswapl(pConnSetup->motionBufferSize, pConnSetupT->motionBufferSize); + cpswaps(pConnSetup->nbytesVendor, pConnSetupT->nbytesVendor); + cpswaps(pConnSetup->maxRequestSize, pConnSetupT->maxRequestSize); + pConnSetupT->minKeyCode = pConnSetup->minKeyCode; + pConnSetupT->maxKeyCode = pConnSetup->maxKeyCode; + pConnSetupT->numRoots = pConnSetup->numRoots; + pConnSetupT->numFormats = pConnSetup->numFormats; + pConnSetupT->imageByteOrder = pConnSetup->imageByteOrder; + pConnSetupT->bitmapBitOrder = pConnSetup->bitmapBitOrder; + pConnSetupT->bitmapScanlineUnit = pConnSetup->bitmapScanlineUnit; + pConnSetupT->bitmapScanlinePad = pConnSetup->bitmapScanlinePad; +} + +static void +SwapWinRoot(xWindowRoot *pRoot, xWindowRoot *pRootT) +{ + cpswapl(pRoot->windowId, pRootT->windowId); + cpswapl(pRoot->defaultColormap, pRootT->defaultColormap); + cpswapl(pRoot->whitePixel, pRootT->whitePixel); + cpswapl(pRoot->blackPixel, pRootT->blackPixel); + cpswapl(pRoot->currentInputMask, pRootT->currentInputMask); + cpswaps(pRoot->pixWidth, pRootT->pixWidth); + cpswaps(pRoot->pixHeight, pRootT->pixHeight); + cpswaps(pRoot->mmWidth, pRootT->mmWidth); + cpswaps(pRoot->mmHeight, pRootT->mmHeight); + cpswaps(pRoot->minInstalledMaps, pRootT->minInstalledMaps); + cpswaps(pRoot->maxInstalledMaps, pRootT->maxInstalledMaps); + cpswapl(pRoot->rootVisualID, pRootT->rootVisualID); + pRootT->backingStore = pRoot->backingStore; + pRootT->saveUnders = pRoot->saveUnders; + pRootT->rootDepth = pRoot->rootDepth; + pRootT->nDepths = pRoot->nDepths; +} + +static void +SwapVisual(xVisualType *pVis, xVisualType *pVisT) +{ + cpswapl(pVis->visualID, pVisT->visualID); + pVisT->class = pVis->class; + pVisT->bitsPerRGB = pVis->bitsPerRGB; + cpswaps(pVis->colormapEntries, pVisT->colormapEntries); + cpswapl(pVis->redMask, pVisT->redMask); + cpswapl(pVis->greenMask, pVisT->greenMask); + cpswapl(pVis->blueMask, pVisT->blueMask); +} + +_X_EXPORT void +SwapConnSetupInfo( + char *pInfo, + char *pInfoT +) +{ + int i, j, k; + xConnSetup *pConnSetup = (xConnSetup *)pInfo; + xDepth *depth; + xWindowRoot *root; + + SwapConnSetup(pConnSetup, (xConnSetup *)pInfoT); + pInfo += sizeof(xConnSetup); + pInfoT += sizeof(xConnSetup); + + /* Copy the vendor string */ + i = (pConnSetup->nbytesVendor + 3) & ~3; + memcpy(pInfoT, pInfo, i); + pInfo += i; + pInfoT += i; + + /* The Pixmap formats don't need to be swapped, just copied. */ + i = sizeof(xPixmapFormat) * pConnSetup->numFormats; + memcpy(pInfoT, pInfo, i); + pInfo += i; + pInfoT += i; + + for(i = 0; i < pConnSetup->numRoots; i++) + { + root = (xWindowRoot*)pInfo; + SwapWinRoot(root, (xWindowRoot *)pInfoT); + pInfo += sizeof(xWindowRoot); + pInfoT += sizeof(xWindowRoot); + + for(j = 0; j < root->nDepths; j++) + { + depth = (xDepth*)pInfo; + ((xDepth *)pInfoT)->depth = depth->depth; + cpswaps(depth->nVisuals, ((xDepth *)pInfoT)->nVisuals); + pInfo += sizeof(xDepth); + pInfoT += sizeof(xDepth); + for(k = 0; k < depth->nVisuals; k++) + { + SwapVisual((xVisualType *)pInfo, (xVisualType *)pInfoT); + pInfo += sizeof(xVisualType); + pInfoT += sizeof(xVisualType); + } + } + } +} + +void +WriteSConnectionInfo(ClientPtr pClient, unsigned long size, char *pInfo) +{ + char *pInfoTBase; + + pInfoTBase = (char *) xalloc(size); + if (!pInfoTBase) + { + pClient->noClientException = -1; + return; + } + SwapConnSetupInfo(pInfo, pInfoTBase); + (void)WriteToClient(pClient, (int)size, (char *) pInfoTBase); + xfree(pInfoTBase); +} + +_X_EXPORT void +SwapConnSetupPrefix(xConnSetupPrefix *pcspFrom, xConnSetupPrefix *pcspTo) +{ + pcspTo->success = pcspFrom->success; + pcspTo->lengthReason = pcspFrom->lengthReason; + cpswaps(pcspFrom->majorVersion, pcspTo->majorVersion); + cpswaps(pcspFrom->minorVersion, pcspTo->minorVersion); + cpswaps(pcspFrom->length, pcspTo->length); +} + +void +WriteSConnSetupPrefix(ClientPtr pClient, xConnSetupPrefix *pcsp) +{ + xConnSetupPrefix cspT; + + SwapConnSetupPrefix(pcsp, &cspT); + (void)WriteToClient(pClient, sizeof(cspT), (char *) &cspT); +} diff --git a/xorg-server/dix/swapreq.c b/xorg-server/dix/swapreq.c new file mode 100644 index 000000000..ad60d17da --- /dev/null +++ b/xorg-server/dix/swapreq.c @@ -0,0 +1,1100 @@ +/************************************************************ + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +********************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_EVENTS +#include +#include +#include "misc.h" +#include "dixstruct.h" +#include "extnsionst.h" /* for SendEvent */ +#include "swapreq.h" + +/* Thanks to Jack Palevich for testing and subsequently rewriting all this */ + +/* Byte swap a list of longs */ +_X_EXPORT void +SwapLongs (CARD32 *list, unsigned long count) +{ + char n; + + while (count >= 8) { + swapl(list+0, n); + swapl(list+1, n); + swapl(list+2, n); + swapl(list+3, n); + swapl(list+4, n); + swapl(list+5, n); + swapl(list+6, n); + swapl(list+7, n); + list += 8; + count -= 8; + } + if (count != 0) { + do { + swapl(list, n); + list++; + } while (--count != 0); + } +} + +/* Byte swap a list of shorts */ +_X_EXPORT void +SwapShorts (short *list, unsigned long count) +{ + char n; + + while (count >= 16) { + swaps(list+0, n); + swaps(list+1, n); + swaps(list+2, n); + swaps(list+3, n); + swaps(list+4, n); + swaps(list+5, n); + swaps(list+6, n); + swaps(list+7, n); + swaps(list+8, n); + swaps(list+9, n); + swaps(list+10, n); + swaps(list+11, n); + swaps(list+12, n); + swaps(list+13, n); + swaps(list+14, n); + swaps(list+15, n); + list += 16; + count -= 16; + } + if (count != 0) { + do { + swaps(list, n); + list++; + } while (--count != 0); + } +} + +/* The following is used for all requests that have + no fields to be swapped (except "length") */ +int +SProcSimpleReq(ClientPtr client) +{ + char n; + + REQUEST(xReq); + swaps(&stuff->length, n); + return(*ProcVector[stuff->reqType])(client); +} + +/* The following is used for all requests that have + only a single 32-bit field to be swapped, coming + right after the "length" field */ +int +SProcResourceReq(ClientPtr client) +{ + char n; + + REQUEST(xResourceReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xResourceReq); /* not EXACT */ + swapl(&stuff->id, n); + return(*ProcVector[stuff->reqType])(client); +} + +int +SProcCreateWindow(ClientPtr client) +{ + char n; + + REQUEST(xCreateWindowReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xCreateWindowReq); + swapl(&stuff->wid, n); + swapl(&stuff->parent, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + swaps(&stuff->borderWidth, n); + swaps(&stuff->class, n); + swapl(&stuff->visual, n); + swapl(&stuff->mask, n); + SwapRestL(stuff); + return((* ProcVector[X_CreateWindow])(client)); +} + +int +SProcChangeWindowAttributes(ClientPtr client) +{ + char n; + + REQUEST(xChangeWindowAttributesReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangeWindowAttributesReq); + swapl(&stuff->window, n); + swapl(&stuff->valueMask, n); + SwapRestL(stuff); + return((* ProcVector[X_ChangeWindowAttributes])(client)); +} + +int +SProcReparentWindow(ClientPtr client) +{ + char n; + REQUEST(xReparentWindowReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xReparentWindowReq); + swapl(&stuff->window, n); + swapl(&stuff->parent, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + return((* ProcVector[X_ReparentWindow])(client)); +} + +int +SProcConfigureWindow(ClientPtr client) +{ + char n; + REQUEST(xConfigureWindowReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xConfigureWindowReq); + swapl(&stuff->window, n); + swaps(&stuff->mask, n); + SwapRestL(stuff); + return((* ProcVector[X_ConfigureWindow])(client)); + +} + + +int +SProcInternAtom(ClientPtr client) +{ + char n; + REQUEST(xInternAtomReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xInternAtomReq); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_InternAtom])(client)); +} + +int +SProcChangeProperty(ClientPtr client) +{ + char n; + REQUEST(xChangePropertyReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangePropertyReq); + swapl(&stuff->window, n); + swapl(&stuff->property, n); + swapl(&stuff->type, n); + swapl(&stuff->nUnits, n); + switch ( stuff->format ) { + case 8 : + break; + case 16: + SwapRestS(stuff); + break; + case 32: + SwapRestL(stuff); + break; + } + return((* ProcVector[X_ChangeProperty])(client)); +} + +int +SProcDeleteProperty(ClientPtr client) +{ + char n; + REQUEST(xDeletePropertyReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xDeletePropertyReq); + swapl(&stuff->window, n); + swapl(&stuff->property, n); + return((* ProcVector[X_DeleteProperty])(client)); + +} + +int +SProcGetProperty(ClientPtr client) +{ + char n; + REQUEST(xGetPropertyReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGetPropertyReq); + swapl(&stuff->window, n); + swapl(&stuff->property, n); + swapl(&stuff->type, n); + swapl(&stuff->longOffset, n); + swapl(&stuff->longLength, n); + return((* ProcVector[X_GetProperty])(client)); +} + +int +SProcSetSelectionOwner(ClientPtr client) +{ + char n; + REQUEST(xSetSelectionOwnerReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xSetSelectionOwnerReq); + swapl(&stuff->window, n); + swapl(&stuff->selection, n); + swapl(&stuff->time, n); + return((* ProcVector[X_SetSelectionOwner])(client)); +} + +int +SProcConvertSelection(ClientPtr client) +{ + char n; + REQUEST(xConvertSelectionReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xConvertSelectionReq); + swapl(&stuff->requestor, n); + swapl(&stuff->selection, n); + swapl(&stuff->target, n); + swapl(&stuff->property, n); + swapl(&stuff->time, n); + return((* ProcVector[X_ConvertSelection])(client)); +} + +int +SProcSendEvent(ClientPtr client) +{ + char n; + xEvent eventT; + EventSwapPtr proc; + REQUEST(xSendEventReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xSendEventReq); + swapl(&stuff->destination, n); + swapl(&stuff->eventMask, n); + + /* Swap event */ + proc = EventSwapVector[stuff->event.u.u.type & 0177]; + if (!proc || proc == NotImplemented) /* no swapping proc; invalid event type? */ + return (BadValue); + (*proc)(&stuff->event, &eventT); + stuff->event = eventT; + + return((* ProcVector[X_SendEvent])(client)); +} + +int +SProcGrabPointer(ClientPtr client) +{ + char n; + REQUEST(xGrabPointerReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGrabPointerReq); + swapl(&stuff->grabWindow, n); + swaps(&stuff->eventMask, n); + swapl(&stuff->confineTo, n); + swapl(&stuff->cursor, n); + swapl(&stuff->time, n); + return((* ProcVector[X_GrabPointer])(client)); +} + +int +SProcGrabButton(ClientPtr client) +{ + char n; + REQUEST(xGrabButtonReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGrabButtonReq); + swapl(&stuff->grabWindow, n); + swaps(&stuff->eventMask, n); + swapl(&stuff->confineTo, n); + swapl(&stuff->cursor, n); + swaps(&stuff->modifiers, n); + return((* ProcVector[X_GrabButton])(client)); +} + +int +SProcUngrabButton(ClientPtr client) +{ + char n; + REQUEST(xUngrabButtonReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xUngrabButtonReq); + swapl(&stuff->grabWindow, n); + swaps(&stuff->modifiers, n); + return((* ProcVector[X_UngrabButton])(client)); +} + +int +SProcChangeActivePointerGrab(ClientPtr client) +{ + char n; + REQUEST(xChangeActivePointerGrabReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xChangeActivePointerGrabReq); + swapl(&stuff->cursor, n); + swapl(&stuff->time, n); + swaps(&stuff->eventMask, n); + return((* ProcVector[X_ChangeActivePointerGrab])(client)); +} + +int +SProcGrabKeyboard(ClientPtr client) +{ + char n; + REQUEST(xGrabKeyboardReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGrabKeyboardReq); + swapl(&stuff->grabWindow, n); + swapl(&stuff->time, n); + return((* ProcVector[X_GrabKeyboard])(client)); +} + +int +SProcGrabKey(ClientPtr client) +{ + char n; + REQUEST(xGrabKeyReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGrabKeyReq); + swapl(&stuff->grabWindow, n); + swaps(&stuff->modifiers, n); + return((* ProcVector[X_GrabKey])(client)); +} + +int +SProcUngrabKey(ClientPtr client) +{ + char n; + REQUEST(xUngrabKeyReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xUngrabKeyReq); + swapl(&stuff->grabWindow, n); + swaps(&stuff->modifiers, n); + return((* ProcVector[X_UngrabKey])(client)); +} + +int +SProcGetMotionEvents(ClientPtr client) +{ + char n; + REQUEST(xGetMotionEventsReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGetMotionEventsReq); + swapl(&stuff->window, n); + swapl(&stuff->start, n); + swapl(&stuff->stop, n); + return((* ProcVector[X_GetMotionEvents])(client)); +} + +int +SProcTranslateCoords(ClientPtr client) +{ + char n; + REQUEST(xTranslateCoordsReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xTranslateCoordsReq); + swapl(&stuff->srcWid, n); + swapl(&stuff->dstWid, n); + swaps(&stuff->srcX, n); + swaps(&stuff->srcY, n); + return((* ProcVector[X_TranslateCoords])(client)); +} + +int +SProcWarpPointer(ClientPtr client) +{ + char n; + REQUEST(xWarpPointerReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xWarpPointerReq); + swapl(&stuff->srcWid, n); + swapl(&stuff->dstWid, n); + swaps(&stuff->srcX, n); + swaps(&stuff->srcY, n); + swaps(&stuff->srcWidth, n); + swaps(&stuff->srcHeight, n); + swaps(&stuff->dstX, n); + swaps(&stuff->dstY, n); + return((* ProcVector[X_WarpPointer])(client)); +} + +int +SProcSetInputFocus(ClientPtr client) +{ + char n; + REQUEST(xSetInputFocusReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xSetInputFocusReq); + swapl(&stuff->focus, n); + swapl(&stuff->time, n); + return((* ProcVector[X_SetInputFocus])(client)); +} + +int +SProcOpenFont(ClientPtr client) +{ + char n; + REQUEST(xOpenFontReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xOpenFontReq); + swapl(&stuff->fid, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_OpenFont])(client)); +} + +int +SProcListFonts(ClientPtr client) +{ + char n; + REQUEST(xListFontsReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xListFontsReq); + swaps(&stuff->maxNames, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_ListFonts])(client)); +} + +int +SProcListFontsWithInfo(ClientPtr client) +{ + char n; + REQUEST(xListFontsWithInfoReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xListFontsWithInfoReq); + swaps(&stuff->maxNames, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_ListFontsWithInfo])(client)); +} + +int +SProcSetFontPath(ClientPtr client) +{ + char n; + REQUEST(xSetFontPathReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xSetFontPathReq); + swaps(&stuff->nFonts, n); + return((* ProcVector[X_SetFontPath])(client)); +} + +int +SProcCreatePixmap(ClientPtr client) +{ + char n; + REQUEST(xCreatePixmapReq); + + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCreatePixmapReq); + swapl(&stuff->pid, n); + swapl(&stuff->drawable, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + return((* ProcVector[X_CreatePixmap])(client)); +} + +int +SProcCreateGC(ClientPtr client) +{ + char n; + REQUEST(xCreateGCReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xCreateGCReq); + swapl(&stuff->gc, n); + swapl(&stuff->drawable, n); + swapl(&stuff->mask, n); + SwapRestL(stuff); + return((* ProcVector[X_CreateGC])(client)); +} + +int +SProcChangeGC(ClientPtr client) +{ + char n; + REQUEST(xChangeGCReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangeGCReq); + swapl(&stuff->gc, n); + swapl(&stuff->mask, n); + SwapRestL(stuff); + return((* ProcVector[X_ChangeGC])(client)); +} + +int +SProcCopyGC(ClientPtr client) +{ + char n; + REQUEST(xCopyGCReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCopyGCReq); + swapl(&stuff->srcGC, n); + swapl(&stuff->dstGC, n); + swapl(&stuff->mask, n); + return((* ProcVector[X_CopyGC])(client)); +} + +int +SProcSetDashes(ClientPtr client) +{ + char n; + REQUEST(xSetDashesReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xSetDashesReq); + swapl(&stuff->gc, n); + swaps(&stuff->dashOffset, n); + swaps(&stuff->nDashes, n); + return((* ProcVector[X_SetDashes])(client)); + +} + +int +SProcSetClipRectangles(ClientPtr client) +{ + char n; + REQUEST(xSetClipRectanglesReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xSetClipRectanglesReq); + swapl(&stuff->gc, n); + swaps(&stuff->xOrigin, n); + swaps(&stuff->yOrigin, n); + SwapRestS(stuff); + return((* ProcVector[X_SetClipRectangles])(client)); +} + +int +SProcClearToBackground(ClientPtr client) +{ + char n; + REQUEST(xClearAreaReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xClearAreaReq); + swapl(&stuff->window, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + return((* ProcVector[X_ClearArea])(client)); +} + +int +SProcCopyArea(ClientPtr client) +{ + char n; + REQUEST(xCopyAreaReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCopyAreaReq); + swapl(&stuff->srcDrawable, n); + swapl(&stuff->dstDrawable, n); + swapl(&stuff->gc, n); + swaps(&stuff->srcX, n); + swaps(&stuff->srcY, n); + swaps(&stuff->dstX, n); + swaps(&stuff->dstY, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + return((* ProcVector[X_CopyArea])(client)); +} + +int +SProcCopyPlane(ClientPtr client) +{ + char n; + REQUEST(xCopyPlaneReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCopyPlaneReq); + swapl(&stuff->srcDrawable, n); + swapl(&stuff->dstDrawable, n); + swapl(&stuff->gc, n); + swaps(&stuff->srcX, n); + swaps(&stuff->srcY, n); + swaps(&stuff->dstX, n); + swaps(&stuff->dstY, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + swapl(&stuff->bitPlane, n); + return((* ProcVector[X_CopyPlane])(client)); +} + +/* The following routine is used for all Poly drawing requests + (except FillPoly, which uses a different request format) */ +int +SProcPoly(ClientPtr client) +{ + char n; + + REQUEST(xPolyPointReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xPolyPointReq); + swapl(&stuff->drawable, n); + swapl(&stuff->gc, n); + SwapRestS(stuff); + return((* ProcVector[stuff->reqType])(client)); +} + +/* cannot use SProcPoly for this one, because xFillPolyReq + is longer than xPolyPointReq, and we don't want to swap + the difference as shorts! */ +int +SProcFillPoly(ClientPtr client) +{ + char n; + + REQUEST(xFillPolyReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xFillPolyReq); + swapl(&stuff->drawable, n); + swapl(&stuff->gc, n); + SwapRestS(stuff); + return((* ProcVector[X_FillPoly])(client)); +} + +int +SProcPutImage(ClientPtr client) +{ + char n; + REQUEST(xPutImageReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xPutImageReq); + swapl(&stuff->drawable, n); + swapl(&stuff->gc, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + swaps(&stuff->dstX, n); + swaps(&stuff->dstY, n); + /* Image should already be swapped */ + return((* ProcVector[X_PutImage])(client)); + +} + +int +SProcGetImage(ClientPtr client) +{ + char n; + REQUEST(xGetImageReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xGetImageReq); + swapl(&stuff->drawable, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + swapl(&stuff->planeMask, n); + return((* ProcVector[X_GetImage])(client)); +} + +/* ProcPolyText used for both PolyText8 and PolyText16 */ + +int +SProcPolyText(ClientPtr client) +{ + char n; + REQUEST(xPolyTextReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xPolyTextReq); + swapl(&stuff->drawable, n); + swapl(&stuff->gc, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + return((* ProcVector[stuff->reqType])(client)); +} + +/* ProcImageText used for both ImageText8 and ImageText16 */ + +int +SProcImageText(ClientPtr client) +{ + char n; + REQUEST(xImageTextReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xImageTextReq); + swapl(&stuff->drawable, n); + swapl(&stuff->gc, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + return((* ProcVector[stuff->reqType])(client)); +} + +int +SProcCreateColormap(ClientPtr client) +{ + char n; + REQUEST(xCreateColormapReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCreateColormapReq); + swapl(&stuff->mid, n); + swapl(&stuff->window, n); + swapl(&stuff->visual, n); + return((* ProcVector[X_CreateColormap])(client)); +} + + +int +SProcCopyColormapAndFree(ClientPtr client) +{ + char n; + REQUEST(xCopyColormapAndFreeReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCopyColormapAndFreeReq); + swapl(&stuff->mid, n); + swapl(&stuff->srcCmap, n); + return((* ProcVector[X_CopyColormapAndFree])(client)); + +} + +int +SProcAllocColor(ClientPtr client) +{ + char n; + REQUEST(xAllocColorReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xAllocColorReq); + swapl(&stuff->cmap, n); + swaps(&stuff->red, n); + swaps(&stuff->green, n); + swaps(&stuff->blue, n); + return((* ProcVector[X_AllocColor])(client)); +} + +int +SProcAllocNamedColor(ClientPtr client) +{ + char n; + + REQUEST(xAllocNamedColorReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xAllocNamedColorReq); + swapl(&stuff->cmap, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_AllocNamedColor])(client)); +} + +int +SProcAllocColorCells(ClientPtr client) +{ + char n; + REQUEST(xAllocColorCellsReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xAllocColorCellsReq); + swapl(&stuff->cmap, n); + swaps(&stuff->colors, n); + swaps(&stuff->planes, n); + return((* ProcVector[X_AllocColorCells])(client)); +} + +int +SProcAllocColorPlanes(ClientPtr client) +{ + char n; + REQUEST(xAllocColorPlanesReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xAllocColorPlanesReq); + swapl(&stuff->cmap, n); + swaps(&stuff->colors, n); + swaps(&stuff->red, n); + swaps(&stuff->green, n); + swaps(&stuff->blue, n); + return((* ProcVector[X_AllocColorPlanes])(client)); +} + +int +SProcFreeColors(ClientPtr client) +{ + char n; + REQUEST(xFreeColorsReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xFreeColorsReq); + swapl(&stuff->cmap, n); + swapl(&stuff->planeMask, n); + SwapRestL(stuff); + return((* ProcVector[X_FreeColors])(client)); + +} + +_X_EXPORT void +SwapColorItem(xColorItem *pItem) +{ + char n; + + swapl(&pItem->pixel, n); + swaps(&pItem->red, n); + swaps(&pItem->green, n); + swaps(&pItem->blue, n); +} + +int +SProcStoreColors(ClientPtr client) +{ + char n; + long count; + xColorItem *pItem; + + REQUEST(xStoreColorsReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xStoreColorsReq); + swapl(&stuff->cmap, n); + pItem = (xColorItem *) &stuff[1]; + for(count = LengthRestB(stuff)/sizeof(xColorItem); --count >= 0; ) + SwapColorItem(pItem++); + return((* ProcVector[X_StoreColors])(client)); +} + +int +SProcStoreNamedColor (ClientPtr client) +{ + char n; + REQUEST(xStoreNamedColorReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xStoreNamedColorReq); + swapl(&stuff->cmap, n); + swapl(&stuff->pixel, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_StoreNamedColor])(client)); +} + +int +SProcQueryColors (ClientPtr client) +{ + char n; + REQUEST(xQueryColorsReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xQueryColorsReq); + swapl(&stuff->cmap, n); + SwapRestL(stuff); + return((* ProcVector[X_QueryColors])(client)); +} + +int +SProcLookupColor (ClientPtr client) +{ + char n; + REQUEST(xLookupColorReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xLookupColorReq); + swapl(&stuff->cmap, n); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_LookupColor])(client)); +} + +int +SProcCreateCursor (ClientPtr client) +{ + char n; + REQUEST(xCreateCursorReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCreateCursorReq); + swapl(&stuff->cid, n); + swapl(&stuff->source, n); + swapl(&stuff->mask, n); + swaps(&stuff->foreRed, n); + swaps(&stuff->foreGreen, n); + swaps(&stuff->foreBlue, n); + swaps(&stuff->backRed, n); + swaps(&stuff->backGreen, n); + swaps(&stuff->backBlue, n); + swaps(&stuff->x, n); + swaps(&stuff->y, n); + return((* ProcVector[X_CreateCursor])(client)); +} + +int +SProcCreateGlyphCursor (ClientPtr client) +{ + char n; + REQUEST(xCreateGlyphCursorReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xCreateGlyphCursorReq); + swapl(&stuff->cid, n); + swapl(&stuff->source, n); + swapl(&stuff->mask, n); + swaps(&stuff->sourceChar, n); + swaps(&stuff->maskChar, n); + swaps(&stuff->foreRed, n); + swaps(&stuff->foreGreen, n); + swaps(&stuff->foreBlue, n); + swaps(&stuff->backRed, n); + swaps(&stuff->backGreen, n); + swaps(&stuff->backBlue, n); + return((* ProcVector[X_CreateGlyphCursor])(client)); +} + + +int +SProcRecolorCursor (ClientPtr client) +{ + char n; + REQUEST(xRecolorCursorReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xRecolorCursorReq); + swapl(&stuff->cursor, n); + swaps(&stuff->foreRed, n); + swaps(&stuff->foreGreen, n); + swaps(&stuff->foreBlue, n); + swaps(&stuff->backRed, n); + swaps(&stuff->backGreen, n); + swaps(&stuff->backBlue, n); + return((* ProcVector[X_RecolorCursor])(client)); +} + +int +SProcQueryBestSize (ClientPtr client) +{ + char n; + REQUEST(xQueryBestSizeReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xQueryBestSizeReq); + swapl(&stuff->drawable, n); + swaps(&stuff->width, n); + swaps(&stuff->height, n); + return((* ProcVector[X_QueryBestSize])(client)); + +} + +int +SProcQueryExtension (ClientPtr client) +{ + char n; + REQUEST(xQueryExtensionReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xQueryExtensionReq); + swaps(&stuff->nbytes, n); + return((* ProcVector[X_QueryExtension])(client)); +} + +int +SProcChangeKeyboardMapping (ClientPtr client) +{ + char n; + REQUEST(xChangeKeyboardMappingReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangeKeyboardMappingReq); + SwapRestL(stuff); + return((* ProcVector[X_ChangeKeyboardMapping])(client)); +} + + +int +SProcChangeKeyboardControl (ClientPtr client) +{ + char n; + REQUEST(xChangeKeyboardControlReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangeKeyboardControlReq); + swapl(&stuff->mask, n); + SwapRestL(stuff); + return((* ProcVector[X_ChangeKeyboardControl])(client)); +} + +int +SProcChangePointerControl (ClientPtr client) +{ + char n; + REQUEST(xChangePointerControlReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xChangePointerControlReq); + swaps(&stuff->accelNum, n); + swaps(&stuff->accelDenum, n); + swaps(&stuff->threshold, n); + return((* ProcVector[X_ChangePointerControl])(client)); +} + + +int +SProcSetScreenSaver (ClientPtr client) +{ + char n; + REQUEST(xSetScreenSaverReq); + swaps(&stuff->length, n); + REQUEST_SIZE_MATCH(xSetScreenSaverReq); + swaps(&stuff->timeout, n); + swaps(&stuff->interval, n); + return((* ProcVector[X_SetScreenSaver])(client)); +} + +int +SProcChangeHosts (ClientPtr client) +{ + char n; + + REQUEST(xChangeHostsReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xChangeHostsReq); + swaps(&stuff->hostLength, n); + return((* ProcVector[X_ChangeHosts])(client)); + +} + +int SProcRotateProperties (ClientPtr client) +{ + char n; + REQUEST(xRotatePropertiesReq); + swaps(&stuff->length, n); + REQUEST_AT_LEAST_SIZE(xRotatePropertiesReq); + swapl(&stuff->window, n); + swaps(&stuff->nAtoms, n); + swaps(&stuff->nPositions, n); + SwapRestL(stuff); + return ((* ProcVector[X_RotateProperties])(client)); +} + +int +SProcNoOperation(ClientPtr client) +{ + char n; + REQUEST(xReq); + swaps(&stuff->length, n); + return ((* ProcVector[X_NoOperation])(client)); +} + +void +SwapConnClientPrefix(xConnClientPrefix *pCCP) +{ + char n; + + swaps(&pCCP->majorVersion, n); + swaps(&pCCP->minorVersion, n); + swaps(&pCCP->nbytesAuthProto, n); + swaps(&pCCP->nbytesAuthString, n); +} diff --git a/xorg-server/dix/tables.c b/xorg-server/dix/tables.c new file mode 100644 index 000000000..2200e3ceb --- /dev/null +++ b/xorg-server/dix/tables.c @@ -0,0 +1,512 @@ +/*********************************************************** + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN +AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts. + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +******************************************************************/ + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include +#define NEED_EVENTS +#define NEED_REPLIES +#include +#include "windowstr.h" +#include "extnsionst.h" +#include "dixstruct.h" +#include "dixevents.h" +#include "dispatch.h" +#include "swaprep.h" +#include "swapreq.h" + +int (* InitialVector[3]) ( + ClientPtr /* client */ + ) = +{ + 0, + ProcInitialConnection, + ProcEstablishConnection +}; + +_X_EXPORT int (* ProcVector[256]) ( + ClientPtr /* client */ + ) = +{ + ProcBadRequest, + ProcCreateWindow, + ProcChangeWindowAttributes, + ProcGetWindowAttributes, + ProcDestroyWindow, + ProcDestroySubwindows, /* 5 */ + ProcChangeSaveSet, + ProcReparentWindow, + ProcMapWindow, + ProcMapSubwindows, + ProcUnmapWindow, /* 10 */ + ProcUnmapSubwindows, + ProcConfigureWindow, + ProcCirculateWindow, + ProcGetGeometry, + ProcQueryTree, /* 15 */ + ProcInternAtom, + ProcGetAtomName, + ProcChangeProperty, + ProcDeleteProperty, + ProcGetProperty, /* 20 */ + ProcListProperties, + ProcSetSelectionOwner, + ProcGetSelectionOwner, + ProcConvertSelection, + ProcSendEvent, /* 25 */ + ProcGrabPointer, + ProcUngrabPointer, + ProcGrabButton, + ProcUngrabButton, + ProcChangeActivePointerGrab, /* 30 */ + ProcGrabKeyboard, + ProcUngrabKeyboard, + ProcGrabKey, + ProcUngrabKey, + ProcAllowEvents, /* 35 */ + ProcGrabServer, + ProcUngrabServer, + ProcQueryPointer, + ProcGetMotionEvents, + ProcTranslateCoords, /* 40 */ + ProcWarpPointer, + ProcSetInputFocus, + ProcGetInputFocus, + ProcQueryKeymap, + ProcOpenFont, /* 45 */ + ProcCloseFont, + ProcQueryFont, + ProcQueryTextExtents, + ProcListFonts, + ProcListFontsWithInfo, /* 50 */ + ProcSetFontPath, + ProcGetFontPath, + ProcCreatePixmap, + ProcFreePixmap, + ProcCreateGC, /* 55 */ + ProcChangeGC, + ProcCopyGC, + ProcSetDashes, + ProcSetClipRectangles, + ProcFreeGC, /* 60 */ + ProcClearToBackground, + ProcCopyArea, + ProcCopyPlane, + ProcPolyPoint, + ProcPolyLine, /* 65 */ + ProcPolySegment, + ProcPolyRectangle, + ProcPolyArc, + ProcFillPoly, + ProcPolyFillRectangle, /* 70 */ + ProcPolyFillArc, + ProcPutImage, + ProcGetImage, + ProcPolyText, + ProcPolyText, /* 75 */ + ProcImageText8, + ProcImageText16, + ProcCreateColormap, + ProcFreeColormap, + ProcCopyColormapAndFree, /* 80 */ + ProcInstallColormap, + ProcUninstallColormap, + ProcListInstalledColormaps, + ProcAllocColor, + ProcAllocNamedColor, /* 85 */ + ProcAllocColorCells, + ProcAllocColorPlanes, + ProcFreeColors, + ProcStoreColors, + ProcStoreNamedColor, /* 90 */ + ProcQueryColors, + ProcLookupColor, + ProcCreateCursor, + ProcCreateGlyphCursor, + ProcFreeCursor, /* 95 */ + ProcRecolorCursor, + ProcQueryBestSize, + ProcQueryExtension, + ProcListExtensions, + ProcChangeKeyboardMapping, /* 100 */ + ProcGetKeyboardMapping, + ProcChangeKeyboardControl, + ProcGetKeyboardControl, + ProcBell, + ProcChangePointerControl, /* 105 */ + ProcGetPointerControl, + ProcSetScreenSaver, + ProcGetScreenSaver, + ProcChangeHosts, + ProcListHosts, /* 110 */ + ProcChangeAccessControl, + ProcChangeCloseDownMode, + ProcKillClient, + ProcRotateProperties, + ProcForceScreenSaver, /* 115 */ + ProcSetPointerMapping, + ProcGetPointerMapping, + ProcSetModifierMapping, + ProcGetModifierMapping, + 0, /* 120 */ + 0, + 0, + 0, + 0, + 0, /* 125 */ + 0, + ProcNoOperation +}; + +int (* SwappedProcVector[256]) ( + ClientPtr /* client */ + ) = +{ + ProcBadRequest, + SProcCreateWindow, + SProcChangeWindowAttributes, + SProcResourceReq, /* GetWindowAttributes */ + SProcResourceReq, /* DestroyWindow */ + SProcResourceReq, /* 5 DestroySubwindows */ + SProcResourceReq, /* SProcChangeSaveSet, */ + SProcReparentWindow, + SProcResourceReq, /* MapWindow */ + SProcResourceReq, /* MapSubwindows */ + SProcResourceReq, /* 10 UnmapWindow */ + SProcResourceReq, /* UnmapSubwindows */ + SProcConfigureWindow, + SProcResourceReq, /* SProcCirculateWindow, */ + SProcResourceReq, /* GetGeometry */ + SProcResourceReq, /* 15 QueryTree */ + SProcInternAtom, + SProcResourceReq, /* SProcGetAtomName, */ + SProcChangeProperty, + SProcDeleteProperty, + SProcGetProperty, /* 20 */ + SProcResourceReq, /* SProcListProperties, */ + SProcSetSelectionOwner, + SProcResourceReq, /* SProcGetSelectionOwner, */ + SProcConvertSelection, + SProcSendEvent, /* 25 */ + SProcGrabPointer, + SProcResourceReq, /* SProcUngrabPointer, */ + SProcGrabButton, + SProcUngrabButton, + SProcChangeActivePointerGrab, /* 30 */ + SProcGrabKeyboard, + SProcResourceReq, /* SProcUngrabKeyboard, */ + SProcGrabKey, + SProcUngrabKey, + SProcResourceReq, /* 35 SProcAllowEvents, */ + SProcSimpleReq, /* SProcGrabServer, */ + SProcSimpleReq, /* SProcUngrabServer, */ + SProcResourceReq, /* SProcQueryPointer, */ + SProcGetMotionEvents, + SProcTranslateCoords, /*40 */ + SProcWarpPointer, + SProcSetInputFocus, + SProcSimpleReq, /* SProcGetInputFocus, */ + SProcSimpleReq, /* QueryKeymap, */ + SProcOpenFont, /* 45 */ + SProcResourceReq, /* SProcCloseFont, */ + SProcResourceReq, /* SProcQueryFont, */ + SProcResourceReq, /* SProcQueryTextExtents, */ + SProcListFonts, + SProcListFontsWithInfo, /* 50 */ + SProcSetFontPath, + SProcSimpleReq, /* GetFontPath, */ + SProcCreatePixmap, + SProcResourceReq, /* SProcFreePixmap, */ + SProcCreateGC, /* 55 */ + SProcChangeGC, + SProcCopyGC, + SProcSetDashes, + SProcSetClipRectangles, + SProcResourceReq, /* 60 SProcFreeGC, */ + SProcClearToBackground, + SProcCopyArea, + SProcCopyPlane, + SProcPoly, /* PolyPoint, */ + SProcPoly, /* 65 PolyLine */ + SProcPoly, /* PolySegment, */ + SProcPoly, /* PolyRectangle, */ + SProcPoly, /* PolyArc, */ + SProcFillPoly, + SProcPoly, /* 70 PolyFillRectangle */ + SProcPoly, /* PolyFillArc, */ + SProcPutImage, + SProcGetImage, + SProcPolyText, + SProcPolyText, /* 75 */ + SProcImageText, + SProcImageText, + SProcCreateColormap, + SProcResourceReq, /* SProcFreeColormap, */ + SProcCopyColormapAndFree, /* 80 */ + SProcResourceReq, /* SProcInstallColormap, */ + SProcResourceReq, /* SProcUninstallColormap, */ + SProcResourceReq, /* SProcListInstalledColormaps, */ + SProcAllocColor, + SProcAllocNamedColor, /* 85 */ + SProcAllocColorCells, + SProcAllocColorPlanes, + SProcFreeColors, + SProcStoreColors, + SProcStoreNamedColor, /* 90 */ + SProcQueryColors, + SProcLookupColor, + SProcCreateCursor, + SProcCreateGlyphCursor, + SProcResourceReq, /* 95 SProcFreeCursor, */ + SProcRecolorCursor, + SProcQueryBestSize, + SProcQueryExtension, + SProcSimpleReq, /* ListExtensions, */ + SProcChangeKeyboardMapping, /* 100 */ + SProcSimpleReq, /* GetKeyboardMapping, */ + SProcChangeKeyboardControl, + SProcSimpleReq, /* GetKeyboardControl, */ + SProcSimpleReq, /* Bell, */ + SProcChangePointerControl, /* 105 */ + SProcSimpleReq, /* GetPointerControl, */ + SProcSetScreenSaver, + SProcSimpleReq, /* GetScreenSaver, */ + SProcChangeHosts, + SProcSimpleReq, /* 110 ListHosts, */ + SProcSimpleReq, /* SProcChangeAccessControl, */ + SProcSimpleReq, /* SProcChangeCloseDownMode, */ + SProcResourceReq, /* SProcKillClient, */ + SProcRotateProperties, + SProcSimpleReq, /* 115 ForceScreenSaver */ + SProcSimpleReq, /* SetPointerMapping, */ + SProcSimpleReq, /* GetPointerMapping, */ + SProcSimpleReq, /* SetModifierMapping, */ + SProcSimpleReq, /* GetModifierMapping, */ + 0, /* 120 */ + 0, + 0, + 0, + 0, + 0, /* 125 */ + 0, + SProcNoOperation +}; + +_X_EXPORT EventSwapPtr EventSwapVector[128] = +{ + (EventSwapPtr)SErrorEvent, + NotImplemented, + SKeyButtonPtrEvent, + SKeyButtonPtrEvent, + SKeyButtonPtrEvent, + SKeyButtonPtrEvent, /* 5 */ + SKeyButtonPtrEvent, + SEnterLeaveEvent, + SEnterLeaveEvent, + SFocusEvent, + SFocusEvent, /* 10 */ + SKeymapNotifyEvent, + SExposeEvent, + SGraphicsExposureEvent, + SNoExposureEvent, + SVisibilityEvent, /* 15 */ + SCreateNotifyEvent, + SDestroyNotifyEvent, + SUnmapNotifyEvent, + SMapNotifyEvent, + SMapRequestEvent, /* 20 */ + SReparentEvent, + SConfigureNotifyEvent, + SConfigureRequestEvent, + SGravityEvent, + SResizeRequestEvent, /* 25 */ + SCirculateEvent, + SCirculateEvent, + SPropertyEvent, + SSelectionClearEvent, + SSelectionRequestEvent, /* 30 */ + SSelectionNotifyEvent, + SColormapEvent, + SClientMessageEvent, + SMappingEvent, +}; + + +_X_EXPORT ReplySwapPtr ReplySwapVector[256] = +{ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SGetWindowAttributesReply, + ReplyNotSwappd, + ReplyNotSwappd, /* 5 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 10 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SGetGeometryReply, + (ReplySwapPtr)SQueryTreeReply, /* 15 */ + (ReplySwapPtr)SInternAtomReply, + (ReplySwapPtr)SGetAtomNameReply, + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SGetPropertyReply, /* 20 */ + (ReplySwapPtr)SListPropertiesReply, + ReplyNotSwappd, + (ReplySwapPtr)SGetSelectionOwnerReply, + ReplyNotSwappd, + ReplyNotSwappd, /* 25 */ + (ReplySwapPtr)SGenericReply, /* SGrabPointerReply, */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 30 */ + (ReplySwapPtr)SGenericReply, /* SGrabKeyboardReply, */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 35 */ + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SQueryPointerReply, + (ReplySwapPtr)SGetMotionEventsReply, + (ReplySwapPtr)STranslateCoordsReply, /* 40 */ + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SGetInputFocusReply, + (ReplySwapPtr)SQueryKeymapReply, + ReplyNotSwappd, /* 45 */ + ReplyNotSwappd, + (ReplySwapPtr)SQueryFontReply, + (ReplySwapPtr)SQueryTextExtentsReply, + (ReplySwapPtr)SListFontsReply, + (ReplySwapPtr)SListFontsWithInfoReply, /* 50 */ + ReplyNotSwappd, + (ReplySwapPtr)SGetFontPathReply, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 55 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 60 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 65 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 70 */ + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SGetImageReply, + ReplyNotSwappd, + ReplyNotSwappd, /* 75 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 80 */ + ReplyNotSwappd, + ReplyNotSwappd, + (ReplySwapPtr)SListInstalledColormapsReply, + (ReplySwapPtr)SAllocColorReply, + (ReplySwapPtr)SAllocNamedColorReply, /* 85 */ + (ReplySwapPtr)SAllocColorCellsReply, + (ReplySwapPtr)SAllocColorPlanesReply, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 90 */ + (ReplySwapPtr)SQueryColorsReply, + (ReplySwapPtr)SLookupColorReply, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 95 */ + ReplyNotSwappd, + (ReplySwapPtr)SQueryBestSizeReply, + (ReplySwapPtr)SGenericReply, /* SQueryExtensionReply, */ + (ReplySwapPtr)SListExtensionsReply, + ReplyNotSwappd, /* 100 */ + (ReplySwapPtr)SGetKeyboardMappingReply, + ReplyNotSwappd, + (ReplySwapPtr)SGetKeyboardControlReply, + ReplyNotSwappd, + ReplyNotSwappd, /* 105 */ + (ReplySwapPtr)SGetPointerControlReply, + ReplyNotSwappd, + (ReplySwapPtr)SGetScreenSaverReply, + ReplyNotSwappd, + (ReplySwapPtr)SListHostsReply, /* 110 */ + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, + ReplyNotSwappd, /* 115 */ + (ReplySwapPtr)SGenericReply, /* SetPointerMapping */ + (ReplySwapPtr)SGetPointerMappingReply, + (ReplySwapPtr)SGenericReply, /* SetModifierMapping */ + (ReplySwapPtr)SGetModifierMappingReply, /* 119 */ + ReplyNotSwappd, /* 120 */ + ReplyNotSwappd, /* 121 */ + ReplyNotSwappd, /* 122 */ + ReplyNotSwappd, /* 123 */ + ReplyNotSwappd, /* 124 */ + ReplyNotSwappd, /* 125 */ + ReplyNotSwappd, /* 126 */ + ReplyNotSwappd, /* NoOperation */ + ReplyNotSwappd +}; diff --git a/xorg-server/dix/window.c b/xorg-server/dix/window.c new file mode 100644 index 000000000..834c26b12 --- /dev/null +++ b/xorg-server/dix/window.c @@ -0,0 +1,3867 @@ +/* + +Copyright (c) 2006, Red Hat, Inc. + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +RED HAT BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Red Hat shall not be +used in advertising or otherwise to promote the sale, use or other dealings +in this Software without prior written authorization from Red Hat. + +Copyright 1987, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. + + +Copyright 1987 by Digital Equipment Corporation, Maynard, Massachusetts, + + All Rights Reserved + +Permission to use, copy, modify, and distribute this software and its +documentation for any purpose and without fee is hereby granted, +provided that the above copyright notice appear in all copies and that +both that copyright notice and this permission notice appear in +supporting documentation, and that the name of Digital not be +used in advertising or publicity pertaining to distribution of the +software without specific, written prior permission. + +DIGITAL DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING +ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN NO EVENT SHALL +DIGITAL BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR +ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, +WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, +ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS +SOFTWARE. + +*/ + +/* The panoramix components contained the following notice */ +/***************************************************************** + +Copyright (c) 1991, 1997 Digital Equipment Corporation, Maynard, Massachusetts. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software. + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL +DIGITAL EQUIPMENT CORPORATION BE LIABLE FOR ANY CLAIM, DAMAGES, INCLUDING, +BUT NOT LIMITED TO CONSEQUENTIAL OR INCIDENTAL DAMAGES, OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR +IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of Digital Equipment Corporation +shall not be used in advertising or otherwise to promote the sale, use or other +dealings in this Software without prior written authorization from Digital +Equipment Corporation. + +******************************************************************/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "misc.h" +#include "scrnintstr.h" +#include "os.h" +#include "regionstr.h" +#include "validate.h" +#include "windowstr.h" +#include "input.h" +#include "resource.h" +#include "colormapst.h" +#include "cursorstr.h" +#include "dixstruct.h" +#include "gcstruct.h" +#include "servermd.h" +#ifdef PANORAMIX +#include "panoramiX.h" +#include "panoramiXsrv.h" +#endif +#include "dixevents.h" +#include "globals.h" + +#ifdef XAPPGROUP +#include "appgroup.h" +#endif +#include "privates.h" +#include "xace.h" + +/****** + * Window stuff for server + * + * CreateRootWindow, CreateWindow, ChangeWindowAttributes, + * GetWindowAttributes, DeleteWindow, DestroySubWindows, + * HandleSaveSet, ReparentWindow, MapWindow, MapSubWindows, + * UnmapWindow, UnmapSubWindows, ConfigureWindow, CirculateWindow, + * + ******/ + +static unsigned char _back_lsb[4] = {0x88, 0x22, 0x44, 0x11}; +static unsigned char _back_msb[4] = {0x11, 0x44, 0x22, 0x88}; + +_X_EXPORT int screenIsSaved = SCREEN_SAVER_OFF; + +_X_EXPORT ScreenSaverStuffRec savedScreenInfo[MAXSCREENS]; + +static Bool TileScreenSaver(int i, int kind); + + +#define INPUTONLY_LEGAL_MASK (CWWinGravity | CWEventMask | \ + CWDontPropagate | CWOverrideRedirect | CWCursor ) + +#define BOXES_OVERLAP(b1, b2) \ + (!( ((b1)->x2 <= (b2)->x1) || \ + ( ((b1)->x1 >= (b2)->x2)) || \ + ( ((b1)->y2 <= (b2)->y1)) || \ + ( ((b1)->y1 >= (b2)->y2)) ) ) + +#define RedirectSend(pWin) \ + ((pWin->eventMask|wOtherEventMasks(pWin)) & SubstructureRedirectMask) + +#define SubSend(pWin) \ + ((pWin->eventMask|wOtherEventMasks(pWin)) & SubstructureNotifyMask) + +#define StrSend(pWin) \ + ((pWin->eventMask|wOtherEventMasks(pWin)) & StructureNotifyMask) + +#define SubStrSend(pWin,pParent) (StrSend(pWin) || SubSend(pParent)) + +_X_EXPORT int numSaveUndersViewable = 0; +_X_EXPORT int deltaSaveUndersViewable = 0; + +#ifdef DEBUG +/****** + * PrintWindowTree + * For debugging only + ******/ + +static void +PrintChildren(WindowPtr p1, int indent) +{ + WindowPtr p2; + int i; + + while (p1) + { + p2 = p1->firstChild; + for (i=0; idrawable.id); + miPrintRegion(&p1->clipList); + PrintChildren(p2, indent+4); + p1 = p1->nextSib; + } +} + +static void +PrintWindowTree(void) +{ + int i; + WindowPtr pWin, p1; + + for (i=0; iclipList); + p1 = pWin->firstChild; + PrintChildren(p1, 4); + } +} +#endif + +_X_EXPORT int +TraverseTree(WindowPtr pWin, VisitWindowProcPtr func, pointer data) +{ + int result; + WindowPtr pChild; + + if (!(pChild = pWin)) + return(WT_NOMATCH); + while (1) + { + result = (* func)(pChild, data); + if (result == WT_STOPWALKING) + return(WT_STOPWALKING); + if ((result == WT_WALKCHILDREN) && pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + while (!pChild->nextSib && (pChild != pWin)) + pChild = pChild->parent; + if (pChild == pWin) + break; + pChild = pChild->nextSib; + } + return(WT_NOMATCH); +} + +/***** + * WalkTree + * Walk the window tree, for SCREEN, preforming FUNC(pWin, data) on + * each window. If FUNC returns WT_WALKCHILDREN, traverse the children, + * if it returns WT_DONTWALKCHILDREN, dont. If it returns WT_STOPWALKING + * exit WalkTree. Does depth-first traverse. + *****/ + +_X_EXPORT int +WalkTree(ScreenPtr pScreen, VisitWindowProcPtr func, pointer data) +{ + return(TraverseTree(WindowTable[pScreen->myNum], func, data)); +} + +/* hack for forcing backing store on all windows */ +int defaultBackingStore = NotUseful; +/* hack to force no backing store */ +Bool disableBackingStore = FALSE; +Bool enableBackingStore = FALSE; +/* hack to force no save unders */ +Bool disableSaveUnders = FALSE; + +static void +SetWindowToDefaults(WindowPtr pWin) +{ + pWin->prevSib = NullWindow; + pWin->firstChild = NullWindow; + pWin->lastChild = NullWindow; + + pWin->valdata = (ValidatePtr)NULL; + pWin->optional = (WindowOptPtr)NULL; + pWin->cursorIsNone = TRUE; + + pWin->backingStore = NotUseful; + pWin->DIXsaveUnder = FALSE; + pWin->backStorage = (pointer) NULL; + + pWin->mapped = FALSE; /* off */ + pWin->realized = FALSE; /* off */ + pWin->viewable = FALSE; + pWin->visibility = VisibilityNotViewable; + pWin->overrideRedirect = FALSE; + pWin->saveUnder = FALSE; + + pWin->bitGravity = ForgetGravity; + pWin->winGravity = NorthWestGravity; + + pWin->eventMask = 0; + pWin->deliverableEvents = 0; + pWin->dontPropagate = 0; + pWin->forcedBS = FALSE; + pWin->redirectDraw = RedirectDrawNone; + pWin->forcedBG = FALSE; +} + +static void +MakeRootTile(WindowPtr pWin) +{ + ScreenPtr pScreen = pWin->drawable.pScreen; + GCPtr pGC; + unsigned char back[128]; + int len = BitmapBytePad(sizeof(long)); + unsigned char *from, *to; + int i, j; + + pWin->background.pixmap = (*pScreen->CreatePixmap)(pScreen, 4, 4, + pScreen->rootDepth, 0); + + pWin->backgroundState = BackgroundPixmap; + pGC = GetScratchGC(pScreen->rootDepth, pScreen); + if (!pWin->background.pixmap || !pGC) + FatalError("could not create root tile"); + + { + CARD32 attributes[2]; + + attributes[0] = pScreen->whitePixel; + attributes[1] = pScreen->blackPixel; + + (void)ChangeGC(pGC, GCForeground | GCBackground, attributes); + } + + ValidateGC((DrawablePtr)pWin->background.pixmap, pGC); + + from = (screenInfo.bitmapBitOrder == LSBFirst) ? _back_lsb : _back_msb; + to = back; + + for (i = 4; i > 0; i--, from++) + for (j = len; j > 0; j--) + *to++ = *from; + + (*pGC->ops->PutImage)((DrawablePtr)pWin->background.pixmap, pGC, 1, + 0, 0, len, 4, 0, XYBitmap, (char *)back); + + FreeScratchGC(pGC); + +} + +/***** + * CreateRootWindow + * Makes a window at initialization time for specified screen + *****/ + +Bool +CreateRootWindow(ScreenPtr pScreen) +{ + WindowPtr pWin; + BoxRec box; + PixmapFormatRec *format; + + pWin = (WindowPtr)xalloc(sizeof(WindowRec)); + if (!pWin) + return FALSE; + + savedScreenInfo[pScreen->myNum].pWindow = NULL; + savedScreenInfo[pScreen->myNum].wid = FakeClientID(0); + savedScreenInfo[pScreen->myNum].ExternalScreenSaver = NULL; + screenIsSaved = SCREEN_SAVER_OFF; + + WindowTable[pScreen->myNum] = pWin; + + pWin->drawable.pScreen = pScreen; + pWin->drawable.type = DRAWABLE_WINDOW; + pWin->devPrivates = NULL; + + pWin->drawable.depth = pScreen->rootDepth; + for (format = screenInfo.formats; + format->depth != pScreen->rootDepth; + format++) + ; + pWin->drawable.bitsPerPixel = format->bitsPerPixel; + + pWin->drawable.serialNumber = NEXT_SERIAL_NUMBER; + + pWin->parent = NullWindow; + SetWindowToDefaults(pWin); + + pWin->optional = (WindowOptRec *) xalloc (sizeof (WindowOptRec)); + if (!pWin->optional) + return FALSE; + + pWin->optional->dontPropagateMask = 0; + pWin->optional->otherEventMasks = 0; + pWin->optional->otherClients = NULL; + pWin->optional->passiveGrabs = NULL; + pWin->optional->userProps = NULL; + pWin->optional->backingBitPlanes = ~0L; + pWin->optional->backingPixel = 0; +#ifdef SHAPE + pWin->optional->boundingShape = NULL; + pWin->optional->clipShape = NULL; + pWin->optional->inputShape = NULL; +#endif +#ifdef XINPUT + pWin->optional->inputMasks = NULL; +#endif + pWin->optional->colormap = pScreen->defColormap; + pWin->optional->visual = pScreen->rootVisual; + + pWin->nextSib = NullWindow; + + pWin->drawable.id = FakeClientID(0); + + pWin->origin.x = pWin->origin.y = 0; + pWin->drawable.height = pScreen->height; + pWin->drawable.width = pScreen->width; + pWin->drawable.x = pWin->drawable.y = 0; + + box.x1 = 0; + box.y1 = 0; + box.x2 = pScreen->width; + box.y2 = pScreen->height; + REGION_INIT(pScreen, &pWin->clipList, &box, 1); + REGION_INIT(pScreen, &pWin->winSize, &box, 1); + REGION_INIT(pScreen, &pWin->borderSize, &box, 1); + REGION_INIT(pScreen, &pWin->borderClip, &box, 1); + + pWin->drawable.class = InputOutput; + pWin->optional->visual = pScreen->rootVisual; + + pWin->backgroundState = BackgroundPixel; + pWin->background.pixel = pScreen->whitePixel; + + pWin->borderIsPixel = TRUE; + pWin->border.pixel = pScreen->blackPixel; + pWin->borderWidth = 0; + + /* security creation/labeling check + */ + if (XaceHook(XACE_RESOURCE_ACCESS, serverClient, pWin->drawable.id, + RT_WINDOW, pWin, RT_NONE, NULL, DixCreateAccess)) + return FALSE; + + if (!AddResource(pWin->drawable.id, RT_WINDOW, (pointer)pWin)) + return FALSE; + + if (disableBackingStore) + pScreen->backingStoreSupport = NotUseful; + if (enableBackingStore) + pScreen->backingStoreSupport = Always; + +#ifdef DO_SAVE_UNDERS + if ((pScreen->backingStoreSupport != NotUseful) && + (pScreen->saveUnderSupport == NotUseful)) + { + /* + * If the screen has backing-store but no save-unders, let the + * clients know we can support save-unders using backing-store. + */ + pScreen->saveUnderSupport = USE_DIX_SAVE_UNDERS; + } +#endif /* DO_SAVE_UNDERS */ + + if (disableSaveUnders) + pScreen->saveUnderSupport = NotUseful; + + return TRUE; +} + +void +InitRootWindow(WindowPtr pWin) +{ + ScreenPtr pScreen = pWin->drawable.pScreen; + int backFlag = CWBorderPixel | CWCursor | CWBackingStore; + + if (!(*pScreen->CreateWindow)(pWin)) + return; /* XXX */ + (*pScreen->PositionWindow)(pWin, 0, 0); + + pWin->cursorIsNone = FALSE; + pWin->optional->cursor = rootCursor; + rootCursor->refcnt++; + + if (!blackRoot && !whiteRoot) { + MakeRootTile(pWin); + backFlag |= CWBackPixmap; + } + else { + if (blackRoot) + pWin->background.pixel = pScreen->blackPixel; + else + pWin->background.pixel = pScreen->whitePixel; + backFlag |= CWBackPixel; + } + + pWin->backingStore = defaultBackingStore; + pWin->forcedBS = (defaultBackingStore != NotUseful); + /* We SHOULD check for an error value here XXX */ + (*pScreen->ChangeWindowAttributes)(pWin, backFlag); + + MapWindow(pWin, serverClient); +} + +/* Set the region to the intersection of the rectangle and the + * window's winSize. The window is typically the parent of the + * window from which the region came. + */ + +static void +ClippedRegionFromBox(WindowPtr pWin, RegionPtr Rgn, + int x, int y, + int w, int h) +{ + ScreenPtr pScreen; + BoxRec box; + + pScreen = pWin->drawable.pScreen; + + box = *(REGION_EXTENTS(pScreen, &pWin->winSize)); + /* we do these calculations to avoid overflows */ + if (x > box.x1) + box.x1 = x; + if (y > box.y1) + box.y1 = y; + x += w; + if (x < box.x2) + box.x2 = x; + y += h; + if (y < box.y2) + box.y2 = y; + if (box.x1 > box.x2) + box.x2 = box.x1; + if (box.y1 > box.y2) + box.y2 = box.y1; + REGION_RESET(pScreen, Rgn, &box); + REGION_INTERSECT(pScreen, Rgn, Rgn, &pWin->winSize); +} + +static RealChildHeadProc realChildHeadProc = NULL; + +void +RegisterRealChildHeadProc (RealChildHeadProc proc) +{ + realChildHeadProc = proc; +} + + +WindowPtr +RealChildHead(WindowPtr pWin) +{ + if (realChildHeadProc) { + return realChildHeadProc (pWin); + } + + if (!pWin->parent && + (screenIsSaved == SCREEN_SAVER_ON) && + (HasSaverWindow (pWin->drawable.pScreen->myNum))) + return (pWin->firstChild); + else + return (NullWindow); +} + +/***** + * CreateWindow + * Makes a window in response to client request + *****/ + +_X_EXPORT WindowPtr +CreateWindow(Window wid, WindowPtr pParent, int x, int y, unsigned w, + unsigned h, unsigned bw, unsigned class, Mask vmask, XID *vlist, + int depth, ClientPtr client, VisualID visual, int *error) +{ + WindowPtr pWin; + WindowPtr pHead; + ScreenPtr pScreen; + xEvent event; + int idepth, ivisual; + Bool fOK; + DepthPtr pDepth; + PixmapFormatRec *format; + WindowOptPtr ancwopt; + + if (class == CopyFromParent) + class = pParent->drawable.class; + + if ((class != InputOutput) && (class != InputOnly)) + { + *error = BadValue; + client->errorValue = class; + return NullWindow; + } + + if ((class != InputOnly) && (pParent->drawable.class == InputOnly)) + { + *error = BadMatch; + return NullWindow; + } + + if ((class == InputOnly) && ((bw != 0) || (depth != 0))) + { + *error = BadMatch; + return NullWindow; + } + + pScreen = pParent->drawable.pScreen; + if ((class == InputOutput) && (depth == 0)) + depth = pParent->drawable.depth; + ancwopt = pParent->optional; + if (!ancwopt) + ancwopt = FindWindowWithOptional(pParent)->optional; + if (visual == CopyFromParent) { +#ifdef XAPPGROUP + VisualID ag_visual; + + if (client->appgroup && !pParent->parent && + (ag_visual = XagRootVisual (client))) + visual = ag_visual; + else +#endif + visual = ancwopt->visual; + } + + /* Find out if the depth and visual are acceptable for this Screen */ + if ((visual != ancwopt->visual) || (depth != pParent->drawable.depth)) + { + fOK = FALSE; + for(idepth = 0; idepth < pScreen->numDepths; idepth++) + { + pDepth = (DepthPtr) &pScreen->allowedDepths[idepth]; + if ((depth == pDepth->depth) || (depth == 0)) + { + for (ivisual = 0; ivisual < pDepth->numVids; ivisual++) + { + if (visual == pDepth->vids[ivisual]) + { + fOK = TRUE; + break; + } + } + } + } + if (fOK == FALSE) + { + *error = BadMatch; + return NullWindow; + } + } + + if (((vmask & (CWBorderPixmap | CWBorderPixel)) == 0) && + (class != InputOnly) && + (depth != pParent->drawable.depth)) + { + *error = BadMatch; + return NullWindow; + } + + if (((vmask & CWColormap) == 0) && + (class != InputOnly) && + ((visual != ancwopt->visual) || (ancwopt->colormap == None))) + { + *error = BadMatch; + return NullWindow; + } + + pWin = (WindowPtr)xalloc(sizeof(WindowRec)); + if (!pWin) + { + *error = BadAlloc; + return NullWindow; + } + pWin->drawable = pParent->drawable; + pWin->devPrivates = NULL; + pWin->drawable.depth = depth; + if (depth == pParent->drawable.depth) + pWin->drawable.bitsPerPixel = pParent->drawable.bitsPerPixel; + else + { + for (format = screenInfo.formats; format->depth != depth; format++) + ; + pWin->drawable.bitsPerPixel = format->bitsPerPixel; + } + if (class == InputOnly) + pWin->drawable.type = (short) UNDRAWABLE_WINDOW; + pWin->drawable.serialNumber = NEXT_SERIAL_NUMBER; + + pWin->drawable.id = wid; + pWin->drawable.class = class; + + pWin->parent = pParent; + SetWindowToDefaults(pWin); + + if (visual != ancwopt->visual) + { + if (!MakeWindowOptional (pWin)) + { + xfree (pWin); + *error = BadAlloc; + return NullWindow; + } + pWin->optional->visual = visual; + pWin->optional->colormap = None; + } + + pWin->borderWidth = bw; + + /* security creation/labeling check + */ + *error = XaceHook(XACE_RESOURCE_ACCESS, client, wid, RT_WINDOW, pWin, + RT_WINDOW, pWin->parent, DixCreateAccess|DixSetAttrAccess); + if (*error != Success) { + xfree(pWin); + return NullWindow; + } + + pWin->backgroundState = XaceBackgroundNoneState(pWin); + pWin->background.pixel = pScreen->whitePixel; + + pWin->borderIsPixel = pParent->borderIsPixel; + pWin->border = pParent->border; + if (pWin->borderIsPixel == FALSE) + pWin->border.pixmap->refcnt++; + + pWin->origin.x = x + (int)bw; + pWin->origin.y = y + (int)bw; + pWin->drawable.width = w; + pWin->drawable.height = h; + pWin->drawable.x = pParent->drawable.x + x + (int)bw; + pWin->drawable.y = pParent->drawable.y + y + (int)bw; + + /* set up clip list correctly for unobscured WindowPtr */ + REGION_NULL(pScreen, &pWin->clipList); + REGION_NULL(pScreen, &pWin->borderClip); + REGION_NULL(pScreen, &pWin->winSize); + REGION_NULL(pScreen, &pWin->borderSize); + + pHead = RealChildHead(pParent); + if (pHead) + { + pWin->nextSib = pHead->nextSib; + if (pHead->nextSib) + pHead->nextSib->prevSib = pWin; + else + pParent->lastChild = pWin; + pHead->nextSib = pWin; + pWin->prevSib = pHead; + } + else + { + pWin->nextSib = pParent->firstChild; + if (pParent->firstChild) + pParent->firstChild->prevSib = pWin; + else + pParent->lastChild = pWin; + pParent->firstChild = pWin; + } + + SetWinSize (pWin); + SetBorderSize (pWin); + + /* We SHOULD check for an error value here XXX */ + if (!(*pScreen->CreateWindow)(pWin)) + { + *error = BadAlloc; + DeleteWindow(pWin, None); + return NullWindow; + } + /* We SHOULD check for an error value here XXX */ + (*pScreen->PositionWindow)(pWin, pWin->drawable.x, pWin->drawable.y); + + if (!(vmask & CWEventMask)) + RecalculateDeliverableEvents(pWin); + + if (vmask) + *error = ChangeWindowAttributes(pWin, vmask, vlist, wClient (pWin)); + else + *error = Success; + + if (*error != Success) + { + DeleteWindow(pWin, None); + return NullWindow; + } + if (!(vmask & CWBackingStore) && (defaultBackingStore != NotUseful)) + { + XID value = defaultBackingStore; + (void)ChangeWindowAttributes(pWin, CWBackingStore, &value, wClient (pWin)); + pWin->forcedBS = TRUE; + } + + if (SubSend(pParent)) + { + event.u.u.type = CreateNotify; + event.u.createNotify.window = wid; + event.u.createNotify.parent = pParent->drawable.id; + event.u.createNotify.x = x; + event.u.createNotify.y = y; + event.u.createNotify.width = w; + event.u.createNotify.height = h; + event.u.createNotify.borderWidth = bw; + event.u.createNotify.override = pWin->overrideRedirect; + DeliverEvents(pParent, &event, 1, NullWindow); + } + return pWin; +} + +static void +DisposeWindowOptional (WindowPtr pWin) +{ + if (!pWin->optional) + return; + /* + * everything is peachy. Delete the optional record + * and clean up + */ + if (pWin->optional->cursor) + { + FreeCursor (pWin->optional->cursor, (Cursor)0); + pWin->cursorIsNone = FALSE; + } + else + pWin->cursorIsNone = TRUE; + xfree (pWin->optional); + pWin->optional = NULL; +} + +static void +FreeWindowResources(WindowPtr pWin) +{ + ScreenPtr pScreen = pWin->drawable.pScreen; + + DeleteWindowFromAnySaveSet(pWin); + DeleteWindowFromAnySelections(pWin); + DeleteWindowFromAnyEvents(pWin, TRUE); + REGION_UNINIT(pScreen, &pWin->clipList); + REGION_UNINIT(pScreen, &pWin->winSize); + REGION_UNINIT(pScreen, &pWin->borderClip); + REGION_UNINIT(pScreen, &pWin->borderSize); +#ifdef SHAPE + if (wBoundingShape (pWin)) + REGION_DESTROY(pScreen, wBoundingShape (pWin)); + if (wClipShape (pWin)) + REGION_DESTROY(pScreen, wClipShape (pWin)); + if (wInputShape (pWin)) + REGION_DESTROY(pScreen, wInputShape (pWin)); +#endif + if (pWin->borderIsPixel == FALSE) + (*pScreen->DestroyPixmap)(pWin->border.pixmap); + if (pWin->backgroundState == BackgroundPixmap) + (*pScreen->DestroyPixmap)(pWin->background.pixmap); + + DeleteAllWindowProperties(pWin); + /* We SHOULD check for an error value here XXX */ + (*pScreen->DestroyWindow)(pWin); + DisposeWindowOptional (pWin); +} + +static void +CrushTree(WindowPtr pWin) +{ + WindowPtr pChild, pSib, pParent; + UnrealizeWindowProcPtr UnrealizeWindow; + xEvent event; + + if (!(pChild = pWin->firstChild)) + return; + UnrealizeWindow = pWin->drawable.pScreen->UnrealizeWindow; + while (1) + { + if (pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + while (1) + { + pParent = pChild->parent; + if (SubStrSend(pChild, pParent)) + { + event.u.u.type = DestroyNotify; + event.u.destroyNotify.window = pChild->drawable.id; + DeliverEvents(pChild, &event, 1, NullWindow); + } + FreeResource(pChild->drawable.id, RT_WINDOW); + pSib = pChild->nextSib; +#ifdef DO_SAVE_UNDERS + if (pChild->saveUnder && pChild->viewable) + deltaSaveUndersViewable--; +#endif + pChild->viewable = FALSE; + if (pChild->realized) + { + pChild->realized = FALSE; + (*UnrealizeWindow)(pChild); + } + FreeWindowResources(pChild); + dixFreePrivates(pChild->devPrivates); + xfree(pChild); + if ( (pChild = pSib) ) + break; + pChild = pParent; + pChild->firstChild = NullWindow; + pChild->lastChild = NullWindow; + if (pChild == pWin) + return; + } + } +} + +/***** + * DeleteWindow + * Deletes child of window then window itself + * If wid is None, don't send any events + *****/ + +int +DeleteWindow(pointer value, XID wid) + { + WindowPtr pParent; + WindowPtr pWin = (WindowPtr)value; + xEvent event; + + UnmapWindow(pWin, FALSE); + + CrushTree(pWin); + + pParent = pWin->parent; + if (wid && pParent && SubStrSend(pWin, pParent)) + { + event.u.u.type = DestroyNotify; + event.u.destroyNotify.window = pWin->drawable.id; + DeliverEvents(pWin, &event, 1, NullWindow); + } + + FreeWindowResources(pWin); + if (pParent) + { + if (pParent->firstChild == pWin) + pParent->firstChild = pWin->nextSib; + if (pParent->lastChild == pWin) + pParent->lastChild = pWin->prevSib; + if (pWin->nextSib) + pWin->nextSib->prevSib = pWin->prevSib; + if (pWin->prevSib) + pWin->prevSib->nextSib = pWin->nextSib; + } + dixFreePrivates(pWin->devPrivates); + xfree(pWin); + return Success; +} + +int +DestroySubwindows(WindowPtr pWin, ClientPtr client) +{ + /* XXX + * The protocol is quite clear that each window should be + * destroyed in turn, however, unmapping all of the first + * eliminates most of the calls to ValidateTree. So, + * this implementation is incorrect in that all of the + * UnmapNotifies occur before all of the DestroyNotifies. + * If you care, simply delete the call to UnmapSubwindows. + */ + UnmapSubwindows(pWin); + while (pWin->lastChild) { + int rc = XaceHook(XACE_RESOURCE_ACCESS, client, + pWin->lastChild->drawable.id, RT_WINDOW, + pWin->lastChild, RT_NONE, NULL, DixDestroyAccess); + if (rc != Success) + return rc; + FreeResource(pWin->lastChild->drawable.id, RT_NONE); + } + return Success; +} + +#define DeviceEventMasks (KeyPressMask | KeyReleaseMask | ButtonPressMask | \ + ButtonReleaseMask | PointerMotionMask) + +/***** + * ChangeWindowAttributes + * + * The value-mask specifies which attributes are to be changed; the + * value-list contains one value for each one bit in the mask, from least + * to most significant bit in the mask. + *****/ + +_X_EXPORT int +ChangeWindowAttributes(WindowPtr pWin, Mask vmask, XID *vlist, ClientPtr client) +{ + XID *pVlist; + PixmapPtr pPixmap; + Pixmap pixID; + CursorPtr pCursor, pOldCursor; + Cursor cursorID; + WindowPtr pChild, pLayerWin; + Colormap cmap; + ColormapPtr pCmap; + xEvent xE; + int error, rc; + ScreenPtr pScreen; + Mask index2, tmask, vmaskCopy = 0; + unsigned int val; + Bool checkOptional = FALSE, borderRelative = FALSE; + + if ((pWin->drawable.class == InputOnly) && (vmask & (~INPUTONLY_LEGAL_MASK))) + return BadMatch; + + error = Success; + pScreen = pWin->drawable.pScreen; + pVlist = vlist; + tmask = vmask; + while (tmask) + { + index2 = (Mask) lowbit (tmask); + tmask &= ~index2; + switch (index2) + { + case CWBackPixmap: + pixID = (Pixmap )*pVlist; + pVlist++; + if (pWin->backgroundState == ParentRelative) + borderRelative = TRUE; + if (pixID == None) + { + if (pWin->backgroundState == BackgroundPixmap) + (*pScreen->DestroyPixmap)(pWin->background.pixmap); + if (!pWin->parent) + MakeRootTile(pWin); + else { + pWin->backgroundState = XaceBackgroundNoneState(pWin); + pWin->background.pixel = pScreen->whitePixel; + } + } + else if (pixID == ParentRelative) + { + if (pWin->parent && + pWin->drawable.depth != pWin->parent->drawable.depth) + { + error = BadMatch; + goto PatchUp; + } + if (pWin->backgroundState == BackgroundPixmap) + (*pScreen->DestroyPixmap)(pWin->background.pixmap); + if (!pWin->parent) + MakeRootTile(pWin); + else + pWin->backgroundState = ParentRelative; + borderRelative = TRUE; + /* Note that the parent's backgroundTile's refcnt is NOT + * incremented. */ + } + else + { + rc = dixLookupResource((pointer *)&pPixmap, pixID, RT_PIXMAP, + client, DixReadAccess); + if (rc == Success) + { + if ((pPixmap->drawable.depth != pWin->drawable.depth) || + (pPixmap->drawable.pScreen != pScreen)) + { + error = BadMatch; + goto PatchUp; + } + if (pWin->backgroundState == BackgroundPixmap) + (*pScreen->DestroyPixmap)(pWin->background.pixmap); + pWin->backgroundState = BackgroundPixmap; + pWin->background.pixmap = pPixmap; + pPixmap->refcnt++; + } + else + { + error = (rc == BadValue) ? BadPixmap : rc; + client->errorValue = pixID; + goto PatchUp; + } + } + break; + case CWBackPixel: + if (pWin->backgroundState == ParentRelative) + borderRelative = TRUE; + if (pWin->backgroundState == BackgroundPixmap) + (*pScreen->DestroyPixmap)(pWin->background.pixmap); + pWin->backgroundState = BackgroundPixel; + pWin->background.pixel = (CARD32 ) *pVlist; + /* background pixel overrides background pixmap, + so don't let the ddx layer see both bits */ + vmaskCopy &= ~CWBackPixmap; + pVlist++; + break; + case CWBorderPixmap: + pixID = (Pixmap ) *pVlist; + pVlist++; + if (pixID == CopyFromParent) + { + if (!pWin->parent || + (pWin->drawable.depth != pWin->parent->drawable.depth)) + { + error = BadMatch; + goto PatchUp; + } + if (pWin->parent->borderIsPixel == TRUE) { + if (pWin->borderIsPixel == FALSE) + (*pScreen->DestroyPixmap)(pWin->border.pixmap); + pWin->border = pWin->parent->border; + pWin->borderIsPixel = TRUE; + index2 = CWBorderPixel; + break; + } + else + { + pixID = pWin->parent->border.pixmap->drawable.id; + } + } + rc = dixLookupResource((pointer *)&pPixmap, pixID, RT_PIXMAP, + client, DixReadAccess); + if (rc == Success) + { + if ((pPixmap->drawable.depth != pWin->drawable.depth) || + (pPixmap->drawable.pScreen != pScreen)) + { + error = BadMatch; + goto PatchUp; + } + if (pWin->borderIsPixel == FALSE) + (*pScreen->DestroyPixmap)(pWin->border.pixmap); + pWin->borderIsPixel = FALSE; + pWin->border.pixmap = pPixmap; + pPixmap->refcnt++; + } + else + { + error = (rc == BadValue) ? BadPixmap : rc; + client->errorValue = pixID; + goto PatchUp; + } + break; + case CWBorderPixel: + if (pWin->borderIsPixel == FALSE) + (*pScreen->DestroyPixmap)(pWin->border.pixmap); + pWin->borderIsPixel = TRUE; + pWin->border.pixel = (CARD32) *pVlist; + /* border pixel overrides border pixmap, + so don't let the ddx layer see both bits */ + vmaskCopy &= ~CWBorderPixmap; + pVlist++; + break; + case CWBitGravity: + val = (CARD8 )*pVlist; + pVlist++; + if (val > StaticGravity) + { + error = BadValue; + client->errorValue = val; + goto PatchUp; + } + pWin->bitGravity = val; + break; + case CWWinGravity: + val = (CARD8 )*pVlist; + pVlist++; + if (val > StaticGravity) + { + error = BadValue; + client->errorValue = val; + goto PatchUp; + } + pWin->winGravity = val; + break; + case CWBackingStore: + val = (CARD8 )*pVlist; + pVlist++; + if ((val != NotUseful) && (val != WhenMapped) && (val != Always)) + { + error = BadValue; + client->errorValue = val; + goto PatchUp; + } + pWin->backingStore = val; + pWin->forcedBS = FALSE; + break; + case CWBackingPlanes: + if (pWin->optional || ((CARD32)*pVlist != (CARD32)~0L)) { + if (!pWin->optional && !MakeWindowOptional (pWin)) + { + error = BadAlloc; + goto PatchUp; + } + pWin->optional->backingBitPlanes = (CARD32) *pVlist; + if ((CARD32)*pVlist == (CARD32)~0L) + checkOptional = TRUE; + } + pVlist++; + break; + case CWBackingPixel: + if (pWin->optional || (CARD32) *pVlist) { + if (!pWin->optional && !MakeWindowOptional (pWin)) + { + error = BadAlloc; + goto PatchUp; + } + pWin->optional->backingPixel = (CARD32) *pVlist; + if (!*pVlist) + checkOptional = TRUE; + } + pVlist++; + break; + case CWSaveUnder: + val = (BOOL) *pVlist; + pVlist++; + if ((val != xTrue) && (val != xFalse)) + { + error = BadValue; + client->errorValue = val; + goto PatchUp; + } +#ifdef DO_SAVE_UNDERS + if (pWin->parent && (pWin->saveUnder != val) && (pWin->viewable) && + DO_SAVE_UNDERS(pWin)) + { + /* + * Re-check all siblings and inferiors for obscurity or + * exposition (hee hee). + */ + if (pWin->saveUnder) + deltaSaveUndersViewable--; + else + deltaSaveUndersViewable++; + pWin->saveUnder = val; + + if (pWin->firstChild) + { + pLayerWin = (*pScreen->GetLayerWindow)(pWin); + if ((*pScreen->ChangeSaveUnder)(pLayerWin->parent, pWin->nextSib)) + (*pScreen->PostChangeSaveUnder)(pLayerWin->parent, + pWin->nextSib); + } + else + { + if ((*pScreen->ChangeSaveUnder)(pWin, pWin->nextSib)) + (*pScreen->PostChangeSaveUnder)(pWin, + pWin->nextSib); + } + } + else + { + /* If we're changing the saveUnder attribute of the root + * window, all we do is set pWin->saveUnder so that + * GetWindowAttributes returns the right value. We don't + * do the "normal" save-under processing (as above). + * Hope that doesn't cause any problems. + */ + pWin->saveUnder = val; + } +#else + pWin->saveUnder = val; +#endif /* DO_SAVE_UNDERS */ + break; + case CWEventMask: + rc = EventSelectForWindow(pWin, client, (Mask )*pVlist); + if (rc) + { + error = rc; + goto PatchUp; + } + pVlist++; + break; + case CWDontPropagate: + rc = EventSuppressForWindow(pWin, client, (Mask )*pVlist, + &checkOptional); + if (rc) + { + error = rc; + goto PatchUp; + } + pVlist++; + break; + case CWOverrideRedirect: + val = (BOOL ) *pVlist; + pVlist++; + if ((val != xTrue) && (val != xFalse)) + { + error = BadValue; + client->errorValue = val; + goto PatchUp; + } + if (val == xTrue) { + rc = XaceHook(XACE_RESOURCE_ACCESS, client, pWin->drawable.id, + RT_WINDOW, pWin, RT_NONE, NULL, DixGrabAccess); + if (rc != Success) { + error = rc; + client->errorValue = pWin->drawable.id; + goto PatchUp; + } + } + pWin->overrideRedirect = val; + break; + case CWColormap: + cmap = (Colormap) *pVlist; + pVlist++; + if (cmap == CopyFromParent) + { +#ifdef XAPPGROUP + Colormap ag_colormap; + ClientPtr win_owner; + + /* + * win_owner == client for CreateWindow, other clients + * can ChangeWindowAttributes + */ + win_owner = clients[CLIENT_ID(pWin->drawable.id)]; + + if ( win_owner && win_owner->appgroup && + !pWin->parent->parent && + (ag_colormap = XagDefaultColormap (win_owner))) + cmap = ag_colormap; + else +#endif + if (pWin->parent && + (!pWin->optional || + pWin->optional->visual == wVisual (pWin->parent))) + { + cmap = wColormap (pWin->parent); + } + else + cmap = None; + } + if (cmap == None) + { + error = BadMatch; + goto PatchUp; + } + rc = dixLookupResource((pointer *)&pCmap, cmap, RT_COLORMAP, + client, DixUseAccess); + if (rc != Success) + { + error = (rc == BadValue) ? BadColor : rc; + client->errorValue = cmap; + goto PatchUp; + } + if (pCmap->pVisual->vid != wVisual (pWin) || + pCmap->pScreen != pScreen) + { + error = BadMatch; + goto PatchUp; + } + if (cmap != wColormap (pWin)) + { + if (!pWin->optional) + { + if (!MakeWindowOptional (pWin)) + { + error = BadAlloc; + goto PatchUp; + } + } + else if (pWin->parent && cmap == wColormap (pWin->parent)) + checkOptional = TRUE; + + /* + * propagate the original colormap to any children + * inheriting it + */ + + for (pChild = pWin->firstChild; pChild; pChild=pChild->nextSib) + { + if (!pChild->optional && !MakeWindowOptional (pChild)) + { + error = BadAlloc; + goto PatchUp; + } + } + + pWin->optional->colormap = cmap; + + /* + * check on any children now matching the new colormap + */ + + for (pChild = pWin->firstChild; pChild; pChild=pChild->nextSib) + { + if (pChild->optional->colormap == cmap) + CheckWindowOptionalNeed (pChild); + } + + xE.u.u.type = ColormapNotify; + xE.u.colormap.window = pWin->drawable.id; + xE.u.colormap.colormap = cmap; + xE.u.colormap.new = xTrue; + xE.u.colormap.state = IsMapInstalled(cmap, pWin); + DeliverEvents(pWin, &xE, 1, NullWindow); + } + break; + case CWCursor: + cursorID = (Cursor ) *pVlist; + pVlist++; + /* + * install the new + */ + if ( cursorID == None) + { + if (pWin == WindowTable[pWin->drawable.pScreen->myNum]) + pCursor = rootCursor; + else + pCursor = (CursorPtr) None; + } + else + { + rc = dixLookupResource((pointer *)&pCursor, cursorID, + RT_CURSOR, client, DixUseAccess); + if (rc != Success) + { + error = (rc == BadValue) ? BadCursor : rc; + client->errorValue = cursorID; + goto PatchUp; + } + } + + if (pCursor != wCursor (pWin)) + { + /* + * patch up child windows so they don't lose cursors. + */ + + for (pChild = pWin->firstChild; pChild; pChild=pChild->nextSib) + { + if (!pChild->optional && !pChild->cursorIsNone && + !MakeWindowOptional (pChild)) + { + error = BadAlloc; + goto PatchUp; + } + } + + pOldCursor = 0; + if (pCursor == (CursorPtr) None) + { + pWin->cursorIsNone = TRUE; + if (pWin->optional) + { + pOldCursor = pWin->optional->cursor; + pWin->optional->cursor = (CursorPtr) None; + checkOptional = TRUE; + } + } else { + if (!pWin->optional) + { + if (!MakeWindowOptional (pWin)) + { + error = BadAlloc; + goto PatchUp; + } + } + else if (pWin->parent && pCursor == wCursor (pWin->parent)) + checkOptional = TRUE; + pOldCursor = pWin->optional->cursor; + pWin->optional->cursor = pCursor; + pCursor->refcnt++; + pWin->cursorIsNone = FALSE; + /* + * check on any children now matching the new cursor + */ + + for (pChild=pWin->firstChild; pChild; pChild=pChild->nextSib) + { + if (pChild->optional && + (pChild->optional->cursor == pCursor)) + CheckWindowOptionalNeed (pChild); + } + } + + if (pWin->realized) + WindowHasNewCursor( pWin); + + /* Can't free cursor until here - old cursor + * is needed in WindowHasNewCursor + */ + if (pOldCursor) + FreeCursor (pOldCursor, (Cursor)0); + } + break; + default: + error = BadValue; + client->errorValue = vmask; + goto PatchUp; + } + vmaskCopy |= index2; + } +PatchUp: + if (checkOptional) + CheckWindowOptionalNeed (pWin); + + /* We SHOULD check for an error value here XXX */ + (*pScreen->ChangeWindowAttributes)(pWin, vmaskCopy); + + /* + If the border contents have changed, redraw the border. + Note that this has to be done AFTER pScreen->ChangeWindowAttributes + for the tile to be rotated, and the correct function selected. + */ + if (((vmaskCopy & (CWBorderPixel | CWBorderPixmap)) || borderRelative) + && pWin->viewable && HasBorder (pWin)) + { + RegionRec exposed; + + REGION_NULL(pScreen, &exposed); + REGION_SUBTRACT(pScreen, &exposed, &pWin->borderClip, &pWin->winSize); + miPaintWindow(pWin, &exposed, PW_BORDER); + REGION_UNINIT(pScreen, &exposed); + } + return error; +} + + +/***** + * GetWindowAttributes + * Notice that this is different than ChangeWindowAttributes + *****/ + +void +GetWindowAttributes(WindowPtr pWin, ClientPtr client, xGetWindowAttributesReply *wa) +{ + wa->type = X_Reply; + wa->bitGravity = pWin->bitGravity; + wa->winGravity = pWin->winGravity; + if (pWin->forcedBS && pWin->backingStore != Always) + wa->backingStore = NotUseful; + else + wa->backingStore = pWin->backingStore; + wa->length = (sizeof(xGetWindowAttributesReply) - + sizeof(xGenericReply)) >> 2; + wa->sequenceNumber = client->sequence; + wa->backingBitPlanes = wBackingBitPlanes (pWin); + wa->backingPixel = wBackingPixel (pWin); + wa->saveUnder = (BOOL)pWin->saveUnder; + wa->override = pWin->overrideRedirect; + if (!pWin->mapped) + wa->mapState = IsUnmapped; + else if (pWin->realized) + wa->mapState = IsViewable; + else + wa->mapState = IsUnviewable; + + wa->colormap = wColormap (pWin); + wa->mapInstalled = (wa->colormap == None) ? xFalse + : IsMapInstalled(wa->colormap, pWin); + + wa->yourEventMask = EventMaskForClient(pWin, client); + wa->allEventMasks = pWin->eventMask | wOtherEventMasks (pWin); + wa->doNotPropagateMask = wDontPropagateMask (pWin); + wa->class = pWin->drawable.class; + wa->visualID = wVisual (pWin); +} + + +_X_EXPORT WindowPtr +MoveWindowInStack(WindowPtr pWin, WindowPtr pNextSib) +{ + WindowPtr pParent = pWin->parent; + WindowPtr pFirstChange = pWin; /* highest window where list changes */ + + if (pWin->nextSib != pNextSib) + { + WindowPtr pOldNextSib = pWin->nextSib; + + if (!pNextSib) /* move to bottom */ + { + if (pParent->firstChild == pWin) + pParent->firstChild = pWin->nextSib; + /* if (pWin->nextSib) */ /* is always True: pNextSib == NULL + * and pWin->nextSib != pNextSib + * therefore pWin->nextSib != NULL */ + pFirstChange = pWin->nextSib; + pWin->nextSib->prevSib = pWin->prevSib; + if (pWin->prevSib) + pWin->prevSib->nextSib = pWin->nextSib; + pParent->lastChild->nextSib = pWin; + pWin->prevSib = pParent->lastChild; + pWin->nextSib = NullWindow; + pParent->lastChild = pWin; + } + else if (pParent->firstChild == pNextSib) /* move to top */ + { + pFirstChange = pWin; + if (pParent->lastChild == pWin) + pParent->lastChild = pWin->prevSib; + if (pWin->nextSib) + pWin->nextSib->prevSib = pWin->prevSib; + if (pWin->prevSib) + pWin->prevSib->nextSib = pWin->nextSib; + pWin->nextSib = pParent->firstChild; + pWin->prevSib = (WindowPtr ) NULL; + pNextSib->prevSib = pWin; + pParent->firstChild = pWin; + } + else /* move in middle of list */ + { + WindowPtr pOldNext = pWin->nextSib; + + pFirstChange = NullWindow; + if (pParent->firstChild == pWin) + pFirstChange = pParent->firstChild = pWin->nextSib; + if (pParent->lastChild == pWin) { + pFirstChange = pWin; + pParent->lastChild = pWin->prevSib; + } + if (pWin->nextSib) + pWin->nextSib->prevSib = pWin->prevSib; + if (pWin->prevSib) + pWin->prevSib->nextSib = pWin->nextSib; + pWin->nextSib = pNextSib; + pWin->prevSib = pNextSib->prevSib; + if (pNextSib->prevSib) + pNextSib->prevSib->nextSib = pWin; + pNextSib->prevSib = pWin; + if (!pFirstChange) { /* do we know it yet? */ + pFirstChange = pParent->firstChild; /* no, search from top */ + while ((pFirstChange != pWin) && (pFirstChange != pOldNext)) + pFirstChange = pFirstChange->nextSib; + } + } + if(pWin->drawable.pScreen->RestackWindow) + (*pWin->drawable.pScreen->RestackWindow)(pWin, pOldNextSib); + } + +#ifdef ROOTLESS + /* + * In rootless mode we can't optimize away window restacks. + * There may be non-X windows around, so even if the window + * is in the correct position from X's point of view, + * the underlying window system may want to reorder it. + */ + else if (pWin->drawable.pScreen->RestackWindow) + (*pWin->drawable.pScreen->RestackWindow)(pWin, pWin->nextSib); +#endif + + return( pFirstChange ); +} + +_X_EXPORT RegionPtr +CreateUnclippedWinSize (WindowPtr pWin) +{ + RegionPtr pRgn; + BoxRec box; + + box.x1 = pWin->drawable.x; + box.y1 = pWin->drawable.y; + box.x2 = pWin->drawable.x + (int) pWin->drawable.width; + box.y2 = pWin->drawable.y + (int) pWin->drawable.height; + pRgn = REGION_CREATE(pWin->drawable.pScreen, &box, 1); +#ifdef SHAPE + if (wBoundingShape (pWin) || wClipShape (pWin)) { + ScreenPtr pScreen; + pScreen = pWin->drawable.pScreen; + + REGION_TRANSLATE(pScreen, pRgn, - pWin->drawable.x, + - pWin->drawable.y); + if (wBoundingShape (pWin)) + REGION_INTERSECT(pScreen, pRgn, pRgn, wBoundingShape (pWin)); + if (wClipShape (pWin)) + REGION_INTERSECT(pScreen, pRgn, pRgn, wClipShape (pWin)); + REGION_TRANSLATE(pScreen, pRgn, pWin->drawable.x, pWin->drawable.y); + } +#endif + return pRgn; +} + +_X_EXPORT void +SetWinSize (WindowPtr pWin) +{ +#ifdef COMPOSITE + if (pWin->redirectDraw != RedirectDrawNone) + { + BoxRec box; + + /* + * Redirected clients get clip list equal to their + * own geometry, not clipped to their parent + */ + box.x1 = pWin->drawable.x; + box.y1 = pWin->drawable.y; + box.x2 = pWin->drawable.x + pWin->drawable.width; + box.y2 = pWin->drawable.y + pWin->drawable.height; + REGION_RESET (pScreen, &pWin->winSize, &box); + } + else +#endif + ClippedRegionFromBox(pWin->parent, &pWin->winSize, + pWin->drawable.x, pWin->drawable.y, + (int)pWin->drawable.width, + (int)pWin->drawable.height); +#ifdef SHAPE + if (wBoundingShape (pWin) || wClipShape (pWin)) { + ScreenPtr pScreen; + pScreen = pWin->drawable.pScreen; + + REGION_TRANSLATE(pScreen, &pWin->winSize, - pWin->drawable.x, + - pWin->drawable.y); + if (wBoundingShape (pWin)) + REGION_INTERSECT(pScreen, &pWin->winSize, &pWin->winSize, + wBoundingShape (pWin)); + if (wClipShape (pWin)) + REGION_INTERSECT(pScreen, &pWin->winSize, &pWin->winSize, + wClipShape (pWin)); + REGION_TRANSLATE(pScreen, &pWin->winSize, pWin->drawable.x, + pWin->drawable.y); + } +#endif +} + +_X_EXPORT void +SetBorderSize (WindowPtr pWin) +{ + int bw; + + if (HasBorder (pWin)) { + bw = wBorderWidth (pWin); +#ifdef COMPOSITE + if (pWin->redirectDraw != RedirectDrawNone) + { + BoxRec box; + + /* + * Redirected clients get clip list equal to their + * own geometry, not clipped to their parent + */ + box.x1 = pWin->drawable.x - bw; + box.y1 = pWin->drawable.y - bw; + box.x2 = pWin->drawable.x + pWin->drawable.width + bw; + box.y2 = pWin->drawable.y + pWin->drawable.height + bw; + REGION_RESET (pScreen, &pWin->borderSize, &box); + } + else +#endif + ClippedRegionFromBox(pWin->parent, &pWin->borderSize, + pWin->drawable.x - bw, pWin->drawable.y - bw, + (int)(pWin->drawable.width + (bw<<1)), + (int)(pWin->drawable.height + (bw<<1))); +#ifdef SHAPE + if (wBoundingShape (pWin)) { + ScreenPtr pScreen; + pScreen = pWin->drawable.pScreen; + + REGION_TRANSLATE(pScreen, &pWin->borderSize, - pWin->drawable.x, + - pWin->drawable.y); + REGION_INTERSECT(pScreen, &pWin->borderSize, &pWin->borderSize, + wBoundingShape (pWin)); + REGION_TRANSLATE(pScreen, &pWin->borderSize, pWin->drawable.x, + pWin->drawable.y); + REGION_UNION(pScreen, &pWin->borderSize, &pWin->borderSize, + &pWin->winSize); + } +#endif + } else { + REGION_COPY(pWin->drawable.pScreen, &pWin->borderSize, + &pWin->winSize); + } +} + +/** + * + * \param x,y new window position + * \param oldx,oldy old window position + * \param destx,desty position relative to gravity + */ + +_X_EXPORT void +GravityTranslate (int x, int y, int oldx, int oldy, + int dw, int dh, unsigned gravity, + int *destx, int *desty) +{ + switch (gravity) { + case NorthGravity: + *destx = x + dw / 2; + *desty = y; + break; + case NorthEastGravity: + *destx = x + dw; + *desty = y; + break; + case WestGravity: + *destx = x; + *desty = y + dh / 2; + break; + case CenterGravity: + *destx = x + dw / 2; + *desty = y + dh / 2; + break; + case EastGravity: + *destx = x + dw; + *desty = y + dh / 2; + break; + case SouthWestGravity: + *destx = x; + *desty = y + dh; + break; + case SouthGravity: + *destx = x + dw / 2; + *desty = y + dh; + break; + case SouthEastGravity: + *destx = x + dw; + *desty = y + dh; + break; + case StaticGravity: + *destx = oldx; + *desty = oldy; + break; + default: + *destx = x; + *desty = y; + break; + } +} + +/* XXX need to retile border on each window with ParentRelative origin */ +_X_EXPORT void +ResizeChildrenWinSize(WindowPtr pWin, int dx, int dy, int dw, int dh) +{ + ScreenPtr pScreen; + WindowPtr pSib, pChild; + Bool resized = (dw || dh); + + pScreen = pWin->drawable.pScreen; + + for (pSib = pWin->firstChild; pSib; pSib = pSib->nextSib) + { + if (resized && (pSib->winGravity > NorthWestGravity)) + { + int cwsx, cwsy; + + cwsx = pSib->origin.x; + cwsy = pSib->origin.y; + GravityTranslate (cwsx, cwsy, cwsx - dx, cwsy - dy, dw, dh, + pSib->winGravity, &cwsx, &cwsy); + if (cwsx != pSib->origin.x || cwsy != pSib->origin.y) + { + xEvent event; + + event.u.u.type = GravityNotify; + event.u.gravity.window = pSib->drawable.id; + event.u.gravity.x = cwsx - wBorderWidth (pSib); + event.u.gravity.y = cwsy - wBorderWidth (pSib); + DeliverEvents (pSib, &event, 1, NullWindow); + pSib->origin.x = cwsx; + pSib->origin.y = cwsy; + } + } + pSib->drawable.x = pWin->drawable.x + pSib->origin.x; + pSib->drawable.y = pWin->drawable.y + pSib->origin.y; + SetWinSize (pSib); + SetBorderSize (pSib); + (*pScreen->PositionWindow)(pSib, pSib->drawable.x, pSib->drawable.y); + + if ( (pChild = pSib->firstChild) ) + { + while (1) + { + pChild->drawable.x = pChild->parent->drawable.x + + pChild->origin.x; + pChild->drawable.y = pChild->parent->drawable.y + + pChild->origin.y; + SetWinSize (pChild); + SetBorderSize (pChild); + (*pScreen->PositionWindow)(pChild, + pChild->drawable.x, pChild->drawable.y); + if (pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + while (!pChild->nextSib && (pChild != pSib)) + pChild = pChild->parent; + if (pChild == pSib) + break; + pChild = pChild->nextSib; + } + } + } +} + +#define GET_INT16(m, f) \ + if (m & mask) \ + { \ + f = (INT16) *pVlist;\ + pVlist++; \ + } +#define GET_CARD16(m, f) \ + if (m & mask) \ + { \ + f = (CARD16) *pVlist;\ + pVlist++;\ + } + +#define GET_CARD8(m, f) \ + if (m & mask) \ + { \ + f = (CARD8) *pVlist;\ + pVlist++;\ + } + +#define ChangeMask ((Mask)(CWX | CWY | CWWidth | CWHeight)) + +#define IllegalInputOnlyConfigureMask (CWBorderWidth) + +/* + * IsSiblingAboveMe + * returns Above if pSib above pMe in stack or Below otherwise + */ + +static int +IsSiblingAboveMe( + WindowPtr pMe, + WindowPtr pSib) +{ + WindowPtr pWin; + + pWin = pMe->parent->firstChild; + while (pWin) + { + if (pWin == pSib) + return(Above); + else if (pWin == pMe) + return(Below); + pWin = pWin->nextSib; + } + return(Below); +} + +static BoxPtr +WindowExtents( + WindowPtr pWin, + BoxPtr pBox) +{ + pBox->x1 = pWin->drawable.x - wBorderWidth (pWin); + pBox->y1 = pWin->drawable.y - wBorderWidth (pWin); + pBox->x2 = pWin->drawable.x + (int)pWin->drawable.width + + wBorderWidth (pWin); + pBox->y2 = pWin->drawable.y + (int)pWin->drawable.height + + wBorderWidth (pWin); + return(pBox); +} + +#ifdef SHAPE +#define IS_SHAPED(pWin) (wBoundingShape (pWin) != (RegionPtr) NULL) + +static RegionPtr +MakeBoundingRegion ( + WindowPtr pWin, + BoxPtr pBox) +{ + RegionPtr pRgn; + ScreenPtr pScreen; + pScreen = pWin->drawable.pScreen; + + pRgn = REGION_CREATE(pScreen, pBox, 1); + if (wBoundingShape (pWin)) { + REGION_TRANSLATE(pScreen, pRgn, -pWin->origin.x, + -pWin->origin.y); + REGION_INTERSECT(pScreen, pRgn, pRgn, wBoundingShape (pWin)); + REGION_TRANSLATE(pScreen, pRgn, pWin->origin.x, + pWin->origin.y); + } + return pRgn; +} + +static Bool +ShapeOverlap ( + WindowPtr pWin, + BoxPtr pWinBox, + WindowPtr pSib, + BoxPtr pSibBox) +{ + RegionPtr pWinRgn, pSibRgn; + ScreenPtr pScreen; + Bool ret; + + if (!IS_SHAPED(pWin) && !IS_SHAPED(pSib)) + return TRUE; + pScreen = pWin->drawable.pScreen; + pWinRgn = MakeBoundingRegion (pWin, pWinBox); + pSibRgn = MakeBoundingRegion (pSib, pSibBox); + REGION_INTERSECT(pScreen, pWinRgn, pWinRgn, pSibRgn); + ret = REGION_NOTEMPTY(pScreen, pWinRgn); + REGION_DESTROY(pScreen, pWinRgn); + REGION_DESTROY(pScreen, pSibRgn); + return ret; +} +#endif + +static Bool +AnyWindowOverlapsMe( + WindowPtr pWin, + WindowPtr pHead, + BoxPtr box) +{ + WindowPtr pSib; + BoxRec sboxrec; + BoxPtr sbox; + + for (pSib = pWin->prevSib; pSib != pHead; pSib = pSib->prevSib) + { + if (pSib->mapped) + { + sbox = WindowExtents(pSib, &sboxrec); + if (BOXES_OVERLAP(sbox, box) +#ifdef SHAPE + && ShapeOverlap (pWin, box, pSib, sbox) +#endif + ) + return(TRUE); + } + } + return(FALSE); +} + +static Bool +IOverlapAnyWindow( + WindowPtr pWin, + BoxPtr box) +{ + WindowPtr pSib; + BoxRec sboxrec; + BoxPtr sbox; + + for (pSib = pWin->nextSib; pSib; pSib = pSib->nextSib) + { + if (pSib->mapped) + { + sbox = WindowExtents(pSib, &sboxrec); + if (BOXES_OVERLAP(sbox, box) +#ifdef SHAPE + && ShapeOverlap (pWin, box, pSib, sbox) +#endif + ) + return(TRUE); + } + } + return(FALSE); +} + +/* + * WhereDoIGoInTheStack() + * Given pWin and pSib and the relationshipe smode, return + * the window that pWin should go ABOVE. + * If a pSib is specified: + * Above: pWin is placed just above pSib + * Below: pWin is placed just below pSib + * TopIf: if pSib occludes pWin, then pWin is placed + * at the top of the stack + * BottomIf: if pWin occludes pSib, then pWin is + * placed at the bottom of the stack + * Opposite: if pSib occludes pWin, then pWin is placed at the + * top of the stack, else if pWin occludes pSib, then + * pWin is placed at the bottom of the stack + * + * If pSib is NULL: + * Above: pWin is placed at the top of the stack + * Below: pWin is placed at the bottom of the stack + * TopIf: if any sibling occludes pWin, then pWin is placed at + * the top of the stack + * BottomIf: if pWin occludes any sibline, then pWin is placed at + * the bottom of the stack + * Opposite: if any sibling occludes pWin, then pWin is placed at + * the top of the stack, else if pWin occludes any + * sibling, then pWin is placed at the bottom of the stack + * + */ + +static WindowPtr +WhereDoIGoInTheStack( + WindowPtr pWin, + WindowPtr pSib, + short x, + short y, + unsigned short w, + unsigned short h, + int smode) +{ + BoxRec box; + ScreenPtr pScreen; + WindowPtr pHead, pFirst; + + if ((pWin == pWin->parent->firstChild) && + (pWin == pWin->parent->lastChild)) + return((WindowPtr ) NULL); + pHead = RealChildHead(pWin->parent); + pFirst = pHead ? pHead->nextSib : pWin->parent->firstChild; + pScreen = pWin->drawable.pScreen; + box.x1 = x; + box.y1 = y; + box.x2 = x + (int)w; + box.y2 = y + (int)h; + switch (smode) + { + case Above: + if (pSib) + return(pSib); + else if (pWin == pFirst) + return(pWin->nextSib); + else + return(pFirst); + case Below: + if (pSib) + if (pSib->nextSib != pWin) + return(pSib->nextSib); + else + return(pWin->nextSib); + else + return NullWindow; + case TopIf: + if ((!pWin->mapped || (pSib && !pSib->mapped))) + return(pWin->nextSib); + else if (pSib) + { + if ((IsSiblingAboveMe(pWin, pSib) == Above) && + (RECT_IN_REGION(pScreen, &pSib->borderSize, &box) != rgnOUT)) + return(pFirst); + else + return(pWin->nextSib); + } + else if (AnyWindowOverlapsMe(pWin, pHead, &box)) + return(pFirst); + else + return(pWin->nextSib); + case BottomIf: + if ((!pWin->mapped || (pSib && !pSib->mapped))) + return(pWin->nextSib); + else if (pSib) + { + if ((IsSiblingAboveMe(pWin, pSib) == Below) && + (RECT_IN_REGION(pScreen, &pSib->borderSize, &box) != rgnOUT)) + return NullWindow; + else + return(pWin->nextSib); + } + else if (IOverlapAnyWindow(pWin, &box)) + return NullWindow; + else + return(pWin->nextSib); + case Opposite: + if ((!pWin->mapped || (pSib && !pSib->mapped))) + return(pWin->nextSib); + else if (pSib) + { + if (RECT_IN_REGION(pScreen, &pSib->borderSize, &box) != rgnOUT) + { + if (IsSiblingAboveMe(pWin, pSib) == Above) + return(pFirst); + else + return NullWindow; + } + else + return(pWin->nextSib); + } + else if (AnyWindowOverlapsMe(pWin, pHead, &box)) + { + /* If I'm occluded, I can't possibly be the first child + * if (pWin == pWin->parent->firstChild) + * return pWin->nextSib; + */ + return(pFirst); + } + else if (IOverlapAnyWindow(pWin, &box)) + return NullWindow; + else + return pWin->nextSib; + default: + { + /* should never happen; make something up. */ + return pWin->nextSib; + } + } +} + +static void +ReflectStackChange( + WindowPtr pWin, + WindowPtr pSib, + VTKind kind) +{ +/* Note that pSib might be NULL */ + + Bool WasViewable = (Bool)pWin->viewable; + Bool anyMarked; + WindowPtr pFirstChange; +#ifdef DO_SAVE_UNDERS + Bool dosave = FALSE; +#endif + WindowPtr pLayerWin; + ScreenPtr pScreen = pWin->drawable.pScreen; + + /* if this is a root window, can't be restacked */ + if (!pWin->parent) + return; + + pFirstChange = MoveWindowInStack(pWin, pSib); + + if (WasViewable) + { + anyMarked = (*pScreen->MarkOverlappedWindows)(pWin, pFirstChange, + &pLayerWin); + if (pLayerWin != pWin) pFirstChange = pLayerWin; +#ifdef DO_SAVE_UNDERS + if (DO_SAVE_UNDERS(pWin)) + { + dosave = (*pScreen->ChangeSaveUnder)(pLayerWin, pFirstChange); + } +#endif /* DO_SAVE_UNDERS */ + if (anyMarked) + { + (*pScreen->ValidateTree)(pLayerWin->parent, pFirstChange, kind); + (*pScreen->HandleExposures)(pLayerWin->parent); + } +#ifdef DO_SAVE_UNDERS + if (dosave) + (*pScreen->PostChangeSaveUnder)(pLayerWin, pFirstChange); +#endif /* DO_SAVE_UNDERS */ + if (anyMarked && pWin->drawable.pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(pLayerWin->parent, pFirstChange, kind); + } + if (pWin->realized) + WindowsRestructured (); +} + +/***** + * ConfigureWindow + *****/ + +int +ConfigureWindow(WindowPtr pWin, Mask mask, XID *vlist, ClientPtr client) +{ +#define RESTACK_WIN 0 +#define MOVE_WIN 1 +#define RESIZE_WIN 2 +#define REBORDER_WIN 3 + WindowPtr pSib = NullWindow; + WindowPtr pParent = pWin->parent; + Window sibwid = 0; + Mask index2, tmask; + XID *pVlist; + short x, y, beforeX, beforeY; + unsigned short w = pWin->drawable.width, + h = pWin->drawable.height, + bw = pWin->borderWidth; + int rc, action, smode = Above; +#ifdef XAPPGROUP + ClientPtr win_owner; + ClientPtr ag_leader = NULL; +#endif + xEvent event; + + if ((pWin->drawable.class == InputOnly) && (mask & IllegalInputOnlyConfigureMask)) + return(BadMatch); + + if ((mask & CWSibling) && !(mask & CWStackMode)) + return(BadMatch); + + pVlist = vlist; + + if (pParent) + { + x = pWin->drawable.x - pParent->drawable.x - (int)bw; + y = pWin->drawable.y - pParent->drawable.y - (int)bw; + } + else + { + x = pWin->drawable.x; + y = pWin->drawable.y; + } + beforeX = x; + beforeY = y; + action = RESTACK_WIN; + if ((mask & (CWX | CWY)) && (!(mask & (CWHeight | CWWidth)))) + { + GET_INT16(CWX, x); + GET_INT16(CWY, y); + action = MOVE_WIN; + } + /* or should be resized */ + else if (mask & (CWX | CWY | CWWidth | CWHeight)) + { + GET_INT16(CWX, x); + GET_INT16(CWY, y); + GET_CARD16(CWWidth, w); + GET_CARD16 (CWHeight, h); + if (!w || !h) + { + client->errorValue = 0; + return BadValue; + } + action = RESIZE_WIN; + } + tmask = mask & ~ChangeMask; + while (tmask) + { + index2 = (Mask)lowbit (tmask); + tmask &= ~index2; + switch (index2) + { + case CWBorderWidth: + GET_CARD16(CWBorderWidth, bw); + break; + case CWSibling: + sibwid = (Window ) *pVlist; + pVlist++; + rc = dixLookupWindow(&pSib, sibwid, client, DixGetAttrAccess); + if (rc != Success) + { + client->errorValue = sibwid; + return rc; + } + if (pSib->parent != pParent) + return(BadMatch); + if (pSib == pWin) + return(BadMatch); + break; + case CWStackMode: + GET_CARD8(CWStackMode, smode); + if ((smode != TopIf) && (smode != BottomIf) && + (smode != Opposite) && (smode != Above) && (smode != Below)) + { + client->errorValue = smode; + return(BadValue); + } + break; + default: + client->errorValue = mask; + return(BadValue); + } + } + /* root really can't be reconfigured, so just return */ + if (!pParent) + return Success; + + /* Figure out if the window should be moved. Doesnt + make the changes to the window if event sent */ + + if (mask & CWStackMode) + pSib = WhereDoIGoInTheStack(pWin, pSib, pParent->drawable.x + x, + pParent->drawable.y + y, + w + (bw << 1), h + (bw << 1), smode); + else + pSib = pWin->nextSib; + +#ifdef XAPPGROUP + win_owner = clients[CLIENT_ID(pWin->drawable.id)]; + ag_leader = XagLeader (win_owner); +#endif + + if ((!pWin->overrideRedirect) && + (RedirectSend(pParent) +#ifdef XAPPGROUP + || (win_owner->appgroup && ag_leader && + XagIsControlledRoot (client, pParent)) +#endif + )) + { + event.u.u.type = ConfigureRequest; + event.u.configureRequest.window = pWin->drawable.id; + if (mask & CWSibling) + event.u.configureRequest.sibling = sibwid; + else + event.u.configureRequest.sibling = None; + if (mask & CWStackMode) + event.u.u.detail = smode; + else + event.u.u.detail = Above; + event.u.configureRequest.x = x; + event.u.configureRequest.y = y; +#ifdef PANORAMIX + if(!noPanoramiXExtension && (!pParent || !pParent->parent)) { + event.u.configureRequest.x += panoramiXdataPtr[0].x; + event.u.configureRequest.y += panoramiXdataPtr[0].y; + } +#endif + event.u.configureRequest.width = w; + event.u.configureRequest.height = h; + event.u.configureRequest.borderWidth = bw; + event.u.configureRequest.valueMask = mask; +#ifdef XAPPGROUP + /* make sure if the ag_leader maps the window it goes to the wm */ + if (ag_leader && ag_leader != client && + XagIsControlledRoot (client, pParent)) { + event.u.configureRequest.parent = XagId (win_owner); + (void) TryClientEvents (ag_leader, &event, 1, + NoEventMask, NoEventMask, NullGrab); + return Success; + } +#endif + event.u.configureRequest.parent = pParent->drawable.id; + if (MaybeDeliverEventsToClient(pParent, &event, 1, + SubstructureRedirectMask, client) == 1) + return(Success); + } + if (action == RESIZE_WIN) + { + Bool size_change = (w != pWin->drawable.width) + || (h != pWin->drawable.height); + if (size_change && ((pWin->eventMask|wOtherEventMasks(pWin)) & ResizeRedirectMask)) + { + xEvent eventT; + eventT.u.u.type = ResizeRequest; + eventT.u.resizeRequest.window = pWin->drawable.id; + eventT.u.resizeRequest.width = w; + eventT.u.resizeRequest.height = h; + if (MaybeDeliverEventsToClient(pWin, &eventT, 1, + ResizeRedirectMask, client) == 1) + { + /* if event is delivered, leave the actual size alone. */ + w = pWin->drawable.width; + h = pWin->drawable.height; + size_change = FALSE; + } + } + if (!size_change) + { + if (mask & (CWX | CWY)) + action = MOVE_WIN; + else if (mask & (CWStackMode | CWBorderWidth)) + action = RESTACK_WIN; + else /* really nothing to do */ + return(Success) ; + } + } + + if (action == RESIZE_WIN) + /* we've already checked whether there's really a size change */ + goto ActuallyDoSomething; + if ((mask & CWX) && (x != beforeX)) + goto ActuallyDoSomething; + if ((mask & CWY) && (y != beforeY)) + goto ActuallyDoSomething; + if ((mask & CWBorderWidth) && (bw != wBorderWidth (pWin))) + goto ActuallyDoSomething; + if (mask & CWStackMode) + { +#ifndef ROOTLESS + /* See above for why we always reorder in rootless mode. */ + if (pWin->nextSib != pSib) +#endif + goto ActuallyDoSomething; + } + return(Success); + +ActuallyDoSomething: + if (SubStrSend(pWin, pParent)) + { + event.u.u.type = ConfigureNotify; + event.u.configureNotify.window = pWin->drawable.id; + if (pSib) + event.u.configureNotify.aboveSibling = pSib->drawable.id; + else + event.u.configureNotify.aboveSibling = None; + event.u.configureNotify.x = x; + event.u.configureNotify.y = y; +#ifdef PANORAMIX + if(!noPanoramiXExtension && (!pParent || !pParent->parent)) { + event.u.configureNotify.x += panoramiXdataPtr[0].x; + event.u.configureNotify.y += panoramiXdataPtr[0].y; + } +#endif + event.u.configureNotify.width = w; + event.u.configureNotify.height = h; + event.u.configureNotify.borderWidth = bw; + event.u.configureNotify.override = pWin->overrideRedirect; + DeliverEvents(pWin, &event, 1, NullWindow); + } + if (mask & CWBorderWidth) + { + if (action == RESTACK_WIN) + { + action = MOVE_WIN; + pWin->borderWidth = bw; + } + else if ((action == MOVE_WIN) && + (beforeX + wBorderWidth (pWin) == x + (int)bw) && + (beforeY + wBorderWidth (pWin) == y + (int)bw)) + { + action = REBORDER_WIN; + (*pWin->drawable.pScreen->ChangeBorderWidth)(pWin, bw); + } + else + pWin->borderWidth = bw; + } + if (action == MOVE_WIN) + (*pWin->drawable.pScreen->MoveWindow)(pWin, x, y, pSib, + (mask & CWBorderWidth) ? VTOther : VTMove); + else if (action == RESIZE_WIN) + (*pWin->drawable.pScreen->ResizeWindow)(pWin, x, y, w, h, pSib); + else if (mask & CWStackMode) + ReflectStackChange(pWin, pSib, VTOther); + + if (action != RESTACK_WIN) + CheckCursorConfinement(pWin); + return(Success); +#undef RESTACK_WIN +#undef MOVE_WIN +#undef RESIZE_WIN +#undef REBORDER_WIN +} + + +/****** + * + * CirculateWindow + * For RaiseLowest, raises the lowest mapped child (if any) that is + * obscured by another child to the top of the stack. For LowerHighest, + * lowers the highest mapped child (if any) that is obscuring another + * child to the bottom of the stack. Exposure processing is performed + * + ******/ + +int +CirculateWindow(WindowPtr pParent, int direction, ClientPtr client) +{ + WindowPtr pWin, pHead, pFirst; + xEvent event; + BoxRec box; + + pHead = RealChildHead(pParent); + pFirst = pHead ? pHead->nextSib : pParent->firstChild; + if (direction == RaiseLowest) + { + for (pWin = pParent->lastChild; + (pWin != pHead) && + !(pWin->mapped && + AnyWindowOverlapsMe(pWin, pHead, WindowExtents(pWin, &box))); + pWin = pWin->prevSib) ; + if (pWin == pHead) + return Success; + } + else + { + for (pWin = pFirst; + pWin && + !(pWin->mapped && + IOverlapAnyWindow(pWin, WindowExtents(pWin, &box))); + pWin = pWin->nextSib) ; + if (!pWin) + return Success; + } + + event.u.circulate.window = pWin->drawable.id; + event.u.circulate.parent = pParent->drawable.id; + event.u.circulate.event = pParent->drawable.id; + if (direction == RaiseLowest) + event.u.circulate.place = PlaceOnTop; + else + event.u.circulate.place = PlaceOnBottom; + + if (RedirectSend(pParent)) + { + event.u.u.type = CirculateRequest; + if (MaybeDeliverEventsToClient(pParent, &event, 1, + SubstructureRedirectMask, client) == 1) + return(Success); + } + + event.u.u.type = CirculateNotify; + DeliverEvents(pWin, &event, 1, NullWindow); + ReflectStackChange(pWin, + (direction == RaiseLowest) ? pFirst : NullWindow, + VTStack); + + return(Success); +} + +static int +CompareWIDs( + WindowPtr pWin, + pointer value) /* must conform to VisitWindowProcPtr */ +{ + Window *wid = (Window *)value; + + if (pWin->drawable.id == *wid) + return(WT_STOPWALKING); + else + return(WT_WALKCHILDREN); +} + +/***** + * ReparentWindow + *****/ + +int +ReparentWindow(WindowPtr pWin, WindowPtr pParent, + int x, int y, ClientPtr client) +{ + WindowPtr pPrev, pPriorParent; + Bool WasMapped = (Bool)(pWin->mapped); + xEvent event; + int bw = wBorderWidth (pWin); + ScreenPtr pScreen; + + pScreen = pWin->drawable.pScreen; + if (TraverseTree(pWin, CompareWIDs, (pointer)&pParent->drawable.id) == WT_STOPWALKING) + return(BadMatch); + if (!MakeWindowOptional(pWin)) + return(BadAlloc); + + if (WasMapped) + UnmapWindow(pWin, FALSE); + + event.u.u.type = ReparentNotify; + event.u.reparent.window = pWin->drawable.id; + event.u.reparent.parent = pParent->drawable.id; + event.u.reparent.x = x; + event.u.reparent.y = y; +#ifdef PANORAMIX + if(!noPanoramiXExtension && !pParent->parent) { + event.u.reparent.x += panoramiXdataPtr[0].x; + event.u.reparent.y += panoramiXdataPtr[0].y; + } +#endif + event.u.reparent.override = pWin->overrideRedirect; + DeliverEvents(pWin, &event, 1, pParent); + + /* take out of sibling chain */ + + pPriorParent = pPrev = pWin->parent; + if (pPrev->firstChild == pWin) + pPrev->firstChild = pWin->nextSib; + if (pPrev->lastChild == pWin) + pPrev->lastChild = pWin->prevSib; + + if (pWin->nextSib) + pWin->nextSib->prevSib = pWin->prevSib; + if (pWin->prevSib) + pWin->prevSib->nextSib = pWin->nextSib; + + /* insert at begining of pParent */ + pWin->parent = pParent; + pPrev = RealChildHead(pParent); + if (pPrev) + { + pWin->nextSib = pPrev->nextSib; + if (pPrev->nextSib) + pPrev->nextSib->prevSib = pWin; + else + pParent->lastChild = pWin; + pPrev->nextSib = pWin; + pWin->prevSib = pPrev; + } + else + { + pWin->nextSib = pParent->firstChild; + pWin->prevSib = NullWindow; + if (pParent->firstChild) + pParent->firstChild->prevSib = pWin; + else + pParent->lastChild = pWin; + pParent->firstChild = pWin; + } + + pWin->origin.x = x + bw; + pWin->origin.y = y + bw; + pWin->drawable.x = x + bw + pParent->drawable.x; + pWin->drawable.y = y + bw + pParent->drawable.y; + + /* clip to parent */ + SetWinSize (pWin); + SetBorderSize (pWin); + + if (pScreen->ReparentWindow) + (*pScreen->ReparentWindow)(pWin, pPriorParent); + (*pScreen->PositionWindow)(pWin, pWin->drawable.x, pWin->drawable.y); + ResizeChildrenWinSize(pWin, 0, 0, 0, 0); + + CheckWindowOptionalNeed(pWin); + + if (WasMapped) + MapWindow(pWin, client); + RecalculateDeliverableEvents(pWin); + return(Success); +} + +static void +RealizeTree(WindowPtr pWin) +{ + WindowPtr pChild; + RealizeWindowProcPtr Realize; + + Realize = pWin->drawable.pScreen->RealizeWindow; + pChild = pWin; + while (1) + { + if (pChild->mapped) + { + pChild->realized = TRUE; +#ifdef DO_SAVE_UNDERS + if (pChild->saveUnder) + deltaSaveUndersViewable++; +#endif + pChild->viewable = (pChild->drawable.class == InputOutput); + (* Realize)(pChild); + if (pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + } + while (!pChild->nextSib && (pChild != pWin)) + pChild = pChild->parent; + if (pChild == pWin) + return; + pChild = pChild->nextSib; + } +} + +static WindowPtr windowDisableMapUnmapEvents; + +void +DisableMapUnmapEvents(WindowPtr pWin) +{ + assert (windowDisableMapUnmapEvents == NULL); + + windowDisableMapUnmapEvents = pWin; +} + +void +EnableMapUnmapEvents(WindowPtr pWin) +{ + assert (windowDisableMapUnmapEvents != NULL); + + windowDisableMapUnmapEvents = NULL; +} + +static Bool +MapUnmapEventsEnabled(WindowPtr pWin) +{ + return pWin != windowDisableMapUnmapEvents; +} + +/***** + * MapWindow + * If some other client has selected SubStructureReDirect on the parent + * and override-redirect is xFalse, then a MapRequest event is generated, + * but the window remains unmapped. Otherwise, the window is mapped and a + * MapNotify event is generated. + *****/ + +_X_EXPORT int +MapWindow(WindowPtr pWin, ClientPtr client) +{ + ScreenPtr pScreen; + + WindowPtr pParent; +#ifdef DO_SAVE_UNDERS + Bool dosave = FALSE; +#endif + WindowPtr pLayerWin; + + if (pWin->mapped) + return(Success); + + /* general check for permission to map window */ + if (XaceHook(XACE_RESOURCE_ACCESS, client, pWin->drawable.id, RT_WINDOW, + pWin, RT_NONE, NULL, DixShowAccess) != Success) + return Success; + + pScreen = pWin->drawable.pScreen; + if ( (pParent = pWin->parent) ) + { + xEvent event; + Bool anyMarked; +#ifdef XAPPGROUP + ClientPtr win_owner = clients[CLIENT_ID(pWin->drawable.id)]; + ClientPtr ag_leader = XagLeader (win_owner); +#endif + + if ((!pWin->overrideRedirect) && + (RedirectSend(pParent) +#ifdef XAPPGROUP + || (win_owner->appgroup && ag_leader && + XagIsControlledRoot (client, pParent)) +#endif + )) + { + event.u.u.type = MapRequest; + event.u.mapRequest.window = pWin->drawable.id; +#ifdef XAPPGROUP + /* make sure if the ag_leader maps the window it goes to the wm */ + if (ag_leader && ag_leader != client && + XagIsControlledRoot (client, pParent)) { + event.u.mapRequest.parent = XagId (win_owner); + (void) TryClientEvents (ag_leader, &event, 1, + NoEventMask, NoEventMask, NullGrab); + return Success; + } +#endif + event.u.mapRequest.parent = pParent->drawable.id; + + if (MaybeDeliverEventsToClient(pParent, &event, 1, + SubstructureRedirectMask, client) == 1) + return(Success); + } + + pWin->mapped = TRUE; + if (SubStrSend(pWin, pParent) && MapUnmapEventsEnabled(pWin)) + { + event.u.u.type = MapNotify; + event.u.mapNotify.window = pWin->drawable.id; + event.u.mapNotify.override = pWin->overrideRedirect; + DeliverEvents(pWin, &event, 1, NullWindow); + } + + if (!pParent->realized) + return(Success); + RealizeTree(pWin); + if (pWin->viewable) + { + anyMarked = (*pScreen->MarkOverlappedWindows)(pWin, pWin, + &pLayerWin); +#ifdef DO_SAVE_UNDERS + if (DO_SAVE_UNDERS(pWin)) + { + dosave = (*pScreen->ChangeSaveUnder)(pLayerWin, pWin->nextSib); + } +#endif /* DO_SAVE_UNDERS */ + if (anyMarked) + { + (*pScreen->ValidateTree)(pLayerWin->parent, pLayerWin, VTMap); + (*pScreen->HandleExposures)(pLayerWin->parent); + } +#ifdef DO_SAVE_UNDERS + if (dosave) + (*pScreen->PostChangeSaveUnder)(pLayerWin, pWin->nextSib); +#endif /* DO_SAVE_UNDERS */ + if (anyMarked && pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(pLayerWin->parent, pLayerWin, VTMap); + } + WindowsRestructured (); + } + else + { + RegionRec temp; + + pWin->mapped = TRUE; + pWin->realized = TRUE; /* for roots */ + pWin->viewable = pWin->drawable.class == InputOutput; + /* We SHOULD check for an error value here XXX */ + (*pScreen->RealizeWindow)(pWin); + if (pScreen->ClipNotify) + (*pScreen->ClipNotify) (pWin, 0, 0); + if (pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(NullWindow, pWin, VTMap); + REGION_NULL(pScreen, &temp); + REGION_COPY(pScreen, &temp, &pWin->clipList); + (*pScreen->WindowExposures) (pWin, &temp, NullRegion); + REGION_UNINIT(pScreen, &temp); + } + + return(Success); +} + + +/***** + * MapSubwindows + * Performs a MapWindow all unmapped children of the window, in top + * to bottom stacking order. + *****/ + +void +MapSubwindows(WindowPtr pParent, ClientPtr client) +{ + WindowPtr pWin; + WindowPtr pFirstMapped = NullWindow; +#ifdef DO_SAVE_UNDERS + WindowPtr pFirstSaveUndered = NullWindow; +#endif + ScreenPtr pScreen; + Mask parentRedirect; + Mask parentNotify; + xEvent event; + Bool anyMarked; +#ifdef DO_SAVE_UNDERS + Bool dosave = FALSE; +#endif + WindowPtr pLayerWin; + + pScreen = pParent->drawable.pScreen; + parentRedirect = RedirectSend(pParent); + parentNotify = SubSend(pParent); + anyMarked = FALSE; + for (pWin = pParent->firstChild; pWin; pWin = pWin->nextSib) + { + if (!pWin->mapped) + { + if (parentRedirect && !pWin->overrideRedirect) + { + event.u.u.type = MapRequest; + event.u.mapRequest.window = pWin->drawable.id; + event.u.mapRequest.parent = pParent->drawable.id; + + if (MaybeDeliverEventsToClient(pParent, &event, 1, + SubstructureRedirectMask, client) == 1) + continue; + } + + pWin->mapped = TRUE; + if (parentNotify || StrSend(pWin)) + { + event.u.u.type = MapNotify; + event.u.mapNotify.window = pWin->drawable.id; + event.u.mapNotify.override = pWin->overrideRedirect; + DeliverEvents(pWin, &event, 1, NullWindow); + } + + if (!pFirstMapped) + pFirstMapped = pWin; + if (pParent->realized) + { + RealizeTree(pWin); + if (pWin->viewable) + { + anyMarked |= (*pScreen->MarkOverlappedWindows)(pWin, pWin, + (WindowPtr *)NULL); +#ifdef DO_SAVE_UNDERS + if (DO_SAVE_UNDERS(pWin)) + { + dosave = TRUE; + } +#endif /* DO_SAVE_UNDERS */ + } + } + } + } + + if (pFirstMapped) + { + pLayerWin = (*pScreen->GetLayerWindow)(pParent); + if (pLayerWin->parent != pParent) { + anyMarked |= (*pScreen->MarkOverlappedWindows)(pLayerWin, + pLayerWin, + (WindowPtr *)NULL); + pFirstMapped = pLayerWin; + } + if (anyMarked) + { +#ifdef DO_SAVE_UNDERS + if (pLayerWin->parent != pParent) + { + if (dosave || (DO_SAVE_UNDERS(pLayerWin))) + { + dosave = (*pScreen->ChangeSaveUnder)(pLayerWin, + pLayerWin); + } + } + else if (dosave) + { + dosave = FALSE; + for (pWin = pParent->firstChild; pWin; pWin = pWin->nextSib) + { + if (DO_SAVE_UNDERS(pWin)) + { + dosave |= (*pScreen->ChangeSaveUnder)(pWin, + pWin->nextSib); + if (dosave && !pFirstSaveUndered) + pFirstSaveUndered = pWin; + } + } + } +#endif /* DO_SAVE_UNDERS */ + (*pScreen->ValidateTree)(pLayerWin->parent, pFirstMapped, VTMap); + (*pScreen->HandleExposures)(pLayerWin->parent); + } +#ifdef DO_SAVE_UNDERS + if (dosave) + (*pScreen->PostChangeSaveUnder)(pLayerWin, + pFirstSaveUndered->nextSib); +#endif /* DO_SAVE_UNDERS */ + if (anyMarked && pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(pLayerWin->parent, pFirstMapped, + VTMap); + WindowsRestructured (); + } +} + +static void +UnrealizeTree( + WindowPtr pWin, + Bool fromConfigure) +{ + WindowPtr pChild; + UnrealizeWindowProcPtr Unrealize; + MarkUnrealizedWindowProcPtr MarkUnrealizedWindow; + + Unrealize = pWin->drawable.pScreen->UnrealizeWindow; + MarkUnrealizedWindow = pWin->drawable.pScreen->MarkUnrealizedWindow; + pChild = pWin; + while (1) + { + if (pChild->realized) + { + pChild->realized = FALSE; + pChild->visibility = VisibilityNotViewable; +#ifdef PANORAMIX + if(!noPanoramiXExtension && !pChild->drawable.pScreen->myNum) { + PanoramiXRes *win; + win = (PanoramiXRes*)LookupIDByType(pChild->drawable.id, + XRT_WINDOW); + if(win) + win->u.win.visibility = VisibilityNotViewable; + } +#endif + (* Unrealize)(pChild); + if (MapUnmapEventsEnabled(pWin)) + DeleteWindowFromAnyEvents(pChild, FALSE); + if (pChild->viewable) + { +#ifdef DO_SAVE_UNDERS + if (pChild->saveUnder) + deltaSaveUndersViewable--; +#endif + pChild->viewable = FALSE; + (* MarkUnrealizedWindow)(pChild, pWin, fromConfigure); + pChild->drawable.serialNumber = NEXT_SERIAL_NUMBER; + } + if (pChild->firstChild) + { + pChild = pChild->firstChild; + continue; + } + } + while (!pChild->nextSib && (pChild != pWin)) + pChild = pChild->parent; + if (pChild == pWin) + return; + pChild = pChild->nextSib; + } +} + +/***** + * UnmapWindow + * If the window is already unmapped, this request has no effect. + * Otherwise, the window is unmapped and an UnMapNotify event is + * generated. Cannot unmap a root window. + *****/ + +_X_EXPORT int +UnmapWindow(WindowPtr pWin, Bool fromConfigure) +{ + WindowPtr pParent; + xEvent event; + Bool wasRealized = (Bool)pWin->realized; + Bool wasViewable = (Bool)pWin->viewable; + ScreenPtr pScreen = pWin->drawable.pScreen; + WindowPtr pLayerWin = pWin; + + if ((!pWin->mapped) || (!(pParent = pWin->parent))) + return(Success); + if (SubStrSend(pWin, pParent) && MapUnmapEventsEnabled(pWin)) + { + event.u.u.type = UnmapNotify; + event.u.unmapNotify.window = pWin->drawable.id; + event.u.unmapNotify.fromConfigure = fromConfigure; + DeliverEvents(pWin, &event, 1, NullWindow); + } + if (wasViewable && !fromConfigure) + { + pWin->valdata = UnmapValData; + (*pScreen->MarkOverlappedWindows)(pWin, pWin->nextSib, &pLayerWin); + (*pScreen->MarkWindow)(pLayerWin->parent); + } + pWin->mapped = FALSE; + if (wasRealized) + UnrealizeTree(pWin, fromConfigure); + if (wasViewable) + { + if (!fromConfigure) + { + (*pScreen->ValidateTree)(pLayerWin->parent, pWin, VTUnmap); + (*pScreen->HandleExposures)(pLayerWin->parent); + } +#ifdef DO_SAVE_UNDERS + if (DO_SAVE_UNDERS(pWin)) + { + if ( (*pScreen->ChangeSaveUnder)(pLayerWin, pWin->nextSib) ) + { + (*pScreen->PostChangeSaveUnder)(pLayerWin, pWin->nextSib); + } + } + pWin->DIXsaveUnder = FALSE; +#endif /* DO_SAVE_UNDERS */ + if (!fromConfigure && pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(pLayerWin->parent, pWin, VTUnmap); + } + if (wasRealized && !fromConfigure) + WindowsRestructured (); + return(Success); +} + +/***** + * UnmapSubwindows + * Performs an UnmapWindow request with the specified mode on all mapped + * children of the window, in bottom to top stacking order. + *****/ + +void +UnmapSubwindows(WindowPtr pWin) +{ + WindowPtr pChild, pHead; + xEvent event; + Bool wasRealized = (Bool)pWin->realized; + Bool wasViewable = (Bool)pWin->viewable; + Bool anyMarked = FALSE; + Mask parentNotify; + WindowPtr pLayerWin = NULL; + ScreenPtr pScreen = pWin->drawable.pScreen; + + if (!pWin->firstChild) + return; + parentNotify = SubSend(pWin); + pHead = RealChildHead(pWin); + + if (wasViewable) + pLayerWin = (*pScreen->GetLayerWindow)(pWin); + + for (pChild = pWin->lastChild; pChild != pHead; pChild = pChild->prevSib) + { + if (pChild->mapped) + { + if (parentNotify || StrSend(pChild)) + { + event.u.u.type = UnmapNotify; + event.u.unmapNotify.window = pChild->drawable.id; + event.u.unmapNotify.fromConfigure = xFalse; + DeliverEvents(pChild, &event, 1, NullWindow); + } + if (pChild->viewable) + { + pChild->valdata = UnmapValData; + anyMarked = TRUE; + } + pChild->mapped = FALSE; + if (pChild->realized) + UnrealizeTree(pChild, FALSE); + if (wasViewable) + { +#ifdef DO_SAVE_UNDERS + pChild->DIXsaveUnder = FALSE; +#endif /* DO_SAVE_UNDERS */ + } + } + } + if (wasViewable) + { + if (anyMarked) + { + if (pLayerWin->parent == pWin) + (*pScreen->MarkWindow)(pWin); + else + { + WindowPtr ptmp; + (*pScreen->MarkOverlappedWindows)(pWin, pLayerWin, + (WindowPtr *)NULL); + (*pScreen->MarkWindow)(pLayerWin->parent); + + /* Windows between pWin and pLayerWin may not have been marked */ + ptmp = pWin; + + while (ptmp != pLayerWin->parent) + { + (*pScreen->MarkWindow)(ptmp); + ptmp = ptmp->parent; + } + pHead = pWin->firstChild; + } + (*pScreen->ValidateTree)(pLayerWin->parent, pHead, VTUnmap); + (*pScreen->HandleExposures)(pLayerWin->parent); + } +#ifdef DO_SAVE_UNDERS + if (DO_SAVE_UNDERS(pWin)) + { + if ( (*pScreen->ChangeSaveUnder)(pLayerWin, pLayerWin)) + (*pScreen->PostChangeSaveUnder)(pLayerWin, pLayerWin); + } +#endif /* DO_SAVE_UNDERS */ + if (anyMarked && pScreen->PostValidateTree) + (*pScreen->PostValidateTree)(pLayerWin->parent, pHead, VTUnmap); + } + if (wasRealized) + WindowsRestructured (); +} + + +void +HandleSaveSet(ClientPtr client) +{ + WindowPtr pParent, pWin; + int j; + + for (j=0; jnumSaved; j++) + { + pWin = SaveSetWindow(client->saveSet[j]); +#ifdef XFIXES + if (SaveSetToRoot(client->saveSet[j])) + pParent = WindowTable[pWin->drawable.pScreen->myNum]; + else +#endif + { + pParent = pWin->parent; + while (pParent && (wClient (pParent) == client)) + pParent = pParent->parent; + } + if (pParent) + { + if (pParent != pWin->parent) + { + ReparentWindow(pWin, pParent, + pWin->drawable.x - wBorderWidth (pWin) - pParent->drawable.x, + pWin->drawable.y - wBorderWidth (pWin) - pParent->drawable.y, + client); + if(!pWin->realized && pWin->mapped) + pWin->mapped = FALSE; + } +#ifdef XFIXES + if (SaveSetRemap (client->saveSet[j])) +#endif + MapWindow(pWin, client); + } + } + xfree(client->saveSet); + client->numSaved = 0; + client->saveSet = (SaveSetElt *)NULL; +} + +/** + * + * \param x,y in root + */ +Bool +PointInWindowIsVisible(WindowPtr pWin, int x, int y) +{ + BoxRec box; + + if (!pWin->realized) + return (FALSE); + if (POINT_IN_REGION(pWin->drawable.pScreen, &pWin->borderClip, + x, y, &box) + && (!wInputShape(pWin) || + POINT_IN_REGION(pWin->drawable.pScreen, + wInputShape(pWin), + x - pWin->drawable.x, + y - pWin->drawable.y, &box))) + return(TRUE); + return(FALSE); +} + + +_X_EXPORT RegionPtr +NotClippedByChildren(WindowPtr pWin) +{ + ScreenPtr pScreen; + RegionPtr pReg; + + pScreen = pWin->drawable.pScreen; + pReg = REGION_CREATE(pScreen, NullBox, 1); + if (pWin->parent || + screenIsSaved != SCREEN_SAVER_ON || + !HasSaverWindow (pWin->drawable.pScreen->myNum)) + { + REGION_INTERSECT(pScreen, pReg, &pWin->borderClip, &pWin->winSize); + } + return(pReg); +} + +_X_EXPORT void +SendVisibilityNotify(WindowPtr pWin) +{ + xEvent event; +#ifndef NO_XINERAMA_PORT + unsigned int visibility = pWin->visibility; +#endif +#ifdef PANORAMIX + /* This is not quite correct yet, but it's close */ + if(!noPanoramiXExtension) { + PanoramiXRes *win; + WindowPtr pWin2; + int i, Scrnum; + + Scrnum = pWin->drawable.pScreen->myNum; + + win = PanoramiXFindIDByScrnum(XRT_WINDOW, pWin->drawable.id, Scrnum); + + if(!win || (win->u.win.visibility == visibility)) + return; + + switch(visibility) { + case VisibilityUnobscured: + for(i = 0; i < PanoramiXNumScreens; i++) { + if(i == Scrnum) continue; + + pWin2 = (WindowPtr)LookupIDByType(win->info[i].id, RT_WINDOW); + + if (pWin2) { + if(pWin2->visibility == VisibilityPartiallyObscured) + return; + + if(!i) pWin = pWin2; + } + } + break; + case VisibilityPartiallyObscured: + if(Scrnum) { + pWin2 = (WindowPtr)LookupIDByType(win->info[0].id, RT_WINDOW); + if (pWin2) pWin = pWin2; + } + break; + case VisibilityFullyObscured: + for(i = 0; i < PanoramiXNumScreens; i++) { + if(i == Scrnum) continue; + + pWin2 = (WindowPtr)LookupIDByType(win->info[i].id, RT_WINDOW); + + if (pWin2) { + if(pWin2->visibility != VisibilityFullyObscured) + return; + + if(!i) pWin = pWin2; + } + } + break; + } + + win->u.win.visibility = visibility; + } +#endif + + event.u.u.type = VisibilityNotify; + event.u.visibility.window = pWin->drawable.id; + event.u.visibility.state = visibility; + DeliverEvents(pWin, &event, 1, NullWindow); +} + +#define RANDOM_WIDTH 32 + +#ifndef NOLOGOHACK +static void DrawLogo( + WindowPtr pWin +); +#endif + +_X_EXPORT int +dixSaveScreens(ClientPtr client, int on, int mode) +{ + int rc, i, what, type; + + if (on == SCREEN_SAVER_FORCER) + { + UpdateCurrentTimeIf(); + lastDeviceEventTime = currentTime; + if (mode == ScreenSaverReset) + what = SCREEN_SAVER_OFF; + else + what = SCREEN_SAVER_ON; + type = what; + } + else + { + what = on; + type = what; + if (what == screenIsSaved) + type = SCREEN_SAVER_CYCLE; + } + + for (i = 0; i < screenInfo.numScreens; i++) { + rc = XaceHook(XACE_SCREENSAVER_ACCESS, client, screenInfo.screens[i], + DixShowAccess | DixHideAccess); + if (rc != Success) + return rc; + } + for (i = 0; i < screenInfo.numScreens; i++) + { + if (on == SCREEN_SAVER_FORCER) + (* screenInfo.screens[i]->SaveScreen) (screenInfo.screens[i], on); + if (savedScreenInfo[i].ExternalScreenSaver) + { + if ((*savedScreenInfo[i].ExternalScreenSaver) + (screenInfo.screens[i], type, on == SCREEN_SAVER_FORCER)) + continue; + } + if (type == screenIsSaved) + continue; + switch (type) { + case SCREEN_SAVER_OFF: + if (savedScreenInfo[i].blanked == SCREEN_IS_BLANKED) + { + (* screenInfo.screens[i]->SaveScreen) (screenInfo.screens[i], + what); + } + else if (HasSaverWindow (i)) + { + savedScreenInfo[i].pWindow = NullWindow; + FreeResource(savedScreenInfo[i].wid, RT_NONE); + } + break; + case SCREEN_SAVER_CYCLE: + if (savedScreenInfo[i].blanked == SCREEN_IS_TILED) + { + WindowPtr pWin = savedScreenInfo[i].pWindow; + /* make it look like screen saver is off, so that + * NotClippedByChildren will compute a clip list + * for the root window, so miPaintWindow works + */ + screenIsSaved = SCREEN_SAVER_OFF; +#ifndef NOLOGOHACK + if (logoScreenSaver) + (*pWin->drawable.pScreen->ClearToBackground)(pWin, 0, 0, 0, 0, FALSE); +#endif + (*pWin->drawable.pScreen->MoveWindow)(pWin, + (short)(-(rand() % RANDOM_WIDTH)), + (short)(-(rand() % RANDOM_WIDTH)), + pWin->nextSib, VTMove); +#ifndef NOLOGOHACK + if (logoScreenSaver) + DrawLogo(pWin); +#endif + screenIsSaved = SCREEN_SAVER_ON; + } + /* + * Call the DDX saver in case it wants to do something + * at cycle time + */ + else if (savedScreenInfo[i].blanked == SCREEN_IS_BLANKED) + { + (* screenInfo.screens[i]->SaveScreen) (screenInfo.screens[i], + type); + } + break; + case SCREEN_SAVER_ON: + if (ScreenSaverBlanking != DontPreferBlanking) + { + if ((* screenInfo.screens[i]->SaveScreen) + (screenInfo.screens[i], what)) + { + savedScreenInfo[i].blanked = SCREEN_IS_BLANKED; + continue; + } + if ((ScreenSaverAllowExposures != DontAllowExposures) && + TileScreenSaver(i, SCREEN_IS_BLACK)) + { + savedScreenInfo[i].blanked = SCREEN_IS_BLACK; + continue; + } + } + if ((ScreenSaverAllowExposures != DontAllowExposures) && + TileScreenSaver(i, SCREEN_IS_TILED)) + { + savedScreenInfo[i].blanked = SCREEN_IS_TILED; + } + else + savedScreenInfo[i].blanked = SCREEN_ISNT_SAVED; + break; + } + } + screenIsSaved = what; + if (mode == ScreenSaverReset) + SetScreenSaverTimer(); + return Success; +} + +_X_EXPORT int +SaveScreens(int on, int mode) +{ + return dixSaveScreens(serverClient, on, mode); +} + +static Bool +TileScreenSaver(int i, int kind) +{ + int j; + int result; + XID attributes[3]; + Mask mask; + WindowPtr pWin; + CursorMetricRec cm; + unsigned char *srcbits, *mskbits; + CursorPtr cursor; + XID cursorID = 0; + int attri; + + mask = 0; + attri = 0; + switch (kind) { + case SCREEN_IS_TILED: + switch (WindowTable[i]->backgroundState) { + case BackgroundPixel: + attributes[attri++] = WindowTable[i]->background.pixel; + mask |= CWBackPixel; + break; + case BackgroundPixmap: + attributes[attri++] = None; + mask |= CWBackPixmap; + break; + default: + break; + } + break; + case SCREEN_IS_BLACK: + attributes[attri++] = WindowTable[i]->drawable.pScreen->blackPixel; + mask |= CWBackPixel; + break; + } + mask |= CWOverrideRedirect; + attributes[attri++] = xTrue; + + /* + * create a blank cursor + */ + + cm.width=16; + cm.height=16; + cm.xhot=8; + cm.yhot=8; + srcbits = (unsigned char *)xalloc( BitmapBytePad(32)*16); + mskbits = (unsigned char *)xalloc( BitmapBytePad(32)*16); + if (!srcbits || !mskbits) + { + xfree(srcbits); + xfree(mskbits); + cursor = 0; + } + else + { + for (j=0; jwidth + RANDOM_WIDTH, + (unsigned short)screenInfo.screens[i]->height + RANDOM_WIDTH, + 0, InputOutput, mask, attributes, 0, serverClient, + wVisual (WindowTable[i]), &result); + + if (cursor) + FreeResource (cursorID, RT_NONE); + + if (!pWin) + return FALSE; + + if (!AddResource(pWin->drawable.id, RT_WINDOW, + (pointer)savedScreenInfo[i].pWindow)) + return FALSE; + + if (mask & CWBackPixmap) + { + MakeRootTile (pWin); + (*pWin->drawable.pScreen->ChangeWindowAttributes)(pWin, CWBackPixmap); + } + MapWindow(pWin, serverClient); +#ifndef NOLOGOHACK + if (kind == SCREEN_IS_TILED && logoScreenSaver) + DrawLogo(pWin); +#endif + return TRUE; +} + +/* + * FindWindowWithOptional + * + * search ancestors of the given window for an entry containing + * a WindowOpt structure. Assumptions: some parent will + * contain the structure. + */ + +_X_EXPORT WindowPtr +FindWindowWithOptional (WindowPtr w) +{ + do + w = w->parent; + while (!w->optional); + return w; +} + +/* + * CheckWindowOptionalNeed + * + * check each optional entry in the given window to see if + * the value is satisfied by the default rules. If so, + * release the optional record + */ + +_X_EXPORT void +CheckWindowOptionalNeed (WindowPtr w) +{ + WindowOptPtr optional; + WindowOptPtr parentOptional; + + if (!w->parent) + return; + optional = w->optional; + if (optional->dontPropagateMask != DontPropagateMasks[w->dontPropagate]) + return; + if (optional->otherEventMasks != 0) + return; + if (optional->otherClients != NULL) + return; + if (optional->passiveGrabs != NULL) + return; + if (optional->userProps != NULL) + return; + if (optional->backingBitPlanes != ~0L) + return; + if (optional->backingPixel != 0) + return; +#ifdef SHAPE + if (optional->boundingShape != NULL) + return; + if (optional->clipShape != NULL) + return; + if (optional->inputShape != NULL) + return; +#endif +#ifdef XINPUT + if (optional->inputMasks != NULL) + return; +#endif + parentOptional = FindWindowWithOptional(w)->optional; + if (optional->visual != parentOptional->visual) + return; + if (optional->cursor != None && + (optional->cursor != parentOptional->cursor || + w->parent->cursorIsNone)) + return; + if (optional->colormap != parentOptional->colormap) + return; + DisposeWindowOptional (w); +} + +/* + * MakeWindowOptional + * + * create an optional record and initialize it with the default + * values. + */ + +_X_EXPORT Bool +MakeWindowOptional (WindowPtr pWin) +{ + WindowOptPtr optional; + WindowOptPtr parentOptional; + + if (pWin->optional) + return TRUE; + optional = (WindowOptPtr) xalloc (sizeof (WindowOptRec)); + if (!optional) + return FALSE; + optional->dontPropagateMask = DontPropagateMasks[pWin->dontPropagate]; + optional->otherEventMasks = 0; + optional->otherClients = NULL; + optional->passiveGrabs = NULL; + optional->userProps = NULL; + optional->backingBitPlanes = ~0L; + optional->backingPixel = 0; +#ifdef SHAPE + optional->boundingShape = NULL; + optional->clipShape = NULL; + optional->inputShape = NULL; +#endif +#ifdef XINPUT + optional->inputMasks = NULL; +#endif + parentOptional = FindWindowWithOptional(pWin)->optional; + optional->visual = parentOptional->visual; + if (!pWin->cursorIsNone) + { + optional->cursor = parentOptional->cursor; + optional->cursor->refcnt++; + } + else + { + optional->cursor = None; + } + optional->colormap = parentOptional->colormap; + pWin->optional = optional; + return TRUE; +} + +#ifndef NOLOGOHACK +static void +DrawLogo(WindowPtr pWin) +{ + DrawablePtr pDraw; + ScreenPtr pScreen; + int x, y; + unsigned int width, height, size; + GC *pGC; + int thin, gap, d31; + DDXPointRec poly[4]; + ChangeGCVal fore[2], back[2]; + xrgb rgb[2]; + BITS32 fmask, bmask; + ColormapPtr cmap; + + pDraw = (DrawablePtr)pWin; + pScreen = pDraw->pScreen; + x = -pWin->origin.x; + y = -pWin->origin.y; + width = pScreen->width; + height = pScreen->height; + pGC = GetScratchGC(pScreen->rootDepth, pScreen); + if (!pGC) + return; + + if ((rand() % 100) <= 17) /* make the probability for white fairly low */ + fore[0].val = pScreen->whitePixel; + else + fore[0].val = pScreen->blackPixel; + if ((pWin->backgroundState == BackgroundPixel) && + (cmap = (ColormapPtr)LookupIDByType(wColormap (pWin), RT_COLORMAP))) { + Pixel querypixels[2]; + + querypixels[0] = fore[0].val; + querypixels[1] = pWin->background.pixel; + QueryColors(cmap, 2, querypixels, rgb); + if ((rgb[0].red == rgb[1].red) && + (rgb[0].green == rgb[1].green) && + (rgb[0].blue == rgb[1].blue)) { + if (fore[0].val == pScreen->blackPixel) + fore[0].val = pScreen->whitePixel; + else + fore[0].val = pScreen->blackPixel; + } + } + fore[1].val = FillSolid; + fmask = GCForeground|GCFillStyle; + if (pWin->backgroundState == BackgroundPixel) { + back[0].val = pWin->background.pixel; + back[1].val = FillSolid; + bmask = GCForeground|GCFillStyle; + } else { + back[0].val = 0; + back[1].val = 0; + dixChangeGC(NullClient, pGC, GCTileStipXOrigin|GCTileStipYOrigin, + NULL, back); + back[0].val = FillTiled; + back[1].ptr = pWin->background.pixmap; + bmask = GCFillStyle|GCTile; + } + + /* should be the same as the reference function XmuDrawLogo() */ + + size = width; + if (height < width) + size = height; + size = RANDOM_WIDTH + rand() % (size - RANDOM_WIDTH); + size &= ~1; + x += rand() % (width - size); + y += rand() % (height - size); + +/* + * Draw what will be the thin strokes. + * + * ----- + * / / + * / / + * / / + * / / + * /____/ + * d + * + * Point d is 9/44 (~1/5) of the way across. + */ + + thin = (size / 11); + if (thin < 1) thin = 1; + gap = (thin+3) / 4; + d31 = thin + thin + gap; + poly[0].x = x + size; poly[0].y = y; + poly[1].x = x + size-d31; poly[1].y = y; + poly[2].x = x + 0; poly[2].y = y + size; + poly[3].x = x + d31; poly[3].y = y + size; + dixChangeGC(NullClient, pGC, fmask, NULL, fore); + ValidateGC(pDraw, pGC); + (*pGC->ops->FillPolygon)(pDraw, pGC, Convex, CoordModeOrigin, 4, poly); + +/* + * Erase area not needed for lower thin stroke. + * + * ------ + * / / + * / __ / + * / / / + * / / / + * /__/__/ + */ + + poly[0].x = x + d31/2; poly[0].y = y + size; + poly[1].x = x + size / 2; poly[1].y = y + size/2; + poly[2].x = x + (size/2)+(d31-(d31/2)); poly[2].y = y + size/2; + poly[3].x = x + d31; poly[3].y = y + size; + dixChangeGC(NullClient, pGC, bmask, NULL, back); + ValidateGC(pDraw, pGC); + (*pGC->ops->FillPolygon)(pDraw, pGC, Convex, CoordModeOrigin, 4, poly); + +/* + * Erase area not needed for upper thin stroke. + * + * ------ + * / / / + * /--/ / + * / / + * / / + * /_____/ + */ + + poly[0].x = x + size - d31/2; poly[0].y = y; + poly[1].x = x + size / 2; poly[1].y = y + size/2; + poly[2].x = x + (size/2)-(d31-(d31/2)); poly[2].y = y + size/2; + poly[3].x = x + size - d31; poly[3].y = y; + ValidateGC(pDraw, pGC); + (*pGC->ops->FillPolygon)(pDraw, pGC, Convex, CoordModeOrigin, 4, poly); + +/* + * Draw thick stroke. + * Point b is 1/4 of the way across. + * + * b + * ----- + * \ \ + * \ \ + * \ \ + * \ \ + * \____\ + */ + + poly[0].x = x; poly[0].y = y; + poly[1].x = x + size/4; poly[1].y = y; + poly[2].x = x + size; poly[2].y = y + size; + poly[3].x = x + size - size/4; poly[3].y = y + size; + dixChangeGC(NullClient, pGC, fmask, NULL, fore); + ValidateGC(pDraw, pGC); + (*pGC->ops->FillPolygon)(pDraw, pGC, Convex, CoordModeOrigin, 4, poly); + +/* + * Erase to create gap. + * + * / + * / + * / + * / + * / + */ + + poly[0].x = x + size- thin; poly[0].y = y; + poly[1].x = x + size-( thin+gap); poly[1].y = y; + poly[2].x = x + thin; poly[2].y = y + size; + poly[3].x = x + thin + gap; poly[3].y = y + size; + dixChangeGC(NullClient, pGC, bmask, NULL, back); + ValidateGC(pDraw, pGC); + (*pGC->ops->FillPolygon)(pDraw, pGC, Convex, CoordModeOrigin, 4, poly); + + FreeScratchGC(pGC); +} + +#endif diff --git a/xorg-server/dix/xpstubs.c b/xorg-server/dix/xpstubs.c new file mode 100644 index 000000000..59340ad21 --- /dev/null +++ b/xorg-server/dix/xpstubs.c @@ -0,0 +1,78 @@ +/* +Copyright 1996, 1998 The Open Group + +Permission to use, copy, modify, distribute, and sell this software and its +documentation for any purpose is hereby granted without fee, provided that +the above copyright notice appear in all copies and that both that +copyright notice and this permission notice appear in supporting +documentation. + +The above copyright notice and this permission notice shall be included +in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS +OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE OPEN GROUP BE LIABLE FOR ANY CLAIM, DAMAGES OR +OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, +ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR +OTHER DEALINGS IN THE SOFTWARE. + +Except as contained in this notice, the name of The Open Group shall +not be used in advertising or otherwise to promote the sale, use or +other dealings in this Software without prior written authorization +from The Open Group. +*/ + + +#ifdef HAVE_DIX_CONFIG_H +#include +#endif + +#include "misc.h" +#include +#ifdef XPRINT +#include "DiPrint.h" +#else +extern Bool XpClientIsBitmapClient(ClientPtr client); +extern Bool XpClientIsPrintClient(ClientPtr client, FontPathElementPtr fpe); +#endif + +Bool +XpClientIsBitmapClient( + ClientPtr client) +{ + return TRUE; +} + +Bool +XpClientIsPrintClient( + ClientPtr client, + FontPathElementPtr fpe) +{ + return FALSE; +} +#ifdef XPRINT +int +PrinterOptions( + int argc, + char **argv, + int i) +{ + return i; +} +void +PrinterInitOutput( + ScreenInfo *pScreenInfo, + int argc, + char **argv) +{ +} +void PrinterUseMsg(void) +{ +} +void PrinterInitGlobals(void) +{ +} +#endif /* XPRINT */ + -- cgit v1.2.3